diff options
Diffstat (limited to 'h-source/Public/Js/jquery')
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.0.min.js | 172 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.1.0.css (renamed from h-source/Public/Js/jquery/jquery.mobile-1.0.css) | 1618 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.1.0.js | 7551 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js | 141 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js | 1937 |
5 files changed, 10400 insertions, 1019 deletions
diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js b/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js deleted file mode 100644 index 0fca54b..0000000 --- a/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js +++ /dev/null @@ -1,172 +0,0 @@ -/*! jQuery Mobile v1.0 jquerymobile.com | jquery.org/license */ -(function(a,e){if(a.cleanData){var b=a.cleanData;a.cleanData=function(f){for(var c=0,h;(h=f[c])!=null;c++)a(h).triggerHandler("remove");b(f)}}else{var d=a.fn.remove;a.fn.remove=function(b,c){return this.each(function(){c||(!b||a.filter(b,[this]).length)&&a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return d.call(a(this),b,c)})}}a.widget=function(b,c,h){var d=b.split(".")[0],e,b=b.split(".")[1];e=d+"-"+b;if(!h)h=c,c=a.Widget;a.expr[":"][e]=function(c){return!!a.data(c, -b)};a[d]=a[d]||{};a[d][b]=function(a,b){arguments.length&&this._createWidget(a,b)};c=new c;c.options=a.extend(true,{},c.options);a[d][b].prototype=a.extend(true,c,{namespace:d,widgetName:b,widgetEventPrefix:a[d][b].prototype.widgetEventPrefix||b,widgetBaseClass:e},h);a.widget.bridge(b,a[d][b])};a.widget.bridge=function(b,c){a.fn[b]=function(d){var g=typeof d==="string",i=Array.prototype.slice.call(arguments,1),k=this,d=!g&&i.length?a.extend.apply(null,[true,d].concat(i)):d;if(g&&d.charAt(0)==="_")return k; -g?this.each(function(){var c=a.data(this,b);if(!c)throw"cannot call methods on "+b+" prior to initialization; attempted to call method '"+d+"'";if(!a.isFunction(c[d]))throw"no such method '"+d+"' for "+b+" widget instance";var g=c[d].apply(c,i);if(g!==c&&g!==e)return k=g,false}):this.each(function(){var e=a.data(this,b);e?e.option(d||{})._init():a.data(this,b,new c(d,this))});return k}};a.Widget=function(a,b){arguments.length&&this._createWidget(a,b)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"", -options:{disabled:false},_createWidget:function(b,c){a.data(c,this.widgetName,this);this.element=a(c);this.options=a.extend(true,{},this.options,this._getCreateOptions(),b);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){var b={};a.metadata&&(b=a.metadata.get(element)[this.widgetName]);return b},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName); -this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(b,c){var d=b;if(arguments.length===0)return a.extend({},this.options);if(typeof b==="string"){if(c===e)return this.options[b];d={};d[b]=c}this._setOptions(d);return this},_setOptions:function(b){var c=this;a.each(b,function(a,b){c._setOption(a,b)});return this},_setOption:function(a,b){this.options[a]=b;a==="disabled"&& -this.widget()[b?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",b);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(b,c,d){var e=this.options[b],c=a.Event(c);c.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase();d=d||{};if(c.originalEvent)for(var b=a.event.props.length,i;b;)i=a.event.props[--b],c[i]=c.originalEvent[i];this.element.trigger(c, -d);return!(a.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -(function(a,e){a.widget("mobile.widget",{_createWidget:function(){a.Widget.prototype._createWidget.apply(this,arguments);this._trigger("init")},_getCreateOptions:function(){var b=this.element,d={};a.each(this.options,function(a){var c=b.jqmData(a.replace(/[A-Z]/g,function(a){return"-"+a.toLowerCase()}));c!==e&&(d[a]=c)});return d},enhanceWithin:function(b){var d=a(b).closest(":jqmData(role='page')").data("page"),d=d&&d.keepNativeSelector()||"";a(this.options.initSelector,b).not(d)[this.widgetName]()}})})(jQuery); -(function(a){a(window);var e=a("html");a.mobile.media=function(){var b={},d=a("<div id='jquery-mediatest'>"),f=a("<body>").append(d);return function(a){if(!(a in b)){var h=document.createElement("style"),g="@media "+a+" { #jquery-mediatest { position:absolute; } }";h.type="text/css";h.styleSheet?h.styleSheet.cssText=g:h.appendChild(document.createTextNode(g));e.prepend(f).prepend(h);b[a]=d.css("position")==="absolute";f.add(h).remove()}return b[a]}}()})(jQuery); -(function(a,e){function b(a){var b=a.charAt(0).toUpperCase()+a.substr(1),a=(a+" "+c.join(b+" ")+b).split(" "),d;for(d in a)if(f[a[d]]!==e)return true}var d=a("<body>").prependTo("html"),f=d[0].style,c=["Webkit","Moz","O"],h="palmGetResource"in window,g=window.operamini&&{}.toString.call(window.operamini)==="[object OperaMini]",i=window.blackberry;a.mobile.browser={};a.mobile.browser.ie=function(){for(var a=3,b=document.createElement("div"),c=b.all||[];b.innerHTML="<\!--[if gt IE "+ ++a+"]><br><![endif]--\>", -c[0];);return a>4?a:!a}();a.extend(a.support,{orientation:"orientation"in window&&"onorientationchange"in window,touch:"ontouchend"in document,cssTransitions:"WebKitTransitionEvent"in window,pushState:"pushState"in history&&"replaceState"in history,mediaquery:a.mobile.media("only all"),cssPseudoElement:!!b("content"),touchOverflow:!!b("overflowScrolling"),boxShadow:!!b("boxShadow")&&!i,scrollTop:("pageXOffset"in window||"scrollTop"in document.documentElement||"scrollTop"in d[0])&&!h&&!g,dynamicBaseTag:function(){var b= -location.protocol+"//"+location.host+location.pathname+"ui-dir/",c=a("head base"),f=null,e="",h;c.length?e=c.attr("href"):c=f=a("<base>",{href:b}).appendTo("head");h=a("<a href='testurl' />").prependTo(d)[0].href;c[0].href=e||location.pathname;f&&f.remove();return h.indexOf(b)===0}()});d.remove();h=function(){var a=window.navigator.userAgent;return a.indexOf("Nokia")>-1&&(a.indexOf("Symbian/3")>-1||a.indexOf("Series60/5")>-1)&&a.indexOf("AppleWebKit")>-1&&a.match(/(BrowserNG|NokiaBrowser)\/7\.[0-3]/)}(); -a.mobile.ajaxBlacklist=window.blackberry&&!window.WebKitPoint||g||h;h&&a(function(){a("head link[rel='stylesheet']").attr("rel","alternate stylesheet").attr("rel","stylesheet")});a.support.boxShadow||a("html").addClass("ui-mobile-nosupport-boxshadow")})(jQuery); -(function(a,e,b,d){function f(a){for(;a&&typeof a.originalEvent!=="undefined";)a=a.originalEvent;return a}function c(b){for(var c={},f,d;b;){f=a.data(b,n);for(d in f)if(f[d])c[d]=c.hasVirtualBinding=true;b=b.parentNode}return c}function h(){v&&(clearTimeout(v),v=0);v=setTimeout(function(){E=v=0;u.length=0;D=false;y=true},a.vmouse.resetTimerDuration)}function g(b,c,r){var e,h;if(!(h=r&&r[b])){if(r=!r)a:{for(r=c.target;r;){if((h=a.data(r,n))&&(!b||h[b]))break a;r=r.parentNode}r=null}h=r}if(h){e=c;var r= -e.type,j,g;e=a.Event(e);e.type=b;h=e.originalEvent;j=a.event.props;if(h)for(g=j.length;g;)b=j[--g],e[b]=h[b];if(r.search(/mouse(down|up)|click/)>-1&&!e.which)e.which=1;if(r.search(/^touch/)!==-1&&(b=f(h),r=b.touches,b=b.changedTouches,r=r&&r.length?r[0]:b&&b.length?b[0]:d))for(h=0,len=z.length;h<len;h++)b=z[h],e[b]=r[b];a(c.target).trigger(e)}return e}function i(b){var c=a.data(b.target,A);if(!D&&(!E||E!==c))if(c=g("v"+b.type,b))c.isDefaultPrevented()&&b.preventDefault(),c.isPropagationStopped()&& -b.stopPropagation(),c.isImmediatePropagationStopped()&&b.stopImmediatePropagation()}function k(b){var d=f(b).touches,e;if(d&&d.length===1&&(e=b.target,d=c(e),d.hasVirtualBinding))E=r++,a.data(e,A,E),v&&(clearTimeout(v),v=0),w=y=false,e=f(b).touches[0],x=e.pageX,t=e.pageY,g("vmouseover",b,d),g("vmousedown",b,d)}function l(a){y||(w||g("vmousecancel",a,c(a.target)),w=true,h())}function o(b){if(!y){var d=f(b).touches[0],r=w,e=a.vmouse.moveDistanceThreshold;w=w||Math.abs(d.pageX-x)>e||Math.abs(d.pageY- -t)>e;flags=c(b.target);w&&!r&&g("vmousecancel",b,flags);g("vmousemove",b,flags);h()}}function m(a){if(!y){y=true;var b=c(a.target),d;g("vmouseup",a,b);if(!w&&(d=g("vclick",a,b))&&d.isDefaultPrevented())d=f(a).changedTouches[0],u.push({touchID:E,x:d.clientX,y:d.clientY}),D=true;g("vmouseout",a,b);w=false;h()}}function p(b){var b=a.data(b,n),c;if(b)for(c in b)if(b[c])return true;return false}function j(){}function q(b){var c=b.substr(1);return{setup:function(){p(this)||a.data(this,n,{});a.data(this, -n)[b]=true;s[b]=(s[b]||0)+1;s[b]===1&&B.bind(c,i);a(this).bind(c,j);if(C)s.touchstart=(s.touchstart||0)+1,s.touchstart===1&&B.bind("touchstart",k).bind("touchend",m).bind("touchmove",o).bind("scroll",l)},teardown:function(){--s[b];s[b]||B.unbind(c,i);C&&(--s.touchstart,s.touchstart||B.unbind("touchstart",k).unbind("touchmove",o).unbind("touchend",m).unbind("scroll",l));var d=a(this),f=a.data(this,n);f&&(f[b]=false);d.unbind(c,j);p(this)||d.removeData(n)}}}var n="virtualMouseBindings",A="virtualTouchID", -e="vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),z="clientX clientY pageX pageY screenX screenY".split(" "),s={},v=0,x=0,t=0,w=false,u=[],D=false,y=false,C="addEventListener"in b,B=a(b),r=1,E=0;a.vmouse={moveDistanceThreshold:10,clickDistanceThreshold:10,resetTimerDuration:1500};for(var F=0;F<e.length;F++)a.event.special[e[F]]=q(e[F]);C&&b.addEventListener("click",function(b){var c=u.length,d=b.target,f,r,e,h,j;if(c){f=b.clientX;r=b.clientY;threshold=a.vmouse.clickDistanceThreshold; -for(e=d;e;){for(h=0;h<c;h++)if(j=u[h],e===d&&Math.abs(j.x-f)<threshold&&Math.abs(j.y-r)<threshold||a.data(e,A)===j.touchID){b.preventDefault();b.stopPropagation();return}e=e.parentNode}}},true)})(jQuery,window,document); -(function(a,e,b){function d(b,c,d){var f=d.type;d.type=c;a.event.handle.call(b,d);d.type=f}a.each("touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split(" "),function(b,c){a.fn[c]=function(a){return a?this.bind(c,a):this.trigger(c)};a.attrFn[c]=true});var f=a.support.touch,c=f?"touchstart":"mousedown",h=f?"touchend":"mouseup",g=f?"touchmove":"mousemove";a.event.special.scrollstart={enabled:true,setup:function(){function b(a, -e){f=e;d(c,f?"scrollstart":"scrollstop",a)}var c=this,f,e;a(c).bind("touchmove scroll",function(c){a.event.special.scrollstart.enabled&&(f||b(c,true),clearTimeout(e),e=setTimeout(function(){b(c,false)},50))})}};a.event.special.tap={setup:function(){var b=this,c=a(b);c.bind("vmousedown",function(f){function e(){clearTimeout(q)}function h(){e();c.unbind("vclick",g).unbind("vmouseup",e).unbind("vmousecancel",h)}function g(a){h();j==a.target&&d(b,"tap",a)}if(f.which&&f.which!==1)return false;var j=f.target, -q;c.bind("vmousecancel",h).bind("vmouseup",e).bind("vclick",g);q=setTimeout(function(){d(b,"taphold",a.Event("taphold"))},750)})}};a.event.special.swipe={scrollSupressionThreshold:10,durationThreshold:1E3,horizontalDistanceThreshold:30,verticalDistanceThreshold:75,setup:function(){var d=a(this);d.bind(c,function(c){function f(b){if(m){var c=b.originalEvent.touches?b.originalEvent.touches[0]:b;p={time:(new Date).getTime(),coords:[c.pageX,c.pageY]};Math.abs(m.coords[0]-p.coords[0])>a.event.special.swipe.scrollSupressionThreshold&& -b.preventDefault()}}var e=c.originalEvent.touches?c.originalEvent.touches[0]:c,m={time:(new Date).getTime(),coords:[e.pageX,e.pageY],origin:a(c.target)},p;d.bind(g,f).one(h,function(){d.unbind(g,f);m&&p&&p.time-m.time<a.event.special.swipe.durationThreshold&&Math.abs(m.coords[0]-p.coords[0])>a.event.special.swipe.horizontalDistanceThreshold&&Math.abs(m.coords[1]-p.coords[1])<a.event.special.swipe.verticalDistanceThreshold&&m.origin.trigger("swipe").trigger(m.coords[0]>p.coords[0]?"swipeleft":"swiperight"); -m=p=b})})}};(function(a,b){function c(){var a=f();a!==e&&(e=a,d.trigger("orientationchange"))}var d=a(b),f,e;a.event.special.orientationchange={setup:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;e=f();d.bind("throttledresize",c)},teardown:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;d.unbind("throttledresize",c)},add:function(a){var b=a.handler;a.handler=function(a){a.orientation=f();return b.apply(this,arguments)}}};a.event.special.orientationchange.orientation= -f=function(){var c=true,c=document.documentElement;return(c=a.support.orientation?b.orientation%180==0:c&&c.clientWidth/c.clientHeight<1.1)?"portrait":"landscape"}})(jQuery,e);(function(){a.event.special.throttledresize={setup:function(){a(this).bind("resize",b)},teardown:function(){a(this).unbind("resize",b)}};var b=function(){f=(new Date).getTime();e=f-c;e>=250?(c=f,a(this).trigger("throttledresize")):(d&&clearTimeout(d),d=setTimeout(b,250-e))},c=0,d,f,e})();a.each({scrollstop:"scrollstart",taphold:"tap", -swipeleft:"swipe",swiperight:"swipe"},function(b,c){a.event.special[b]={setup:function(){a(this).bind(c,a.noop)}}})})(jQuery,this); -(function(a,e,b){function d(a){a=a||location.href;return"#"+a.replace(/^[^#]*#?(.*)$/,"$1")}var f="hashchange",c=document,h,g=a.event.special,i=c.documentMode,k="on"+f in e&&(i===b||i>7);a.fn[f]=function(a){return a?this.bind(f,a):this.trigger(f)};a.fn[f].delay=50;g[f]=a.extend(g[f],{setup:function(){if(k)return false;a(h.start)},teardown:function(){if(k)return false;a(h.stop)}});h=function(){function h(){var b=d(),c=n(p);if(b!==p)q(p=b,c),a(e).trigger(f);else if(c!==p)location.href=location.href.replace(/#.*/, -"")+c;i=setTimeout(h,a.fn[f].delay)}var g={},i,p=d(),j=function(a){return a},q=j,n=j;g.start=function(){i||h()};g.stop=function(){i&&clearTimeout(i);i=b};a.browser.msie&&!k&&function(){var b,e;g.start=function(){if(!b)e=(e=a.fn[f].src)&&e+d(),b=a('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){e||q(d());h()}).attr("src",e||"javascript:0").insertAfter("body")[0].contentWindow,c.onpropertychange=function(){try{if(event.propertyName==="title")b.document.title=c.title}catch(a){}}}; -g.stop=j;n=function(){return d(b.location.href)};q=function(d,e){var h=b.document,g=a.fn[f].domain;if(d!==e)h.title=c.title,h.open(),g&&h.write('<script>document.domain="'+g+'"<\/script>'),h.close(),b.location.hash=d}}();return g}()})(jQuery,this); -(function(a){a.widget("mobile.page",a.mobile.widget,{options:{theme:"c",domCache:false,keepNativeDefault:":jqmData(role='none'), :jqmData(role='nojs')"},_create:function(){this._trigger("beforecreate");this.element.attr("tabindex","0").addClass("ui-page ui-body-"+this.options.theme)},keepNativeSelector:function(){var e=this.options;return e.keepNative&&a.trim(e.keepNative)&&e.keepNative!==e.keepNativeDefault?[e.keepNative,e.keepNativeDefault].join(", "):e.keepNativeDefault}})})(jQuery); -(function(a,e){var b={};a.extend(a.mobile,{ns:"",subPageUrlKey:"ui-page",activePageClass:"ui-page-active",activeBtnClass:"ui-btn-active",ajaxEnabled:true,hashListeningEnabled:true,linkBindingEnabled:true,defaultPageTransition:"slide",minScrollBack:250,defaultDialogTransition:"pop",loadingMessage:"loading",pageLoadErrorMessage:"Error Loading Page",autoInitializePage:true,pushStateEnabled:true,orientationChangeEnabled:true,gradeA:function(){return a.support.mediaquery||a.mobile.browser.ie&&a.mobile.browser.ie>= -7},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91},silentScroll:function(b){if(a.type(b)!=="number")b=a.mobile.defaultHomeScroll;a.event.special.scrollstart.enabled=false; -setTimeout(function(){e.scrollTo(0,b);a(document).trigger("silentscroll",{x:0,y:b})},20);setTimeout(function(){a.event.special.scrollstart.enabled=true},150)},nsNormalizeDict:b,nsNormalize:function(c){return!c?void 0:b[c]||(b[c]=a.camelCase(a.mobile.ns+c))},getInheritedTheme:function(a,b){for(var d=a[0],f="",e=/ui-(bar|body)-([a-z])\b/,l,o;d;){l=d.className||"";if((o=e.exec(l))&&(f=o[2]))break;d=d.parentNode}return f||b||"a"}});a.fn.jqmData=function(b,d){var f;typeof b!="undefined"&&(f=this.data(b? -a.mobile.nsNormalize(b):b,d));return f};a.jqmData=function(b,d,f){var e;typeof d!="undefined"&&(e=a.data(b,d?a.mobile.nsNormalize(d):d,f));return e};a.fn.jqmRemoveData=function(b){return this.removeData(a.mobile.nsNormalize(b))};a.jqmRemoveData=function(b,d){return a.removeData(b,a.mobile.nsNormalize(d))};a.fn.removeWithDependents=function(){a.removeWithDependents(this)};a.removeWithDependents=function(b){b=a(b);(b.jqmData("dependents")||a()).remove();b.remove()};a.fn.addDependents=function(b){a.addDependents(a(this), -b)};a.addDependents=function(b,d){var f=a(b).jqmData("dependents")||a();a(b).jqmData("dependents",a.merge(f,d))};a.fn.getEncodedText=function(){return a("<div/>").text(a(this).text()).html()};var d=a.find,f=/:jqmData\(([^)]*)\)/g;a.find=function(b,e,g,i){b=b.replace(f,"[data-"+(a.mobile.ns||"")+"$1]");return d.call(this,b,e,g,i)};a.extend(a.find,d);a.find.matches=function(b,d){return a.find(b,null,null,d)};a.find.matchesSelector=function(b,d){return a.find(d,null,null,[b]).length>0}})(jQuery,this); -(function(a,e){function b(a){var b=a.find(".ui-title:eq(0)");b.length?b.focus():a.focus()}function d(b){q&&(!q.closest(".ui-page-active").length||b)&&q.removeClass(a.mobile.activeBtnClass);q=null}function f(){z=false;A.length>0&&a.mobile.changePage.apply(null,A.pop())}function c(c,d,f,e){var g=a.mobile.urlHistory.getActive(),j=a.support.touchOverflow&&a.mobile.touchOverflowEnabled,i=g.lastScroll||(j?0:a.mobile.defaultHomeScroll),g=h();window.scrollTo(0,a.mobile.defaultHomeScroll);d&&d.data("page")._trigger("beforehide", -null,{nextPage:c});j||c.height(g+i);c.data("page")._trigger("beforeshow",null,{prevPage:d||a("")});a.mobile.hidePageLoadingMsg();j&&i&&(c.addClass("ui-mobile-pre-transition"),b(c),c.is(".ui-native-fixed")?c.find(".ui-content").scrollTop(i):c.scrollTop(i));f=(a.mobile.transitionHandlers[f||"none"]||a.mobile.defaultTransitionHandler)(f,e,c,d);f.done(function(){j||(c.height(""),b(c));j||a.mobile.silentScroll(i);d&&(j||d.height(""),d.data("page")._trigger("hide",null,{nextPage:c}));c.data("page")._trigger("show", -null,{prevPage:d||a("")})});return f}function h(){var b=a.event.special.orientationchange.orientation()==="portrait",c=b?screen.availHeight:screen.availWidth,b=Math.max(b?480:320,a(window).height());return Math.min(c,b)}function g(){(!a.support.touchOverflow||!a.mobile.touchOverflowEnabled)&&a("."+a.mobile.activePageClass).css("min-height",h())}function i(b,c){c&&b.attr("data-"+a.mobile.ns+"role",c);b.page()}function k(a){for(;a;){if(typeof a.nodeName==="string"&&a.nodeName.toLowerCase()=="a")break; -a=a.parentNode}return a}function l(b){var b=a(b).closest(".ui-page").jqmData("url"),c=t.hrefNoHash;if(!b||!j.isPath(b))b=c;return j.makeUrlAbsolute(b,c)}var o=a(window),m=a("html"),p=a("head"),j={urlParseRE:/^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,parseUrl:function(b){if(a.type(b)==="object")return b;b=j.urlParseRE.exec(b||"")||[];return{href:b[0]||"",hrefNoHash:b[1]|| -"",hrefNoSearch:b[2]||"",domain:b[3]||"",protocol:b[4]||"",doubleSlash:b[5]||"",authority:b[6]||"",username:b[8]||"",password:b[9]||"",host:b[10]||"",hostname:b[11]||"",port:b[12]||"",pathname:b[13]||"",directory:b[14]||"",filename:b[15]||"",search:b[16]||"",hash:b[17]||""}},makePathAbsolute:function(a,b){if(a&&a.charAt(0)==="/")return a;for(var a=a||"",c=(b=b?b.replace(/^\/|(\/[^\/]*|[^\/]+)$/g,""):"")?b.split("/"):[],d=a.split("/"),f=0;f<d.length;f++){var e=d[f];switch(e){case ".":break;case "..":c.length&& -c.pop();break;default:c.push(e)}}return"/"+c.join("/")},isSameDomain:function(a,b){return j.parseUrl(a).domain===j.parseUrl(b).domain},isRelativeUrl:function(a){return j.parseUrl(a).protocol===""},isAbsoluteUrl:function(a){return j.parseUrl(a).protocol!==""},makeUrlAbsolute:function(a,b){if(!j.isRelativeUrl(a))return a;var c=j.parseUrl(a),d=j.parseUrl(b),f=c.protocol||d.protocol,e=c.protocol?c.doubleSlash:c.doubleSlash||d.doubleSlash,h=c.authority||d.authority,g=c.pathname!=="",i=j.makePathAbsolute(c.pathname|| -d.filename,d.pathname);return f+e+h+i+(c.search||!g&&d.search||"")+c.hash},addSearchParams:function(b,c){var d=j.parseUrl(b),f=typeof c==="object"?a.param(c):c,e=d.search||"?";return d.hrefNoSearch+e+(e.charAt(e.length-1)!=="?"?"&":"")+f+(d.hash||"")},convertUrlToDataUrl:function(a){var b=j.parseUrl(a);if(j.isEmbeddedPage(b))return b.hash.split(s)[0].replace(/^#/,"");else if(j.isSameDomain(b,t))return b.hrefNoHash.replace(t.domain,"");return a},get:function(a){if(a===e)a=location.hash;return j.stripHash(a).replace(/[^\/]*\.[^\/*]+$/, -"")},getFilePath:function(b){var c="&"+a.mobile.subPageUrlKey;return b&&b.split(c)[0].split(s)[0]},set:function(a){location.hash=a},isPath:function(a){return/\//.test(a)},clean:function(a){return a.replace(t.domain,"")},stripHash:function(a){return a.replace(/^#/,"")},cleanHash:function(a){return j.stripHash(a.replace(/\?.*$/,"").replace(s,""))},isExternal:function(a){a=j.parseUrl(a);return a.protocol&&a.domain!==x.domain?true:false},hasProtocol:function(a){return/^(:?\w+:)/.test(a)},isFirstPageUrl:function(b){var b= -j.parseUrl(j.makeUrlAbsolute(b,t)),c=a.mobile.firstPage,c=c&&c[0]?c[0].id:e;return(b.hrefNoHash===x.hrefNoHash||w&&b.hrefNoHash===t.hrefNoHash)&&(!b.hash||b.hash==="#"||c&&b.hash.replace(/^#/,"")===c)},isEmbeddedPage:function(a){a=j.parseUrl(a);return a.protocol!==""?a.hash&&(a.hrefNoHash===x.hrefNoHash||w&&a.hrefNoHash===t.hrefNoHash):/^#/.test(a.href)}},q=null,n={stack:[],activeIndex:0,getActive:function(){return n.stack[n.activeIndex]},getPrev:function(){return n.stack[n.activeIndex-1]},getNext:function(){return n.stack[n.activeIndex+ -1]},addNew:function(a,b,c,d,f){n.getNext()&&n.clearForward();n.stack.push({url:a,transition:b,title:c,pageUrl:d,role:f});n.activeIndex=n.stack.length-1},clearForward:function(){n.stack=n.stack.slice(0,n.activeIndex+1)},directHashChange:function(b){var c,d,f;this.getActive();a.each(n.stack,function(a,e){b.currentUrl===e.url&&(c=a<n.activeIndex,d=!c,f=a)});this.activeIndex=f!==e?f:this.activeIndex;c?(b.either||b.isBack)(true):d&&(b.either||b.isForward)(false)},ignoreNextHashChange:false},A=[],z=false, -s="&ui-state=dialog",v=p.children("base"),x=j.parseUrl(location.href),t=v.length?j.parseUrl(j.makeUrlAbsolute(v.attr("href"),x.href)):x,w=x.hrefNoHash!==t.hrefNoHash,u=a.support.dynamicBaseTag?{element:v.length?v:a("<base>",{href:t.hrefNoHash}).prependTo(p),set:function(a){u.element.attr("href",j.makeUrlAbsolute(a,t))},reset:function(){u.element.attr("href",t.hrefNoHash)}}:e,D=true,y,C,B;y=function(){var b=o;a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&(b=a(".ui-page-active"),b=b.is(".ui-native-fixed")? -b.find(".ui-content"):b);return b};C=function(b){if(D){var c=a.mobile.urlHistory.getActive();if(c)b=b&&b.scrollTop(),c.lastScroll=b<a.mobile.minScrollBack?a.mobile.defaultHomeScroll:b}};B=function(){setTimeout(C,100,a(this))};o.bind(a.support.pushState?"popstate":"hashchange",function(){D=false});o.one(a.support.pushState?"popstate":"hashchange",function(){D=true});o.one("pagecontainercreate",function(){a.mobile.pageContainer.bind("pagechange",function(){var a=y();D=true;a.unbind("scrollstop",B); -a.bind("scrollstop",B)})});y().bind("scrollstop",B);a.mobile.getScreenHeight=h;a.fn.animationComplete=function(b){return a.support.cssTransitions?a(this).one("webkitAnimationEnd",b):(setTimeout(b,0),a(this))};a.mobile.path=j;a.mobile.base=u;a.mobile.urlHistory=n;a.mobile.dialogHashKey=s;a.mobile.noneTransitionHandler=function(b,c,d,f){f&&f.removeClass(a.mobile.activePageClass);d.addClass(a.mobile.activePageClass);return a.Deferred().resolve(b,c,d,f).promise()};a.mobile.defaultTransitionHandler=a.mobile.noneTransitionHandler; -a.mobile.transitionHandlers={none:a.mobile.defaultTransitionHandler};a.mobile.allowCrossDomainPages=false;a.mobile.getDocumentUrl=function(b){return b?a.extend({},x):x.href};a.mobile.getDocumentBase=function(b){return b?a.extend({},t):t.href};a.mobile._bindPageRemove=function(){var b=a(this);!b.data("page").options.domCache&&b.is(":jqmData(external-page='true')")&&b.bind("pagehide.remove",function(){var b=a(this),c=new a.Event("pageremove");b.trigger(c);c.isDefaultPrevented()||b.removeWithDependents()})}; -a.mobile.loadPage=function(b,c){var d=a.Deferred(),f=a.extend({},a.mobile.loadPage.defaults,c),h=null,g=null,m=j.makeUrlAbsolute(b,a.mobile.activePage&&l(a.mobile.activePage)||t.hrefNoHash);if(f.data&&f.type==="get")m=j.addSearchParams(m,f.data),f.data=e;if(f.data&&f.type==="post")f.reloadPage=true;var s=j.getFilePath(m),p=j.convertUrlToDataUrl(m);f.pageContainer=f.pageContainer||a.mobile.pageContainer;h=f.pageContainer.children(":jqmData(url='"+p+"')");h.length===0&&p&&!j.isPath(p)&&(h=f.pageContainer.children("#"+ -p).attr("data-"+a.mobile.ns+"url",p));if(h.length===0)if(a.mobile.firstPage&&j.isFirstPageUrl(s))a.mobile.firstPage.parent().length&&(h=a(a.mobile.firstPage));else if(j.isEmbeddedPage(s))return d.reject(m,c),d.promise();u&&u.reset();if(h.length){if(!f.reloadPage)return i(h,f.role),d.resolve(m,c,h),d.promise();g=h}var n=f.pageContainer,k=new a.Event("pagebeforeload"),q={url:b,absUrl:m,dataUrl:p,deferred:d,options:f};n.trigger(k,q);if(k.isDefaultPrevented())return d.promise();if(f.showLoadMsg)var v= -setTimeout(function(){a.mobile.showPageLoadingMsg()},f.loadMsgDelay);!a.mobile.allowCrossDomainPages&&!j.isSameDomain(x,m)?d.reject(m,c):a.ajax({url:s,type:f.type,data:f.data,dataType:"html",success:function(e,n,k){var o=a("<div></div>"),l=e.match(/<title[^>]*>([^<]*)/)&&RegExp.$1,t=RegExp("\\bdata-"+a.mobile.ns+"url=[\"']?([^\"'>]*)[\"']?");RegExp("(<[^>]+\\bdata-"+a.mobile.ns+"role=[\"']?page[\"']?[^>]*>)").test(e)&&RegExp.$1&&t.test(RegExp.$1)&&RegExp.$1&&(b=s=j.getFilePath(RegExp.$1));u&&u.set(s); -o.get(0).innerHTML=e;h=o.find(":jqmData(role='page'), :jqmData(role='dialog')").first();h.length||(h=a("<div data-"+a.mobile.ns+"role='page'>"+e.split(/<\/?body[^>]*>/gmi)[1]+"</div>"));l&&!h.jqmData("title")&&(~l.indexOf("&")&&(l=a("<div>"+l+"</div>").text()),h.jqmData("title",l));if(!a.support.dynamicBaseTag){var x=j.get(s);h.find("[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]").each(function(){var b=a(this).is("[href]")?"href":a(this).is("[src]")?"src":"action",c=a(this).attr(b), -c=c.replace(location.protocol+"//"+location.host+location.pathname,"");/^(\w+:|#|\/)/.test(c)||a(this).attr(b,x+c)})}h.attr("data-"+a.mobile.ns+"url",j.convertUrlToDataUrl(s)).attr("data-"+a.mobile.ns+"external-page",true).appendTo(f.pageContainer);h.one("pagecreate",a.mobile._bindPageRemove);i(h,f.role);m.indexOf("&"+a.mobile.subPageUrlKey)>-1&&(h=f.pageContainer.children(":jqmData(url='"+p+"')"));f.showLoadMsg&&(clearTimeout(v),a.mobile.hidePageLoadingMsg());q.xhr=k;q.textStatus=n;q.page=h;f.pageContainer.trigger("pageload", -q);d.resolve(m,c,h,g)},error:function(b,e,h){u&&u.set(j.get());q.xhr=b;q.textStatus=e;q.errorThrown=h;b=new a.Event("pageloadfailed");f.pageContainer.trigger(b,q);b.isDefaultPrevented()||(f.showLoadMsg&&(clearTimeout(v),a.mobile.hidePageLoadingMsg(),a("<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+a.mobile.pageLoadErrorMessage+"</h1></div>").css({display:"block",opacity:0.96,top:o.scrollTop()+100}).appendTo(f.pageContainer).delay(800).fadeOut(400,function(){a(this).remove()})), -d.reject(m,c))}});return d.promise()};a.mobile.loadPage.defaults={type:"get",data:e,reloadPage:false,role:e,showLoadMsg:false,pageContainer:e,loadMsgDelay:50};a.mobile.changePage=function(b,h){if(z)A.unshift(arguments);else{var g=a.extend({},a.mobile.changePage.defaults,h);g.pageContainer=g.pageContainer||a.mobile.pageContainer;g.fromPage=g.fromPage||a.mobile.activePage;var p=g.pageContainer,k=new a.Event("pagebeforechange"),q={toPage:b,options:g};p.trigger(k,q);if(!k.isDefaultPrevented())if(b=q.toPage, -z=true,typeof b=="string")a.mobile.loadPage(b,g).done(function(b,c,d,f){z=false;c.duplicateCachedPage=f;a.mobile.changePage(d,c)}).fail(function(){z=false;d(true);f();g.pageContainer.trigger("pagechangefailed",q)});else{if(b[0]===a.mobile.firstPage[0]&&!g.dataUrl)g.dataUrl=x.hrefNoHash;var k=g.fromPage,l=g.dataUrl&&j.convertUrlToDataUrl(g.dataUrl)||b.jqmData("url"),v=l;j.getFilePath(l);var o=n.getActive(),t=n.activeIndex===0,w=0,u=document.title,y=g.role==="dialog"||b.jqmData("role")==="dialog";if(k&& -k[0]===b[0]&&!g.allowSamePageTransition)z=false,p.trigger("pagechange",q);else{i(b,g.role);g.fromHashChange&&n.directHashChange({currentUrl:l,isBack:function(){w=-1},isForward:function(){w=1}});try{document.activeElement&&document.activeElement.nodeName.toLowerCase()!="body"?a(document.activeElement).blur():a("input:focus, textarea:focus, select:focus").blur()}catch(B){}y&&o&&(l=(o.url||"")+s);if(g.changeHash!==false&&l)n.ignoreNextHashChange=true,j.set(l);var C=!o?u:b.jqmData("title")||b.children(":jqmData(role='header')").find(".ui-title").getEncodedText(); -C&&u==document.title&&(u=C);b.jqmData("title")||b.jqmData("title",u);g.transition=g.transition||(w&&!t?o.transition:e)||(y?a.mobile.defaultDialogTransition:a.mobile.defaultPageTransition);w||n.addNew(l,g.transition,u,v,g.role);document.title=n.getActive().title;a.mobile.activePage=b;g.reverse=g.reverse||w<0;c(b,k,g.transition,g.reverse).done(function(){d();g.duplicateCachedPage&&g.duplicateCachedPage.remove();m.removeClass("ui-mobile-rendering");f();p.trigger("pagechange",q)})}}}};a.mobile.changePage.defaults= -{transition:e,reverse:false,changeHash:true,fromHashChange:false,role:e,duplicateCachedPage:e,pageContainer:e,showLoadMsg:true,dataUrl:e,fromPage:e,allowSamePageTransition:false};a.mobile._registerInternalEvents=function(){a("form").live("submit",function(b){var c=a(this);if(a.mobile.ajaxEnabled&&!c.is(":jqmData(ajax='false')")){var d=c.attr("method"),f=c.attr("target"),e=c.attr("action");if(!e&&(e=l(c),e===t.hrefNoHash))e=x.hrefNoSearch;e=j.makeUrlAbsolute(e,l(c));!j.isExternal(e)&&!f&&(a.mobile.changePage(e, -{type:d&&d.length&&d.toLowerCase()||"get",data:c.serialize(),transition:c.jqmData("transition"),direction:c.jqmData("direction"),reloadPage:true}),b.preventDefault())}});a(document).bind("vclick",function(b){if(!(b.which>1)&&a.mobile.linkBindingEnabled&&(b=k(b.target))&&j.parseUrl(b.getAttribute("href")||"#").hash!=="#")d(true),q=a(b).closest(".ui-btn").not(".ui-disabled"),q.addClass(a.mobile.activeBtnClass),a("."+a.mobile.activePageClass+" .ui-btn").not(b).blur()});a(document).bind("click",function(b){if(a.mobile.linkBindingEnabled){var c= -k(b.target);if(c&&!(b.which>1)){var f=a(c),h=function(){window.setTimeout(function(){d(true)},200)};if(f.is(":jqmData(rel='back')"))return window.history.back(),false;var g=l(f),c=j.makeUrlAbsolute(f.attr("href")||"#",g);if(!a.mobile.ajaxEnabled&&!j.isEmbeddedPage(c))h();else{if(c.search("#")!=-1)if(c=c.replace(/[^#]*#/,""))c=j.isPath(c)?j.makeUrlAbsolute(c,g):j.makeUrlAbsolute("#"+c,x.hrefNoHash);else{b.preventDefault();return}var g=f.is("[rel='external']")||f.is(":jqmData(ajax='false')")||f.is("[target]"), -i=a.mobile.allowCrossDomainPages&&x.protocol==="file:"&&c.search(/^https?:/)!=-1;g||j.isExternal(c)&&!i?h():(h=f.jqmData("transition"),g=(g=f.jqmData("direction"))&&g==="reverse"||f.jqmData("back"),f=f.attr("data-"+a.mobile.ns+"rel")||e,a.mobile.changePage(c,{transition:h,reverse:g,role:f}),b.preventDefault())}}}});a(".ui-page").live("pageshow.prefetch",function(){var b=[];a(this).find("a:jqmData(prefetch)").each(function(){var c=a(this),f=c.attr("href");f&&a.inArray(f,b)===-1&&(b.push(f),a.mobile.loadPage(f, -{role:c.attr("data-"+a.mobile.ns+"rel")}))})});a.mobile._handleHashChange=function(b){var c=j.stripHash(b),f={transition:a.mobile.urlHistory.stack.length===0?"none":e,changeHash:false,fromHashChange:true};if(!a.mobile.hashListeningEnabled||n.ignoreNextHashChange)n.ignoreNextHashChange=false;else{if(n.stack.length>1&&c.indexOf(s)>-1)if(a.mobile.activePage.is(".ui-dialog"))n.directHashChange({currentUrl:c,either:function(b){var d=a.mobile.urlHistory.getActive();c=d.pageUrl;a.extend(f,{role:d.role,transition:d.transition, -reverse:b})}});else{n.directHashChange({currentUrl:c,isBack:function(){window.history.back()},isForward:function(){window.history.forward()}});return}c?(c=typeof c==="string"&&!j.isPath(c)?j.makeUrlAbsolute("#"+c,t):c,a.mobile.changePage(c,f)):a.mobile.changePage(a.mobile.firstPage,f)}};o.bind("hashchange",function(){a.mobile._handleHashChange(location.hash)});a(document).bind("pageshow",g);a(window).bind("throttledresize",g)}})(jQuery); -(function(a,e){var b={},d=a(e),f=a.mobile.path.parseUrl(location.href);a.extend(b,{initialFilePath:f.pathname+f.search,initialHref:f.hrefNoHash,hashchangeFired:false,state:function(){return{hash:location.hash||"#"+b.initialFilePath,title:document.title,initialHref:b.initialHref}},resetUIKeys:function(b){var f="&"+a.mobile.subPageUrlKey,d=b.indexOf(a.mobile.dialogHashKey);d>-1?b=b.slice(0,d)+"#"+b.slice(d):b.indexOf(f)>-1&&(b=b.split(f).join("#"+f));return b},nextHashChangePrevented:function(c){a.mobile.urlHistory.ignoreNextHashChange= -c;b.onHashChangeDisabled=c},onHashChange:function(){if(!b.onHashChangeDisabled){var c,f;c=location.hash;var d=a.mobile.path.isPath(c),e=d?location.href:a.mobile.getDocumentUrl();c=d?c.replace("#",""):c;f=b.state();c=a.mobile.path.makeUrlAbsolute(c,e);d&&(c=b.resetUIKeys(c));history.replaceState(f,document.title,c)}},onPopState:function(c){var f=c.originalEvent.state;f&&(b.nextHashChangePrevented(true),setTimeout(function(){b.nextHashChangePrevented(false);a.mobile._handleHashChange(f.hash)},100))}, -init:function(){d.bind("hashchange",b.onHashChange);d.bind("popstate",b.onPopState);location.hash===""&&history.replaceState(b.state(),document.title,location.href)}});a(function(){a.mobile.pushStateEnabled&&a.support.pushState&&b.init()})})(jQuery,this); -(function(a){function e(b,d,f,c){var e=new a.Deferred,g=d?" reverse":"",i="ui-mobile-viewport-transitioning viewport-"+b;f.animationComplete(function(){f.add(c).removeClass("out in reverse "+b);c&&c[0]!==f[0]&&c.removeClass(a.mobile.activePageClass);f.parent().removeClass(i);e.resolve(b,d,f,c)});f.parent().addClass(i);c&&c.addClass(b+" out"+g);f.addClass(a.mobile.activePageClass+" "+b+" in"+g);return e.promise()}a.mobile.css3TransitionHandler=e;if(a.mobile.defaultTransitionHandler===a.mobile.noneTransitionHandler)a.mobile.defaultTransitionHandler= -e})(jQuery,this); -(function(a){a.mobile.page.prototype.options.degradeInputs={color:false,date:false,datetime:false,"datetime-local":false,email:false,month:false,number:false,range:"number",search:"text",tel:false,time:false,url:false,week:false};a(document).bind("pagecreate create",function(e){var b=a(e.target).closest(':jqmData(role="page")').data("page"),d;if(b)d=b.options,a(e.target).find("input").not(b.keepNativeSelector()).each(function(){var b=a(this),c=this.getAttribute("type"),e=d.degradeInputs[c]||"text"; -if(d.degradeInputs[c]){var g=a("<div>").html(b.clone()).html(),i=g.indexOf(" type=")>-1;b.replaceWith(g.replace(i?/\s+type=["']?\w+['"]?/:/\/?>/,' type="'+e+'" data-'+a.mobile.ns+'type="'+c+'"'+(i?"":">")))}})})})(jQuery); -(function(a,e){a.widget("mobile.dialog",a.mobile.widget,{options:{closeBtnText:"Close",overlayTheme:"a",initSelector:":jqmData(role='dialog')"},_create:function(){var b=this,d=this.element,f=a("<a href='#' data-"+a.mobile.ns+"icon='delete' data-"+a.mobile.ns+"iconpos='notext'>"+this.options.closeBtnText+"</a>");d.addClass("ui-overlay-"+this.options.overlayTheme);d.attr("role","dialog").addClass("ui-dialog").find(":jqmData(role='header')").addClass("ui-corner-top ui-overlay-shadow").prepend(f).end().find(":jqmData(role='content'),:jqmData(role='footer')").addClass("ui-overlay-shadow").last().addClass("ui-corner-bottom"); -f.bind("vclick",function(){b.close()});d.bind("vclick submit",function(b){var b=a(b.target).closest(b.type==="vclick"?"a":"form"),f;b.length&&!b.jqmData("transition")&&(f=a.mobile.urlHistory.getActive()||{},b.attr("data-"+a.mobile.ns+"transition",f.transition||a.mobile.defaultDialogTransition).attr("data-"+a.mobile.ns+"direction","reverse"))}).bind("pagehide",function(){a(this).find("."+a.mobile.activeBtnClass).removeClass(a.mobile.activeBtnClass)})},close:function(){e.history.back()}});a(a.mobile.dialog.prototype.options.initSelector).live("pagecreate", -function(){a(this).dialog()})})(jQuery,this); -(function(a){a.mobile.page.prototype.options.backBtnText="Back";a.mobile.page.prototype.options.addBackBtn=false;a.mobile.page.prototype.options.backBtnTheme=null;a.mobile.page.prototype.options.headerTheme="a";a.mobile.page.prototype.options.footerTheme="a";a.mobile.page.prototype.options.contentTheme=null;a(":jqmData(role='page'), :jqmData(role='dialog')").live("pagecreate",function(){var e=a(this),b=e.data("page").options,d=e.jqmData("role"),f=b.theme;a(":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", -this).each(function(){var c=a(this),e=c.jqmData("role"),g=c.jqmData("theme"),i=g||b.contentTheme||d==="dialog"&&f,k;c.addClass("ui-"+e);if(e==="header"||e==="footer"){var l=g||(e==="header"?b.headerTheme:b.footerTheme)||f;c.addClass("ui-bar-"+l).attr("role",e==="header"?"banner":"contentinfo");g=c.children("a");i=g.hasClass("ui-btn-left");k=g.hasClass("ui-btn-right");i=i||g.eq(0).not(".ui-btn-right").addClass("ui-btn-left").length;k||g.eq(1).addClass("ui-btn-right");b.addBackBtn&&e==="header"&&a(".ui-page").length> -1&&c.jqmData("url")!==a.mobile.path.stripHash(location.hash)&&!i&&a("<a href='#' class='ui-btn-left' data-"+a.mobile.ns+"rel='back' data-"+a.mobile.ns+"icon='arrow-l'>"+b.backBtnText+"</a>").attr("data-"+a.mobile.ns+"theme",b.backBtnTheme||l).prependTo(c);c.children("h1, h2, h3, h4, h5, h6").addClass("ui-title").attr({tabindex:"0",role:"heading","aria-level":"1"})}else e==="content"&&(i&&c.addClass("ui-body-"+i),c.attr("role","main"))})})})(jQuery); -(function(a){a.widget("mobile.collapsible",a.mobile.widget,{options:{expandCueText:" click to expand contents",collapseCueText:" click to collapse contents",collapsed:true,heading:"h1,h2,h3,h4,h5,h6,legend",theme:null,contentTheme:null,iconTheme:"d",initSelector:":jqmData(role='collapsible')"},_create:function(){var e=this.element,b=this.options,d=e.addClass("ui-collapsible"),f=e.children(b.heading).first(),c=d.wrapInner("<div class='ui-collapsible-content'></div>").find(".ui-collapsible-content"), -h=e.closest(":jqmData(role='collapsible-set')").addClass("ui-collapsible-set"),e=h.children(":jqmData(role='collapsible')");f.is("legend")&&(f=a("<div role='heading'>"+f.html()+"</div>").insertBefore(f),f.next().remove());if(h.length){if(!b.theme)b.theme=h.jqmData("theme");if(!b.contentTheme)b.contentTheme=h.jqmData("content-theme")}c.addClass(b.contentTheme?"ui-body-"+b.contentTheme:"");f.insertBefore(c).addClass("ui-collapsible-heading").append("<span class='ui-collapsible-heading-status'></span>").wrapInner("<a href='#' class='ui-collapsible-heading-toggle'></a>").find("a").first().buttonMarkup({shadow:false, -corners:false,iconPos:"left",icon:"plus",theme:b.theme});h.length?(h.jqmData("collapsiblebound")||h.jqmData("collapsiblebound",true).bind("expand",function(b){a(b.target).closest(".ui-collapsible").siblings(".ui-collapsible").trigger("collapse")}),e.first().find("a").first().addClass("ui-corner-top").find(".ui-btn-inner").addClass("ui-corner-top"),e.last().jqmData("collapsible-last",true).find("a").first().addClass("ui-corner-bottom").find(".ui-btn-inner").addClass("ui-corner-bottom"),d.jqmData("collapsible-last")&& -f.find("a").first().add(f.find(".ui-btn-inner")).addClass("ui-corner-bottom")):f.find("a").first().add(f.find(".ui-btn-inner")).addClass("ui-corner-top ui-corner-bottom");d.bind("expand collapse",function(e){if(!e.isDefaultPrevented()){e.preventDefault();var i=a(this),e=e.type==="collapse",k=b.contentTheme;f.toggleClass("ui-collapsible-heading-collapsed",e).find(".ui-collapsible-heading-status").text(e?b.expandCueText:b.collapseCueText).end().find(".ui-icon").toggleClass("ui-icon-minus",!e).toggleClass("ui-icon-plus", -e);i.toggleClass("ui-collapsible-collapsed",e);c.toggleClass("ui-collapsible-content-collapsed",e).attr("aria-hidden",e);if(k&&(!h.length||d.jqmData("collapsible-last")))f.find("a").first().add(f.find(".ui-btn-inner")).toggleClass("ui-corner-bottom",e),c.toggleClass("ui-corner-bottom",!e);c.trigger("updatelayout")}}).trigger(b.collapsed?"collapse":"expand");f.bind("click",function(a){var b=f.is(".ui-collapsible-heading-collapsed")?"expand":"collapse";d.trigger(b);a.preventDefault()})}});a(document).bind("pagecreate create", -function(e){a(a.mobile.collapsible.prototype.options.initSelector,e.target).collapsible()})})(jQuery);(function(a){a.fn.fieldcontain=function(){return this.addClass("ui-field-contain ui-body ui-br")};a(document).bind("pagecreate create",function(e){a(":jqmData(role='fieldcontain')",e.target).fieldcontain()})})(jQuery); -(function(a){a.fn.grid=function(e){return this.each(function(){var b=a(this),d=a.extend({grid:null},e),f=b.children(),c={solo:1,a:2,b:3,c:4,d:5},d=d.grid;if(!d)if(f.length<=5)for(var h in c)c[h]===f.length&&(d=h);else d="a";c=c[d];b.addClass("ui-grid-"+d);f.filter(":nth-child("+c+"n+1)").addClass("ui-block-a");c>1&&f.filter(":nth-child("+c+"n+2)").addClass("ui-block-b");c>2&&f.filter(":nth-child(3n+3)").addClass("ui-block-c");c>3&&f.filter(":nth-child(4n+4)").addClass("ui-block-d");c>4&&f.filter(":nth-child(5n+5)").addClass("ui-block-e")})}})(jQuery); -(function(a,e){a.widget("mobile.navbar",a.mobile.widget,{options:{iconpos:"top",grid:null,initSelector:":jqmData(role='navbar')"},_create:function(){var b=this.element,d=b.find("a"),f=d.filter(":jqmData(icon)").length?this.options.iconpos:e;b.addClass("ui-navbar").attr("role","navigation").find("ul").grid({grid:this.options.grid});f||b.addClass("ui-navbar-noicons");d.buttonMarkup({corners:false,shadow:false,iconpos:f});b.delegate("a","vclick",function(){d.not(".ui-state-persist").removeClass(a.mobile.activeBtnClass); -a(this).addClass(a.mobile.activeBtnClass)})}});a(document).bind("pagecreate create",function(b){a(a.mobile.navbar.prototype.options.initSelector,b.target).navbar()})})(jQuery); -(function(a){var e={};a.widget("mobile.listview",a.mobile.widget,{options:{theme:null,countTheme:"c",headerTheme:"b",dividerTheme:"b",splitIcon:"arrow-r",splitTheme:"b",inset:false,initSelector:":jqmData(role='listview')"},_create:function(){var a=this;a.element.addClass(function(d,f){return f+" ui-listview "+(a.options.inset?" ui-listview-inset ui-corner-all ui-shadow ":"")});a.refresh(true)},_removeCorners:function(a,d){a=a.add(a.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb"));d==="top"?a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl"): -d==="bottom"?a.removeClass("ui-corner-bottom ui-corner-br ui-corner-bl"):a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl ui-corner-bottom ui-corner-br ui-corner-bl")},_refreshCorners:function(a){var d,f;this.options.inset&&(d=this.element.children("li"),f=a?d.not(".ui-screen-hidden"):d.filter(":visible"),this._removeCorners(d),d=f.first().addClass("ui-corner-top"),d.add(d.find(".ui-btn-inner").not(".ui-li-link-alt span:first-child")).addClass("ui-corner-top").end().find(".ui-li-link-alt, .ui-li-link-alt span:first-child").addClass("ui-corner-tr").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-tl"), -f=f.last().addClass("ui-corner-bottom"),f.add(f.find(".ui-btn-inner")).find(".ui-li-link-alt").addClass("ui-corner-br").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-bl"));a||this.element.trigger("updatelayout")},_findFirstElementByTagName:function(a,d,f,c){var e={};for(e[f]=e[c]=true;a;){if(e[a.nodeName])return a;a=a[d]}return null},_getChildrenByTagName:function(b,d,f){var c=[],e={};e[d]=e[f]=true;for(b=b.firstChild;b;)e[b.nodeName]&&c.push(b),b=b.nextSibling;return a(c)},_addThumbClasses:function(b){var d, -f,c=b.length;for(d=0;d<c;d++)f=a(this._findFirstElementByTagName(b[d].firstChild,"nextSibling","img","IMG")),f.length&&(f.addClass("ui-li-thumb"),a(this._findFirstElementByTagName(f[0].parentNode,"parentNode","li","LI")).addClass(f.is(".ui-li-icon")?"ui-li-has-icon":"ui-li-has-thumb"))},refresh:function(b){this.parentPage=this.element.closest(".ui-page");this._createSubPages();var d=this.options,f=this.element,c=f.jqmData("dividertheme")||d.dividerTheme,e=f.jqmData("splittheme"),g=f.jqmData("spliticon"), -i=this._getChildrenByTagName(f[0],"li","LI"),k=a.support.cssPseudoElement||!a.nodeName(f[0],"ol")?0:1,l={},o,m,p,j,q;k&&f.find(".ui-li-dec").remove();if(!d.theme)d.theme=a.mobile.getInheritedTheme(this.element,"c");for(var n=0,A=i.length;n<A;n++){o=i.eq(n);m="ui-li";if(b||!o.hasClass("ui-li"))p=o.jqmData("theme")||d.theme,j=this._getChildrenByTagName(o[0],"a","A"),j.length?(q=o.jqmData("icon"),o.buttonMarkup({wrapperEls:"div",shadow:false,corners:false,iconpos:"right",icon:j.length>1||q===false?false: -q||"arrow-r",theme:p}),q!=false&&j.length==1&&o.addClass("ui-li-has-arrow"),j.first().addClass("ui-link-inherit"),j.length>1&&(m+=" ui-li-has-alt",j=j.last(),q=e||j.jqmData("theme")||d.splitTheme,j.appendTo(o).attr("title",j.getEncodedText()).addClass("ui-li-link-alt").empty().buttonMarkup({shadow:false,corners:false,theme:p,icon:false,iconpos:false}).find(".ui-btn-inner").append(a(document.createElement("span")).buttonMarkup({shadow:true,corners:true,theme:q,iconpos:"notext",icon:g||j.jqmData("icon")|| -d.splitIcon})))):o.jqmData("role")==="list-divider"?(m+=" ui-li-divider ui-btn ui-bar-"+c,o.attr("role","heading"),k&&(k=1)):m+=" ui-li-static ui-body-"+p;k&&m.indexOf("ui-li-divider")<0&&(p=o.is(".ui-li-static:first")?o:o.find(".ui-link-inherit"),p.addClass("ui-li-jsnumbering").prepend("<span class='ui-li-dec'>"+k++ +". </span>"));l[m]||(l[m]=[]);l[m].push(o[0])}for(m in l)a(l[m]).addClass(m).children(".ui-btn-inner").addClass(m);f.find("h1, h2, h3, h4, h5, h6").addClass("ui-li-heading").end().find("p, dl").addClass("ui-li-desc").end().find(".ui-li-aside").each(function(){var b= -a(this);b.prependTo(b.parent())}).end().find(".ui-li-count").each(function(){a(this).closest("li").addClass("ui-li-has-count")}).addClass("ui-btn-up-"+(f.jqmData("counttheme")||this.options.countTheme)+" ui-btn-corner-all");this._addThumbClasses(i);this._addThumbClasses(f.find(".ui-link-inherit"));this._refreshCorners(b)},_idStringEscape:function(a){return a.replace(/[^a-zA-Z0-9]/g,"-")},_createSubPages:function(){var b=this.element,d=b.closest(".ui-page"),f=d.jqmData("url"),c=f||d[0][a.expando], -h=b.attr("id"),g=this.options,i="data-"+a.mobile.ns,k=this,l=d.find(":jqmData(role='footer')").jqmData("id"),o;typeof e[c]==="undefined"&&(e[c]=-1);h=h||++e[c];a(b.find("li>ul, li>ol").toArray().reverse()).each(function(c){var d=a(this),e=d.attr("id")||h+"-"+c,c=d.parent(),k=a(d.prevAll().toArray().reverse()),k=k.length?k:a("<span>"+a.trim(c.contents()[0].nodeValue)+"</span>"),n=k.first().getEncodedText(),e=(f||"")+"&"+a.mobile.subPageUrlKey+"="+e,A=d.jqmData("theme")||g.theme,z=d.jqmData("counttheme")|| -b.jqmData("counttheme")||g.countTheme;o=true;d.detach().wrap("<div "+i+"role='page' "+i+"url='"+e+"' "+i+"theme='"+A+"' "+i+"count-theme='"+z+"'><div "+i+"role='content'></div></div>").parent().before("<div "+i+"role='header' "+i+"theme='"+g.headerTheme+"'><div class='ui-title'>"+n+"</div></div>").after(l?a("<div "+i+"role='footer' "+i+"id='"+l+"'>"):"").parent().appendTo(a.mobile.pageContainer).page();d=c.find("a:first");d.length||(d=a("<a/>").html(k||n).prependTo(c.empty()));d.attr("href","#"+e)}).listview(); -o&&d.is(":jqmData(external-page='true')")&&d.data("page").options.domCache===false&&d.unbind("pagehide.remove").bind("pagehide.remove",function(b,c){var e=c.nextPage;c.nextPage&&(e=e.jqmData("url"),e.indexOf(f+"&"+a.mobile.subPageUrlKey)!==0&&(k.childPages().remove(),d.remove()))})},childPages:function(){var b=this.parentPage.jqmData("url");return a(":jqmData(url^='"+b+"&"+a.mobile.subPageUrlKey+"')")}});a(document).bind("pagecreate create",function(b){a(a.mobile.listview.prototype.options.initSelector, -b.target).listview()})})(jQuery); -(function(a){a.mobile.listview.prototype.options.filter=false;a.mobile.listview.prototype.options.filterPlaceholder="Filter items...";a.mobile.listview.prototype.options.filterTheme="c";a.mobile.listview.prototype.options.filterCallback=function(a,b){return a.toLowerCase().indexOf(b)===-1};a(":jqmData(role='listview')").live("listviewcreate",function(){var e=a(this),b=e.data("listview");if(b.options.filter){var d=a("<form>",{"class":"ui-listview-filter ui-bar-"+b.options.filterTheme,role:"search"}); -a("<input>",{placeholder:b.options.filterPlaceholder}).attr("data-"+a.mobile.ns+"type","search").jqmData("lastval","").bind("keyup change",function(){var d=a(this),c=this.value.toLowerCase(),h=null,h=d.jqmData("lastval")+"",g=false,i="";d.jqmData("lastval",c);i=c.substr(0,h.length-1).replace(h,"");h=c.length<h.length||i.length!=c.length-h.length?e.children():e.children(":not(.ui-screen-hidden)");if(c){for(var k=h.length-1;k>=0;k--)d=a(h[k]),i=d.jqmData("filtertext")||d.text(),d.is("li:jqmData(role=list-divider)")? -(d.toggleClass("ui-filter-hidequeue",!g),g=false):b.options.filterCallback(i,c)?d.toggleClass("ui-filter-hidequeue",true):g=true;h.filter(":not(.ui-filter-hidequeue)").toggleClass("ui-screen-hidden",false);h.filter(".ui-filter-hidequeue").toggleClass("ui-screen-hidden",true).toggleClass("ui-filter-hidequeue",false)}else h.toggleClass("ui-screen-hidden",false);b._refreshCorners()}).appendTo(d).textinput();a(this).jqmData("inset")&&d.addClass("ui-listview-filter-inset");d.bind("submit",function(){return false}).insertBefore(e)}})})(jQuery); -(function(a){a(document).bind("pagecreate create",function(e){a(":jqmData(role='nojs')",e.target).addClass("ui-nojs")})})(jQuery); -(function(a,e){a.widget("mobile.checkboxradio",a.mobile.widget,{options:{theme:null,initSelector:"input[type='checkbox'],input[type='radio']"},_create:function(){var b=this,d=this.element,f=d.closest("form,fieldset,:jqmData(role='page')").find("label[for='"+d[0].id+"']"),c=d.attr("type"),h=c+"-on",g=c+"-off",i=d.parents(":jqmData(type='horizontal')").length?e:g;if(!(c!=="checkbox"&&c!=="radio")){a.extend(this,{label:f,inputtype:c,checkedClass:"ui-"+h+(i?"":" "+a.mobile.activeBtnClass),uncheckedClass:"ui-"+ -g,checkedicon:"ui-icon-"+h,uncheckedicon:"ui-icon-"+g});if(!this.options.theme)this.options.theme=this.element.jqmData("theme");f.buttonMarkup({theme:this.options.theme,icon:i,shadow:false});d.add(f).wrapAll("<div class='ui-"+c+"'></div>");f.bind({vmouseover:function(b){a(this).parent().is(".ui-disabled")&&b.stopPropagation()},vclick:function(a){if(d.is(":disabled"))a.preventDefault();else return b._cacheVals(),d.prop("checked",c==="radio"&&true||!d.prop("checked")),d.triggerHandler("click"),b._getInputSet().not(d).prop("checked", -false),b._updateAll(),false}});d.bind({vmousedown:function(){b._cacheVals()},vclick:function(){var c=a(this);c.is(":checked")?(c.prop("checked",true),b._getInputSet().not(c).prop("checked",false)):c.prop("checked",false);b._updateAll()},focus:function(){f.addClass("ui-focus")},blur:function(){f.removeClass("ui-focus")}});this.refresh()}},_cacheVals:function(){this._getInputSet().each(function(){var b=a(this);b.jqmData("cacheVal",b.is(":checked"))})},_getInputSet:function(){return this.inputtype== -"checkbox"?this.element:this.element.closest("form,fieldset,:jqmData(role='page')").find("input[name='"+this.element.attr("name")+"'][type='"+this.inputtype+"']")},_updateAll:function(){var b=this;this._getInputSet().each(function(){var d=a(this);(d.is(":checked")||b.inputtype==="checkbox")&&d.trigger("change")}).checkboxradio("refresh")},refresh:function(){var b=this.element,d=this.label,f=d.find(".ui-icon");a(b[0]).prop("checked")?(d.addClass(this.checkedClass).removeClass(this.uncheckedClass), -f.addClass(this.checkedicon).removeClass(this.uncheckedicon)):(d.removeClass(this.checkedClass).addClass(this.uncheckedClass),f.removeClass(this.checkedicon).addClass(this.uncheckedicon));b.is(":disabled")?this.disable():this.enable()},disable:function(){this.element.prop("disabled",true).parent().addClass("ui-disabled")},enable:function(){this.element.prop("disabled",false).parent().removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(b){a.mobile.checkboxradio.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a,e){a.widget("mobile.button",a.mobile.widget,{options:{theme:null,icon:null,iconpos:null,inline:null,corners:true,shadow:true,iconshadow:true,initSelector:"button, [type='button'], [type='submit'], [type='reset'], [type='image']"},_create:function(){var b=this.element,d=this.options,f,c;this.button=a("<div></div>").text(b.text()||b.val()).insertBefore(b).buttonMarkup({theme:d.theme,icon:d.icon,iconpos:d.iconpos,inline:d.inline,corners:d.corners,shadow:d.shadow,iconshadow:d.iconshadow}).append(b.addClass("ui-btn-hidden")); -d=b.attr("type");f=b.attr("name");d!=="button"&&d!=="reset"&&f&&b.bind("vclick",function(){c===e&&(c=a("<input>",{type:"hidden",name:b.attr("name"),value:b.attr("value")}).insertBefore(b),a(document).one("submit",function(){c.remove();c=e}))});this.refresh()},enable:function(){this.element.attr("disabled",false);this.button.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.button.addClass("ui-disabled").attr("aria-disabled", -true);return this._setOption("disabled",true)},refresh:function(){var a=this.element;a.prop("disabled")?this.disable():this.enable();this.button.data("textWrapper").text(a.text()||a.val())}});a(document).bind("pagecreate create",function(b){a.mobile.button.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a,e){a.widget("mobile.slider",a.mobile.widget,{options:{theme:null,trackTheme:null,disabled:false,initSelector:"input[type='range'], :jqmData(type='range'), :jqmData(role='slider')"},_create:function(){var b=this,d=this.element,f=a.mobile.getInheritedTheme(d,"c"),c=this.options.theme||f,h=this.options.trackTheme||f,g=d[0].nodeName.toLowerCase(),f=g=="select"?"ui-slider-switch":"",i=d.attr("id"),k=i+"-label",i=a("[for='"+i+"']").attr("id",k),l=function(){return g=="input"?parseFloat(d.val()): -d[0].selectedIndex},o=g=="input"?parseFloat(d.attr("min")):0,m=g=="input"?parseFloat(d.attr("max")):d.find("option").length-1,p=window.parseFloat(d.attr("step")||1),j=a("<div class='ui-slider "+f+" ui-btn-down-"+h+" ui-btn-corner-all' role='application'></div>"),q=a("<a href='#' class='ui-slider-handle'></a>").appendTo(j).buttonMarkup({corners:true,theme:c,shadow:true}).attr({role:"slider","aria-valuemin":o,"aria-valuemax":m,"aria-valuenow":l(),"aria-valuetext":l(),title:l(),"aria-labelledby":k}); -a.extend(this,{slider:j,handle:q,dragging:false,beforeStart:null,userModified:false,mouseMoved:false});g=="select"&&(j.wrapInner("<div class='ui-slider-inneroffset'></div>"),q.addClass("ui-slider-handle-snapping"),d.find("option"),d.find("option").each(function(b){var c=!b?"b":"a",d=!b?"right":"left",b=!b?" ui-btn-down-"+h:" "+a.mobile.activeBtnClass;a("<div class='ui-slider-labelbg ui-slider-labelbg-"+c+b+" ui-btn-corner-"+d+"'></div>").prependTo(j);a("<span class='ui-slider-label ui-slider-label-"+ -c+b+" ui-btn-corner-"+d+"' role='img'>"+a(this).getEncodedText()+"</span>").prependTo(q)}));i.addClass("ui-slider");d.addClass(g==="input"?"ui-slider-input":"ui-slider-switch").change(function(){b.mouseMoved||b.refresh(l(),true)}).keyup(function(){b.refresh(l(),true,true)}).blur(function(){b.refresh(l(),true)});a(document).bind("vmousemove",function(a){if(b.dragging)return b.mouseMoved=true,g==="select"&&q.removeClass("ui-slider-handle-snapping"),b.refresh(a),b.userModified=b.beforeStart!==d[0].selectedIndex, -false});j.bind("vmousedown",function(a){b.dragging=true;b.userModified=false;b.mouseMoved=false;if(g==="select")b.beforeStart=d[0].selectedIndex;b.refresh(a);return false});j.add(document).bind("vmouseup",function(){if(b.dragging)return b.dragging=false,g==="select"&&(q.addClass("ui-slider-handle-snapping"),b.mouseMoved?b.userModified?b.refresh(b.beforeStart==0?1:0):b.refresh(b.beforeStart):b.refresh(b.beforeStart==0?1:0)),b.mouseMoved=false});j.insertAfter(d);this.handle.bind("vmousedown",function(){a(this).focus()}).bind("vclick", -false);this.handle.bind("keydown",function(c){var d=l();if(!b.options.disabled){switch(c.keyCode){case a.mobile.keyCode.HOME:case a.mobile.keyCode.END:case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:if(c.preventDefault(),!b._keySliding)b._keySliding=true,a(this).addClass("ui-state-active")}switch(c.keyCode){case a.mobile.keyCode.HOME:b.refresh(o);break;case a.mobile.keyCode.END:b.refresh(m); -break;case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:b.refresh(d+p);break;case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:b.refresh(d-p)}}}).keyup(function(){if(b._keySliding)b._keySliding=false,a(this).removeClass("ui-state-active")});this.refresh(e,e,true)},refresh:function(a,d,f){(this.options.disabled||this.element.attr("disabled"))&&this.disable();var c=this.element,e,g=c[0].nodeName.toLowerCase(),i=g==="input"?parseFloat(c.attr("min")): -0,k=g==="input"?parseFloat(c.attr("max")):c.find("option").length-1;if(typeof a==="object"){if(!this.dragging||a.pageX<this.slider.offset().left-8||a.pageX>this.slider.offset().left+this.slider.width()+8)return;e=Math.round((a.pageX-this.slider.offset().left)/this.slider.width()*100)}else a==null&&(a=g==="input"?parseFloat(c.val()):c[0].selectedIndex),e=(parseFloat(a)-i)/(k-i)*100;if(!isNaN(e)&&(e<0&&(e=0),e>100&&(e=100),a=Math.round(e/100*(k-i))+i,a<i&&(a=i),a>k&&(a=k),this.handle.css("left",e+"%"), -this.handle.attr({"aria-valuenow":g==="input"?a:c.find("option").eq(a).attr("value"),"aria-valuetext":g==="input"?a:c.find("option").eq(a).getEncodedText(),title:a}),g==="select"&&(a===0?this.slider.addClass("ui-slider-switch-a").removeClass("ui-slider-switch-b"):this.slider.addClass("ui-slider-switch-b").removeClass("ui-slider-switch-a")),!f))f=false,g==="input"?(f=c.val()!==a,c.val(a)):(f=c[0].selectedIndex!==a,c[0].selectedIndex=a),!d&&f&&c.trigger("change")},enable:function(){this.element.attr("disabled", -false);this.slider.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.slider.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)}});a(document).bind("pagecreate create",function(b){a.mobile.slider.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a){a.widget("mobile.textinput",a.mobile.widget,{options:{theme:null,initSelector:"input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])"},_create:function(){var e=this.element, -b=this.options.theme||a.mobile.getInheritedTheme(this.element,"c"),d=" ui-body-"+b,f,c;a("label[for='"+e.attr("id")+"']").addClass("ui-input-text");f=e.addClass("ui-input-text ui-body-"+b);typeof e[0].autocorrect!=="undefined"&&!a.support.touchOverflow&&(e[0].setAttribute("autocorrect","off"),e[0].setAttribute("autocomplete","off"));e.is("[type='search'],:jqmData(type='search')")?(f=e.wrap("<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield"+d+"'></div>").parent(), -c=a("<a href='#' class='ui-input-clear' title='clear text'>clear text</a>").tap(function(a){e.val("").focus();e.trigger("change");c.addClass("ui-input-clear-hidden");a.preventDefault()}).appendTo(f).buttonMarkup({icon:"delete",iconpos:"notext",corners:true,shadow:true}),b=function(){setTimeout(function(){c.toggleClass("ui-input-clear-hidden",!e.val())},0)},b(),e.bind("paste cut keyup focus change blur",b)):e.addClass("ui-corner-all ui-shadow-inset"+d);e.focus(function(){f.addClass("ui-focus")}).blur(function(){f.removeClass("ui-focus")}); -if(e.is("textarea")){var h=function(){var a=e[0].scrollHeight;e[0].clientHeight<a&&e.height(a+15)},g;e.keyup(function(){clearTimeout(g);g=setTimeout(h,100)});a.trim(e.val())&&(a(window).load(h),a(document).one("pagechange",h))}},disable:function(){(this.element.attr("disabled",true).is("[type='search'],:jqmData(type='search')")?this.element.parent():this.element).addClass("ui-disabled")},enable:function(){(this.element.attr("disabled",false).is("[type='search'],:jqmData(type='search')")?this.element.parent(): -this.element).removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(e){a.mobile.textinput.prototype.enhanceWithin(e.target)})})(jQuery); -(function(a){var e=function(b){var d=b.selectID,f=b.label,c=b.select.closest(".ui-page"),e=a("<div>",{"class":"ui-selectmenu-screen ui-screen-hidden"}).appendTo(c),g=b._selectOptions(),i=b.isMultiple=b.select[0].multiple,k=d+"-button",l=d+"-menu",o=a("<div data-"+a.mobile.ns+"role='dialog' data-"+a.mobile.ns+"theme='"+b.options.theme+"' data-"+a.mobile.ns+"overlay-theme='"+b.options.overlayTheme+"'><div data-"+a.mobile.ns+"role='header'><div class='ui-title'>"+f.getEncodedText()+"</div></div><div data-"+ -a.mobile.ns+"role='content'></div></div>").appendTo(a.mobile.pageContainer).page(),m=a("<div>",{"class":"ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-"+b.options.overlayTheme+" "+a.mobile.defaultDialogTransition}).insertAfter(e),p=a("<ul>",{"class":"ui-selectmenu-list",id:l,role:"listbox","aria-labelledby":k}).attr("data-"+a.mobile.ns+"theme",b.options.theme).appendTo(m),j=a("<div>",{"class":"ui-header ui-bar-"+b.options.theme}).prependTo(m),q=a("<h1>",{"class":"ui-title"}).appendTo(j), -n=a("<a>",{text:b.options.closeText,href:"#","class":"ui-btn-left"}).attr("data-"+a.mobile.ns+"iconpos","notext").attr("data-"+a.mobile.ns+"icon","delete").appendTo(j).buttonMarkup(),A=o.find(".ui-content"),z=o.find(".ui-header a");a.extend(b,{select:b.select,selectID:d,buttonId:k,menuId:l,thisPage:c,menuPage:o,label:f,screen:e,selectOptions:g,isMultiple:i,theme:b.options.theme,listbox:m,list:p,header:j,headerTitle:q,headerClose:n,menuPageContent:A,menuPageClose:z,placeholder:"",build:function(){var b= -this;b.refresh();b.select.attr("tabindex","-1").focus(function(){a(this).blur();b.button.focus()});b.button.bind("vclick keydown",function(c){if(c.type=="vclick"||c.keyCode&&(c.keyCode===a.mobile.keyCode.ENTER||c.keyCode===a.mobile.keyCode.SPACE))b.open(),c.preventDefault()});b.list.attr("role","listbox").delegate(".ui-li>a","focusin",function(){a(this).attr("tabindex","0")}).delegate(".ui-li>a","focusout",function(){a(this).attr("tabindex","-1")}).delegate("li:not(.ui-disabled, .ui-li-divider)", -"click",function(c){var d=b.select[0].selectedIndex,f=b.list.find("li:not(.ui-li-divider)").index(this),e=b._selectOptions().eq(f)[0];e.selected=b.isMultiple?!e.selected:true;b.isMultiple&&a(this).find(".ui-icon").toggleClass("ui-icon-checkbox-on",e.selected).toggleClass("ui-icon-checkbox-off",!e.selected);(b.isMultiple||d!==f)&&b.select.trigger("change");b.isMultiple||b.close();c.preventDefault()}).keydown(function(b){var c=a(b.target),d=c.closest("li");switch(b.keyCode){case 38:return b=d.prev(), -b.length&&(c.blur().attr("tabindex","-1"),b.find("a").first().focus()),false;case 40:return b=d.next(),b.length&&(c.blur().attr("tabindex","-1"),b.find("a").first().focus()),false;case 13:case 32:return c.trigger("click"),false}});b.menuPage.bind("pagehide",function(){b.list.appendTo(b.listbox);b._focusButton();a.mobile._bindPageRemove.call(b.thisPage)});b.screen.bind("vclick",function(){b.close()});b.headerClose.click(function(){if(b.menuType=="overlay")return b.close(),false});b.thisPage.addDependents(this.menuPage)}, -_isRebuildRequired:function(){var a=this.list.find("li");return this._selectOptions().text()!==a.text()},refresh:function(b){var c=this;this._selectOptions();this.selected();var d=this.selectedIndices();(b||this._isRebuildRequired())&&c._buildList();c.setButtonText();c.setButtonCount();c.list.find("li:not(.ui-li-divider)").removeClass(a.mobile.activeBtnClass).attr("aria-selected",false).each(function(b){a.inArray(b,d)>-1&&(b=a(this),b.attr("aria-selected",true),c.isMultiple?b.find(".ui-icon").removeClass("ui-icon-checkbox-off").addClass("ui-icon-checkbox-on"): -b.addClass(a.mobile.activeBtnClass))})},close:function(){if(!this.options.disabled&&this.isOpen)this.menuType=="page"?window.history.back():(this.screen.addClass("ui-screen-hidden"),this.listbox.addClass("ui-selectmenu-hidden").removeAttr("style").removeClass("in"),this.list.appendTo(this.listbox),this._focusButton()),this.isOpen=false},open:function(){if(!this.options.disabled){var b=this,c=b.list.parent().outerHeight(),d=b.list.parent().outerWidth(),f=a(".ui-page-active"),e=a.support.touchOverflow&& -a.mobile.touchOverflowEnabled,f=f.is(".ui-native-fixed")?f.find(".ui-content"):f;scrollTop=e?f.scrollTop():a(window).scrollTop();btnOffset=b.button.offset().top;screenHeight=window.innerHeight;screenWidth=window.innerWidth;b.button.addClass(a.mobile.activeBtnClass);setTimeout(function(){b.button.removeClass(a.mobile.activeBtnClass)},300);if(c>screenHeight-80||!a.support.scrollTop){b.thisPage.unbind("pagehide.remove");if(scrollTop==0&&btnOffset>screenHeight)b.thisPage.one("pagehide",function(){a(this).jqmData("lastScroll", -btnOffset)});b.menuPage.one("pageshow",function(){a(window).one("silentscroll",function(){b.list.find(a.mobile.activeBtnClass).focus()});b.isOpen=true});b.menuType="page";b.menuPageContent.append(b.list);b.menuPage.find("div .ui-title").text(b.label.text());a.mobile.changePage(b.menuPage,{transition:a.mobile.defaultDialogTransition})}else{b.menuType="overlay";b.screen.height(a(document).height()).removeClass("ui-screen-hidden");var f=btnOffset-scrollTop,h=scrollTop+screenHeight-btnOffset,g=c/2,e= -parseFloat(b.list.parent().css("max-width")),c=f>c/2&&h>c/2?btnOffset+b.button.outerHeight()/2-g:f>h?scrollTop+screenHeight-c-30:scrollTop+30;d<e?e=(screenWidth-d)/2:(e=b.button.offset().left+b.button.outerWidth()/2-d/2,e<30?e=30:e+d>screenWidth&&(e=screenWidth-d-30));b.listbox.append(b.list).removeClass("ui-selectmenu-hidden").css({top:c,left:e}).addClass("in");b.list.find(a.mobile.activeBtnClass).focus();b.isOpen=true}}},_buildList:function(){var b=this,c=this.options,d=this.placeholder,f=[],e= -[],h=b.isMultiple?"checkbox-off":"false";b.list.empty().filter(".ui-listview").listview("destroy");b.select.find("option").each(function(g){var j=a(this),i=j.parent(),m=j.getEncodedText(),p="<a href='#'>"+m+"</a>",k=[],n=[];i.is("optgroup")&&(i=i.attr("label"),a.inArray(i,f)===-1&&(e.push("<li data-"+a.mobile.ns+"role='list-divider'>"+i+"</li>"),f.push(i)));if(!this.getAttribute("value")||m.length==0||j.jqmData("placeholder"))c.hidePlaceholderMenuItems&&k.push("ui-selectmenu-placeholder"),d=b.placeholder= -m;this.disabled&&(k.push("ui-disabled"),n.push("aria-disabled='true'"));e.push("<li data-"+a.mobile.ns+"option-index='"+g+"' data-"+a.mobile.ns+"icon='"+h+"' class='"+k.join(" ")+"' "+n.join(" ")+">"+p+"</li>")});b.list.html(e.join(" "));b.list.find("li").attr({role:"option",tabindex:"-1"}).first().attr("tabindex","0");this.isMultiple||this.headerClose.hide();!this.isMultiple&&!d.length?this.header.hide():this.headerTitle.text(this.placeholder);b.list.listview()},_button:function(){return a("<a>", -{href:"#",role:"button",id:this.buttonId,"aria-haspopup":"true","aria-owns":this.menuId})}})};a("select").live("selectmenubeforecreate",function(){var b=a(this).data("selectmenu");b.options.nativeMenu||e(b)})})(jQuery); -(function(a){a.widget("mobile.selectmenu",a.mobile.widget,{options:{theme:null,disabled:false,icon:"arrow-d",iconpos:"right",inline:null,corners:true,shadow:true,iconshadow:true,menuPageTheme:"b",overlayTheme:"a",hidePlaceholderMenuItems:true,closeText:"Close",nativeMenu:true,initSelector:"select:not(:jqmData(role='slider'))"},_button:function(){return a("<div/>")},_setDisabled:function(a){this.element.attr("disabled",a);this.button.attr("aria-disabled",a);return this._setOption("disabled",a)},_focusButton:function(){var a= -this;setTimeout(function(){a.button.focus()},40)},_selectOptions:function(){return this.select.find("option")},_preExtension:function(){this.select=this.element.wrap("<div class='ui-select'>");this.selectID=this.select.attr("id");this.label=a("label[for='"+this.selectID+"']").addClass("ui-select");this.isMultiple=this.select[0].multiple;if(!this.options.theme)this.options.theme=a.mobile.getInheritedTheme(this.select,"c")},_create:function(){this._preExtension();this._trigger("beforeCreate");this.button= -this._button();var e=this,b=this.options,d=this.button.text(a(this.select[0].options.item(this.select[0].selectedIndex==-1?0:this.select[0].selectedIndex)).text()).insertBefore(this.select).buttonMarkup({theme:b.theme,icon:b.icon,iconpos:b.iconpos,inline:b.inline,corners:b.corners,shadow:b.shadow,iconshadow:b.iconshadow});b.nativeMenu&&window.opera&&window.opera.version&&this.select.addClass("ui-select-nativeonly");if(this.isMultiple)this.buttonCount=a("<span>").addClass("ui-li-count ui-btn-up-c ui-btn-corner-all").hide().appendTo(d.addClass("ui-li-has-count")); -(b.disabled||this.element.attr("disabled"))&&this.disable();this.select.change(function(){e.refresh()});this.build()},build:function(){var e=this;this.select.appendTo(e.button).bind("vmousedown",function(){e.button.addClass(a.mobile.activeBtnClass)}).bind("focus vmouseover",function(){e.button.trigger("vmouseover")}).bind("vmousemove",function(){e.button.removeClass(a.mobile.activeBtnClass)}).bind("change blur vmouseout",function(){e.button.trigger("vmouseout").removeClass(a.mobile.activeBtnClass)}).bind("change blur", -function(){e.button.removeClass("ui-btn-down-"+e.options.theme)})},selected:function(){return this._selectOptions().filter(":selected")},selectedIndices:function(){var a=this;return this.selected().map(function(){return a._selectOptions().index(this)}).get()},setButtonText:function(){var e=this,b=this.selected();this.button.find(".ui-btn-text").text(function(){return!e.isMultiple?b.text():b.length?b.map(function(){return a(this).text()}).get().join(", "):e.placeholder})},setButtonCount:function(){var a= -this.selected();this.isMultiple&&this.buttonCount[a.length>1?"show":"hide"]().text(a.length)},refresh:function(){this.setButtonText();this.setButtonCount()},open:a.noop,close:a.noop,disable:function(){this._setDisabled(true);this.button.addClass("ui-disabled")},enable:function(){this._setDisabled(false);this.button.removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(e){a.mobile.selectmenu.prototype.enhanceWithin(e.target)})})(jQuery); -(function(a,e){function b(b){for(var c;b;){if((c=typeof b.className==="string"&&b.className.split(" "))&&a.inArray("ui-btn",c)>-1&&a.inArray("ui-disabled",c)<0)break;b=b.parentNode}return b}a.fn.buttonMarkup=function(b){for(var b=b||{},c=0;c<this.length;c++){var h=this.eq(c),g=h[0],i=a.extend({},a.fn.buttonMarkup.defaults,{icon:b.icon!==e?b.icon:h.jqmData("icon"),iconpos:b.iconpos!==e?b.iconpos:h.jqmData("iconpos"),theme:b.theme!==e?b.theme:h.jqmData("theme"),inline:b.inline!==e?b.inline:h.jqmData("inline"), -shadow:b.shadow!==e?b.shadow:h.jqmData("shadow"),corners:b.corners!==e?b.corners:h.jqmData("corners"),iconshadow:b.iconshadow!==e?b.iconshadow:h.jqmData("iconshadow")},b),k="ui-btn-inner",l,o,m=document.createElement(i.wrapperEls),p=document.createElement(i.wrapperEls),j=i.icon?document.createElement("span"):null;d&&d();if(!i.theme)i.theme=a.mobile.getInheritedTheme(h,"c");l="ui-btn ui-btn-up-"+i.theme;i.inline&&(l+=" ui-btn-inline");if(i.icon)i.icon="ui-icon-"+i.icon,i.iconpos=i.iconpos||"left", -o="ui-icon "+i.icon,i.iconshadow&&(o+=" ui-icon-shadow");i.iconpos&&(l+=" ui-btn-icon-"+i.iconpos,i.iconpos=="notext"&&!h.attr("title")&&h.attr("title",h.getEncodedText()));i.corners&&(l+=" ui-btn-corner-all",k+=" ui-btn-corner-all");i.shadow&&(l+=" ui-shadow");g.setAttribute("data-"+a.mobile.ns+"theme",i.theme);h.addClass(l);m.className=k;m.setAttribute("aria-hidden","true");p.className="ui-btn-text";m.appendChild(p);if(j)j.className=o,m.appendChild(j);for(;g.firstChild;)p.appendChild(g.firstChild); -g.appendChild(m);a.data(g,"textWrapper",a(p))}return this};a.fn.buttonMarkup.defaults={corners:true,shadow:true,iconshadow:true,inline:false,wrapperEls:"span"};var d=function(){a(document).bind({vmousedown:function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-up-"+c).addClass("ui-btn-down-"+c))},"vmousecancel vmouseup":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-down-"+c).addClass("ui-btn-up-"+ -c))},"vmouseover focus":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-up-"+c).addClass("ui-btn-hover-"+c))},"vmouseout blur":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-hover-"+c+" ui-btn-down-"+c).addClass("ui-btn-up-"+c))}});d=null};a(document).bind("pagecreate create",function(b){a(":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", -b.target).not(".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')").buttonMarkup()})})(jQuery); -(function(a){a.fn.controlgroup=function(e){return this.each(function(){function b(a){a.removeClass("ui-btn-corner-all ui-shadow").eq(0).addClass(h[0]).end().last().addClass(h[1]).addClass("ui-controlgroup-last")}var d=a(this),f=a.extend({direction:d.jqmData("type")||"vertical",shadow:false,excludeInvisible:true},e),c=d.children("legend"),h=f.direction=="horizontal"?["ui-corner-left","ui-corner-right"]:["ui-corner-top","ui-corner-bottom"];d.find("input").first().attr("type");c.length&&(d.wrapInner("<div class='ui-controlgroup-controls'></div>"), -a("<div role='heading' class='ui-controlgroup-label'>"+c.html()+"</div>").insertBefore(d.children(0)),c.remove());d.addClass("ui-corner-all ui-controlgroup ui-controlgroup-"+f.direction);b(d.find(".ui-btn"+(f.excludeInvisible?":visible":"")));b(d.find(".ui-btn-inner"));f.shadow&&d.addClass("ui-shadow")})};a(document).bind("pagecreate create",function(e){a(":jqmData(role='controlgroup')",e.target).controlgroup({excludeInvisible:false})})})(jQuery); -(function(a){a(document).bind("pagecreate create",function(e){a(e.target).find("a").not(".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')").addClass("ui-link")})})(jQuery); -(function(a,e){a.fn.fixHeaderFooter=function(){return!a.support.scrollTop||a.support.touchOverflow&&a.mobile.touchOverflowEnabled?this:this.each(function(){var b=a(this);b.jqmData("fullscreen")&&b.addClass("ui-page-fullscreen");b.find(".ui-header:jqmData(position='fixed')").addClass("ui-header-fixed ui-fixed-inline fade");b.find(".ui-footer:jqmData(position='fixed')").addClass("ui-footer-fixed ui-fixed-inline fade")})};a.mobile.fixedToolbars=function(){function b(){!i&&g==="overlay"&&(h||a.mobile.fixedToolbars.hide(true), -a.mobile.fixedToolbars.startShowTimer())}function d(a){var b=0,c,d;if(a){d=document.body;c=a.offsetParent;for(b=a.offsetTop;a&&a!=d;){b+=a.scrollTop||0;if(a==c)b+=c.offsetTop,c=a.offsetParent;a=a.parentNode}}return b}function f(b){var c=a(window).scrollTop(),e=d(b[0]),f=b.css("top")=="auto"?0:parseFloat(b.css("top")),h=window.innerHeight,g=b.outerHeight(),i=b.parents(".ui-page:not(.ui-page-fullscreen)").length;return b.is(".ui-header-fixed")?(f=c-e+f,f<e&&(f=0),b.css("top",i?f:c)):b.css("top",i?c+ -h-g-(e-f):c+h-g)}if(a.support.scrollTop&&(!a.support.touchOverflow||!a.mobile.touchOverflowEnabled)){var c,h,g="inline",i=false,k=null,l=false,o=true;a(function(){var c=a(document),d=a(window);c.bind("vmousedown",function(){o&&(k=g)}).bind("vclick",function(b){o&&!a(b.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length&&!l&&(a.mobile.fixedToolbars.toggle(k),k=null)}).bind("silentscroll",b);(c.scrollTop()===0?d:c).bind("scrollstart",function(){l=true;k=== -null&&(k=g);var b=k=="overlay";if(i=b||!!h)a.mobile.fixedToolbars.clearShowTimer(),b&&a.mobile.fixedToolbars.hide(true)}).bind("scrollstop",function(b){a(b.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length||(l=false,i&&(a.mobile.fixedToolbars.startShowTimer(),i=false),k=null)});d.bind("resize updatelayout",b)});a(".ui-page").live("pagebeforeshow",function(b,d){var e=a(b.target).find(":jqmData(role='footer')"),h=e.data("id"),g=d.prevPage,g=g&&g.find(":jqmData(role='footer')"), -g=g.length&&g.jqmData("id")===h;h&&g&&(c=e,f(c.removeClass("fade in out").appendTo(a.mobile.pageContainer)))}).live("pageshow",function(){var b=a(this);c&&c.length&&setTimeout(function(){f(c.appendTo(b).addClass("fade"));c=null},500);a.mobile.fixedToolbars.show(true,this)});a(".ui-collapsible-contain").live("collapse expand",b);return{show:function(b,c){a.mobile.fixedToolbars.clearShowTimer();g="overlay";return(c?a(c):a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var c= -a(this),e=a(window).scrollTop(),h=d(c[0]),g=window.innerHeight,i=c.outerHeight(),e=c.is(".ui-header-fixed")&&e<=h+i||c.is(".ui-footer-fixed")&&h<=e+g;c.addClass("ui-fixed-overlay").removeClass("ui-fixed-inline");!e&&!b&&c.animationComplete(function(){c.removeClass("in")}).addClass("in");f(c)})},hide:function(b){g="inline";return(a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var c=a(this), -d=c.css("top"),d=d=="auto"?0:parseFloat(d);c.addClass("ui-fixed-inline").removeClass("ui-fixed-overlay");if(d<0||c.is(".ui-header-fixed")&&d!==0)b?c.css("top",0):c.css("top")!=="auto"&&parseFloat(c.css("top"))!==0&&c.animationComplete(function(){c.removeClass("out reverse").css("top",0)}).addClass("out reverse")})},startShowTimer:function(){a.mobile.fixedToolbars.clearShowTimer();var b=[].slice.call(arguments);h=setTimeout(function(){h=e;a.mobile.fixedToolbars.show.apply(null,b)},100)},clearShowTimer:function(){h&& -clearTimeout(h);h=e},toggle:function(b){b&&(g=b);return g==="overlay"?a.mobile.fixedToolbars.hide():a.mobile.fixedToolbars.show()},setTouchToggleEnabled:function(a){o=a}}}}();a(document).bind("pagecreate create",function(b){a(":jqmData(position='fixed')",b.target).length&&a(b.target).each(function(){if(!a.support.scrollTop||a.support.touchOverflow&&a.mobile.touchOverflowEnabled)return this;var b=a(this);b.jqmData("fullscreen")&&b.addClass("ui-page-fullscreen");b.find(".ui-header:jqmData(position='fixed')").addClass("ui-header-fixed ui-fixed-inline fade"); -b.find(".ui-footer:jqmData(position='fixed')").addClass("ui-footer-fixed ui-fixed-inline fade")})})})(jQuery); -(function(a){a.mobile.touchOverflowEnabled=false;a.mobile.touchOverflowZoomEnabled=false;a(document).bind("pagecreate",function(e){a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&(e=a(e.target),e.is(":jqmData(role='page')")&&e.each(function(){var b=a(this),d=b.find(":jqmData(role='header'), :jqmData(role='footer')").filter(":jqmData(position='fixed')"),e=b.jqmData("fullscreen"),c=d.length?b.find(".ui-content"):b;b.addClass("ui-mobile-touch-overflow");c.bind("scrollstop",function(){c.scrollTop()> -0&&window.scrollTo(0,a.mobile.defaultHomeScroll)});d.length&&(b.addClass("ui-native-fixed"),e&&(b.addClass("ui-native-fullscreen"),d.addClass("fade in"),a(document).bind("vclick",function(){d.removeClass("ui-native-bars-hidden").toggleClass("in out").animationComplete(function(){a(this).not(".in").addClass("ui-native-bars-hidden")})})))}))})})(jQuery); -(function(a,e){function b(){var b=a("meta[name='viewport']");b.length?b.attr("content",b.attr("content")+", user-scalable=no"):a("head").prepend("<meta>",{name:"viewport",content:"user-scalable=no"})}var d=a("html");a("head");var f=a(e);a(e.document).trigger("mobileinit");if(a.mobile.gradeA()){if(a.mobile.ajaxBlacklist)a.mobile.ajaxEnabled=false;d.addClass("ui-mobile ui-mobile-rendering");var c=a("<div class='ui-loader ui-body-a ui-corner-all'><span class='ui-icon ui-icon-loading spin'></span><h1></h1></div>"); -a.extend(a.mobile,{showPageLoadingMsg:function(){if(a.mobile.loadingMessage){var b=a("."+a.mobile.activeBtnClass).first();c.find("h1").text(a.mobile.loadingMessage).end().appendTo(a.mobile.pageContainer).css({top:a.support.scrollTop&&f.scrollTop()+f.height()/2||b.length&&b.offset().top||100})}d.addClass("ui-loading")},hidePageLoadingMsg:function(){d.removeClass("ui-loading")},initializePage:function(){var b=a(":jqmData(role='page')");b.length||(b=a("body").wrapInner("<div data-"+a.mobile.ns+"role='page'></div>").children(0)); -b.add(":jqmData(role='dialog')").each(function(){var b=a(this);b.jqmData("url")||b.attr("data-"+a.mobile.ns+"url",b.attr("id")||location.pathname+location.search)});a.mobile.firstPage=b.first();a.mobile.pageContainer=b.first().parent().addClass("ui-mobile-viewport");f.trigger("pagecontainercreate");a.mobile.showPageLoadingMsg();!a.mobile.hashListeningEnabled||!a.mobile.path.stripHash(location.hash)?a.mobile.changePage(a.mobile.firstPage,{transition:"none",reverse:true,changeHash:false,fromHashChange:true}): -f.trigger("hashchange",[true])}});a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&!a.mobile.touchOverflowZoomEnabled&&b();a.mobile._registerInternalEvents();a(function(){e.scrollTo(0,1);a.mobile.defaultHomeScroll=!a.support.scrollTop||a(e).scrollTop()===1?0:1;a.mobile.autoInitializePage&&a.mobile.initializePage();f.load(a.mobile.silentScroll)})}})(jQuery,this); diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.0.css b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.css index 5d34136..06dbf8f 100644 --- a/h-source/Public/Js/jquery/jquery.mobile-1.0.css +++ b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.css @@ -1,5 +1,5 @@ /* -* jQuery Mobile Framework 1.0 +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 * http://jquerymobile.com * * Copyright 2011 (c) jQuery Project @@ -8,22 +8,20 @@ * */ /* Swatches */ - /* A -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-a { - border: 1px solid #2A2A2A /*{a-bar-border}*/; + border: 1px solid #333 /*{a-bar-border}*/; background: #111111 /*{a-bar-background-color}*/; color: #ffffff /*{a-bar-color}*/; font-weight: bold; text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000000 /*{a-bar-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #3c3c3c /*{a-bar-background-start}*/), to( #111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); + background-image: -webkit-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); } .ui-bar-a, .ui-bar-a input, @@ -35,36 +33,36 @@ .ui-bar-a .ui-link-inherit { color: #fff /*{a-bar-color}*/; } - .ui-bar-a .ui-link { color: #7cc4e7 /*{a-bar-link-color}*/; font-weight: bold; } - .ui-bar-a .ui-link:hover { color: #2489CE /*{a-bar-link-hover}*/; } - .ui-bar-a .ui-link:active { color: #2489CE /*{a-bar-link-active}*/; } - .ui-bar-a .ui-link:visited { color: #2489CE /*{a-bar-link-visited}*/; } .ui-body-a, -.ui-dialog.ui-overlay-a { - border: 1px solid #2A2A2A /*{a-body-border}*/; - background: #222222 /*{a-body-background-color}*/; +.ui-overlay-a { + border: 1px solid #444 /*{a-body-border}*/; + background: #222 /*{a-body-background-color}*/; color: #fff /*{a-body-color}*/; - text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #000 /*{a-body-shadow-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 1px /*{a-body-shadow-radius}*/ #111 /*{a-body-shadow-color}*/; font-weight: normal; - background-image: -webkit-gradient(linear, left top, left bottom, from( #666 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #444 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; } .ui-body-a, .ui-body-a input, @@ -76,36 +74,31 @@ .ui-body-a .ui-link-inherit { color: #fff /*{a-body-color}*/; } - .ui-body-a .ui-link { color: #2489CE /*{a-body-link-color}*/; font-weight: bold; } - .ui-body-a .ui-link:hover { color: #2489CE /*{a-body-link-hover}*/; } - .ui-body-a .ui-link:active { color: #2489CE /*{a-body-link-active}*/; } - .ui-body-a .ui-link:visited { color: #2489CE /*{a-body-link-visited}*/; } - .ui-btn-up-a { - border: 1px solid #222 /*{a-bup-border}*/; - background: #333333 /*{a-bup-background-color}*/; + border: 1px solid #111 /*{a-bup-border}*/; + background: #333 /*{a-bup-background-color}*/; font-weight: bold; color: #fff /*{a-bup-color}*/; - text-shadow: 0 /*{a-bup-shadow-x}*/ -1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #000 /*{a-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #555 /*{a-bup-background-start}*/), to( #333 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #111 /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444444 /*{a-bup-background-start}*/), to( #2d2d2d /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); } .ui-btn-up-a a.ui-link-inherit { color: #fff /*{a-bup-color}*/; @@ -115,29 +108,29 @@ background: #444444 /*{a-bhover-background-color}*/; font-weight: bold; color: #fff /*{a-bhover-color}*/; - text-shadow: 0 /*{a-bhover-shadow-x}*/ -1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #000 /*{a-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #666 /*{a-bhover-background-start}*/), to( #444 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #111 /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #555555 /*{a-bhover-background-start}*/), to( #383838 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); } .ui-btn-hover-a a.ui-link-inherit { color: #fff /*{a-bhover-color}*/; } .ui-btn-down-a { border: 1px solid #000 /*{a-bdown-border}*/; - background: #3d3d3d /*{a-bdown-background-color}*/; + background: #222 /*{a-bdown-background-color}*/; font-weight: bold; color: #fff /*{a-bdown-color}*/; - text-shadow: 0 /*{a-bdown-shadow-x}*/ -1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #000 /*{a-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #333 /*{a-bdown-background-start}*/), to( #5a5a5a /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #111 /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #202020 /*{a-bdown-background-start}*/), to( #2c2c2c /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); } .ui-btn-down-a a.ui-link-inherit { color: #fff /*{a-bdown-color}*/; @@ -148,23 +141,20 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* B -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-b { border: 1px solid #456f9a /*{b-bar-border}*/; background: #5e87b0 /*{b-bar-background-color}*/; color: #fff /*{b-bar-color}*/; font-weight: bold; - text-shadow: 0 /*{b-bar-shadow-x}*/ -1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #254f7a /*{b-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #81a8ce /*{b-bar-background-start}*/), to( #5e87b0 /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #3e6790 /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bar-background-start}*/), to( #497bae /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); } .ui-bar-b, .ui-bar-b input, @@ -180,31 +170,32 @@ color: #ddf0f8 /*{b-bar-link-color}*/; font-weight: bold; } - .ui-bar-b .ui-link:hover { color: #ddf0f8 /*{b-bar-link-hover}*/; } - .ui-bar-b .ui-link:active { color: #ddf0f8 /*{b-bar-link-active}*/; } - .ui-bar-b .ui-link:visited { color: #ddf0f8 /*{b-bar-link-visited}*/; } .ui-body-b, -.ui-dialog.ui-overlay-b { - border: 1px solid #C6C6C6 /*{b-body-border}*/; - background: #cccccc /*{b-body-background-color}*/; - color: #333333 /*{b-body-color}*/; +.ui-overlay-b { + border: 1px solid #999 /*{b-body-border}*/; + background: #f3f3f3 /*{b-body-background-color}*/; + color: #222222 /*{b-body-color}*/; text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/; font-weight: normal; - background-image: -webkit-gradient(linear, left top, left bottom, from( #e6e6e6 /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; } .ui-body-b, .ui-body-b input, @@ -216,52 +207,47 @@ .ui-body-b .ui-link-inherit { color: #333333 /*{b-body-color}*/; } - .ui-body-b .ui-link { color: #2489CE /*{b-body-link-color}*/; font-weight: bold; } - .ui-body-b .ui-link:hover { color: #2489CE /*{b-body-link-hover}*/; } - .ui-body-b .ui-link:active { color: #2489CE /*{b-body-link-active}*/; } - .ui-body-b .ui-link:visited { color: #2489CE /*{b-body-link-visited}*/; } - .ui-btn-up-b { - border: 1px solid #145072 /*{b-bup-border}*/; - background: #2567ab /*{b-bup-background-color}*/; + border: 1px solid #044062 /*{b-bup-border}*/; + background: #396b9e /*{b-bup-background-color}*/; font-weight: bold; color: #fff /*{b-bup-color}*/; - text-shadow: 0 /*{b-bup-shadow-x}*/ -1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #145072 /*{b-bup-shadow-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #194b7e /*{b-bup-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #5f9cc5 /*{b-bup-background-start}*/), to( #396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); + background-image: -webkit-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); } .ui-btn-up-b a.ui-link-inherit { color: #fff /*{b-bup-color}*/; } .ui-btn-hover-b { - border: 1px solid #00516e /*{b-bhover-border}*/; + border: 1px solid #00415e /*{b-bhover-border}*/; background: #4b88b6 /*{b-bhover-background-color}*/; font-weight: bold; color: #fff /*{b-bhover-color}*/; - text-shadow: 0 /*{b-bhover-shadow-x}*/ -1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #014D68 /*{b-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #72b0d4 /*{b-bhover-background-start}*/), to( #4b88b6 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #194b7e /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bhover-background-start}*/), to( #4272a4 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); } .ui-btn-hover-b a.ui-link-inherit { color: #fff /*{b-bhover-color}*/; @@ -271,13 +257,13 @@ background: #4e89c5 /*{b-bdown-background-color}*/; font-weight: bold; color: #fff /*{b-bdown-color}*/; - text-shadow: 0 /*{b-bdown-shadow-x}*/ -1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #225377 /*{b-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #396b9e /*{b-bdown-background-start}*/), to( #4e89c5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #194b7e /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #295b8e /*{b-bdown-background-start}*/), to( #3e79b5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); } .ui-btn-down-b a.ui-link-inherit { color: #fff /*{b-bdown-color}*/; @@ -288,25 +274,21 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* C -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-c { border: 1px solid #B3B3B3 /*{c-bar-border}*/; - background: #e9eaeb /*{c-bar-background-color}*/; + background: #eeeeee /*{c-bar-background-color}*/; color: #3E3E3E /*{c-bar-color}*/; font-weight: bold; text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #e9eaeb /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); -} - + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #ddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); +} .ui-bar-c .ui-link-inherit { color: #3E3E3E /*{c-bar-color}*/; } @@ -314,19 +296,15 @@ color: #7cc4e7 /*{c-bar-link-color}*/; font-weight: bold; } - .ui-bar-c .ui-link:hover { color: #2489CE /*{c-bar-link-hover}*/; } - .ui-bar-c .ui-link:active { color: #2489CE /*{c-bar-link-active}*/; } - .ui-bar-c .ui-link:visited { color: #2489CE /*{c-bar-link-visited}*/; } - .ui-bar-c, .ui-bar-c input, .ui-bar-c select, @@ -335,17 +313,21 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } .ui-body-c, -.ui-dialog.ui-overlay-c { - border: 1px solid #B3B3B3 /*{c-body-border}*/; +.ui-overlay-c { + border: 1px solid #aaa /*{c-body-border}*/; color: #333333 /*{c-body-color}*/; text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/; - background: #f0f0f0 /*{c-body-background-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{c-body-background-start}*/), to( #ddd /*{c-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eeeeee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; } .ui-body-c, .ui-body-c input, @@ -354,73 +336,66 @@ .ui-body-c button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-body-c .ui-link-inherit { color: #333333 /*{c-body-color}*/; } - .ui-body-c .ui-link { color: #2489CE /*{c-body-link-color}*/; font-weight: bold; } - .ui-body-c .ui-link:hover { color: #2489CE /*{c-body-link-hover}*/; } - .ui-body-c .ui-link:active { color: #2489CE /*{c-body-link-active}*/; } - .ui-body-c .ui-link:visited { color: #2489CE /*{c-body-link-visited}*/; } - .ui-btn-up-c { border: 1px solid #ccc /*{c-bup-border}*/; background: #eee /*{c-bup-background-color}*/; font-weight: bold; - color: #444 /*{c-bup-color}*/; - text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 1px /*{c-bup-shadow-radius}*/ #f6f6f6 /*{c-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fdfdfd /*{c-bup-background-start}*/), to( #eee /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); + color: #222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #ffffff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); } .ui-btn-up-c a.ui-link-inherit { color: #2F3E46 /*{c-bup-color}*/; } - .ui-btn-hover-c { - border: 1px solid #bbbbbb /*{c-bhover-border}*/; - background: #dadada /*{c-bhover-background-color}*/; + border: 1px solid #bbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; font-weight: bold; - color: #101010 /*{c-bhover-color}*/; - text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 1px /*{c-bhover-shadow-radius}*/ #fff /*{c-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #ededed /*{c-bhover-background-start}*/), to( #dadada /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); + color: #222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #ffffff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); } .ui-btn-hover-c a.ui-link-inherit { color: #2F3E46 /*{c-bhover-color}*/; } .ui-btn-down-c { - border: 1px solid #808080 /*{c-bdown-border}*/; - background: #fdfdfd /*{c-bdown-background-color}*/; + border: 1px solid #bbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; font-weight: bold; - color: #111111 /*{c-bdown-color}*/; - text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 1px /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{c-bdown-background-start}*/), to( #fdfdfd /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); + color: #222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); } .ui-btn-down-c a.ui-link-inherit { color: #2F3E46 /*{c-bdown-color}*/; @@ -431,22 +406,19 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* D -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-d { - border: 1px solid #ccc /*{d-bar-border}*/; + border: 1px solid #bbb /*{d-bar-border}*/; background: #bbb /*{d-bar-background-color}*/; color: #333 /*{d-bar-color}*/; text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{d-bar-background-start}*/), to( #bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); + background-image: -webkit-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); } .ui-bar-d, .ui-bar-d input, @@ -455,7 +427,6 @@ .ui-bar-d button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-bar-d .ui-link-inherit { color: #333333 /*{d-bar-color}*/; } @@ -463,31 +434,31 @@ color: #2489CE /*{d-bar-link-color}*/; font-weight: bold; } - .ui-bar-d .ui-link:hover { color: #2489CE /*{d-bar-link-hover}*/; } - .ui-bar-d .ui-link:active { color: #2489CE /*{d-bar-link-active}*/; } - .ui-bar-d .ui-link:visited { color: #2489CE /*{d-bar-link-visited}*/; } - .ui-body-d, -.ui-dialog.ui-overlay-d { - border: 1px solid #ccc /*{d-body-border}*/; +.ui-overlay-d { + border: 1px solid #bbb /*{d-body-border}*/; color: #333333 /*{d-body-color}*/; text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/; background: #ffffff /*{d-body-background-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #fff), to( #fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); + background-image: -webkit-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); +} +.ui-overlay-d { + background-image: none; + border-width: 0; } .ui-body-d, .ui-body-d input, @@ -496,40 +467,34 @@ .ui-body-d button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-body-d .ui-link-inherit { color: #333333 /*{d-body-color}*/; } - .ui-body-d .ui-link { color: #2489CE /*{d-body-link-color}*/; font-weight: bold; } - .ui-body-d .ui-link:hover { color: #2489CE /*{d-body-link-hover}*/; } - .ui-body-d .ui-link:active { color: #2489CE /*{d-body-link-active}*/; } - .ui-body-d .ui-link:visited { color: #2489CE /*{d-body-link-visited}*/; } - .ui-btn-up-d { - border: 1px solid #ccc /*{d-bup-border}*/; + border: 1px solid #bbb /*{d-bup-border}*/; background: #fff /*{d-bup-background-color}*/; font-weight: bold; - color: #444 /*{d-bup-color}*/; - text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 1px /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fff), to( #fff /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); + color: #333 /*{d-bup-color}*/; + text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 0 /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fafafa), to( #f6f6f6 /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); } .ui-btn-up-d a.ui-link-inherit { color: #333 /*{d-bup-color}*/; @@ -538,34 +503,34 @@ border: 1px solid #aaa /*{d-bhover-border}*/; background: #eeeeee /*{d-bhover-background-color}*/; font-weight: bold; - color: #222 /*{d-bhover-color}*/; + color: #333 /*{d-bhover-color}*/; cursor: pointer; - text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 1px /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fdfdfd), to( #eee /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); + text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 0 /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #eee), to( #fff /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); } .ui-btn-hover-d a.ui-link-inherit { - color: #222 /*{d-bhover-color}*/; + color: #333 /*{d-bhover-color}*/; } .ui-btn-down-d { - border: 1px solid #aaaaaa /*{d-bdown-border}*/; - background: #ffffff /*{d-bdown-background-color}*/; + border: 1px solid #aaa /*{d-bdown-border}*/; + background: #eee /*{d-bdown-background-color}*/; font-weight: bold; - color: #111 /*{d-bdown-color}*/; - text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 1px /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{d-bdown-background-start}*/), to( #fff /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); + color: #333 /*{d-bdown-color}*/; + text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 0 /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #e5e5e5 /*{d-bdown-background-start}*/), to( #f2f2f2 /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); } .ui-btn-down-d a.ui-link-inherit { - color: #111 /*{d-bdown-color}*/; + color: #333 /*{d-bdown-color}*/; } .ui-btn-up-d, .ui-btn-hover-d, @@ -573,22 +538,19 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* E -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-e { border: 1px solid #F7C942 /*{e-bar-border}*/; background: #fadb4e /*{e-bar-background-color}*/; color: #333 /*{e-bar-color}*/; text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fadb4e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fbef7e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); } .ui-bar-e, .ui-bar-e input, @@ -604,31 +566,31 @@ color: #2489CE /*{e-bar-link-color}*/; font-weight: bold; } - .ui-bar-e .ui-link:hover { color: #2489CE /*{e-bar-link-hover}*/; } - .ui-bar-e .ui-link:active { color: #2489CE /*{e-bar-link-active}*/; } - .ui-bar-e .ui-link:visited { color: #2489CE /*{e-bar-link-visited}*/; } - .ui-body-e, -.ui-dialog.ui-overlay-e { +.ui-overlay-e { border: 1px solid #F7C942 /*{e-body-border}*/; - color: #333333 /*{e-body-color}*/; + color: #222222 /*{e-body-color}*/; text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/; - background: #faeb9e /*{e-body-background-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fff /*{e-body-background-start}*/), to( #faeb9e /*{e-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); + background: #fff9df /*{e-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fffadf /*{e-body-background-start}*/), to( #fff3a5 /*{e-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); +} +.ui-overlay-e { + background-image: none; + border-width: 0; } .ui-body-e, .ui-body-e input, @@ -640,69 +602,63 @@ .ui-body-e .ui-link-inherit { color: #333333 /*{e-body-color}*/; } - .ui-body-e .ui-link { color: #2489CE /*{e-body-link-color}*/; font-weight: bold; } - .ui-body-e .ui-link:hover { color: #2489CE /*{e-body-link-hover}*/; } - .ui-body-e .ui-link:active { color: #2489CE /*{e-body-link-active}*/; } - .ui-body-e .ui-link:visited { color: #2489CE /*{e-body-link-visited}*/; } - .ui-btn-up-e { - border: 1px solid #F7C942 /*{e-bup-border}*/; + border: 1px solid #F4C63f /*{e-bup-border}*/; background: #fadb4e /*{e-bup-background-color}*/; font-weight: bold; - color: #333 /*{e-bup-color}*/; + color: #222 /*{e-bup-color}*/; text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bup-background-start}*/), to( #fadb4e /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffefaa /*{e-bup-background-start}*/), to( #ffe155 /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); } .ui-btn-up-e a.ui-link-inherit { - color: #333 /*{e-bup-color}*/; + color: #222 /*{e-bup-color}*/; } .ui-btn-hover-e { - border: 1px solid #e79952 /*{e-bhover-border}*/; + border: 1px solid #F2C43d /*{e-bhover-border}*/; background: #fbe26f /*{e-bhover-background-color}*/; font-weight: bold; color: #111 /*{e-bhover-color}*/; - text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 1px /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fcf0b5 /*{e-bhover-background-start}*/), to( #fbe26f /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); -} - + text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 0 /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff5ba /*{e-bhover-background-start}*/), to( #fbdd52 /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); +} .ui-btn-hover-e a.ui-link-inherit { color: #333 /*{e-bhover-color}*/; } .ui-btn-down-e { - border: 1px solid #F7C942 /*{e-bdown-border}*/; + border: 1px solid #F2C43d /*{e-bdown-border}*/; background: #fceda7 /*{e-bdown-background-color}*/; font-weight: bold; color: #111 /*{e-bdown-color}*/; - text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 1px /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fadb4e /*{e-bdown-background-start}*/), to( #fceda7 /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); + text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 0 /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f8d94c /*{e-bdown-background-start}*/), to( #fadb4e /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); } .ui-btn-down-e a.ui-link-inherit { color: #333 /*{e-bdown-color}*/; @@ -713,53 +669,41 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - /* Structure */ - /* links within "buttons" -----------------------------------------------------------------------------------------------------------*/ - a.ui-link-inherit { text-decoration: none !important; } - - /* Active class used as the "on" state across all themes -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-active { - border: 1px solid #155678 /*{global-active-border}*/; - background: #4596ce /*{global-active-background-color}*/; + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; font-weight: bold; color: #fff /*{global-active-color}*/; cursor: pointer; - text-shadow: 0 /*{global-active-shadow-x}*/ -1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #145072 /*{global-active-shadow-color}*/; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; text-decoration: none; - background-image: -webkit-gradient(linear, left top, left bottom, from( #85bae4 /*{global-active-background-start}*/), to( #5393c5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } .ui-btn-active a.ui-link-inherit { color: #fff /*{global-active-color}*/; } - - /* button inner top highlight -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-inner { border-top: 1px solid #fff; border-color: rgba(255,255,255,.3); } - - /* corner rounding classes -----------------------------------------------------------------------------------------------------------*/ - .ui-corner-tl { -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; @@ -822,7 +766,6 @@ a.ui-link-inherit { -webkit-border-radius: 0; border-radius: 0; } - /* Form field separator -----------------------------------------------------------------------------------------------------------*/ .ui-br { @@ -831,7 +774,6 @@ a.ui-link-inherit { border-bottom-width: 1px; border-bottom-style: solid; } - /* Interaction cues -----------------------------------------------------------------------------------------------------------*/ .ui-disabled { @@ -839,13 +781,16 @@ a.ui-link-inherit { } .ui-disabled, .ui-disabled a { + cursor: default !important; pointer-events: none; - cursor: default; } - +.ui-disabled .ui-btn-text { + -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(opacity=30)"; + filter: alpha(opacity=30); + zoom: 1; +} /* Icons -----------------------------------------------------------------------------------------------------------*/ - .ui-icon, .ui-icon-searchfield:after { background: #666 /*{global-icon-color}*/; @@ -856,21 +801,16 @@ a.ui-link-inherit { -webkit-border-radius: 9px; border-radius: 9px; } - - /* Alt icon color -----------------------------------------------------------------------------------------------------------*/ - .ui-icon-alt { background: #fff; background: rgba(255,255,255,.3); background-image: url(images/icons-18-black.png); background-repeat: no-repeat; } - /* HD/"retina" sprite -----------------------------------------------------------------------------------------------------------*/ - @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min--moz-device-pixel-ratio: 1.5), only screen and (min-resolution: 240dpi) { @@ -890,7 +830,6 @@ a.ui-link-inherit { background-image: url(images/icons-36-black.png); } } - /* plus minus */ .ui-icon-plus { background-position: -0 50%; @@ -898,12 +837,10 @@ a.ui-link-inherit { .ui-icon-minus { background-position: -36px 50%; } - /* delete/close */ .ui-icon-delete { background-position: -72px 50%; } - /* arrows */ .ui-icon-arrow-r { background-position: -108px 50%; @@ -917,7 +854,6 @@ a.ui-link-inherit { .ui-icon-arrow-d { background-position: -216px 50%; } - /* misc */ .ui-icon-check { background-position: -252px 50%; @@ -965,8 +901,6 @@ a.ui-link-inherit { .ui-icon-radio-on { background-position: -720px 50%; } - - /* checks,radios */ .ui-checkbox .ui-icon { -moz-border-radius: 3px; @@ -981,22 +915,13 @@ a.ui-link-inherit { .ui-radio-on .ui-icon { background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ } - /* loading icon */ .ui-icon-loading { - background-image: url(images/ajax-loader.png); - width: 40px; - height: 40px; - -moz-border-radius: 20px; - -webkit-border-radius: 20px; - border-radius: 20px; - background-size: 35px 35px; -} - - + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} /* Button corner classes -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-corner-tl { -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; @@ -1054,7 +979,6 @@ a.ui-link-inherit { -webkit-border-radius: 1em /*{global-radii-buttons}*/; border-radius: 1em /*{global-radii-buttons}*/; } - /* radius clip workaround for cleaning up corner trapping */ .ui-corner-tl, .ui-corner-tr, @@ -1078,10 +1002,8 @@ a.ui-link-inherit { -moz-background-clip: padding; background-clip: padding-box; } - /* Overlay / modal -----------------------------------------------------------------------------------------------------------*/ - .ui-overlay { background: #666; opacity: .5; @@ -1113,51 +1035,48 @@ a.ui-link-inherit { box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); } .ui-icon-shadow { - -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); - -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); - box-shadow: 0px 1px 0 rgba(255,255,255,.4); + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; } - -/* Focus state - set here for specificity +/* Focus state - set here for specificity (note: these classes are added by JavaScript) -----------------------------------------------------------------------------------------------------------*/ - -.ui-focus { +.ui-btn:focus { + outline: 0; +} +.ui-focus, +.ui-btn:focus { -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; } - /* unset box shadow in browsers that don't do it right -----------------------------------------------------------------------------------------------------------*/ - .ui-mobile-nosupport-boxshadow * { -moz-box-shadow: none !important; -webkit-box-shadow: none !important; box-shadow: none !important; } - /* ...and bring back focus */ -.ui-mobile-nosupport-boxshadow .ui-focus { - outline-width: 2px; +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus { + outline-width: 1px; + outline-style: dotted; } /* some unsets - more probably needed */ -.ui-mobile, .ui-mobile body { height: 100%; } +.ui-mobile, .ui-mobile body { height: 99.9%; } .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } -.ui-mobile a img, .ui-mobile fieldset { border: 0; } - +.ui-mobile a img, .ui-mobile fieldset { border-width: 0; } /* responsive page widths */ .ui-mobile-viewport { margin: 0; overflow-x: visible; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } /* Issue #2066 */ body.ui-mobile-viewport, div.ui-mobile-viewport { overflow-x: hidden; } - /* "page" containers - full-screen views, one should always be in view post-pageload */ .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } .ui-mobile .ui-page-active { display: block; overflow: visible; } - /* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */ .ui-page { outline: none; } - /*orientations from js are available */ @media screen and (orientation: portrait){ .ui-mobile, .ui-mobile .ui-page { min-height: 420px; } @@ -1165,249 +1084,351 @@ div.ui-mobile-viewport { overflow-x: hidden; } @media screen and (orientation: landscape){ .ui-mobile, .ui-mobile .ui-page { min-height: 300px; } } - -/* native overflow scrolling */ -.ui-page.ui-mobile-touch-overflow, -.ui-mobile-touch-overflow.ui-native-fixed .ui-content { - overflow: auto; - height: 100%; - -webkit-overflow-scrolling: touch; - -moz-overflow-scrolling: touch; - -o-overflow-scrolling: touch; - -ms-overflow-scrolling: touch; - overflow-scrolling: touch; -} -.ui-page.ui-mobile-touch-overflow, -.ui-page.ui-mobile-touch-overflow * { - /* some level of transform keeps elements from blinking out of visibility on iOS */ - -webkit-transform: rotateY(0); -} -.ui-page.ui-mobile-pre-transition { - display: block; -} - /* loading screen */ -.ui-loading .ui-mobile-viewport { overflow: hidden !important; } .ui-loading .ui-loader { display: block; } -.ui-loading .ui-page { overflow: hidden; } -.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } -.ui-loader h1 { font-size: 15px; text-align: center; } -.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } - +.ui-loader { display: none; z-index: 9999999; position: fixed; top: 50%; box-shadow: 0 1px 1px -1px #fff; left: 50%; border:0; } +.ui-loader-default { background: none; opacity: .18; width: 46px; height: 46px; margin-left: -23px; margin-top: -23px; } +.ui-loader-verbose { width: 200px; opacity: .88; height: auto; margin-left: -110px; margin-top: -43px; padding: 10px; } +.ui-loader-default h1 { font-size: 0; width: 0; height: 0; overflow: hidden; } +.ui-loader-verbose h1 { font-size: 16px; margin: 0; text-align: center; } +.ui-loader .ui-icon { background-color: #000; display: block; margin: 0; width: 44px; height: 44px; padding: 1px; -webkit-border-radius: 36px; -moz-border-radius: 36px; border-radius: 36px; } +.ui-loader-verbose .ui-icon { margin: 0 auto 10px; opacity: .75; } +.ui-loader-textonly { padding: 15px; margin-left: -115px; } +.ui-loader-textonly .ui-icon { display: none; } +.ui-loader-fakefix { position: absolute; } /*fouc*/ .ui-mobile-rendering > * { visibility: hidden; } - /*headers, content panels*/ .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } .ui-bar { font-size: 16px; margin: 0; } .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } - -.ui-header, .ui-footer { display: block; } -.ui-page .ui-header, .ui-page .ui-footer { position: relative; } -.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } -.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } -.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } +.ui-header, .ui-footer { position: relative; border-left-width: 0; border-right-width: 0; } +.ui-header .ui-btn-left, +.ui-header .ui-btn-right, +.ui-footer .ui-btn-left, +.ui-footer .ui-btn-right { position: absolute; top: 3px; } +.ui-header .ui-btn-left, +.ui-footer .ui-btn-left { left: 5px; } +.ui-header .ui-btn-right, +.ui-footer .ui-btn-right { right: 5px; } +.ui-footer .ui-btn-icon-notext, +.ui-header .ui-btn-icon-notext { top: 6px; } +.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 30% .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } .ui-footer .ui-title { margin: .6em 15px .8em; } - /*content area*/ .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } -.ui-page-fullscreen .ui-content { padding:0; } - -/* native fixed headers and footers */ -.ui-mobile-touch-overflow.ui-page.ui-native-fixed, -.ui-mobile-touch-overflow.ui-page.ui-native-fullscreen { - overflow: visible; -} -.ui-mobile-touch-overflow.ui-native-fixed .ui-header, -.ui-mobile-touch-overflow.ui-native-fixed .ui-footer { - position: fixed; - left: 0; - right: 0; - top: 0; - z-index: 200; -} -.ui-mobile-touch-overflow.ui-page.ui-native-fixed .ui-footer { - top: auto; - bottom: 0; -} -.ui-mobile-touch-overflow.ui-native-fixed .ui-content { - padding-top: 2.5em; - padding-bottom: 3em; - top: 0; - bottom: 0; - height: auto; - position: absolute; -} -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-content { - padding-top: 0; - padding-bottom: 0; -} -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-header, -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-footer { - opacity: .9; -} -.ui-native-bars-hidden { - display: none; -} - /* icons sizing */ .ui-icon { width: 18px; height: 18px; } - -/* fullscreen class on ui-content div */ -.ui-fullscreen { } -.ui-fullscreen img { max-width: 100%; } - /* non-js content hiding */ .ui-nojs { position: absolute; left: -9999px; } - /* accessible content hiding */ .ui-hide-label label, .ui-hidden-accessible { position: absolute !important; left: -9999px; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.spin { - -webkit-transform: rotate(360deg); - -webkit-animation-name: spin; - -webkit-animation-duration: 1s; - -webkit-animation-iteration-count: infinite; - -webkit-animation-timing-function: linear; -} -@-webkit-keyframes spin { - from {-webkit-transform: rotate(0deg);} - to {-webkit-transform: rotate(360deg);} -} - -/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ -Built by David Kaneda and maintained by Jonathan Stark. -*/ -.in, .out { - -webkit-animation-timing-function: ease-in-out; +/* Transitions originally inspired by those from jQtouch, nice work, folks */ +.ui-mobile-viewport-transitioning, +.ui-mobile-viewport-transitioning .ui-page { + width: 100%; + height: 100%; + overflow: hidden; +} +.in { + -webkit-animation-timing-function: ease-out; -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.out { + -webkit-animation-timing-function: ease-in; + -webkit-animation-duration: 225ms; + -moz-animation-timing-function: ease-in; + -moz-animation-duration: 225; +} +@-webkit-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-moz-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-webkit-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +@-moz-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +.fade.out { + opacity: 0; + -webkit-animation-duration: 125ms; + -webkit-animation-name: fadeout; + -moz-animation-duration: 125ms; + -moz-animation-name: fadeout; +} +.fade.in { + opacity: 1; + -webkit-animation-duration: 225ms; + -webkit-animation-name: fadein; + -moz-animation-duration: 225ms; + -moz-animation-name: fadein; +} +.pop { + -webkit-transform-origin: 50% 50%; + -moz-transform-origin: 50% 50%; +} +.pop.in { + -webkit-transform: scale(1); + -moz-transform: scale(1); + opacity: 1; + -webkit-animation-name: popin; + -moz-animation-name: popin; + -webkit-animation-duration: 350ms; + -moz-animation-duration: 350ms; +} +.pop.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + opacity: 0; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.pop.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; +} +.pop.out.reverse { + -webkit-transform: scale(.8); + -moz-transform: scale(.8); + -webkit-animation-name: popout; + -moz-animation-name: popout; +} +@-webkit-keyframes popin { + from { + -webkit-transform: scale(.8); + opacity: 0; + } + to { + -webkit-transform: scale(1); + opacity: 1; + } +} +@-moz-keyframes popin { + from { + -moz-transform: scale(.8); + opacity: 0; + } + to { + -moz-transform: scale(1); + opacity: 1; + } +} +@-webkit-keyframes popout { + from { + -webkit-transform: scale(1); + opacity: 1; + } + to { + -webkit-transform: scale(.8); + opacity: 0; + } +} +@-moz-keyframes popout { + from { + -moz-transform: scale(1); + opacity: 1; + } + to { + -moz-transform: scale(.8); + opacity: 0; + } +} +/* keyframes for slidein from sides */ +@-webkit-keyframes slideinfromright { + from { -webkit-transform: translateX(100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromright { + from { -moz-transform: translateX(100%); } + to { -moz-transform: translateX(0); } +} +@-webkit-keyframes slideinfromleft { + from { -webkit-transform: translateX(-100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromleft { + from { -moz-transform: translateX(-100%); } + to { -moz-transform: translateX(0); } +} +/* keyframes for slideout to sides */ +@-webkit-keyframes slideouttoleft { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(-100%); } +} +@-moz-keyframes slideouttoleft { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(-100%); } +} +@-webkit-keyframes slideouttoright { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(100%); } +} +@-moz-keyframes slideouttoright { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(100%); } +} +.slide.out, .slide.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; } - - .slide.out { -webkit-transform: translateX(-100%); -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; } - .slide.in { -webkit-transform: translateX(0); -webkit-animation-name: slideinfromright; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromright; } - .slide.out.reverse { -webkit-transform: translateX(100%); -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; } - .slide.in.reverse { -webkit-transform: translateX(0); -webkit-animation-name: slideinfromleft; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromleft; } - -.slideup.out { - -webkit-animation-name: dontmove; - z-index: 0; +.slidefade.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; + -webkit-animation-duration: 225ms; + -moz-animation-duration: 225ms; } - -.slideup.in { - -webkit-transform: translateY(0); - -webkit-animation-name: slideinfrombottom; - z-index: 10; +.slidefade.in { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -.slideup.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; +.slidefade.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -.slideup.out.reverse { - -webkit-transform: translateY(100%); - z-index: 10; - -webkit-animation-name: slideouttobottom; +.slidefade.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - +/* slide down */ .slidedown.out { - -webkit-animation-name: dontmove; - z-index: 0; + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; } - .slidedown.in { -webkit-transform: translateY(0); -webkit-animation-name: slideinfromtop; - z-index: 10; + -moz-transform: translateY(0); + -moz-animation-name: slideinfromtop; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; } - .slidedown.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; } - .slidedown.out.reverse { -webkit-transform: translateY(-100%); - z-index: 10; + -moz-transform: translateY(-100%); -webkit-animation-name: slideouttotop; + -moz-animation-name: slideouttotop; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -@-webkit-keyframes slideinfromright { - from { -webkit-transform: translateX(100%); } - to { -webkit-transform: translateX(0); } -} - -@-webkit-keyframes slideinfromleft { - from { -webkit-transform: translateX(-100%); } - to { -webkit-transform: translateX(0); } -} - -@-webkit-keyframes slideouttoleft { - from { -webkit-transform: translateX(0); } - to { -webkit-transform: translateX(-100%); } -} - -@-webkit-keyframes slideouttoright { - from { -webkit-transform: translateX(0); } - to { -webkit-transform: translateX(100%); } -} - @-webkit-keyframes slideinfromtop { from { -webkit-transform: translateY(-100%); } to { -webkit-transform: translateY(0); } } - -@-webkit-keyframes slideinfrombottom { - from { -webkit-transform: translateY(100%); } - to { -webkit-transform: translateY(0); } -} - -@-webkit-keyframes slideouttobottom { - from { -webkit-transform: translateY(0); } - to { -webkit-transform: translateY(100%); } +@-moz-keyframes slideinfromtop { + from { -moz-transform: translateY(-100%); } + to { -moz-transform: translateY(0); } } - @-webkit-keyframes slideouttotop { from { -webkit-transform: translateY(0); } to { -webkit-transform: translateY(-100%); } } -@-webkit-keyframes fadein { - from { opacity: 0; } - to { opacity: 1; } -} - -@-webkit-keyframes fadeout { - from { opacity: 1; } - to { opacity: 0; } +@-moz-keyframes slideouttotop { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(-100%); } } - -.fade.out { - z-index: 0; +/* slide up */ +.slideup.out { -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; } - -.fade.in { - opacity: 1; - z-index: 10; +.slideup.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfrombottom; + -moz-transform: translateY(0); + -moz-animation-name: slideinfrombottom; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slideup.in.reverse { -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slideup.out.reverse { + -webkit-transform: translateY(100%); + -moz-transform: translateY(100%); + -webkit-animation-name: slideouttobottom; + -moz-animation-name: slideouttobottom; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfrombottom { + from { -webkit-transform: translateY(100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfrombottom { + from { -moz-transform: translateY(100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttobottom { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(100%); } +} +@-moz-keyframes slideouttobottom { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(100%); } } - /* The properties in this rule are only necessary for the 'flip' transition. * We need specify the perspective to create a projection matrix. This will add * some depth as the element flips. The depth number represents the distance of @@ -1416,151 +1437,294 @@ Built by David Kaneda and maintained by Jonathan Stark. */ .viewport-flip { -webkit-perspective: 1000; + -moz-perspective: 1000; position: absolute; } - -.ui-mobile-viewport-transitioning, -.ui-mobile-viewport-transitioning .ui-page { - width: 100%; - height: 100%; - overflow: hidden; -} - .flip { - -webkit-animation-duration: .65s; -webkit-backface-visibility:hidden; -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); } - .flip.out { - -webkit-transform: rotateY(-180deg) scale(.8); + -webkit-transform: rotateY(-90deg) scale(.9); -webkit-animation-name: flipouttoleft; + -webkit-animation-duration: 175ms; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -moz-animation-duration: 175ms; } - .flip.in { - -webkit-transform: rotateY(0) scale(1); - -webkit-animation-name: flipinfromleft; + -webkit-animation-name: flipintoright; + -webkit-animation-duration: 225ms; + -moz-animation-name: flipintoright; + -moz-animation-duration: 225ms; } - -/* Shake it all about */ - .flip.out.reverse { - -webkit-transform: rotateY(180deg) scale(.8); + -webkit-transform: rotateY(90deg) scale(.9); -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; } - .flip.in.reverse { - -webkit-transform: rotateY(0) scale(1); - -webkit-animation-name: flipinfromright; -} - -@-webkit-keyframes flipinfromright { - from { -webkit-transform: rotateY(-180deg) scale(.8); } - to { -webkit-transform: rotateY(0) scale(1); } + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; } - -@-webkit-keyframes flipinfromleft { - from { -webkit-transform: rotateY(180deg) scale(.8); } - to { -webkit-transform: rotateY(0) scale(1); } -} - @-webkit-keyframes flipouttoleft { - from { -webkit-transform: rotateY(0) scale(1); } - to { -webkit-transform: rotateY(-180deg) scale(.8); } + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } } - @-webkit-keyframes flipouttoright { - from { -webkit-transform: rotateY(0) scale(1); } - to { -webkit-transform: rotateY(180deg) scale(.8); } -} - - -/* Hackish, but reliable. */ - -@-webkit-keyframes dontmove { - from { opacity: 1; } - to { opacity: 1; } + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } } - -.pop { - -webkit-transform-origin: 50% 50%; +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } } - -.pop.in { - -webkit-transform: scale(1); - opacity: 1; - -webkit-animation-name: popin; - z-index: 10; +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } } - -.pop.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } } - -.pop.out.reverse { - -webkit-transform: scale(.2); - opacity: 0; - -webkit-animation-name: popout; - z-index: 10; +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } } - -@-webkit-keyframes popin { - from { - -webkit-transform: scale(.2); - opacity: 0; - } - to { - -webkit-transform: scale(1); - opacity: 1; - } +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } } - -@-webkit-keyframes popout { - from { - -webkit-transform: scale(1); - opacity: 1; - } - to { - -webkit-transform: scale(.2); - opacity: 0; - } -}/* content configurations. */ +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-turn { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.turn { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -webkit-transform-origin: 0; + + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-transform-origin: 0; +} +.turn.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -webkit-animation-duration: 125ms; + -moz-animation-duration: 125ms; +} +.turn.in { + -webkit-animation-name: flipintoright; + -moz-animation-name: flipintoright; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; + +} +.turn.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.turn.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* flow transition */ +.flow { + -webkit-transform-origin: 50% 30%; + -moz-transform-origin: 50% 30%; + -webkit-box-shadow: 0 0 20px rgba(0,0,0,.4); + -moz-box-shadow: 0 0 20px rgba(0,0,0,.4); +} +.ui-dialog.flow { + -webkit-transform-origin: none; + -moz-transform-origin: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; +} +.flow.out { + -webkit-transform: translateX(-100%) scale(.7); + -webkit-animation-name: flowouttoleft; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(-100%) scale(.7); + -moz-animation-name: flowouttoleft; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.in { + -webkit-transform: translateX(0) scale(1); + -webkit-animation-name: flowinfromright; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(0) scale(1); + -moz-animation-name: flowinfromright; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: flowouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: flowouttoright; +} +.flow.in.reverse { + -webkit-animation-name: flowinfromleft; + -moz-animation-name: flowinfromleft; +} +@-webkit-keyframes flowouttoleft { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(-100%) scale(.7); } +} +@-moz-keyframes flowouttoleft { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(-100%) scale(.7); } +} +@-webkit-keyframes flowouttoright { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(100%) scale(.7); } +} +@-moz-keyframes flowouttoright { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(100%) scale(.7); } +} +@-webkit-keyframes flowinfromleft { + 0% { -webkit-transform: translateX(-100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromleft { + 0% { -moz-transform: translateX(-100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +@-webkit-keyframes flowinfromright { + 0% { -webkit-transform: translateX(100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromright { + 0% { -moz-transform: translateX(100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +/* content configurations. */ .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} - /* grid solo: 100 - single item fallback */ .ui-grid-solo .ui-block-a { width: 100%; float: none; } - /* grid a: 50/50 */ .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } .ui-grid-a .ui-block-a { clear: left; } - /* grid b: 33/33/33 */ .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } .ui-grid-b .ui-block-a { clear: left; } - /* grid c: 25/25/25/25 */ .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } .ui-grid-c .ui-block-a { clear: left; } - /* grid d: 20/20/20/20/20 */ .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } .ui-grid-d .ui-block-a { clear: left; } /* fixed page header & footer configuration */ -.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } -.ui-header-fixed, .ui-footer-fixed { +.ui-header-fixed, +.ui-footer-fixed { + left: 0; + right: 0; + width: 100%; + position: fixed; z-index: 1000; - -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ } -.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } -.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } +.ui-header-fixed { + top: 0; +} +.ui-footer-fixed { + bottom: 0; +} +.ui-header-fullscreen, +.ui-footer-fullscreen { + opacity: .9; +} +.ui-page-header-fixed { + padding-top: 2.5em; +} +.ui-page-footer-fixed { + padding-bottom: 3em; +} +.ui-page-header-fullscreen .ui-content, +.ui-page-footer-fullscreen .ui-content { + padding: 0; +} +.ui-fixed-hidden { + position: absolute; +} +.ui-page-header-fullscreen .ui-fixed-hidden, +.ui-page-footer-fullscreen .ui-fixed-hidden { + left: -99999em; +} +.ui-header-fixed .ui-btn, +.ui-footer-fixed .ui-btn { + z-index: 10; +} .ui-navbar { overflow: hidden; } .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } -.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } +.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; max-width: 100%; } .ui-navbar li .ui-btn { margin-right: -1px; } .ui-navbar li .ui-btn:last-child { margin-right: 0; } .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, @@ -1577,59 +1741,73 @@ Built by David Kaneda and maintained by Jonathan Stark. .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } -.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } -.ui-btn-inline { display: inline-block; } -.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } +.ui-mini { margin: .25em 5px; } +.ui-btn-inner { padding: .6em 20px; min-width: .75em; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } .ui-btn input, .ui-btn button { z-index: 2; } -.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } +.ui-btn-left, .ui-btn-right, .ui-btn-inline { display: inline-block; } +.ui-btn-block { display: block; } +.ui-header .ui-btn, +.ui-footer .ui-btn { display: inline-block; margin: 0; } +.ui-header .ui-btn-inner, +.ui-footer .ui-btn-inner, +.ui-mini .ui-btn-inner { font-size: 12.5px; padding: .55em 11px .5em; } +.ui-header .ui-fullsize .ui-btn-inner, +.ui-footer .ui-fullsize .ui-btn-inner { font-size: 16px; padding: .6em 25px; } .ui-btn-icon-notext { width: 24px; height: 24px; } -.ui-btn-icon-notext .ui-btn-inner { padding: 2px 1px 2px 3px; } -.ui-btn-text { position: relative; z-index: 1; } +.ui-btn-icon-notext .ui-btn-inner { padding: 0; height: 100%; } +.ui-btn-icon-notext .ui-btn-inner .ui-icon { margin: 2px 1px 2px 3px; } +.ui-btn-text { position: relative; z-index: 1; width: 100%; } .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -9999px; } -.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } +.ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-btn-icon-right .ui-btn-inner { padding-right: 40px; } +.ui-btn-icon-top .ui-btn-inner { padding-top: 40px; } +.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 40px; } .ui-header .ui-btn-icon-left .ui-btn-inner, .ui-footer .ui-btn-icon-left .ui-btn-inner, -.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } -.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } +.ui-mini .ui-btn-icon-left .ui-btn-inner { padding-left: 30px; } .ui-header .ui-btn-icon-right .ui-btn-inner, .ui-footer .ui-btn-icon-right .ui-btn-inner, -.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } -.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } +.ui-mini .ui-btn-icon-right .ui-btn-inner { padding-right: 30px; } .ui-header .ui-btn-icon-top .ui-btn-inner, .ui-footer .ui-btn-icon-top .ui-btn-inner, -.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } -.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } +.ui-mini .ui-btn-icon-top .ui-btn-inner { padding: 30px 3px .5em 3px; } .ui-header .ui-btn-icon-bottom .ui-btn-inner, .ui-footer .ui-btn-icon-bottom .ui-btn-inner, -.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } - +.ui-mini .ui-btn-icon-bottom .ui-btn-inner { padding: .55em 3px 30px 3px; } /*btn icon positioning*/ .ui-btn-icon-notext .ui-icon { display: block; z-index: 0;} -.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } -.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } +.ui-btn-icon-left .ui-btn-inner .ui-icon, .ui-btn-icon-right .ui-btn-inner .ui-icon { position: absolute; top: 50%; margin-top: -9px; } +.ui-btn-icon-top .ui-btn-inner .ui-icon, .ui-btn-icon-bottom .ui-btn-inner .ui-icon { position: absolute; left: 50%; margin-left: -9px; } .ui-btn-icon-left .ui-icon { left: 10px; } .ui-btn-icon-right .ui-icon { right: 10px; } .ui-btn-icon-top .ui-icon { top: 10px; } -.ui-btn-icon-bottom .ui-icon { bottom: 10px; } +.ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } .ui-header .ui-btn-icon-left .ui-icon, .ui-footer .ui-btn-icon-left .ui-icon, -.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } +.ui-mini.ui-btn-icon-left .ui-icon, +.ui-mini .ui-btn-icon-left .ui-icon { left: 5px; } .ui-header .ui-btn-icon-right .ui-icon, .ui-footer .ui-btn-icon-right .ui-icon, -.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } +.ui-mini.ui-btn-icon-right .ui-icon, +.ui-mini .ui-btn-icon-right .ui-icon { right: 5px; } .ui-header .ui-btn-icon-top .ui-icon, .ui-footer .ui-btn-icon-top .ui-icon, -.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } +.ui-mini.ui-btn-icon-top .ui-icon, +.ui-mini .ui-btn-icon-top .ui-icon { top: 5px; } .ui-header .ui-btn-icon-bottom .ui-icon, .ui-footer .ui-btn-icon-bottom .ui-icon, -.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } - +.ui-mini.ui-btn-icon-bottom .ui-icon, +.ui-mini .ui-btn-icon-bottom .ui-icon { bottom: 5px; } /*hiding native button,inputs */ -.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=.0001); font-size: 1px; border: none; line-height: 999px; } +.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=.0001); font-size: 1px; border: none; text-indent: -9999px; } .ui-collapsible { margin: .5em 0; } .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } .ui-collapsible-heading a { text-align: left; margin: 0; } -.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner { padding-left: 12px; padding-right: 40px; } +.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner { padding-right: 40px; text-align: center; } .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } @@ -1643,22 +1821,21 @@ Built by David Kaneda and maintained by Jonathan Stark. font-weight: normal; /* Overrides ui-btn-up-* */ } .ui-collapsible-content-collapsed { display: none; } - .ui-collapsible-set { margin: .5em 0; } .ui-collapsible-set .ui-collapsible { margin: -1px 0 0; } -.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } +.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: 0em 0 .5em; zoom: 1; } .ui-bar .ui-controlgroup { margin: 0 .3em; } -.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } +.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .4em; } .ui-controlgroup-controls { display: block; width: 100%;} .ui-controlgroup li { list-style: none; } .ui-controlgroup-vertical .ui-btn, .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } .ui-controlgroup-controls label.ui-select { position: absolute; left: -9999px; } - .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } .ui-controlgroup-horizontal { padding: 0; } -.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select { display: inline-block; margin: 0 -5px 0 0; } -.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; margin: 0 -1px 0 0; } +.ui-controlgroup-horizontal .ui-btn-inner { text-align:center; } +.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select { display: inline-block; margin: 0 -6px 0 0; } +.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; clear: none; margin: 0 -1px 0 0; } .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } @@ -1667,71 +1844,96 @@ Built by David Kaneda and maintained by Jonathan Stark. .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } */ - @media all and (min-width: 450px){ .ui-field-contain .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain .ui-controlgroup-controls { width: 60%; display: inline-block; } .ui-field-contain .ui-controlgroup .ui-select { width: 100%; } .ui-field-contain .ui-controlgroup-horizontal .ui-select { width: auto; } -} .ui-dialog { min-height: 480px; } +} +.ui-dialog { + background: none !important; /* this is to ensure that dialog theming does not apply (by default at least) on the page div */ +} +.ui-dialog-contain { width: 92.5%; max-width: 500px; margin: 10% auto 15px auto; padding: 0; } +.ui-dialog .ui-header { + margin-top: 15%; + border: none; + overflow: hidden; +} .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { - max-width: 500px; - margin: 10% auto 15px auto; - width: 85%; + display: block; position: relative; + width: auto; } .ui-dialog .ui-header, .ui-dialog .ui-footer { - padding: 0 15px; z-index: 10; + padding: 0; +} +.ui-dialog .ui-footer { + padding: 0 15px; } .ui-dialog .ui-content { padding: 15px; } -.ui-dialog .ui-content, -.ui-dialog .ui-footer { +.ui-dialog { margin-top: -15px; } -.ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } +.ui-checkbox, .ui-radio { position: relative; clear: both; margin: .2em 0 .5em; z-index: 1; } .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner { padding-left: 36px; } .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner { padding-right: 36px; } +.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner, .ui-radio .ui-btn-icon-bottom .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } -.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } -.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } +.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon { left: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon, .ui-radio .ui-mini.ui-btn-icon-left .ui-icon { left: 9px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +.ui-checkbox .ui-btn-icon-top .ui-icon, .ui-radio .ui-btn-icon-top .ui-icon { top: 10px; } +.ui-checkbox .ui-btn-icon-bottom .ui-icon, .ui-radio .ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } /* input, label positioning */ -.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }.ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } +.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; } +.ui-field-contain, fieldset.ui-field-contain { padding: .8em 0; margin: 0; border-width: 0 0 1px 0; overflow: visible; } .ui-field-contain:first-child { border-top-width: 0; } +.ui-header .ui-field-contain-left, +.ui-header .ui-field-contain-right { + position: absolute; + top: 0; + width: 25%; +} +.ui-header .ui-field-contain-left { + left: 1em; +} +.ui-header .ui-field-contain-right { + right: 1em; +} @media all and (min-width: 450px){ - .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } -} .ui-select { display: block; position: relative; } + .ui-field-contain, .ui-mobile fieldset.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } +} +.ui-select { display: block; position: relative; } .ui-select select { position: absolute; left: -9999px; top: -9999px; } -.ui-select .ui-btn { overflow: hidden; } - - -.ui-select .ui-btn { opacity: 1; } - +.ui-select .ui-btn { overflow: hidden; opacity: 1; margin: 0; } /* Fixes #2588 — When Windows Phone 7.5 (Mango) tries to calculate a numeric opacity for a select—including “inherit”—without explicitly specifying an opacity on the parent to give it context, a bug appears where clicking elsewhere on the page after opening the select will open the select again. */ .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); z-index: 2; } - .ui-select .ui-disabled { opacity: .3; } - @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } - .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } - +.ui-select .ui-mini.ui-btn-icon-right .ui-icon { right: 7px; } /* labels */ label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } - /*listbox*/ -.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden; } +.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden !important; +/* This !important is required for iPad Safari specifically. See https://github.com/jquery/jquery-mobile/issues/2647 */ } .ui-select .ui-btn-text { text-overflow: ellipsis; } - .ui-selectmenu { position: absolute; padding: 0; z-index: 1100 !important; width: 80%; max-width: 350px; padding: 6px; } .ui-selectmenu .ui-listview { margin: 0; } .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } @@ -1741,23 +1943,26 @@ label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margi .ui-selectmenu-list .ui-li .ui-icon { display: block; } .ui-li.ui-selectmenu-placeholder { display: none; } .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } - @media all and (min-width: 450px){ .ui-field-contain label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain .ui-select { width: 60%; display: inline-block; } } - /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ -.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } -input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 97%; } -input.ui-input-text { -webkit-appearance: none; } +.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; } +label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } +input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 97%; outline: 0; } +.ui-header input.ui-input-text, +.ui-footer input.ui-input-text { margin-left: 1.25%; padding: .4em 1%; width: 95.5% } /* Note that padding left/right on text inputs is factored into how the element is displayed in Firefox, but does not actually pad the text inside it. */ + input.ui-input-text { -webkit-appearance: none; } textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } .ui-input-search { padding: 0 30px; background-image: none; position: relative; } .ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; } .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -13px; } +.ui-mini .ui-input-clear { right: -3px; } .ui-input-search .ui-input-clear-hidden { display: none; } - +input.ui-mini, .ui-mini input, textarea.ui-mini { font-size: 14px; } +textarea.ui-mini { height: 45px; } /* orientation adjustments - incomplete!*/ @media all and (min-width: 450px){ .ui-field-contain label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } @@ -1769,7 +1974,8 @@ textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; .ui-hide-label textarea.ui-input-text, .ui-hide-label .ui-input-search { padding: .4em; width: 97%; } .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } -}.ui-listview { margin: 0; counter-reset: listnumbering; } +} +.ui-listview { margin: 0; counter-reset: listnumbering; } .ui-content .ui-listview { margin: -15px; } .ui-content .ui-listview-inset { margin: 1em 0; } .ui-listview, .ui-li { list-style:none; padding:0; } @@ -1794,54 +2000,54 @@ ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid .ui-li-thumb, .ui-listview .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } .ui-listview .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } .ui-li-thumb, .ui-listview .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } - .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } @media all and (min-width: 480px){ .ui-li-aside { width: 45%; } } .ui-li-divider { cursor: default; } .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } -.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } +.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 48px; } .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } .ui-li-has-alt .ui-li-count { right: 55px; } .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; } .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; z-index: -1;} .ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;} .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } - .ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; } - .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } - .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } .ui-li.ui-screen-hidden{display:none;} /* Odd iPad positioning issue. */ @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { .ui-li .ui-btn-text { overflow: visible; } -}label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +} +label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } input.ui-slider-input, .ui-field-contain input.ui-slider-input { display: inline-block; width: 50px; } select.ui-slider-switch { display: none; } -div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 60%; } -div.ui-slider-switch { width: 99.8%; } -a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } -a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } -@media all and (min-width: 480px){ - .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } +div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 65%; } +div.ui-slider-mini { height: 12px; margin-left: 10px; } +div.ui-slider-bg { border: none; height: 100%; padding-right: 8px; } +.ui-controlgroup a.ui-slider-handle, a.ui-slider-handle { position: absolute; z-index: 1; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; outline: 0; } +a.ui-slider-handle .ui-btn-inner { padding: 0; height: 100%; } +div.ui-slider-mini a.ui-slider-handle { height: 14px; width: 14px; margin: -8px 0 0 -7px; } +div.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: -9px 0 0 -9px; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain div.ui-slider { width: 43%; } + .ui-field-contain div.ui-slider-switch { width: 5.5em; } } - -div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } -div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } -a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; } -div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } -div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } -div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } -.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } -.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } - -div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } -span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } -span.ui-slider-label-a { left: -100%; margin-right: -1px } -span.ui-slider-label-b { right: -100%; margin-left: -1px } +div.ui-slider-switch { height: 32px; margin-left: 0; width: 5.8em; } +a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; -moz-transition: left 70ms linear; } +div.ui-slider-switch .ui-slider-handle { margin-top: 1px; } +.ui-slider-inneroffset { margin: 0 16px; position: relative; z-index: 1; } +div.ui-slider-switch.ui-slider-mini { width: 5em; height: 29px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset { margin: 0 15px 0 14px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-handle { width: 25px; height: 25px; margin: 1px 0 0 -13px; } +div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: 0; } +span.ui-slider-label { position: absolute; text-align: center; width: 100%; overflow: hidden; font-size: 16px; top: 0; line-height: 2; min-height: 100%; border-width: 0; white-space: nowrap; } +.ui-slider-mini span.ui-slider-label { font-size: 14px; } +span.ui-slider-label-a { z-index: 1; left: 0; text-indent: -1.5em; } +span.ui-slider-label-b { z-index: 0; right: 0; text-indent: 1.5em;} +.ui-slider-inline { width: 120px; display: inline-block; } diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js new file mode 100644 index 0000000..c12426c --- /dev/null +++ b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js @@ -0,0 +1,7551 @@ +/* +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 +* http://jquerymobile.com +* +* Copyright 2011 (c) jQuery Project +* Dual licensed under the MIT or GPL Version 2 licenses. +* http://jquery.org/license +* +*/ +(function ( root, doc, factory ) { + if ( typeof define === "function" && define.amd ) { + // AMD. Register as an anonymous module. + define( [ "jquery" ], function ( $ ) { + factory( $, root, doc ); + return $.mobile; + }); + } else { + // Browser globals + factory( root.jQuery, root, doc ); + } +}( this, document, function ( $, window, document, undefined ) { + + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], + mouseEventProps = $.event.props.concat( mouseHookProps ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j; + + event = $.Event(event); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 + // https://github.com/jquery/jquery-mobile/issues/3280 + if ( t.search( /^(mouse|click)/ ) > -1 ) { + props = mouseEventProps; + } + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ){ + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++){ + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout(function(){ + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ){ + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data(event.target, touchTargetPropertyName); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){ + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold; + didScroll = didScroll || + ( Math.abs(t.pageX - startX) > moveThreshold || + Math.abs(t.pageY - startY) > moveThreshold ), + flags = getVirtualBindingFlags( event.target ); + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler(){} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {}); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if (activeDocHandlers[ "touchstart" ] === 1) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ){ + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ){ + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); + + + +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and +// lowered its default value to 50. Added <jQuery.fn.hashchange.domain> +// and <jQuery.fn.hashchange.src> properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function($,window,undefined){ + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the <hashchange event> section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the <hashchange event> + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the <jQuery.fn.hashchange.src> property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in <jQuery.fn.hashchange>: + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function(){ + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function(val){ return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function(){ + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function(){ + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $('<iframe tabindex="-1" title="empty"/>').hide() + + // When Iframe has completely loaded, initialize the history and + // start polling. + .one( 'load', function(){ + iframe_src || history_set( get_fragment() ); + poll(); + }) + + // Load Iframe src if specified, otherwise nothing. + .attr( 'src', iframe_src || 'javascript:0' ) + + // Append Iframe after the end of the body to prevent unnecessary + // initial page scrolling (yes, this works). + .insertAfter( 'body' )[0].contentWindow; + + // Whenever `document.title` changes, update the Iframe's title to + // prettify the back/next history menu entries. Since IE sometimes + // errors with "Unspecified error" the very first time this is set + // (yes, very useful) wrap this with a try/catch block. + doc.onpropertychange = function(){ + try { + if ( event.propertyName === 'title' ) { + iframe.document.title = doc.title; + } + } catch(e) {} + }; + + } + }; + + // Override the "stop" method since an IE6/7 Iframe was created. Even + // if there are no longer any bound event handlers, the polling loop + // is still necessary for back/next to work at all! + self.stop = fn_retval; + + // Get history by looking at the hidden Iframe's location.hash. + history_get = function() { + return get_fragment( iframe.location.href ); + }; + + // Set a new history item by opening and then closing the Iframe + // document, *then* setting its location.hash. If document.domain has + // been set, update that as well. + history_set = function( hash, history_hash ) { + var iframe_doc = iframe.document, + domain = $.fn[ str_hashchange ].domain; + + if ( hash !== history_hash ) { + // Update Iframe with any initial `document.title` that might be set. + iframe_doc.title = doc.title; + + // Opening the Iframe's document after it has been closed is what + // actually adds a history entry. + iframe_doc.open(); + + // Set document.domain for the Iframe document as well, if necessary. + domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' ); + + iframe_doc.close(); + + // Update the Iframe's hash, for great justice. + iframe.location.hash = hash; + } + }; + + })(); + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + + return self; + })(); + +})(jQuery,this); + +/*! + * jQuery UI Widget @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ); + if ( !instance ) { + throw "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'"; + } + if ( !$.isFunction( instance[options] ) ) { + throw "no such method '" + options + "' for " + name + " widget instance"; + } + var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + var options = {}; + if ( $.metadata ) { + options = $.metadata.get( element )[ this.widgetName ]; + } + return options; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target, useKeepNative ) { + this.enhance( $( this.options.initSelector, $( target )), useKeepNative ); + }, + + enhance: function( targets, useKeepNative ) { + var page, keepNative, $widgetElements = $( targets ), self = this; + + // if ignoreContentEnabled is set to true the framework should + // only enhance the selected elements when they do NOT have a + // parent with the data-namespace-ignore attribute + $widgetElements = $.mobile.enhanceable( $widgetElements ); + + if ( useKeepNative && $widgetElements.length ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + page = $.mobile.closestPageData( $widgetElements ); + keepNative = (page && page.keepNativeSelector()) || ""; + + $widgetElements = $widgetElements.not( keepNative ); + } + + $widgetElements[ this.widgetName ](); + }, + + raise: function( msg ) { + throw "Widget [" + this.widgetName + "]: " + msg; + } +}); + +})( jQuery ); + +(function( $, window, undefined ) { + + var nsNormalizeDict = {}; + + // jQuery.mobile configurable options + $.mobile = $.extend( {}, { + + // Version of the jQuery Mobile Framework + version: "1.1.0", + + // Namespace used framework-wide for data-attrs. Default is no namespace + ns: "", + + // Define the url parameter used for referencing widget-generated sub-pages. + // Translates to to example.html&ui-page=subpageIdentifier + // hash segment before &ui-page= is used to make Ajax request + subPageUrlKey: "ui-page", + + // Class assigned to page currently in view, and during transitions + activePageClass: "ui-page-active", + + // Class used for "active" button state, from CSS framework + activeBtnClass: "ui-btn-active", + + // Class used for "focus" form element state, from CSS framework + focusClass: "ui-focus", + + // Automatically handle clicks and form submissions through Ajax, when same-domain + ajaxEnabled: true, + + // Automatically load and show pages based on location.hash + hashListeningEnabled: true, + + // disable to prevent jquery from bothering with links + linkBindingEnabled: true, + + // Set default page transition - 'none' for no transitions + defaultPageTransition: "fade", + + // Set maximum window width for transitions to apply - 'false' for no limit + maxTransitionWidth: false, + + // Minimum scroll distance that will be remembered when returning to a page + minScrollBack: 250, + + // DEPRECATED: the following property is no longer in use, but defined until 2.0 to prevent conflicts + touchOverflowEnabled: false, + + // Set default dialog transition - 'none' for no transitions + defaultDialogTransition: "pop", + + // Show loading message during Ajax requests + // if false, message will not appear, but loading classes will still be toggled on html el + loadingMessage: "loading", + + // Error response message - appears when an Ajax page request fails + pageLoadErrorMessage: "Error Loading Page", + + // Should the text be visble in the loading message? + loadingMessageTextVisible: false, + + // When the text is visible, what theme does the loading box use? + loadingMessageTheme: "a", + + // For error messages, which theme does the box uses? + pageLoadErrorMessageTheme: "e", + + //automatically initialize the DOM when it's ready + autoInitializePage: true, + + pushStateEnabled: true, + + // allows users to opt in to ignoring content by marking a parent element as + // data-ignored + ignoreContentEnabled: false, + + // turn of binding to the native orientationchange due to android orientation behavior + orientationChangeEnabled: true, + + buttonMarkup: { + hoverDelay: 200 + }, + + // TODO might be useful upstream in jquery itself ? + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + }, + + // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value + silentScroll: function( ypos ) { + if ( $.type( ypos ) !== "number" ) { + ypos = $.mobile.defaultHomeScroll; + } + + // prevent scrollstart and scrollstop events + $.event.special.scrollstart.enabled = false; + + setTimeout(function() { + window.scrollTo( 0, ypos ); + $( document ).trigger( "silentscroll", { x: 0, y: ypos }); + }, 20 ); + + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + + // Expose our cache for testing purposes. + nsNormalizeDict: nsNormalizeDict, + + // Take a data attribute property, prepend the namespace + // and then camel case the attribute string. Add the result + // to our nsNormalizeDict so we don't have to do this again. + nsNormalize: function( prop ) { + if ( !prop ) { + return; + } + + return nsNormalizeDict[ prop ] || ( nsNormalizeDict[ prop ] = $.camelCase( $.mobile.ns + prop ) ); + }, + + getInheritedTheme: function( el, defaultTheme ) { + + // Find the closest parent with a theme class on it. Note that + // we are not using $.fn.closest() on purpose here because this + // method gets called quite a bit and we need it to be as fast + // as possible. + + var e = el[ 0 ], + ltr = "", + re = /ui-(bar|body|overlay)-([a-z])\b/, + c, m; + + while ( e ) { + var c = e.className || ""; + if ( ( m = re.exec( c ) ) && ( ltr = m[ 2 ] ) ) { + // We found a parent with a theme class + // on it so bail from this loop. + break; + } + e = e.parentNode; + } + + // Return the theme letter we found, if none, return the + // specified default. + + return ltr || defaultTheme || "a"; + }, + + // TODO the following $ and $.fn extensions can/probably should be moved into jquery.mobile.core.helpers + // + // Find the closest javascript page element to gather settings data jsperf test + // http://jsperf.com/single-complex-selector-vs-many-complex-selectors/edit + // possibly naive, but it shows that the parsing overhead for *just* the page selector vs + // the page and dialog selector is negligable. This could probably be speed up by + // doing a similar parent node traversal to the one found in the inherited theme code above + closestPageData: function( $target ) { + return $target + .closest(':jqmData(role="page"), :jqmData(role="dialog")') + .data("page"); + }, + + enhanceable: function( $set ) { + return this.haveParents( $set, "enhance" ); + }, + + hijackable: function( $set ) { + return this.haveParents( $set, "ajax" ); + }, + + haveParents: function( $set, attr ) { + if( !$.mobile.ignoreContentEnabled ){ + return $set; + } + + var count = $set.length, + $newSet = $(), + e, $element, excluded; + + for ( var i = 0; i < count; i++ ) { + $element = $set.eq( i ); + excluded = false; + e = $set[ i ]; + + while ( e ) { + var c = e.getAttribute ? e.getAttribute( "data-" + $.mobile.ns + attr ) : ""; + + if ( c === "false" ) { + excluded = true; + break; + } + + e = e.parentNode; + } + + if ( !excluded ) { + $newSet = $newSet.add( $element ); + } + } + + return $newSet; + } + }, $.mobile ); + + // Mobile version of data and removeData and hasData methods + // ensures all data is set and retrieved using jQuery Mobile's data namespace + $.fn.jqmData = function( prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + if ( prop ) { + prop = $.mobile.nsNormalize( prop ); + } + result = this.data.apply( this, arguments.length < 2 ? [ prop ] : [ prop, value ] ); + } + return result; + }; + + $.jqmData = function( elem, prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + result = $.data( elem, prop ? $.mobile.nsNormalize( prop ) : prop, value ); + } + return result; + }; + + $.fn.jqmRemoveData = function( prop ) { + return this.removeData( $.mobile.nsNormalize( prop ) ); + }; + + $.jqmRemoveData = function( elem, prop ) { + return $.removeData( elem, $.mobile.nsNormalize( prop ) ); + }; + + $.fn.removeWithDependents = function() { + $.removeWithDependents( this ); + }; + + $.removeWithDependents = function( elem ) { + var $elem = $( elem ); + + ( $elem.jqmData('dependents') || $() ).remove(); + $elem.remove(); + }; + + $.fn.addDependents = function( newDependents ) { + $.addDependents( $(this), newDependents ); + }; + + $.addDependents = function( elem, newDependents ) { + var dependents = $(elem).jqmData( 'dependents' ) || $(); + + $(elem).jqmData( 'dependents', $.merge(dependents, newDependents) ); + }; + + // note that this helper doesn't attempt to handle the callback + // or setting of an html elements text, its only purpose is + // to return the html encoded version of the text in all cases. (thus the name) + $.fn.getEncodedText = function() { + return $( "<div/>" ).text( $(this).text() ).html(); + }; + + // fluent helper function for the mobile namespaced equivalent + $.fn.jqmEnhanceable = function() { + return $.mobile.enhanceable( this ); + }; + + $.fn.jqmHijackable = function() { + return $.mobile.hijackable( this ); + }; + + // Monkey-patching Sizzle to filter the :jqmData selector + var oldFind = $.find, + jqmDataRE = /:jqmData\(([^)]*)\)/g; + + $.find = function( selector, context, ret, extra ) { + selector = selector.replace( jqmDataRE, "[data-" + ( $.mobile.ns || "" ) + "$1]" ); + + return oldFind.call( this, selector, context, ret, extra ); + }; + + $.extend( $.find, oldFind ); + + $.find.matches = function( expr, set ) { + return $.find( expr, null, null, set ); + }; + + $.find.matchesSelector = function( node, expr ) { + return $.find( expr, null, null, [ node ] ).length > 0; + }; +})( jQuery, this ); + + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') // tests for screen media type + $.mobile.media('screen and (min-width: 480px)') // tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') // tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "<div id='jquery-mediatest'>" ), + fakeBody = $( "<body>" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ){ + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); + +(function( $, undefined ) { + +var fakeBody = $( "<body>" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ){ + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +function validStyle( prop, value, check_vend ) { + var div = document.createElement('div'), + uc = function( txt ) { + return txt.charAt( 0 ).toUpperCase() + txt.substr( 1 ) + }, + vend_pref = function( vend ) { + return "-" + vend.charAt( 0 ).toLowerCase() + vend.substr( 1 ) + "-"; + }, + check_style = function( vend ) { + var vend_prop = vend_pref( vend ) + prop + ": " + value + ";", + uc_vend = uc( vend ), + propStyle = uc_vend + uc( prop ); + + div.setAttribute( "style", vend_prop ); + + if( !!div.style[ propStyle ] ) { + ret = true; + } + }, + check_vends = check_vend ? [ check_vend ] : vendors, + ret; + + for( i = 0; i < check_vends.length; i++ ) { + check_style( check_vends[i] ); + } + return !!ret; +} + +// Thanks to Modernizr src for this test idea. `perspective` check is limited to Moz to prevent a false positive for 3D transforms on Android. +function transform3dTest() { + var prop = "transform-3d"; + return validStyle( 'perspective', '10px', 'moz' ) || $.mobile.media( "(-" + vendors.join( "-" + prop + "),(-" ) + "-" + prop + "),(" + prop + ")" ); +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "<base>", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "<a href='testurl' />" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.extend( $.mobile, { browser: {} } ); +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + // added {} to silence closure compiler warnings. registering my dislike of all things + // overly clever here for future reference + while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ){}; + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window, + touch: "ontouchend" in document, + cssTransitions: "WebKitTransitionEvent" in window || validStyle( 'transition', 'height 100ms linear' ), + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + cssTransform3d: transform3dTest(), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function(){ + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +// Support conditions that must be met in order to proceed +// default enhanced qualifications are media query support OR IE 7+ +$.mobile.gradeA = function(){ + return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7; +}; + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); + +(function( $, window, undefined ) { + +// add new event shortcuts +$.each( ( "touchstart touchmove touchend orientationchange throttledresize " + + "tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + $.attrFn[ name ] = true; +}); + +var supportTouch = $.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + +function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; +} + +// also handles scrollstop +$.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout(function() { + trigger( event, false ); + }, 50 ); + }); + } +}; + +// also handles taphold +$.event.special.tap = { + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ); + $( document ).unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler(event) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget == event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + $( document ).bind( "vmousecancel", clearTapHandlers ); + + timer = setTimeout(function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); + }, 750 ); + }); + } +}; + +// also handles swipeleft, swiperight +$.event.special.swipe = { + scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } +}; + +(function( $, window ) { + // "Cowboy" Ben Alman + + var win = $( window ), + special_event, + get_orientation, + last_orientation, + initial_orientation_is_landscape, + initial_orientation_is_default, + portrait_map = { "0": true, "180": true }; + + // It seems that some device/browser vendors use window.orientation values 0 and 180 to + // denote the "default" orientation. For iOS devices, and most other smart-phones tested, + // the default orientation is always "portrait", but in some Android and RIM based tablets, + // the default orientation is "landscape". The following code attempts to use the window + // dimensions to figure out what the current orientation is, and then makes adjustments + // to the to the portrait_map if necessary, so that we can properly decode the + // window.orientation value whenever get_orientation() is called. + // + // Note that we used to use a media query to figure out what the orientation the browser + // thinks it is in: + // + // initial_orientation_is_landscape = $.mobile.media("all and (orientation: landscape)"); + // + // but there was an iPhone/iPod Touch bug beginning with iOS 4.2, up through iOS 5.1, + // where the browser *ALWAYS* applied the landscape media query. This bug does not + // happen on iPad. + + if ( $.support.orientation ) { + + // Check the window width and height to figure out what the current orientation + // of the device is at this moment. Note that we've initialized the portrait map + // values to 0 and 180, *AND* we purposely check for landscape so that if we guess + // wrong, , we default to the assumption that portrait is the default orientation. + // We use a threshold check below because on some platforms like iOS, the iPhone + // form-factor can report a larger width than height if the user turns on the + // developer console. The actual threshold value is somewhat arbitrary, we just + // need to make sure it is large enough to exclude the developer console case. + + var ww = window.innerWidth || $( window ).width(), + wh = window.innerHeight || $( window ).height(), + landscape_threshold = 50; + + initial_orientation_is_landscape = ww > wh && ( ww - wh ) > landscape_threshold; + + + // Now check to see if the current window.orientation is 0 or 180. + initial_orientation_is_default = portrait_map[ window.orientation ]; + + // If the initial orientation is landscape, but window.orientation reports 0 or 180, *OR* + // if the initial orientation is portrait, but window.orientation reports 90 or -90, we + // need to flip our portrait_map values because landscape is the default orientation for + // this device/browser. + if ( ( initial_orientation_is_landscape && initial_orientation_is_default ) || ( !initial_orientation_is_landscape && !initial_orientation_is_default ) ) { + portrait_map = { "-90": true, "90": true }; + } + } + + $.event.special.orientationchange = special_event = { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function(){ + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }; + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( "orientationchange" ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = portrait_map[ window.orientation ]; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + +})( jQuery, window ); + + +// throttled resize event +(function() { + + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function(){ + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; +})(); + + +$.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" +}, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.widget( "mobile.page", $.mobile.widget, { + options: { + theme: "c", + domCache: false, + keepNativeDefault: ":jqmData(role='none'), :jqmData(role='nojs')" + }, + + _create: function() { + + var self = this; + + // if false is returned by the callbacks do not create the page + if( self._trigger( "beforecreate" ) === false ){ + return false; + } + + self.element + .attr( "tabindex", "0" ) + .addClass( "ui-page ui-body-" + self.options.theme ) + .bind( "pagebeforehide", function(){ + self.removeContainerBackground(); + } ) + .bind( "pagebeforeshow", function(){ + self.setContainerBackground(); + } ); + + }, + + removeContainerBackground: function(){ + $.mobile.pageContainer.removeClass( "ui-overlay-" + $.mobile.getInheritedTheme( this.element.parent() ) ); + }, + + // set the page container background to the page theme + setContainerBackground: function( theme ){ + if( this.options.theme ){ + $.mobile.pageContainer.addClass( "ui-overlay-" + ( theme || this.options.theme ) ); + } + }, + + keepNativeSelector: function() { + var options = this.options, + keepNativeDefined = options.keepNative && $.trim(options.keepNative); + + if( keepNativeDefined && options.keepNative !== options.keepNativeDefault ){ + return [options.keepNative, options.keepNativeDefault].join(", "); + } + + return options.keepNativeDefault; + } +}); +})( jQuery ); + + +(function( $, window, undefined ) { + +var createHandler = function( sequential ){ + + // Default to sequential + if( sequential === undefined ){ + sequential = true; + } + + return function( name, reverse, $to, $from ) { + + var deferred = new $.Deferred(), + reverseClass = reverse ? " reverse" : "", + active = $.mobile.urlHistory.getActive(), + toScroll = active.lastScroll || $.mobile.defaultHomeScroll, + screenHeight = $.mobile.getScreenHeight(), + maxTransitionOverride = $.mobile.maxTransitionWidth !== false && $( window ).width() > $.mobile.maxTransitionWidth, + none = !$.support.cssTransitions || maxTransitionOverride || !name || name === "none", + toggleViewportClass = function(){ + $.mobile.pageContainer.toggleClass( "ui-mobile-viewport-transitioning viewport-" + name ); + }, + scrollPage = function(){ + // By using scrollTo instead of silentScroll, we can keep things better in order + // Just to be precautios, disable scrollstart listening like silentScroll would + $.event.special.scrollstart.enabled = false; + + window.scrollTo( 0, toScroll ); + + // reenable scrollstart listening like silentScroll would + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + cleanFrom = function(){ + $from + .removeClass( $.mobile.activePageClass + " out in reverse " + name ) + .height( "" ); + }, + startOut = function(){ + // if it's not sequential, call the doneOut transition to start the TO page animating in simultaneously + if( !sequential ){ + doneOut(); + } + else { + $from.animationComplete( doneOut ); + } + + // Set the from page's height and start it transitioning out + // Note: setting an explicit height helps eliminate tiling in the transitions + $from + .height( screenHeight + $(window ).scrollTop() ) + .addClass( name + " out" + reverseClass ); + }, + + doneOut = function() { + + if ( $from && sequential ) { + cleanFrom(); + } + + startIn(); + }, + + startIn = function(){ + + $to.addClass( $.mobile.activePageClass ); + + // Send focus to page as it is now display: block + $.mobile.focusPage( $to ); + + // Set to page height + $to.height( screenHeight + toScroll ); + + scrollPage(); + + if( !none ){ + $to.animationComplete( doneIn ); + } + + $to.addClass( name + " in" + reverseClass ); + + if( none ){ + doneIn(); + } + + }, + + doneIn = function() { + + if ( !sequential ) { + + if( $from ){ + cleanFrom(); + } + } + + $to + .removeClass( "out in reverse " + name ) + .height( "" ); + + toggleViewportClass(); + + // In some browsers (iOS5), 3D transitions block the ability to scroll to the desired location during transition + // This ensures we jump to that spot after the fact, if we aren't there already. + if( $( window ).scrollTop() !== toScroll ){ + scrollPage(); + } + + deferred.resolve( name, reverse, $to, $from, true ); + }; + + toggleViewportClass(); + + if ( $from && !none ) { + startOut(); + } + else { + doneOut(); + } + + return deferred.promise(); + }; +} + +// generate the handlers from the above +var sequentialHandler = createHandler(), + simultaneousHandler = createHandler( false ); + +// Make our transition handler the public default. +$.mobile.defaultTransitionHandler = sequentialHandler; + +//transition handler dictionary for 3rd party transitions +$.mobile.transitionHandlers = { + "default": $.mobile.defaultTransitionHandler, + "sequential": sequentialHandler, + "simultaneous": simultaneousHandler +}; + +$.mobile.transitionFallbacks = {}; + +})( jQuery, this ); + +( function( $, undefined ) { + + //define vars for interal use + var $window = $( window ), + $html = $( 'html' ), + $head = $( 'head' ), + + //url path helpers for use in relative url management + path = { + + // This scary looking regular expression parses an absolute URL or its relative + // variants (protocol, site, document, query, and hash), into the various + // components (protocol, host, path, query, fragment, etc that make up the + // URL as well as some other commonly used sub-parts. When used with RegExp.exec() + // or String.match, it parses the URL into a results array that looks like this: + // + // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content + // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread + // [2]: http://jblas:password@mycompany.com:8080/mail/inbox + // [3]: http://jblas:password@mycompany.com:8080 + // [4]: http: + // [5]: // + // [6]: jblas:password@mycompany.com:8080 + // [7]: jblas:password + // [8]: jblas + // [9]: password + // [10]: mycompany.com:8080 + // [11]: mycompany.com + // [12]: 8080 + // [13]: /mail/inbox + // [14]: /mail/ + // [15]: inbox + // [16]: ?msg=1234&type=unread + // [17]: #msg-content + // + urlParseRE: /^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/, + + //Parse a URL into a structure that allows easy access to + //all of the URL components by name. + parseUrl: function( url ) { + // If we're passed an object, we'll assume that it is + // a parsed url object and just return it back to the caller. + if ( $.type( url ) === "object" ) { + return url; + } + + var matches = path.urlParseRE.exec( url || "" ) || []; + + // Create an object that allows the caller to access the sub-matches + // by name. Note that IE returns an empty string instead of undefined, + // like all other browsers do, so we normalize everything so its consistent + // no matter what browser we're running on. + return { + href: matches[ 0 ] || "", + hrefNoHash: matches[ 1 ] || "", + hrefNoSearch: matches[ 2 ] || "", + domain: matches[ 3 ] || "", + protocol: matches[ 4 ] || "", + doubleSlash: matches[ 5 ] || "", + authority: matches[ 6 ] || "", + username: matches[ 8 ] || "", + password: matches[ 9 ] || "", + host: matches[ 10 ] || "", + hostname: matches[ 11 ] || "", + port: matches[ 12 ] || "", + pathname: matches[ 13 ] || "", + directory: matches[ 14 ] || "", + filename: matches[ 15 ] || "", + search: matches[ 16 ] || "", + hash: matches[ 17 ] || "" + }; + }, + + //Turn relPath into an asbolute path. absPath is + //an optional absolute path which describes what + //relPath is relative to. + makePathAbsolute: function( relPath, absPath ) { + if ( relPath && relPath.charAt( 0 ) === "/" ) { + return relPath; + } + + relPath = relPath || ""; + absPath = absPath ? absPath.replace( /^\/|(\/[^\/]*|[^\/]+)$/g, "" ) : ""; + + var absStack = absPath ? absPath.split( "/" ) : [], + relStack = relPath.split( "/" ); + for ( var i = 0; i < relStack.length; i++ ) { + var d = relStack[ i ]; + switch ( d ) { + case ".": + break; + case "..": + if ( absStack.length ) { + absStack.pop(); + } + break; + default: + absStack.push( d ); + break; + } + } + return "/" + absStack.join( "/" ); + }, + + //Returns true if both urls have the same domain. + isSameDomain: function( absUrl1, absUrl2 ) { + return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain; + }, + + //Returns true for any relative variant. + isRelativeUrl: function( url ) { + // All relative Url variants have one thing in common, no protocol. + return path.parseUrl( url ).protocol === ""; + }, + + //Returns true for an absolute url. + isAbsoluteUrl: function( url ) { + return path.parseUrl( url ).protocol !== ""; + }, + + //Turn the specified realtive URL into an absolute one. This function + //can handle all relative variants (protocol, site, document, query, fragment). + makeUrlAbsolute: function( relUrl, absUrl ) { + if ( !path.isRelativeUrl( relUrl ) ) { + return relUrl; + } + + var relObj = path.parseUrl( relUrl ), + absObj = path.parseUrl( absUrl ), + protocol = relObj.protocol || absObj.protocol, + doubleSlash = relObj.protocol ? relObj.doubleSlash : ( relObj.doubleSlash || absObj.doubleSlash ), + authority = relObj.authority || absObj.authority, + hasPath = relObj.pathname !== "", + pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ), + search = relObj.search || ( !hasPath && absObj.search ) || "", + hash = relObj.hash; + + return protocol + doubleSlash + authority + pathname + search + hash; + }, + + //Add search (aka query) params to the specified url. + addSearchParams: function( url, params ) { + var u = path.parseUrl( url ), + p = ( typeof params === "object" ) ? $.param( params ) : params, + s = u.search || "?"; + return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" ); + }, + + convertUrlToDataUrl: function( absUrl ) { + var u = path.parseUrl( absUrl ); + if ( path.isEmbeddedPage( u ) ) { + // For embedded pages, remove the dialog hash key as in getFilePath(), + // otherwise the Data Url won't match the id of the embedded Page. + return u.hash.split( dialogHashKey )[0].replace( /^#/, "" ); + } else if ( path.isSameDomain( u, documentBase ) ) { + return u.hrefNoHash.replace( documentBase.domain, "" ); + } + return absUrl; + }, + + //get path from current hash, or from a file path + get: function( newPath ) { + if( newPath === undefined ) { + newPath = location.hash; + } + return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' ); + }, + + //return the substring of a filepath before the sub-page key, for making a server request + getFilePath: function( path ) { + var splitkey = '&' + $.mobile.subPageUrlKey; + return path && path.split( splitkey )[0].split( dialogHashKey )[0]; + }, + + //set location hash to path + set: function( path ) { + location.hash = path; + }, + + //test if a given url (string) is a path + //NOTE might be exceptionally naive + isPath: function( url ) { + return ( /\// ).test( url ); + }, + + //return a url path with the window's location protocol/hostname/pathname removed + clean: function( url ) { + return url.replace( documentBase.domain, "" ); + }, + + //just return the url without an initial # + stripHash: function( url ) { + return url.replace( /^#/, "" ); + }, + + //remove the preceding hash, any query params, and dialog notations + cleanHash: function( hash ) { + return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) ); + }, + + //check whether a url is referencing the same domain, or an external domain or different protocol + //could be mailto, etc + isExternal: function( url ) { + var u = path.parseUrl( url ); + return u.protocol && u.domain !== documentUrl.domain ? true : false; + }, + + hasProtocol: function( url ) { + return ( /^(:?\w+:)/ ).test( url ); + }, + + //check if the specified url refers to the first page in the main application document. + isFirstPageUrl: function( url ) { + // We only deal with absolute paths. + var u = path.parseUrl( path.makeUrlAbsolute( url, documentBase ) ), + + // Does the url have the same path as the document? + samePath = u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ), + + // Get the first page element. + fp = $.mobile.firstPage, + + // Get the id of the first page element if it has one. + fpId = fp && fp[0] ? fp[0].id : undefined; + + // The url refers to the first page if the path matches the document and + // it either has no hash value, or the hash is exactly equal to the id of the + // first page element. + return samePath && ( !u.hash || u.hash === "#" || ( fpId && u.hash.replace( /^#/, "" ) === fpId ) ); + }, + + isEmbeddedPage: function( url ) { + var u = path.parseUrl( url ); + + //if the path is absolute, then we need to compare the url against + //both the documentUrl and the documentBase. The main reason for this + //is that links embedded within external documents will refer to the + //application document, whereas links embedded within the application + //document will be resolved against the document base. + if ( u.protocol !== "" ) { + return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) ); + } + return (/^#/).test( u.href ); + } + }, + + //will be defined when a link is clicked and given an active class + $activeClickedLink = null, + + //urlHistory is purely here to make guesses at whether the back or forward button was clicked + //and provide an appropriate transition + urlHistory = { + // Array of pages that are visited during a single page load. + // Each has a url and optional transition, title, and pageUrl (which represents the file path, in cases where URL is obscured, such as dialogs) + stack: [], + + //maintain an index number for the active page in the stack + activeIndex: 0, + + //get active + getActive: function() { + return urlHistory.stack[ urlHistory.activeIndex ]; + }, + + getPrev: function() { + return urlHistory.stack[ urlHistory.activeIndex - 1 ]; + }, + + getNext: function() { + return urlHistory.stack[ urlHistory.activeIndex + 1 ]; + }, + + // addNew is used whenever a new page is added + addNew: function( url, transition, title, pageUrl, role ) { + //if there's forward history, wipe it + if( urlHistory.getNext() ) { + urlHistory.clearForward(); + } + + urlHistory.stack.push( {url : url, transition: transition, title: title, pageUrl: pageUrl, role: role } ); + + urlHistory.activeIndex = urlHistory.stack.length - 1; + }, + + //wipe urls ahead of active index + clearForward: function() { + urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 ); + }, + + directHashChange: function( opts ) { + var back , forward, newActiveIndex, prev = this.getActive(); + + // check if url isp in history and if it's ahead or behind current page + $.each( urlHistory.stack, function( i, historyEntry ) { + + //if the url is in the stack, it's a forward or a back + if( opts.currentUrl === historyEntry.url ) { + //define back and forward by whether url is older or newer than current page + back = i < urlHistory.activeIndex; + forward = !back; + newActiveIndex = i; + } + }); + + // save new page index, null check to prevent falsey 0 result + this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex; + + if( back ) { + ( opts.either || opts.isBack )( true ); + } else if( forward ) { + ( opts.either || opts.isForward )( false ); + } + }, + + //disable hashchange event listener internally to ignore one change + //toggled internally when location.hash is updated to match the url of a successful page load + ignoreNextHashChange: false + }, + + //define first selector to receive focus when a page is shown + focusable = "[tabindex],a,button:visible,select:visible,input", + + //queue to hold simultanious page transitions + pageTransitionQueue = [], + + //indicates whether or not page is in process of transitioning + isPageTransitioning = false, + + //nonsense hash change key for dialogs, so they create a history entry + dialogHashKey = "&ui-state=dialog", + + //existing base tag? + $base = $head.children( "base" ), + + //tuck away the original document URL minus any fragment. + documentUrl = path.parseUrl( location.href ), + + //if the document has an embedded base tag, documentBase is set to its + //initial value. If a base tag does not exist, then we default to the documentUrl. + documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl, + + //cache the comparison once. + documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash ); + + //base element management, defined depending on dynamic base tag support + var base = $.support.dynamicBaseTag ? { + + //define base element, for use in routing asset urls that are referenced in Ajax-requested markup + element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ), + + //set the generated BASE element's href attribute to a new page's base path + set: function( href ) { + base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) ); + }, + + //set the generated BASE element's href attribute to a new page's base path + reset: function() { + base.element.attr( "href", documentBase.hrefNoHash ); + } + + } : undefined; + +/* + internal utility functions +--------------------------------------*/ + + + //direct focus to the page title, or otherwise first focusable element + $.mobile.focusPage = function ( page ) { + var autofocus = page.find("[autofocus]"), + pageTitle = page.find( ".ui-title:eq(0)" ); + + if( autofocus.length ) { + autofocus.focus(); + return; + } + + if( pageTitle.length ) { + pageTitle.focus(); + } + else{ + page.focus(); + } + } + + //remove active classes after page transition or error + function removeActiveLinkClass( forceRemoval ) { + if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) { + $activeClickedLink.removeClass( $.mobile.activeBtnClass ); + } + $activeClickedLink = null; + } + + function releasePageTransitionLock() { + isPageTransitioning = false; + if( pageTransitionQueue.length > 0 ) { + $.mobile.changePage.apply( null, pageTransitionQueue.pop() ); + } + } + + // Save the last scroll distance per page, before it is hidden + var setLastScrollEnabled = true, + setLastScroll, delayedSetLastScroll; + + setLastScroll = function() { + // this barrier prevents setting the scroll value based on the browser + // scrolling the window based on a hashchange + if( !setLastScrollEnabled ) { + return; + } + + var active = $.mobile.urlHistory.getActive(); + + if( active ) { + var lastScroll = $window.scrollTop(); + + // Set active page's lastScroll prop. + // If the location we're scrolling to is less than minScrollBack, let it go. + active.lastScroll = lastScroll < $.mobile.minScrollBack ? $.mobile.defaultHomeScroll : lastScroll; + } + }; + + // bind to scrollstop to gather scroll position. The delay allows for the hashchange + // event to fire and disable scroll recording in the case where the browser scrolls + // to the hash targets location (sometimes the top of the page). once pagechange fires + // getLastScroll is again permitted to operate + delayedSetLastScroll = function() { + setTimeout( setLastScroll, 100 ); + }; + + // disable an scroll setting when a hashchange has been fired, this only works + // because the recording of the scroll position is delayed for 100ms after + // the browser might have changed the position because of the hashchange + $window.bind( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = false; + }); + + // handle initial hashchange from chrome :( + $window.one( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = true; + }); + + // wait until the mobile page container has been determined to bind to pagechange + $window.one( "pagecontainercreate", function(){ + // once the page has changed, re-enable the scroll recording + $.mobile.pageContainer.bind( "pagechange", function() { + + setLastScrollEnabled = true; + + // remove any binding that previously existed on the get scroll + // which may or may not be different than the scroll element determined for + // this page previously + $window.unbind( "scrollstop", delayedSetLastScroll ); + + // determine and bind to the current scoll element which may be the window + // or in the case of touch overflow the element with touch overflow + $window.bind( "scrollstop", delayedSetLastScroll ); + }); + }); + + // bind to scrollstop for the first page as "pagechange" won't be fired in that case + $window.bind( "scrollstop", delayedSetLastScroll ); + + //function for transitioning between two existing pages + function transitionPages( toPage, fromPage, transition, reverse ) { + + if( fromPage ) { + //trigger before show/hide events + fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } ); + } + + toPage.data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } ); + + //clear page loader + $.mobile.hidePageLoadingMsg(); + + // If transition is defined, check if css 3D transforms are supported, and if not, if a fallback is specified + if( transition && !$.support.cssTransform3d && $.mobile.transitionFallbacks[ transition ] ){ + transition = $.mobile.transitionFallbacks[ transition ]; + } + + //find the transition handler for the specified transition. If there + //isn't one in our transitionHandlers dictionary, use the default one. + //call the handler immediately to kick-off the transition. + var th = $.mobile.transitionHandlers[ transition || "default" ] || $.mobile.defaultTransitionHandler, + promise = th( transition, reverse, toPage, fromPage ); + + promise.done(function() { + + //trigger show/hide events + if( fromPage ) { + fromPage.data( "page" )._trigger( "hide", null, { nextPage: toPage } ); + } + + //trigger pageshow, define prevPage as either fromPage or empty jQuery obj + toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } ); + }); + + return promise; + } + + //simply set the active page's minimum height to screen height, depending on orientation + function getScreenHeight(){ + // Native innerHeight returns more accurate value for this across platforms, + // jQuery version is here as a normalized fallback for platforms like Symbian + return window.innerHeight || $( window ).height(); + } + + $.mobile.getScreenHeight = getScreenHeight; + + //simply set the active page's minimum height to screen height, depending on orientation + function resetActivePageHeight(){ + var aPage = $( "." + $.mobile.activePageClass ), + aPagePadT = parseFloat( aPage.css( "padding-top" ) ), + aPagePadB = parseFloat( aPage.css( "padding-bottom" ) ); + + aPage.css( "min-height", getScreenHeight() - aPagePadT - aPagePadB ); + } + + //shared page enhancements + function enhancePage( $page, role ) { + // If a role was specified, make sure the data-role attribute + // on the page element is in sync. + if( role ) { + $page.attr( "data-" + $.mobile.ns + "role", role ); + } + + //run page plugin + $page.page(); + } + +/* exposed $.mobile methods */ + + //animation complete callback + $.fn.animationComplete = function( callback ) { + if( $.support.cssTransitions ) { + return $( this ).one( 'webkitAnimationEnd animationend', callback ); + } + else{ + // defer execution for consistency between webkit/non webkit + setTimeout( callback, 0 ); + return $( this ); + } + }; + + //expose path object on $.mobile + $.mobile.path = path; + + //expose base object on $.mobile + $.mobile.base = base; + + //history stack + $.mobile.urlHistory = urlHistory; + + $.mobile.dialogHashKey = dialogHashKey; + + + + //enable cross-domain page support + $.mobile.allowCrossDomainPages = false; + + //return the original document url + $.mobile.getDocumentUrl = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href; + }; + + //return the original document base url + $.mobile.getDocumentBase = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href; + }; + + $.mobile._bindPageRemove = function() { + var page = $(this); + + // when dom caching is not enabled or the page is embedded bind to remove the page on hide + if( !page.data("page").options.domCache + && page.is(":jqmData(external-page='true')") ) { + + page.bind( 'pagehide.remove', function() { + var $this = $( this ), + prEvent = new $.Event( "pageremove" ); + + $this.trigger( prEvent ); + + if( !prEvent.isDefaultPrevented() ){ + $this.removeWithDependents(); + } + }); + } + }; + + // Load a page into the DOM. + $.mobile.loadPage = function( url, options ) { + // This function uses deferred notifications to let callers + // know when the page is done loading, or if an error has occurred. + var deferred = $.Deferred(), + + // The default loadPage options with overrides specified by + // the caller. + settings = $.extend( {}, $.mobile.loadPage.defaults, options ), + + // The DOM element for the page after it has been loaded. + page = null, + + // If the reloadPage option is true, and the page is already + // in the DOM, dupCachedPage will be set to the page element + // so that it can be removed after the new version of the + // page is loaded off the network. + dupCachedPage = null, + + // determine the current base url + findBaseWithDefault = function(){ + var closestBase = ( $.mobile.activePage && getClosestBaseUrl( $.mobile.activePage ) ); + return closestBase || documentBase.hrefNoHash; + }, + + // The absolute version of the URL passed into the function. This + // version of the URL may contain dialog/subpage params in it. + absUrl = path.makeUrlAbsolute( url, findBaseWithDefault() ); + + + // If the caller provided data, and we're using "get" request, + // append the data to the URL. + if ( settings.data && settings.type === "get" ) { + absUrl = path.addSearchParams( absUrl, settings.data ); + settings.data = undefined; + } + + // If the caller is using a "post" request, reloadPage must be true + if( settings.data && settings.type === "post" ){ + settings.reloadPage = true; + } + + // The absolute version of the URL minus any dialog/subpage params. + // In otherwords the real URL of the page to be loaded. + var fileUrl = path.getFilePath( absUrl ), + + // The version of the Url actually stored in the data-url attribute of + // the page. For embedded pages, it is just the id of the page. For pages + // within the same domain as the document base, it is the site relative + // path. For cross-domain pages (Phone Gap only) the entire absolute Url + // used to load the page. + dataUrl = path.convertUrlToDataUrl( absUrl ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Check to see if the page already exists in the DOM. + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + + // If we failed to find the page, check to see if the url is a + // reference to an embedded page. If so, it may have been dynamically + // injected by a developer, in which case it would be lacking a data-url + // attribute and in need of enhancement. + if ( page.length === 0 && dataUrl && !path.isPath( dataUrl ) ) { + page = settings.pageContainer.children( "#" + dataUrl ) + .attr( "data-" + $.mobile.ns + "url", dataUrl ); + } + + // If we failed to find a page in the DOM, check the URL to see if it + // refers to the first page in the application. If it isn't a reference + // to the first page and refers to non-existent embedded page, error out. + if ( page.length === 0 ) { + if ( $.mobile.firstPage && path.isFirstPageUrl( fileUrl ) ) { + // Check to make sure our cached-first-page is actually + // in the DOM. Some user deployed apps are pruning the first + // page from the DOM for various reasons, we check for this + // case here because we don't want a first-page with an id + // falling through to the non-existent embedded page error + // case. If the first-page is not in the DOM, then we let + // things fall through to the ajax loading code below so + // that it gets reloaded. + if ( $.mobile.firstPage.parent().length ) { + page = $( $.mobile.firstPage ); + } + } else if ( path.isEmbeddedPage( fileUrl ) ) { + deferred.reject( absUrl, options ); + return deferred.promise(); + } + } + + // Reset base to the default document base. + if ( base ) { + base.reset(); + } + + // If the page we are interested in is already in the DOM, + // and the caller did not indicate that we should force a + // reload of the file, we are done. Otherwise, track the + // existing page as a duplicated. + if ( page.length ) { + if ( !settings.reloadPage ) { + enhancePage( page, settings.role ); + deferred.resolve( absUrl, options, page ); + return deferred.promise(); + } + dupCachedPage = page; + } + + var mpc = settings.pageContainer, + pblEvent = new $.Event( "pagebeforeload" ), + triggerData = { url: url, absUrl: absUrl, dataUrl: dataUrl, deferred: deferred, options: settings }; + + // Let listeners know we're about to load a page. + mpc.trigger( pblEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pblEvent.isDefaultPrevented() ){ + return deferred.promise(); + } + + if ( settings.showLoadMsg ) { + + // This configurable timeout allows cached pages a brief delay to load without showing a message + var loadMsgDelay = setTimeout(function(){ + $.mobile.showPageLoadingMsg(); + }, settings.loadMsgDelay ), + + // Shared logic for clearing timeout and removing message. + hideMsg = function(){ + + // Stop message show timer + clearTimeout( loadMsgDelay ); + + // Hide loading message + $.mobile.hidePageLoadingMsg(); + }; + } + + if ( !( $.mobile.allowCrossDomainPages || path.isSameDomain( documentUrl, absUrl ) ) ) { + deferred.reject( absUrl, options ); + } else { + // Load the new page. + $.ajax({ + url: fileUrl, + type: settings.type, + data: settings.data, + dataType: "html", + success: function( html, textStatus, xhr ) { + //pre-parse html to check for a data-url, + //use it as the new fileUrl, base path, etc + var all = $( "<div></div>" ), + + //page title regexp + newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1, + + // TODO handle dialogs again + pageElemRegex = new RegExp( "(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>)" ), + dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" ); + + + // data-url must be provided for the base tag so resource requests can be directed to the + // correct url. loading into a temprorary element makes these requests immediately + if( pageElemRegex.test( html ) + && RegExp.$1 + && dataUrlRegex.test( RegExp.$1 ) + && RegExp.$1 ) { + url = fileUrl = path.getFilePath( RegExp.$1 ); + } + + if ( base ) { + base.set( fileUrl ); + } + + //workaround to allow scripts to execute when included in page divs + all.get( 0 ).innerHTML = html; + page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first(); + + //if page elem couldn't be found, create one and insert the body element's contents + if( !page.length ){ + page = $( "<div data-" + $.mobile.ns + "role='page'>" + html.split( /<\/?body[^>]*>/gmi )[1] + "</div>" ); + } + + if ( newPageTitle && !page.jqmData( "title" ) ) { + if ( ~newPageTitle.indexOf( "&" ) ) { + newPageTitle = $( "<div>" + newPageTitle + "</div>" ).text(); + } + page.jqmData( "title", newPageTitle ); + } + + //rewrite src and href attrs to use a base url + if( !$.support.dynamicBaseTag ) { + var newPath = path.get( fileUrl ); + page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() { + var thisAttr = $( this ).is( '[href]' ) ? 'href' : + $(this).is('[src]') ? 'src' : 'action', + thisUrl = $( this ).attr( thisAttr ); + + // XXX_jblas: We need to fix this so that it removes the document + // base URL, and then prepends with the new page URL. + //if full path exists and is same, chop it - helps IE out + thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' ); + + if( !/^(\w+:|#|\/)/.test( thisUrl ) ) { + $( this ).attr( thisAttr, newPath + thisUrl ); + } + }); + } + + //append to page and enhance + // TODO taging a page with external to make sure that embedded pages aren't removed + // by the various page handling code is bad. Having page handling code in many + // places is bad. Solutions post 1.0 + page + .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) ) + .attr( "data-" + $.mobile.ns + "external-page", true ) + .appendTo( settings.pageContainer ); + + // wait for page creation to leverage options defined on widget + page.one( 'pagecreate', $.mobile._bindPageRemove ); + + enhancePage( page, settings.role ); + + // Enhancing the page may result in new dialogs/sub pages being inserted + // into the DOM. If the original absUrl refers to a sub-page, that is the + // real page we are interested in. + if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) { + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + } + + //bind pageHide to removePage after it's hidden, if the page options specify to do so + + // Remove loading message. + if ( settings.showLoadMsg ) { + hideMsg(); + } + + // Add the page reference and xhr to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.page = page; + + // Let listeners know the page loaded successfully. + settings.pageContainer.trigger( "pageload", triggerData ); + + deferred.resolve( absUrl, options, page, dupCachedPage ); + }, + error: function( xhr, textStatus, errorThrown ) { + //set base back to current path + if( base ) { + base.set( path.get() ); + } + + // Add error info to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.errorThrown = errorThrown; + + var plfEvent = new $.Event( "pageloadfailed" ); + + // Let listeners know the page load failed. + settings.pageContainer.trigger( plfEvent, triggerData ); + + // If the default behavior is prevented, stop here! + // Note that it is the responsibility of the listener/handler + // that called preventDefault(), to resolve/reject the + // deferred object within the triggerData. + if( plfEvent.isDefaultPrevented() ){ + return; + } + + // Remove loading message. + if ( settings.showLoadMsg ) { + + // Remove loading message. + hideMsg(); + + // show error message + $.mobile.showPageLoadingMsg( $.mobile.pageLoadErrorMessageTheme, $.mobile.pageLoadErrorMessage, true ); + + // hide after delay + setTimeout( $.mobile.hidePageLoadingMsg, 1500 ); + } + + deferred.reject( absUrl, options ); + } + }); + } + + return deferred.promise(); + }; + + $.mobile.loadPage.defaults = { + type: "get", + data: undefined, + reloadPage: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + showLoadMsg: false, + pageContainer: undefined, + loadMsgDelay: 50 // This delay allows loads that pull from browser cache to occur without showing the loading message. + }; + + // Show a specific page in the page container. + $.mobile.changePage = function( toPage, options ) { + // If we are in the midst of a transition, queue the current request. + // We'll call changePage() once we're done with the current transition to + // service the request. + if( isPageTransitioning ) { + pageTransitionQueue.unshift( arguments ); + return; + } + + var settings = $.extend( {}, $.mobile.changePage.defaults, options ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Make sure we have a fromPage. + settings.fromPage = settings.fromPage || $.mobile.activePage; + + var mpc = settings.pageContainer, + pbcEvent = new $.Event( "pagebeforechange" ), + triggerData = { toPage: toPage, options: settings }; + + // Let listeners know we're about to change the current page. + mpc.trigger( pbcEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pbcEvent.isDefaultPrevented() ){ + return; + } + + // We allow "pagebeforechange" observers to modify the toPage in the trigger + // data to allow for redirects. Make sure our toPage is updated. + + toPage = triggerData.toPage; + + // Set the isPageTransitioning flag to prevent any requests from + // entering this method while we are in the midst of loading a page + // or transitioning. + + isPageTransitioning = true; + + // If the caller passed us a url, call loadPage() + // to make sure it is loaded into the DOM. We'll listen + // to the promise object it returns so we know when + // it is done loading or if an error ocurred. + if ( typeof toPage == "string" ) { + $.mobile.loadPage( toPage, settings ) + .done(function( url, options, newPage, dupCachedPage ) { + isPageTransitioning = false; + options.duplicateCachedPage = dupCachedPage; + $.mobile.changePage( newPage, options ); + }) + .fail(function( url, options ) { + isPageTransitioning = false; + + //clear out the active button state + removeActiveLinkClass( true ); + + //release transition lock so navigation is free again + releasePageTransitionLock(); + settings.pageContainer.trigger( "pagechangefailed", triggerData ); + }); + return; + } + + // If we are going to the first-page of the application, we need to make + // sure settings.dataUrl is set to the application document url. This allows + // us to avoid generating a document url with an id hash in the case where the + // first-page of the document has an id attribute specified. + if ( toPage[ 0 ] === $.mobile.firstPage[ 0 ] && !settings.dataUrl ) { + settings.dataUrl = documentUrl.hrefNoHash; + } + + // The caller passed us a real page DOM element. Update our + // internal state and then trigger a transition to the page. + var fromPage = settings.fromPage, + url = ( settings.dataUrl && path.convertUrlToDataUrl( settings.dataUrl ) ) || toPage.jqmData( "url" ), + // The pageUrl var is usually the same as url, except when url is obscured as a dialog url. pageUrl always contains the file path + pageUrl = url, + fileUrl = path.getFilePath( url ), + active = urlHistory.getActive(), + activeIsInitialPage = urlHistory.activeIndex === 0, + historyDir = 0, + pageTitle = document.title, + isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog"; + + // By default, we prevent changePage requests when the fromPage and toPage + // are the same element, but folks that generate content manually/dynamically + // and reuse pages want to be able to transition to the same page. To allow + // this, they will need to change the default value of allowSamePageTransition + // to true, *OR*, pass it in as an option when they manually call changePage(). + // It should be noted that our default transition animations assume that the + // formPage and toPage are different elements, so they may behave unexpectedly. + // It is up to the developer that turns on the allowSamePageTransitiona option + // to either turn off transition animations, or make sure that an appropriate + // animation transition is used. + if( fromPage && fromPage[0] === toPage[0] && !settings.allowSamePageTransition ) { + isPageTransitioning = false; + mpc.trigger( "pagechange", triggerData ); + return; + } + + // We need to make sure the page we are given has already been enhanced. + enhancePage( toPage, settings.role ); + + // If the changePage request was sent from a hashChange event, check to see if the + // page is already within the urlHistory stack. If so, we'll assume the user hit + // the forward/back button and will try to match the transition accordingly. + if( settings.fromHashChange ) { + urlHistory.directHashChange({ + currentUrl: url, + isBack: function() { historyDir = -1; }, + isForward: function() { historyDir = 1; } + }); + } + + // Kill the keyboard. + // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead, + // we should be tracking focus with a delegate() handler so we already have + // the element in hand at this point. + // Wrap this in a try/catch block since IE9 throw "Unspecified error" if document.activeElement + // is undefined when we are in an IFrame. + try { + if(document.activeElement && document.activeElement.nodeName.toLowerCase() != 'body') { + $(document.activeElement).blur(); + } else { + $( "input:focus, textarea:focus, select:focus" ).blur(); + } + } catch(e) {} + + // If we're displaying the page as a dialog, we don't want the url + // for the dialog content to be used in the hash. Instead, we want + // to append the dialogHashKey to the url of the current page. + if ( isDialog && active ) { + // on the initial page load active.url is undefined and in that case should + // be an empty string. Moving the undefined -> empty string back into + // urlHistory.addNew seemed imprudent given undefined better represents + // the url state + url = ( active.url || "" ) + dialogHashKey; + } + + // Set the location hash. + if( settings.changeHash !== false && url ) { + //disable hash listening temporarily + urlHistory.ignoreNextHashChange = true; + //update hash and history + path.set( url ); + } + + // if title element wasn't found, try the page div data attr too + // If this is a deep-link or a reload ( active === undefined ) then just use pageTitle + var newPageTitle = ( !active )? pageTitle : toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).getEncodedText(); + if( !!newPageTitle && pageTitle == document.title ) { + pageTitle = newPageTitle; + } + if ( !toPage.jqmData( "title" ) ) { + toPage.jqmData( "title", pageTitle ); + } + + // Make sure we have a transition defined. + settings.transition = settings.transition + || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined ) + || ( isDialog ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition ); + + //add page to history stack if it's not back or forward + if( !historyDir ) { + urlHistory.addNew( url, settings.transition, pageTitle, pageUrl, settings.role ); + } + + //set page title + document.title = urlHistory.getActive().title; + + //set "toPage" as activePage + $.mobile.activePage = toPage; + + // If we're navigating back in the URL history, set reverse accordingly. + settings.reverse = settings.reverse || historyDir < 0; + + transitionPages( toPage, fromPage, settings.transition, settings.reverse ) + .done(function( name, reverse, $to, $from, alreadyFocused ) { + removeActiveLinkClass(); + + //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden + if ( settings.duplicateCachedPage ) { + settings.duplicateCachedPage.remove(); + } + + // Send focus to the newly shown page. Moved from promise .done binding in transitionPages + // itself to avoid ie bug that reports offsetWidth as > 0 (core check for visibility) + // despite visibility: hidden addresses issue #2965 + // https://github.com/jquery/jquery-mobile/issues/2965 + if( !alreadyFocused ){ + $.mobile.focusPage( toPage ); + } + + releasePageTransitionLock(); + + // Let listeners know we're all done changing the current page. + mpc.trigger( "pagechange", triggerData ); + }); + }; + + $.mobile.changePage.defaults = { + transition: undefined, + reverse: false, + changeHash: true, + fromHashChange: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + duplicateCachedPage: undefined, + pageContainer: undefined, + showLoadMsg: true, //loading message shows by default when pages are being fetched during changePage + dataUrl: undefined, + fromPage: undefined, + allowSamePageTransition: false + }; + +/* Event Bindings - hashchange, submit, and click */ + function findClosestLink( ele ) + { + while ( ele ) { + // Look for the closest element with a nodeName of "a". + // Note that we are checking if we have a valid nodeName + // before attempting to access it. This is because the + // node we get called with could have originated from within + // an embedded SVG document where some symbol instance elements + // don't have nodeName defined on them, or strings are of type + // SVGAnimatedString. + if ( ( typeof ele.nodeName === "string" ) && ele.nodeName.toLowerCase() == "a" ) { + break; + } + ele = ele.parentNode; + } + return ele; + } + + // The base URL for any given element depends on the page it resides in. + function getClosestBaseUrl( ele ) + { + // Find the closest page and extract out its url. + var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ), + base = documentBase.hrefNoHash; + + if ( !url || !path.isPath( url ) ) { + url = base; + } + + return path.makeUrlAbsolute( url, base); + } + + + //The following event bindings should be bound after mobileinit has been triggered + //the following function is called in the init file + $.mobile._registerInternalEvents = function(){ + + //bind to form submit events, handle with Ajax + $( document ).delegate( "form", "submit", function( event ) { + var $this = $( this ); + + if( !$.mobile.ajaxEnabled || + // test that the form is, itself, ajax false + $this.is(":jqmData(ajax='false')") || + // test that $.mobile.ignoreContentEnabled is set and + // the form or one of it's parents is ajax=false + !$this.jqmHijackable().length ) { + return; + } + + var type = $this.attr( "method" ), + target = $this.attr( "target" ), + url = $this.attr( "action" ); + + // If no action is specified, browsers default to using the + // URL of the document containing the form. Since we dynamically + // pull in pages from external documents, the form should submit + // to the URL for the source document of the page containing + // the form. + if ( !url ) { + // Get the @data-url for the page containing the form. + url = getClosestBaseUrl( $this ); + if ( url === documentBase.hrefNoHash ) { + // The url we got back matches the document base, + // which means the page must be an internal/embedded page, + // so default to using the actual document url as a browser + // would. + url = documentUrl.hrefNoSearch; + } + } + + url = path.makeUrlAbsolute( url, getClosestBaseUrl($this) ); + + //external submits use regular HTTP + if( path.isExternal( url ) || target ) { + return; + } + + $.mobile.changePage( + url, + { + type: type && type.length && type.toLowerCase() || "get", + data: $this.serialize(), + transition: $this.jqmData( "transition" ), + direction: $this.jqmData( "direction" ), + reloadPage: true + } + ); + event.preventDefault(); + }); + + //add active state on vclick + $( document ).bind( "vclick", function( event ) { + // if this isn't a left click we don't care. Its important to note + // that when the virtual event is generated it will create the which attr + if ( event.which > 1 || !$.mobile.linkBindingEnabled ) { + return; + } + + var link = findClosestLink( event.target ); + + // split from the previous return logic to avoid find closest where possible + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !$(link).jqmHijackable().length ) { + return; + } + + if ( link ) { + if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) { + removeActiveLinkClass( true ); + $activeClickedLink = $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ); + $activeClickedLink.addClass( $.mobile.activeBtnClass ); + $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur(); + + // By caching the href value to data and switching the href to a #, we can avoid address bar showing in iOS. The click handler resets the href during its initial steps if this data is present + $( link ) + .jqmData( "href", $( link ).attr( "href" ) ) + .attr( "href", "#" ); + } + } + }); + + // click routing - direct to HTTP or Ajax, accordingly + $( document ).bind( "click", function( event ) { + if( !$.mobile.linkBindingEnabled ){ + return; + } + + var link = findClosestLink( event.target ), $link = $( link ), httpCleanup; + + // If there is no link associated with the click or its not a left + // click we want to ignore the click + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !link || event.which > 1 || !$link.jqmHijackable().length ) { + return; + } + + //remove active link class if external (then it won't be there if you come back) + httpCleanup = function(){ + window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 ); + }; + + // If there's data cached for the real href value, set the link's href back to it again. This pairs with an address bar workaround from the vclick handler + if( $link.jqmData( "href" ) ){ + $link.attr( "href", $link.jqmData( "href" ) ); + } + + //if there's a data-rel=back attr, go back in history + if( $link.is( ":jqmData(rel='back')" ) ) { + window.history.back(); + return false; + } + + var baseUrl = getClosestBaseUrl( $link ), + + //get href, if defined, otherwise default to empty hash + href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl ); + + //if ajax is disabled, exit early + if( !$.mobile.ajaxEnabled && !path.isEmbeddedPage( href ) ){ + httpCleanup(); + //use default click handling + return; + } + + // XXX_jblas: Ideally links to application pages should be specified as + // an url to the application document with a hash that is either + // the site relative path or id to the page. But some of the + // internal code that dynamically generates sub-pages for nested + // lists and select dialogs, just write a hash in the link they + // create. This means the actual URL path is based on whatever + // the current value of the base tag is at the time this code + // is called. For now we are just assuming that any url with a + // hash in it is an application page reference. + if ( href.search( "#" ) != -1 ) { + href = href.replace( /[^#]*#/, "" ); + if ( !href ) { + //link was an empty hash meant purely + //for interaction, so we ignore it. + event.preventDefault(); + return; + } else if ( path.isPath( href ) ) { + //we have apath so make it the href we want to load. + href = path.makeUrlAbsolute( href, baseUrl ); + } else { + //we have a simple id so use the documentUrl as its base. + href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash ); + } + } + + // Should we handle this link, or let the browser deal with it? + var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ), + + // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR + // requests if the document doing the request was loaded via the file:// protocol. + // This is usually to allow the application to "phone home" and fetch app specific + // data. We normally let the browser handle external/cross-domain urls, but if the + // allowCrossDomainPages option is true, we will allow cross-domain http/https + // requests to go through our page loading logic. + isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ), + + //check for protocol or rel and its not an embedded page + //TODO overlap in logic from isExternal, rel=external check should be + // moved into more comprehensive isExternalLink + isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad ); + + if( isExternal ) { + httpCleanup(); + //use default click handling + return; + } + + //use ajax + var transition = $link.jqmData( "transition" ), + direction = $link.jqmData( "direction" ), + reverse = ( direction && direction === "reverse" ) || + // deprecated - remove by 1.0 + $link.jqmData( "back" ), + + //this may need to be more specific as we use data-rel more + role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined; + + $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } ); + event.preventDefault(); + }); + + //prefetch pages when anchors with data-prefetch are encountered + $( document ).delegate( ".ui-page", "pageshow.prefetch", function() { + var urls = []; + $( this ).find( "a:jqmData(prefetch)" ).each(function(){ + var $link = $(this), + url = $link.attr( "href" ); + + if ( url && $.inArray( url, urls ) === -1 ) { + urls.push( url ); + + $.mobile.loadPage( url, {role: $link.attr("data-" + $.mobile.ns + "rel")} ); + } + }); + }); + + $.mobile._handleHashChange = function( hash ) { + //find first page via hash + var to = path.stripHash( hash ), + //transition is false if it's the first page, undefined otherwise (and may be overridden by default) + transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined, + + // default options for the changPage calls made after examining the current state + // of the page and the hash + changePageOptions = { + transition: transition, + changeHash: false, + fromHashChange: true + }; + + //if listening is disabled (either globally or temporarily), or it's a dialog hash + if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) { + urlHistory.ignoreNextHashChange = false; + return; + } + + // special case for dialogs + if( urlHistory.stack.length > 1 && to.indexOf( dialogHashKey ) > -1 ) { + + // If current active page is not a dialog skip the dialog and continue + // in the same direction + if(!$.mobile.activePage.is( ".ui-dialog" )) { + //determine if we're heading forward or backward and continue accordingly past + //the current dialog + urlHistory.directHashChange({ + currentUrl: to, + isBack: function() { window.history.back(); }, + isForward: function() { window.history.forward(); } + }); + + // prevent changePage() + return; + } else { + // if the current active page is a dialog and we're navigating + // to a dialog use the dialog objected saved in the stack + urlHistory.directHashChange({ + currentUrl: to, + + // regardless of the direction of the history change + // do the following + either: function( isBack ) { + var active = $.mobile.urlHistory.getActive(); + + to = active.pageUrl; + + // make sure to set the role, transition and reversal + // as most of this is lost by the domCache cleaning + $.extend( changePageOptions, { + role: active.role, + transition: active.transition, + reverse: isBack + }); + } + }); + } + } + + //if to is defined, load it + if ( to ) { + // At this point, 'to' can be one of 3 things, a cached page element from + // a history stack entry, an id, or site-relative/absolute URL. If 'to' is + // an id, we need to resolve it against the documentBase, not the location.href, + // since the hashchange could've been the result of a forward/backward navigation + // that crosses from an external page/dialog to an internal page/dialog. + to = ( typeof to === "string" && !path.isPath( to ) ) ? ( path.makeUrlAbsolute( '#' + to, documentBase ) ) : to; + $.mobile.changePage( to, changePageOptions ); + } else { + //there's no hash, go to the first page in the dom + $.mobile.changePage( $.mobile.firstPage, changePageOptions ); + } + }; + + //hashchange event handler + $window.bind( "hashchange", function( e, triggered ) { + $.mobile._handleHashChange( location.hash ); + }); + + //set page min-heights to be device specific + $( document ).bind( "pageshow", resetActivePageHeight ); + $( window ).bind( "throttledresize", resetActivePageHeight ); + + };//_registerInternalEvents callback + +})( jQuery ); + +( function( $, window ) { + // For now, let's Monkeypatch this onto the end of $.mobile._registerInternalEvents + // Scope self to pushStateHandler so we can reference it sanely within the + // methods handed off as event handlers + var pushStateHandler = {}, + self = pushStateHandler, + $win = $( window ), + url = $.mobile.path.parseUrl( location.href ); + + $.extend( pushStateHandler, { + // TODO move to a path helper, this is rather common functionality + initialFilePath: (function() { + return url.pathname + url.search; + })(), + + initialHref: url.hrefNoHash, + + state: function() { + return { + hash: location.hash || "#" + self.initialFilePath, + title: document.title, + + // persist across refresh + initialHref: self.initialHref + }; + }, + + resetUIKeys: function( url ) { + var dialog = $.mobile.dialogHashKey, + subkey = "&" + $.mobile.subPageUrlKey, + dialogIndex = url.indexOf( dialog ); + + if( dialogIndex > -1 ) { + url = url.slice( 0, dialogIndex ) + "#" + url.slice( dialogIndex ); + } else if( url.indexOf( subkey ) > -1 ) { + url = url.split( subkey ).join( "#" + subkey ); + } + + return url; + }, + + hashValueAfterReset: function( url ) { + var resetUrl = self.resetUIKeys( url ); + return $.mobile.path.parseUrl( resetUrl ).hash; + }, + + // TODO sort out a single barrier to hashchange functionality + nextHashChangePrevented: function( value ) { + $.mobile.urlHistory.ignoreNextHashChange = value; + self.onHashChangeDisabled = value; + }, + + // on hash change we want to clean up the url + // NOTE this takes place *after* the vanilla navigation hash change + // handling has taken place and set the state of the DOM + onHashChange: function( e ) { + // disable this hash change + if( self.onHashChangeDisabled ){ + return; + } + + var href, state, + hash = location.hash, + isPath = $.mobile.path.isPath( hash ), + resolutionUrl = isPath ? location.href : $.mobile.getDocumentUrl(); + + hash = isPath ? hash.replace( "#", "" ) : hash; + + + // propulate the hash when its not available + state = self.state(); + + // make the hash abolute with the current href + href = $.mobile.path.makeUrlAbsolute( hash, resolutionUrl ); + + if ( isPath ) { + href = self.resetUIKeys( href ); + } + + // replace the current url with the new href and store the state + // Note that in some cases we might be replacing an url with the + // same url. We do this anyways because we need to make sure that + // all of our history entries have a state object associated with + // them. This allows us to work around the case where window.history.back() + // is called to transition from an external page to an embedded page. + // In that particular case, a hashchange event is *NOT* generated by the browser. + // Ensuring each history entry has a state object means that onPopState() + // will always trigger our hashchange callback even when a hashchange event + // is not fired. + history.replaceState( state, document.title, href ); + }, + + // on popstate (ie back or forward) we need to replace the hash that was there previously + // cleaned up by the additional hash handling + onPopState: function( e ) { + var poppedState = e.originalEvent.state, + timeout, fromHash, toHash, hashChanged; + + // if there's no state its not a popstate we care about, eg chrome's initial popstate + if( poppedState ) { + // the active url in the history stack will still be from the previous state + // so we can use it to verify if a hashchange will be fired from the popstate + fromHash = self.hashValueAfterReset( $.mobile.urlHistory.getActive().url ); + + // the hash stored in the state popped off the stack will be our currenturl or + // the url to which we wish to navigate + toHash = self.hashValueAfterReset( poppedState.hash.replace("#", "") ); + + // if the hashes of the urls are different we must assume that the browser + // will fire a hashchange + hashChanged = fromHash !== toHash; + + // unlock hash handling once the hashchange caused be the popstate has fired + if( hashChanged ) { + $win.one( "hashchange.pushstate", function() { + self.nextHashChangePrevented( false ); + }); + } + + // enable hash handling for the the _handleHashChange call + self.nextHashChangePrevented( false ); + + // change the page based on the hash + $.mobile._handleHashChange( poppedState.hash ); + + // only prevent another hash change handling if a hash change will be fired + // by the browser + if( hashChanged ) { + // disable hash handling until one of the above timers fires + self.nextHashChangePrevented( true ); + } + } + }, + + init: function() { + $win.bind( "hashchange", self.onHashChange ); + + // Handle popstate events the occur through history changes + $win.bind( "popstate", self.onPopState ); + + // if there's no hash, we need to replacestate for returning to home + if ( location.hash === "" ) { + history.replaceState( self.state(), document.title, location.href ); + } + } + }); + + $( function() { + if( $.mobile.pushStateEnabled && $.support.pushState ){ + pushStateHandler.init(); + } + }); +})( jQuery, this ); + +/* +* fallback transition for pop in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.pop = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slide in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +// Use the simultaneous transition handler for slide transitions +$.mobile.transitionHandlers.slide = $.mobile.transitionHandlers.simultaneous; + +// Set the slide transition's fallback to "fade" +$.mobile.transitionFallbacks.slide = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slidedown in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slidedown = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slideup in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slideup = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flip in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flip = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flow in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flow = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for turn in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.turn = "fade"; + +})( jQuery, this ); + +(function( $, undefined ) { + +$.mobile.page.prototype.options.degradeInputs = { + color: false, + date: false, + datetime: false, + "datetime-local": false, + email: false, + month: false, + number: false, + range: "number", + search: "text", + tel: false, + time: false, + url: false, + week: false +}; + + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + var page = $.mobile.closestPageData($(e.target)), options; + + if( !page ) { + return; + } + + options = page.options; + + // degrade inputs to avoid poorly implemented native functionality + $( e.target ).find( "input" ).not( page.keepNativeSelector() ).each(function() { + var $this = $( this ), + type = this.getAttribute( "type" ), + optType = options.degradeInputs[ type ] || "text"; + + if ( options.degradeInputs[ type ] ) { + var html = $( "<div>" ).html( $this.clone() ).html(), + // In IE browsers, the type sometimes doesn't exist in the cloned markup, so we replace the closing tag instead + hasType = html.indexOf( " type=" ) > -1, + findstr = hasType ? /\s+type=["']?\w+['"]?/ : /\/?>/, + repstr = " type=\"" + optType + "\" data-" + $.mobile.ns + "type=\"" + type + "\"" + ( hasType ? "" : ">" ); + + $this.replaceWith( html.replace( findstr, repstr ) ); + } + }); + +}); + +})( jQuery ); + +(function( $, window, undefined ) { + +$.widget( "mobile.dialog", $.mobile.widget, { + options: { + closeBtnText : "Close", + overlayTheme : "a", + initSelector : ":jqmData(role='dialog')" + }, + _create: function() { + var self = this, + $el = this.element, + headerCloseButton = $( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText + "</a>" ), + dialogWrap = $("<div/>", { + "role" : "dialog", + "class" : "ui-dialog-contain ui-corner-all ui-overlay-shadow" + }); + + $el.addClass( "ui-dialog ui-overlay-" + this.options.overlayTheme ); + + // Class the markup for dialog styling + // Set aria role + $el + .wrapInner( dialogWrap ) + .children() + .find( ":jqmData(role='header')" ) + .prepend( headerCloseButton ) + .end() + .children( ':first-child') + .addClass( "ui-corner-top" ) + .end() + .children( ":last-child" ) + .addClass( "ui-corner-bottom" ); + + // this must be an anonymous function so that select menu dialogs can replace + // the close method. This is a change from previously just defining data-rel=back + // on the button and letting nav handle it + // + // Use click rather than vclick in order to prevent the possibility of unintentionally + // reopening the dialog if the dialog opening item was directly under the close button. + headerCloseButton.bind( "click", function() { + self.close(); + }); + + /* bind events + - clicks and submits should use the closing transition that the dialog opened with + unless a data-transition is specified on the link/form + - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally + */ + $el.bind( "vclick submit", function( event ) { + var $target = $( event.target ).closest( event.type === "vclick" ? "a" : "form" ), + active; + + if ( $target.length && !$target.jqmData( "transition" ) ) { + + active = $.mobile.urlHistory.getActive() || {}; + + $target.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) ) + .attr( "data-" + $.mobile.ns + "direction", "reverse" ); + } + }) + .bind( "pagehide", function( e, ui ) { + $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass ); + }) + // Override the theme set by the page plugin on pageshow + .bind( "pagebeforeshow", function(){ + if( self.options.overlayTheme ){ + self.element + .page( "removeContainerBackground" ) + .page( "setContainerBackground", self.options.overlayTheme ); + } + }); + }, + + // Close method goes back in history + close: function() { + window.history.back(); + } +}); + +//auto self-init widgets +$( document ).delegate( $.mobile.dialog.prototype.options.initSelector, "pagecreate", function(){ + $.mobile.dialog.prototype.enhance( this ); +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.fn.fieldcontain = function( options ) { + return this.addClass( "ui-field-contain ui-body ui-br" ); +}; + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='fieldcontain')", e.target ).jqmEnhanceable().fieldcontain(); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.grid = function( options ) { + return this.each(function() { + + var $this = $( this ), + o = $.extend({ + grid: null + },options), + $kids = $this.children(), + gridCols = {solo:1, a:2, b:3, c:4, d:5}, + grid = o.grid, + iterator; + + if ( !grid ) { + if ( $kids.length <= 5 ) { + for ( var letter in gridCols ) { + if ( gridCols[ letter ] === $kids.length ) { + grid = letter; + } + } + } else { + grid = "a"; + } + } + iterator = gridCols[grid]; + + $this.addClass( "ui-grid-" + grid ); + + $kids.filter( ":nth-child(" + iterator + "n+1)" ).addClass( "ui-block-a" ); + + if ( iterator > 1 ) { + $kids.filter( ":nth-child(" + iterator + "n+2)" ).addClass( "ui-block-b" ); + } + if ( iterator > 2 ) { + $kids.filter( ":nth-child(3n+3)" ).addClass( "ui-block-c" ); + } + if ( iterator > 3 ) { + $kids.filter( ":nth-child(4n+4)" ).addClass( "ui-block-d" ); + } + if ( iterator > 4 ) { + $kids.filter( ":nth-child(5n+5)" ).addClass( "ui-block-e" ); + } + }); +}; +})( jQuery ); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='nojs')", e.target ).addClass( "ui-nojs" ); + +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.fn.buttonMarkup = function( options ) { + var $workingSet = this; + + // Enforce options to be of type string + options = ( options && ( $.type( options ) == "object" ) )? options : {}; + for ( var i = 0; i < $workingSet.length; i++ ) { + var el = $workingSet.eq( i ), + e = el[ 0 ], + o = $.extend( {}, $.fn.buttonMarkup.defaults, { + icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ), + iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ), + theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ), + inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ), + shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ), + corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ), + iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ), + mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" ) + }, options ), + + // Classes Defined + innerClass = "ui-btn-inner", + textClass = "ui-btn-text", + buttonClass, iconClass, + // Button inner markup + buttonInner, + buttonText, + buttonIcon, + buttonElements; + + $.each(o, function(key, value) { + e.setAttribute( "data-" + $.mobile.ns + key, value ); + el.jqmData(key, value); + }); + + // Check if this element is already enhanced + buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements"); + + if (buttonElements) { + e = buttonElements.outer; + el = $(e); + buttonInner = buttonElements.inner; + buttonText = buttonElements.text; + // We will recreate this icon below + $(buttonElements.icon).remove(); + buttonElements.icon = null; + } + else { + buttonInner = document.createElement( o.wrapperEls ); + buttonText = document.createElement( o.wrapperEls ); + } + buttonIcon = o.icon ? document.createElement( "span" ) : null; + + if ( attachEvents && !buttonElements) { + attachEvents(); + } + + // if not, try to find closest theme container + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( el, "c" ); + } + + buttonClass = "ui-btn ui-btn-up-" + o.theme; + buttonClass += o.inline ? " ui-btn-inline" : ""; + buttonClass += o.shadow ? " ui-shadow" : ""; + buttonClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.mini !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.mini ? " ui-mini" : " ui-fullsize"; + } + + if ( o.inline !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline"; + } + + + if ( o.icon ) { + o.icon = "ui-icon-" + o.icon; + o.iconpos = o.iconpos || "left"; + + iconClass = "ui-icon " + o.icon; + + if ( o.iconshadow ) { + iconClass += " ui-icon-shadow"; + } + } + + if ( o.iconpos ) { + buttonClass += " ui-btn-icon-" + o.iconpos; + + if ( o.iconpos == "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + } + + innerClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + + if ( buttonElements ) { + el.removeClass( buttonElements.bcls || "" ); + } + el.removeClass( "ui-link" ).addClass( buttonClass ); + + buttonInner.className = innerClass; + + buttonText.className = textClass; + if ( !buttonElements ) { + buttonInner.appendChild( buttonText ); + } + if ( buttonIcon ) { + buttonIcon.className = iconClass; + if ( !(buttonElements && buttonElements.icon) ) { + buttonIcon.appendChild( document.createTextNode("\u00a0") ); + buttonInner.appendChild( buttonIcon ); + } + } + + while ( e.firstChild && !buttonElements) { + buttonText.appendChild( e.firstChild ); + } + + if ( !buttonElements ) { + e.appendChild( buttonInner ); + } + + // Assign a structure containing the elements of this button to the elements of this button. This + // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup(). + buttonElements = { + bcls : buttonClass, + outer : e, + inner : buttonInner, + text : buttonText, + icon : buttonIcon + }; + + $.data(e, 'buttonElements', buttonElements); + $.data(buttonInner, 'buttonElements', buttonElements); + $.data(buttonText, 'buttonElements', buttonElements); + if (buttonIcon) { + $.data(buttonIcon, 'buttonElements', buttonElements); + } + } + + return this; +}; + +$.fn.buttonMarkup.defaults = { + corners: true, + shadow: true, + iconshadow: true, + wrapperEls: "span" +}; + +function closestEnabledButton( element ) { + var cname; + + while ( element ) { + // Note that we check for typeof className below because the element we + // handed could be in an SVG DOM where className on SVG elements is defined to + // be of a different type (SVGAnimatedString). We only operate on HTML DOM + // elements, so we look for plain "string". + cname = ( typeof element.className === 'string' ) && (element.className + ' '); + if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) { + break; + } + + element = element.parentNode; + } + + return element; +} + +var attachEvents = function() { + var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc; + + $( document ).bind( { + "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) { + var theme, + $btn = $( closestEnabledButton( event.target ) ), + evt = event.type; + + if ( $btn.length ) { + theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); + + if ( evt === "vmousedown" ) { + if ( $.support.touch ) { + hov = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + } + } else if ( evt === "vmousecancel" || evt === "vmouseup" ) { + $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + } else if ( evt === "vmouseover" || evt === "focus" ) { + if ( $.support.touch ) { + foc = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + } + } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) { + $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + if ( hov ) { + clearTimeout( hov ); + } + if ( foc ) { + clearTimeout( foc ); + } + } + } + }, + "focusin focus": function( event ){ + $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass ); + }, + "focusout blur": function( event ){ + $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass ); + } + }); + + attachEvents = null; +}; + +//links in bars, or those with data-role become buttons +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + $( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", e.target ) + .not( ".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')" ) + .buttonMarkup(); +}); + +})( jQuery ); + + +(function( $, undefined ) { + +$.mobile.page.prototype.options.backBtnText = "Back"; +$.mobile.page.prototype.options.addBackBtn = false; +$.mobile.page.prototype.options.backBtnTheme = null; +$.mobile.page.prototype.options.headerTheme = "a"; +$.mobile.page.prototype.options.footerTheme = "a"; +$.mobile.page.prototype.options.contentTheme = null; + +$( document ).delegate( ":jqmData(role='page'), :jqmData(role='dialog')", "pagecreate", function( e ) { + + var $page = $( this ), + o = $page.data( "page" ).options, + pageRole = $page.jqmData( "role" ), + pageTheme = o.theme; + + $( ":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", this ) + .jqmEnhanceable() + .each(function() { + + var $this = $( this ), + role = $this.jqmData( "role" ), + theme = $this.jqmData( "theme" ), + contentTheme = theme || o.contentTheme || ( pageRole === "dialog" && pageTheme ), + $headeranchors, + leftbtn, + rightbtn, + backBtn; + + $this.addClass( "ui-" + role ); + + //apply theming and markup modifications to page,header,content,footer + if ( role === "header" || role === "footer" ) { + + var thisTheme = theme || ( role === "header" ? o.headerTheme : o.footerTheme ) || pageTheme; + + $this + //add theme class + .addClass( "ui-bar-" + thisTheme ) + // Add ARIA role + .attr( "role", role === "header" ? "banner" : "contentinfo" ); + + if( role === "header") { + // Right,left buttons + $headeranchors = $this.children( "a" ); + leftbtn = $headeranchors.hasClass( "ui-btn-left" ); + rightbtn = $headeranchors.hasClass( "ui-btn-right" ); + + leftbtn = leftbtn || $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length; + + rightbtn = rightbtn || $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length; + } + + // Auto-add back btn on pages beyond first view + if ( o.addBackBtn && + role === "header" && + $( ".ui-page" ).length > 1 && + $page.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) && + !leftbtn ) { + + backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ) + // If theme is provided, override default inheritance + .attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme || thisTheme ) + .prependTo( $this ); + } + + // Page title + $this.children( "h1, h2, h3, h4, h5, h6" ) + .addClass( "ui-title" ) + // Regardless of h element number in src, it becomes h1 for the enhanced page + .attr({ + "role": "heading", + "aria-level": "1" + }); + + } else if ( role === "content" ) { + if ( contentTheme ) { + $this.addClass( "ui-body-" + ( contentTheme ) ); + } + + // Add ARIA role + $this.attr( "role", "main" ); + } + }); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsible", $.mobile.widget, { + options: { + expandCueText: " click to expand contents", + collapseCueText: " click to collapse contents", + collapsed: true, + heading: "h1,h2,h3,h4,h5,h6,legend", + theme: null, + contentTheme: null, + iconTheme: "d", + mini: false, + initSelector: ":jqmData(role='collapsible')" + }, + _create: function() { + + var $el = this.element, + o = this.options, + collapsible = $el.addClass( "ui-collapsible" ), + collapsibleHeading = $el.children( o.heading ).first(), + collapsibleContent = collapsible.wrapInner( "<div class='ui-collapsible-content'></div>" ).find( ".ui-collapsible-content" ), + collapsibleSet = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" ); + + // Replace collapsibleHeading if it's a legend + if ( collapsibleHeading.is( "legend" ) ) { + collapsibleHeading = $( "<div role='heading'>"+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading ); + collapsibleHeading.next().remove(); + } + + // If we are in a collapsible set + if ( collapsibleSet.length ) { + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = collapsibleSet.jqmData("theme") || $.mobile.getInheritedTheme( collapsibleSet, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = collapsibleSet.jqmData( "content-theme" ); + } + + // Gets the preference icon position in the set + if ( !o.iconPos ) { + o.iconPos = collapsibleSet.jqmData( "iconpos" ); + } + + if( !o.mini ) { + o.mini = collapsibleSet.jqmData( "mini" ); + } + } + collapsibleContent.addClass( ( o.contentTheme ) ? ( "ui-body-" + o.contentTheme ) : ""); + + collapsibleHeading + //drop heading in before content + .insertBefore( collapsibleContent ) + //modify markup & attributes + .addClass( "ui-collapsible-heading" ) + .append( "<span class='ui-collapsible-heading-status'></span>" ) + .wrapInner( "<a href='#' class='ui-collapsible-heading-toggle'></a>" ) + .find( "a" ) + .first() + .buttonMarkup({ + shadow: false, + corners: false, + iconpos: $el.jqmData( "iconpos" ) || o.iconPos || "left", + icon: "plus", + mini: o.mini, + theme: o.theme + }) + .add( ".ui-btn-inner", $el ) + .addClass( "ui-corner-top ui-corner-bottom" ); + + //events + collapsible + .bind( "expand collapse", function( event ) { + if ( !event.isDefaultPrevented() ) { + + event.preventDefault(); + + var $this = $( this ), + isCollapse = ( event.type === "collapse" ), + contentTheme = o.contentTheme; + + collapsibleHeading + .toggleClass( "ui-collapsible-heading-collapsed", isCollapse) + .find( ".ui-collapsible-heading-status" ) + .text( isCollapse ? o.expandCueText : o.collapseCueText ) + .end() + .find( ".ui-icon" ) + .toggleClass( "ui-icon-minus", !isCollapse ) + .toggleClass( "ui-icon-plus", isCollapse ); + + $this.toggleClass( "ui-collapsible-collapsed", isCollapse ); + collapsibleContent.toggleClass( "ui-collapsible-content-collapsed", isCollapse ).attr( "aria-hidden", isCollapse ); + + if ( contentTheme && ( !collapsibleSet.length || collapsible.jqmData( "collapsible-last" ) ) ) { + collapsibleHeading + .find( "a" ).first().add( collapsibleHeading.find( ".ui-btn-inner" ) ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsibleContent.toggleClass( "ui-corner-bottom", !isCollapse ); + } + collapsibleContent.trigger( "updatelayout" ); + } + }) + .trigger( o.collapsed ? "collapse" : "expand" ); + + collapsibleHeading + .bind( "click", function( event ) { + + var type = collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ? + "expand" : "collapse"; + + collapsible.trigger( type ); + + event.preventDefault(); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsible.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsibleset", $.mobile.widget, { + options: { + initSelector: ":jqmData(role='collapsible-set')" + }, + _create: function() { + var $el = this.element.addClass( "ui-collapsible-set" ), + o = this.options; + + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( $el, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = $el.jqmData( "content-theme" ); + } + + if ( !o.corners ) { + o.corners = $el.jqmData( "corners" ) === undefined ? true : false; + } + + // Initialize the collapsible set if it's not already initialized + if ( !$el.jqmData( "collapsiblebound" ) ) { + $el + .jqmData( "collapsiblebound", true ) + .bind( "expand collapse", function( event ) { + var isCollapse = ( event.type === "collapse" ), + collapsible = $( event.target ).closest( ".ui-collapsible" ), + widget = collapsible.data( "collapsible" ), + contentTheme = widget.options.contentTheme; + if ( contentTheme && collapsible.jqmData( "collapsible-last" ) ) { + collapsible.find( widget.options.heading ).first() + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsible.find( ".ui-collapsible-content" ).toggleClass( "ui-corner-bottom", !isCollapse ); + } + }) + .bind( "expand", function( event ) { + $( event.target ) + .closest( ".ui-collapsible" ) + .siblings( ".ui-collapsible" ) + .trigger( "collapse" ); + }); + } + }, + + _init: function() { + this.refresh(); + }, + + refresh: function() { + var $el = this.element, + o = this.options, + collapsiblesInSet = $el.children( ":jqmData(role='collapsible')" ); + + $.mobile.collapsible.prototype.enhance( collapsiblesInSet.not( ".ui-collapsible" ) ); + + // clean up borders + collapsiblesInSet.each( function() { + $( this ).find( $.mobile.collapsible.prototype.options.heading ) + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .removeClass( "ui-corner-top ui-corner-bottom" ); + }); + + collapsiblesInSet.first() + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-top" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-top" ); + + collapsiblesInSet.last() + .jqmData( "collapsible-last", true ) + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-bottom" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-bottom" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsibleset.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.navbar", $.mobile.widget, { + options: { + iconpos: "top", + grid: null, + initSelector: ":jqmData(role='navbar')" + }, + + _create: function(){ + + var $navbar = this.element, + $navbtns = $navbar.find( "a" ), + iconpos = $navbtns.filter( ":jqmData(icon)" ).length ? + this.options.iconpos : undefined; + + $navbar.addClass( "ui-navbar" ) + .attr( "role","navigation" ) + .find( "ul" ) + .jqmEnhanceable() + .grid({ grid: this.options.grid }); + + if ( !iconpos ) { + $navbar.addClass( "ui-navbar-noicons" ); + } + + $navbtns.buttonMarkup({ + corners: false, + shadow: false, + inline: true, + iconpos: iconpos + }); + + $navbar.delegate( "a", "vclick", function( event ) { + if( !$(event.target).hasClass("ui-disabled") ) { + $navbtns.removeClass( $.mobile.activeBtnClass ); + $( this ).addClass( $.mobile.activeBtnClass ); + } + }); + + // Buttons in the navbar with ui-state-persist class should regain their active state before page show + $navbar.closest( ".ui-page" ).bind( "pagebeforeshow", function() { + $navbtns.filter( ".ui-state-persist" ).addClass( $.mobile.activeBtnClass ); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.navbar.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +//Keeps track of the number of lists per page UID +//This allows support for multiple nested list in the same page +//https://github.com/jquery/jquery-mobile/issues/1617 +var listCountPerPage = {}; + +$.widget( "mobile.listview", $.mobile.widget, { + + options: { + theme: null, + countTheme: "c", + headerTheme: "b", + dividerTheme: "b", + splitIcon: "arrow-r", + splitTheme: "b", + mini: false, + inset: false, + initSelector: ":jqmData(role='listview')" + }, + + _create: function() { + var t = this, + listviewClasses = ""; + + listviewClasses += t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : ""; + listviewClasses += t.element.jqmData( "mini" ) || t.options.mini === true ? " ui-mini" : ""; + + // create listview markup + t.element.addClass(function( i, orig ) { + return orig + " ui-listview " + listviewClasses; + }); + + t.refresh( true ); + }, + + _removeCorners: function( li, which ) { + var top = "ui-corner-top ui-corner-tr ui-corner-tl", + bot = "ui-corner-bottom ui-corner-br ui-corner-bl"; + + li = li.add( li.find( ".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb" ) ); + + if ( which === "top" ) { + li.removeClass( top ); + } else if ( which === "bottom" ) { + li.removeClass( bot ); + } else { + li.removeClass( top + " " + bot ); + } + }, + + _refreshCorners: function( create ) { + var $li, + $visibleli, + $topli, + $bottomli; + + if ( this.options.inset ) { + $li = this.element.children( "li" ); + // at create time the li are not visible yet so we need to rely on .ui-screen-hidden + $visibleli = create?$li.not( ".ui-screen-hidden" ):$li.filter( ":visible" ); + + this._removeCorners( $li ); + + // Select the first visible li element + $topli = $visibleli.first() + .addClass( "ui-corner-top" ); + + $topli.add( $topli.find( ".ui-btn-inner" ) + .not( ".ui-li-link-alt span:first-child" ) ) + .addClass( "ui-corner-top" ) + .end() + .find( ".ui-li-link-alt, .ui-li-link-alt span:first-child" ) + .addClass( "ui-corner-tr" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-tl" ); + + // Select the last visible li element + $bottomli = $visibleli.last() + .addClass( "ui-corner-bottom" ); + + $bottomli.add( $bottomli.find( ".ui-btn-inner" ) ) + .find( ".ui-li-link-alt" ) + .addClass( "ui-corner-br" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-bl" ); + } + if ( !create ) { + this.element.trigger( "updatelayout" ); + } + }, + + // This is a generic utility method for finding the first + // node with a given nodeName. It uses basic DOM traversal + // to be fast and is meant to be a substitute for simple + // $.fn.closest() and $.fn.children() calls on a single + // element. Note that callers must pass both the lowerCase + // and upperCase version of the nodeName they are looking for. + // The main reason for this is that this function will be + // called many times and we want to avoid having to lowercase + // the nodeName from the element every time to ensure we have + // a match. Note that this function lives here for now, but may + // be moved into $.mobile if other components need a similar method. + _findFirstElementByTagName: function( ele, nextProp, lcName, ucName ) + { + var dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + return ele; + } + ele = ele[ nextProp ]; + } + return null; + }, + _getChildrenByTagName: function( ele, lcName, ucName ) + { + var results = [], + dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + ele = ele.firstChild; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + results.push( ele ); + } + ele = ele.nextSibling; + } + return $( results ); + }, + + _addThumbClasses: function( containers ) + { + var i, img, len = containers.length; + for ( i = 0; i < len; i++ ) { + img = $( this._findFirstElementByTagName( containers[ i ].firstChild, "nextSibling", "img", "IMG" ) ); + if ( img.length ) { + img.addClass( "ui-li-thumb" ); + $( this._findFirstElementByTagName( img[ 0 ].parentNode, "parentNode", "li", "LI" ) ).addClass( img.is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" ); + } + } + }, + + refresh: function( create ) { + this.parentPage = this.element.closest( ".ui-page" ); + this._createSubPages(); + + var o = this.options, + $list = this.element, + self = this, + dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme, + listsplittheme = $list.jqmData( "splittheme" ), + listspliticon = $list.jqmData( "spliticon" ), + li = this._getChildrenByTagName( $list[ 0 ], "li", "LI" ), + counter = $.support.cssPseudoElement || !$.nodeName( $list[ 0 ], "ol" ) ? 0 : 1, + itemClassDict = {}, + item, itemClass, itemTheme, + a, last, splittheme, countParent, icon, imgParents, img, linkIcon; + + if ( counter ) { + $list.find( ".ui-li-dec" ).remove(); + } + + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + for ( var pos = 0, numli = li.length; pos < numli; pos++ ) { + item = li.eq( pos ); + itemClass = "ui-li"; + + // If we're creating the element, we update it regardless + if ( create || !item.hasClass( "ui-li" ) ) { + itemTheme = item.jqmData("theme") || o.theme; + a = this._getChildrenByTagName( item[ 0 ], "a", "A" ); + + if ( a.length ) { + icon = item.jqmData("icon"); + + item.buttonMarkup({ + wrapperEls: "div", + shadow: false, + corners: false, + iconpos: "right", + icon: a.length > 1 || icon === false ? false : icon || "arrow-r", + theme: itemTheme + }); + + if ( ( icon != false ) && ( a.length == 1 ) ) { + item.addClass( "ui-li-has-arrow" ); + } + + a.first().removeClass( "ui-link" ).addClass( "ui-link-inherit" ); + + if ( a.length > 1 ) { + itemClass += " ui-li-has-alt"; + + last = a.last(); + splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme; + linkIcon = last.jqmData("icon"); + + last.appendTo(item) + .attr( "title", last.getEncodedText() ) + .addClass( "ui-li-link-alt" ) + .empty() + .buttonMarkup({ + shadow: false, + corners: false, + theme: itemTheme, + icon: false, + iconpos: false + }) + .find( ".ui-btn-inner" ) + .append( + $( document.createElement( "span" ) ).buttonMarkup({ + shadow: true, + corners: true, + theme: splittheme, + iconpos: "notext", + // link icon overrides list item icon overrides ul element overrides options + icon: linkIcon || icon || listspliticon || o.splitIcon + }) + ); + } + } else if ( item.jqmData( "role" ) === "list-divider" ) { + + itemClass += " ui-li-divider ui-bar-" + dividertheme; + item.attr( "role", "heading" ); + + //reset counter when a divider heading is encountered + if ( counter ) { + counter = 1; + } + + } else { + itemClass += " ui-li-static ui-body-" + itemTheme; + } + } + + if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) { + countParent = item.is( ".ui-li-static:first" ) ? item : item.find( ".ui-link-inherit" ); + + countParent.addClass( "ui-li-jsnumbering" ) + .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" ); + } + + // Instead of setting item class directly on the list item and its + // btn-inner at this point in time, push the item into a dictionary + // that tells us what class to set on it so we can do this after this + // processing loop is finished. + + if ( !itemClassDict[ itemClass ] ) { + itemClassDict[ itemClass ] = []; + } + + itemClassDict[ itemClass ].push( item[ 0 ] ); + } + + // Set the appropriate listview item classes on each list item + // and their btn-inner elements. The main reason we didn't do this + // in the for-loop above is because we can eliminate per-item function overhead + // by calling addClass() and children() once or twice afterwards. This + // can give us a significant boost on platforms like WP7.5. + + for ( itemClass in itemClassDict ) { + $( itemClassDict[ itemClass ] ).addClass( itemClass ).children( ".ui-btn-inner" ).addClass( itemClass ); + } + + $list.find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ) + .end() + + .find( "p, dl" ).addClass( "ui-li-desc" ) + .end() + + .find( ".ui-li-aside" ).each(function() { + var $this = $(this); + $this.prependTo( $this.parent() ); //shift aside to front for css float + }) + .end() + + .find( ".ui-li-count" ).each( function() { + $( this ).closest( "li" ).addClass( "ui-li-has-count" ); + }).addClass( "ui-btn-up-" + ( $list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ); + + // The idea here is to look at the first image in the list item + // itself, and any .ui-link-inherit element it may contain, so we + // can place the appropriate classes on the image and list item. + // Note that we used to use something like: + // + // li.find(">img:eq(0), .ui-link-inherit>img:eq(0)").each( ... ); + // + // But executing a find() like that on Windows Phone 7.5 took a + // really long time. Walking things manually with the code below + // allows the 400 listview item page to load in about 3 seconds as + // opposed to 30 seconds. + + this._addThumbClasses( li ); + this._addThumbClasses( $list.find( ".ui-link-inherit" ) ); + + this._refreshCorners( create ); + }, + + //create a string for ID/subpage url creation + _idStringEscape: function( str ) { + return str.replace(/[^a-zA-Z0-9]/g, '-'); + }, + + _createSubPages: function() { + var parentList = this.element, + parentPage = parentList.closest( ".ui-page" ), + parentUrl = parentPage.jqmData( "url" ), + parentId = parentUrl || parentPage[ 0 ][ $.expando ], + parentListId = parentList.attr( "id" ), + o = this.options, + dns = "data-" + $.mobile.ns, + self = this, + persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ), + hasSubPages; + + if ( typeof listCountPerPage[ parentId ] === "undefined" ) { + listCountPerPage[ parentId ] = -1; + } + + parentListId = parentListId || ++listCountPerPage[ parentId ]; + + $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) { + var self = this, + list = $( this ), + listId = list.attr( "id" ) || parentListId + "-" + i, + parent = list.parent(), + nodeEls = $( list.prevAll().toArray().reverse() ), + nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ), + title = nodeEls.first().getEncodedText(),//url limits to first 30 chars of text + id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId, + theme = list.jqmData( "theme" ) || o.theme, + countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme, + newPage, anchor; + + //define hasSubPages for use in later removal + hasSubPages = true; + + newPage = list.detach() + .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" ) + .parent() + .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" ) + .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" ) + .parent() + .appendTo( $.mobile.pageContainer ); + + newPage.page(); + + anchor = parent.find('a:first'); + + if ( !anchor.length ) { + anchor = $( "<a/>" ).html( nodeEls || title ).prependTo( parent.empty() ); + } + + anchor.attr( "href", "#" + id ); + + }).listview(); + + // on pagehide, remove any nested pages along with the parent page, as long as they aren't active + // and aren't embedded + if( hasSubPages && + parentPage.is( ":jqmData(external-page='true')" ) && + parentPage.data("page").options.domCache === false ) { + + var newRemove = function( e, ui ){ + var nextPage = ui.nextPage, npURL; + + if( ui.nextPage ){ + npURL = nextPage.jqmData( "url" ); + if( npURL.indexOf( parentUrl + "&" + $.mobile.subPageUrlKey ) !== 0 ){ + self.childPages().remove(); + parentPage.remove(); + } + } + }; + + // unbind the original page remove and replace with our specialized version + parentPage + .unbind( "pagehide.remove" ) + .bind( "pagehide.remove", newRemove); + } + }, + + // TODO sort out a better way to track sub pages of the listview this is brittle + childPages: function(){ + var parentUrl = this.parentPage.jqmData( "url" ); + + return $( ":jqmData(url^='"+ parentUrl + "&" + $.mobile.subPageUrlKey +"')"); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.listview.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +/* +* "checkboxradio" plugin +*/ + +(function( $, undefined ) { + +$.widget( "mobile.checkboxradio", $.mobile.widget, { + options: { + theme: null, + initSelector: "input[type='checkbox'],input[type='radio']" + }, + _create: function() { + var self = this, + input = this.element, + inheritAttr = function( input, dataAttr ) { + return input.jqmData( dataAttr ) || input.closest( "form,fieldset" ).jqmData( dataAttr ) + }, + // NOTE: Windows Phone could not find the label through a selector + // filter works though. + parentLabel = $( input ).closest( "label" ), + label = parentLabel.length ? parentLabel : $( input ).closest( "form,fieldset,:jqmData(role='page'),:jqmData(role='dialog')" ).find( "label" ).filter( "[for='" + input[0].id + "']" ), + inputtype = input[0].type, + mini = inheritAttr( input, "mini" ), + checkedState = inputtype + "-on", + uncheckedState = inputtype + "-off", + icon = input.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedState, + iconpos = inheritAttr( input, "iconpos" ), + activeBtn = icon ? "" : " " + $.mobile.activeBtnClass, + checkedClass = "ui-" + checkedState + activeBtn, + uncheckedClass = "ui-" + uncheckedState, + checkedicon = "ui-icon-" + checkedState, + uncheckedicon = "ui-icon-" + uncheckedState; + + if ( inputtype !== "checkbox" && inputtype !== "radio" ) { + return; + } + + // Expose for other methods + $.extend( this, { + label: label, + inputtype: inputtype, + checkedClass: checkedClass, + uncheckedClass: uncheckedClass, + checkedicon: checkedicon, + uncheckedicon: uncheckedicon + }); + + // If there's no selected theme check the data attr + if( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + label.buttonMarkup({ + theme: this.options.theme, + icon: icon, + shadow: false, + mini: mini, + iconpos: iconpos + }); + + // Wrap the input + label in a div + var wrapper = document.createElement('div'); + wrapper.className = 'ui-' + inputtype; + + input.add( label ).wrapAll( wrapper ); + + label.bind({ + vmouseover: function( event ) { + if ( $( this ).parent().is( ".ui-disabled" ) ) { + event.stopPropagation(); + } + }, + + vclick: function( event ) { + if ( input.is( ":disabled" ) ) { + event.preventDefault(); + return; + } + + self._cacheVals(); + + input.prop( "checked", inputtype === "radio" && true || !input.prop( "checked" ) ); + + // trigger click handler's bound directly to the input as a substitute for + // how label clicks behave normally in the browsers + // TODO: it would be nice to let the browser's handle the clicks and pass them + // through to the associate input. we can swallow that click at the parent + // wrapper element level + input.triggerHandler( 'click' ); + + // Input set for common radio buttons will contain all the radio + // buttons, but will not for checkboxes. clearing the checked status + // of other radios ensures the active button state is applied properly + self._getInputSet().not( input ).prop( "checked", false ); + + self._updateAll(); + return false; + } + }); + + input + .bind({ + vmousedown: function() { + self._cacheVals(); + }, + + vclick: function() { + var $this = $(this); + + // Adds checked attribute to checked input when keyboard is used + if ( $this.is( ":checked" ) ) { + + $this.prop( "checked", true); + self._getInputSet().not($this).prop( "checked", false ); + } else { + + $this.prop( "checked", false ); + } + + self._updateAll(); + }, + + focus: function() { + label.addClass( $.mobile.focusClass ); + }, + + blur: function() { + label.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + _cacheVals: function() { + this._getInputSet().each(function() { + $(this).jqmData( "cacheVal", this.checked ); + }); + }, + + //returns either a set of radios with the same name attribute, or a single checkbox + _getInputSet: function(){ + if(this.inputtype === "checkbox") { + return this.element; + } + + return this.element.closest( "form,fieldset,:jqmData(role='page')" ) + .find( "input[name='"+ this.element[0].name +"'][type='"+ this.inputtype +"']" ); + }, + + _updateAll: function() { + var self = this; + + this._getInputSet().each(function() { + var $this = $(this); + + if ( this.checked || self.inputtype === "checkbox" ) { + $this.trigger( "change" ); + } + }) + .checkboxradio( "refresh" ); + }, + + refresh: function() { + var input = this.element[0], + label = this.label, + icon = label.find( ".ui-icon" ); + + if ( input.checked ) { + label.addClass( this.checkedClass ).removeClass( this.uncheckedClass ); + icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon ); + } else { + label.removeClass( this.checkedClass ).addClass( this.uncheckedClass ); + icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon ); + } + + if ( input.disabled ) { + this.disable(); + } else { + this.enable(); + } + }, + + disable: function() { + this.element.prop( "disabled", true ).parent().addClass( "ui-disabled" ); + }, + + enable: function() { + this.element.prop( "disabled", false ).parent().removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.checkboxradio.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.button", $.mobile.widget, { + options: { + theme: null, + icon: null, + iconpos: null, + inline: false, + corners: true, + shadow: true, + iconshadow: true, + initSelector: "button, [type='button'], [type='submit'], [type='reset'], [type='image']", + mini: false + }, + _create: function() { + var $el = this.element, + $button, + o = this.options, + type, + name, + classes = "", + $buttonPlaceholder; + + // if this is a link, check if it's been enhanced and, if not, use the right function + if( $el[ 0 ].tagName === "A" ) { + !$el.hasClass( "ui-btn" ) && $el.buttonMarkup(); + return; + } + + // get the inherited theme + // TODO centralize for all widgets + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~$el[0].className.indexOf( "ui-btn-left" ) ) { + classes = "ui-btn-left"; + } + + if( !!~$el[0].className.indexOf( "ui-btn-right" ) ) { + classes = "ui-btn-right"; + } + + // Add ARIA role + this.button = $( "<div></div>" ) + .text( $el.text() || $el.val() ) + .insertBefore( $el ) + .buttonMarkup({ + theme: o.theme, + icon: o.icon, + iconpos: o.iconpos, + inline: o.inline, + corners: o.corners, + shadow: o.shadow, + iconshadow: o.iconshadow, + mini: o.mini + }) + .addClass( classes ) + .append( $el.addClass( "ui-btn-hidden" ) ); + + $button = this.button; + type = $el.attr( "type" ); + name = $el.attr( "name" ); + + // Add hidden input during submit if input type="submit" has a name. + if ( type !== "button" && type !== "reset" && name ) { + $el.bind( "vclick", function() { + // Add hidden input if it doesn’t already exist. + if( $buttonPlaceholder === undefined ) { + $buttonPlaceholder = $( "<input>", { + type: "hidden", + name: $el.attr( "name" ), + value: $el.attr( "value" ) + }).insertBefore( $el ); + + // Bind to doc to remove after submit handling + $( document ).one("submit", function(){ + $buttonPlaceholder.remove(); + + // reset the local var so that the hidden input + // will be re-added on subsequent clicks + $buttonPlaceholder = undefined; + }); + } + }); + } + + $el.bind({ + focus: function() { + $button.addClass( $.mobile.focusClass ); + }, + + blur: function() { + $button.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + }, + + refresh: function() { + var $el = this.element; + + if ( $el.prop("disabled") ) { + this.disable(); + } else { + this.enable(); + } + + // Grab the button's text element from its implementation-independent data item + $( this.button.data( 'buttonElements' ).text ).text( $el.text() || $el.val() ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.button.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.controlgroup = function( options ) { + function flipClasses( els, flCorners ) { + els.removeClass( "ui-btn-corner-all ui-shadow" ) + .eq( 0 ).addClass( flCorners[ 0 ] ) + .end() + .last().addClass( flCorners[ 1 ] ).addClass( "ui-controlgroup-last" ); + } + + return this.each(function() { + var $el = $( this ), + o = $.extend({ + direction: $el.jqmData( "type" ) || "vertical", + shadow: false, + excludeInvisible: true, + mini: $el.jqmData( "mini" ) + }, options ), + groupheading = $el.children( "legend" ), + flCorners = o.direction == "horizontal" ? [ "ui-corner-left", "ui-corner-right" ] : [ "ui-corner-top", "ui-corner-bottom" ], + type = $el.find( "input" ).first().attr( "type" ); + + // Replace legend with more stylable replacement div + if ( groupheading.length ) { + $el.wrapInner( "<div class='ui-controlgroup-controls'></div>" ); + $( "<div role='heading' class='ui-controlgroup-label'>" + groupheading.html() + "</div>" ).insertBefore( $el.children(0) ); + groupheading.remove(); + } + + $el.addClass( "ui-corner-all ui-controlgroup ui-controlgroup-" + o.direction ); + + flipClasses( $el.find( ".ui-btn" + ( o.excludeInvisible ? ":visible" : "" ) ).not('.ui-slider-handle'), flCorners ); + flipClasses( $el.find( ".ui-btn-inner" ), flCorners ); + + if ( o.shadow ) { + $el.addClass( "ui-shadow" ); + } + + if ( o.mini ) { + $el.addClass( "ui-mini" ); + } + + }); +}; + +// The pagecreate handler for controlgroup is in jquery.mobile.init because of the soft-dependency on the wrapped widgets + +})(jQuery); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + + //links within content areas, tests included with page + $( e.target ) + .find( "a" ) + .jqmEnhanceable() + .not( ".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')" ) + .addClass( "ui-link" ); + +}); + +})( jQuery ); + + +( function( $ ) { + var meta = $( "meta[name=viewport]" ), + initialContent = meta.attr( "content" ), + disabledZoom = initialContent + ",maximum-scale=1, user-scalable=no", + enabledZoom = initialContent + ",maximum-scale=10, user-scalable=yes", + disabledInitially = /(user-scalable[\s]*=[\s]*no)|(maximum-scale[\s]*=[\s]*1)[$,\s]/.test( initialContent ); + + $.mobile.zoom = $.extend( {}, { + enabled: !disabledInitially, + locked: false, + disable: function( lock ) { + if( !disabledInitially && !$.mobile.zoom.locked ){ + meta.attr( "content", disabledZoom ); + $.mobile.zoom.enabled = false; + $.mobile.zoom.locked = lock || false; + } + }, + enable: function( unlock ) { + if( !disabledInitially && ( !$.mobile.zoom.locked || unlock === true ) ){ + meta.attr( "content", enabledZoom ); + $.mobile.zoom.enabled = true; + $.mobile.zoom.locked = false; + } + }, + restore: function() { + if( !disabledInitially ){ + meta.attr( "content", initialContent ); + $.mobile.zoom.enabled = true; + } + } + }); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "mobile.textinput", $.mobile.widget, { + options: { + theme: null, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])", + clearSearchButtonText: "clear text" + }, + + _create: function() { + + var input = this.element, + o = this.options, + theme = o.theme || $.mobile.getInheritedTheme( this.element, "c" ), + themeclass = " ui-body-" + theme, + mini = input.jqmData("mini") == true, + miniclass = mini ? " ui-mini" : "", + focusedEl, clearbtn; + + $( "label[for='" + input.attr( "id" ) + "']" ).addClass( "ui-input-text" ); + + focusedEl = input.addClass("ui-input-text ui-body-"+ theme ); + + // XXX: Temporary workaround for issue 785 (Apple bug 8910589). + // Turn off autocorrect and autocomplete on non-iOS 5 devices + // since the popup they use can't be dismissed by the user. Note + // that we test for the presence of the feature by looking for + // the autocorrect property on the input element. We currently + // have no test for iOS 5 or newer so we're temporarily using + // the touchOverflow support flag for jQM 1.0. Yes, I feel dirty. - jblas + if ( typeof input[0].autocorrect !== "undefined" && !$.support.touchOverflow ) { + // Set the attribute instead of the property just in case there + // is code that attempts to make modifications via HTML. + input[0].setAttribute( "autocorrect", "off" ); + input[0].setAttribute( "autocomplete", "off" ); + } + + + //"search" input widget + if ( input.is( "[type='search'],:jqmData(type='search')" ) ) { + + focusedEl = input.wrap( "<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield" + themeclass + miniclass + "'></div>" ).parent(); + clearbtn = $( "<a href='#' class='ui-input-clear' title='" + o.clearSearchButtonText + "'>" + o.clearSearchButtonText + "</a>" ) + .bind('click', function( event ) { + input + .val( "" ) + .focus() + .trigger( "change" ); + clearbtn.addClass( "ui-input-clear-hidden" ); + event.preventDefault(); + }) + .appendTo( focusedEl ) + .buttonMarkup({ + icon: "delete", + iconpos: "notext", + corners: true, + shadow: true, + mini: mini + }); + + function toggleClear() { + setTimeout(function() { + clearbtn.toggleClass( "ui-input-clear-hidden", !input.val() ); + }, 0); + } + + toggleClear(); + + input.bind('paste cut keyup focus change blur', toggleClear); + + } else { + input.addClass( "ui-corner-all ui-shadow-inset" + themeclass + miniclass ); + } + + input.focus(function() { + focusedEl.addClass( $.mobile.focusClass ); + }) + .blur(function(){ + focusedEl.removeClass( $.mobile.focusClass ); + }) + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + .bind( "focus", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "blur", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + + // Autogrow + if ( input.is( "textarea" ) ) { + var extraLineHeight = 15, + keyupTimeoutBuffer = 100, + keyup = function() { + var scrollHeight = input[ 0 ].scrollHeight, + clientHeight = input[ 0 ].clientHeight; + + if ( clientHeight < scrollHeight ) { + input.height(scrollHeight + extraLineHeight); + } + }, + keyupTimeout; + + input.keyup(function() { + clearTimeout( keyupTimeout ); + keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer ); + }); + + // binding to pagechange here ensures that for pages loaded via + // ajax the height is recalculated without user input + $( document ).one( "pagechange", keyup ); + + // Issue 509: the browser is not providing scrollHeight properly until the styles load + if ( $.trim( input.val() ) ) { + // bind to the window load to make sure the height is calculated based on BOTH + // the DOM and CSS + $( window ).load( keyup ); + } + } + }, + + disable: function(){ + ( this.element.attr( "disabled", true ).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).addClass( "ui-disabled" ); + }, + + enable: function(){ + ( this.element.attr( "disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.textinput.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.mobile.listview.prototype.options.filter = false; +$.mobile.listview.prototype.options.filterPlaceholder = "Filter items..."; +$.mobile.listview.prototype.options.filterTheme = "c"; +$.mobile.listview.prototype.options.filterCallback = function( text, searchValue ){ + return text.toLowerCase().indexOf( searchValue ) === -1; +}; + +$( document ).delegate( ":jqmData(role='listview')", "listviewcreate", function() { + + var list = $( this ), + listview = list.data( "listview" ); + + if ( !listview.options.filter ) { + return; + } + + var wrapper = $( "<form>", { + "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, + "role": "search" + }), + search = $( "<input>", { + placeholder: listview.options.filterPlaceholder + }) + .attr( "data-" + $.mobile.ns + "type", "search" ) + .jqmData( "lastval", "" ) + .bind( "keyup change", function() { + + var $this = $(this), + val = this.value.toLowerCase(), + listItems = null, + lastval = $this.jqmData( "lastval" ) + "", + childItems = false, + itemtext = "", + item; + + // Change val as lastval for next execution + $this.jqmData( "lastval" , val ); + if ( val.length < lastval.length || val.indexOf(lastval) !== 0 ) { + + // Removed chars or pasted something totally different, check all items + listItems = list.children(); + } else { + + // Only chars added, not removed, only use visible subset + listItems = list.children( ":not(.ui-screen-hidden)" ); + } + + if ( val ) { + + // This handles hiding regular rows without the text we search for + // and any list dividers without regular rows shown under it + + for ( var i = listItems.length - 1; i >= 0; i-- ) { + item = $( listItems[ i ] ); + itemtext = item.jqmData( "filtertext" ) || item.text(); + + if ( item.is( "li:jqmData(role=list-divider)" ) ) { + + item.toggleClass( "ui-filter-hidequeue" , !childItems ); + + // New bucket! + childItems = false; + + } else if ( listview.options.filterCallback( itemtext, val ) ) { + + //mark to be hidden + item.toggleClass( "ui-filter-hidequeue" , true ); + } else { + + // There's a shown item in the bucket + childItems = true; + } + } + + // Show items, not marked to be hidden + listItems + .filter( ":not(.ui-filter-hidequeue)" ) + .toggleClass( "ui-screen-hidden", false ); + + // Hide items, marked to be hidden + listItems + .filter( ".ui-filter-hidequeue" ) + .toggleClass( "ui-screen-hidden", true ) + .toggleClass( "ui-filter-hidequeue", false ); + + } else { + + //filtervalue is empty => show all + listItems.toggleClass( "ui-screen-hidden", false ); + } + listview._refreshCorners(); + }) + .appendTo( wrapper ) + .textinput(); + + if ( listview.options.inset ) { + wrapper.addClass( "ui-listview-filter-inset" ); + } + + wrapper.bind( "submit", function() { + return false; + }) + .insertBefore( list ); +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.widget( "mobile.slider", $.mobile.widget, { + options: { + theme: null, + trackTheme: null, + disabled: false, + initSelector: "input[type='range'], :jqmData(type='range'), :jqmData(role='slider')", + mini: false + }, + + _create: function() { + + // TODO: Each of these should have comments explain what they're for + var self = this, + + control = this.element, + + parentTheme = $.mobile.getInheritedTheme( control, "c" ), + + theme = this.options.theme || parentTheme, + + trackTheme = this.options.trackTheme || parentTheme, + + cType = control[ 0 ].nodeName.toLowerCase(), + + selectClass = ( cType == "select" ) ? "ui-slider-switch" : "", + + controlID = control.attr( "id" ), + + labelID = controlID + "-label", + + label = $( "[for='"+ controlID +"']" ).attr( "id", labelID ), + + val = function() { + return cType == "input" ? parseFloat( control.val() ) : control[0].selectedIndex; + }, + + min = cType == "input" ? parseFloat( control.attr( "min" ) ) : 0, + + max = cType == "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length-1, + + step = window.parseFloat( control.attr( "step" ) || 1 ), + + inlineClass = ( this.options.inline || control.jqmData("inline") == true ) ? " ui-slider-inline" : "", + + miniClass = ( this.options.mini || control.jqmData("mini") ) ? " ui-slider-mini" : "", + + + domHandle = document.createElement('a'), + handle = $( domHandle ), + domSlider = document.createElement('div'), + slider = $( domSlider ), + + valuebg = control.jqmData("highlight") && cType != "select" ? (function() { + var bg = document.createElement('div'); + bg.className = 'ui-slider-bg ui-btn-active ui-btn-corner-all'; + return $( bg ).prependTo( slider ); + })() : false, + + options; + + domHandle.setAttribute( 'href', "#" ); + domSlider.setAttribute('role','application'); + domSlider.className = ['ui-slider ',selectClass," ui-btn-down-",trackTheme,' ui-btn-corner-all', inlineClass, miniClass].join(""); + domHandle.className = 'ui-slider-handle'; + domSlider.appendChild(domHandle); + + handle.buttonMarkup({ corners: true, theme: theme, shadow: true }) + .attr({ + "role": "slider", + "aria-valuemin": min, + "aria-valuemax": max, + "aria-valuenow": val(), + "aria-valuetext": val(), + "title": val(), + "aria-labelledby": labelID + }); + + $.extend( this, { + slider: slider, + handle: handle, + valuebg: valuebg, + dragging: false, + beforeStart: null, + userModified: false, + mouseMoved: false + }); + + if ( cType == "select" ) { + var wrapper = document.createElement('div'); + wrapper.className = 'ui-slider-inneroffset'; + + for(var j = 0,length = domSlider.childNodes.length;j < length;j++){ + wrapper.appendChild(domSlider.childNodes[j]); + } + + domSlider.appendChild(wrapper); + + // slider.wrapInner( "<div class='ui-slider-inneroffset'></div>" ); + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + options = control.find( "option" ); + + for(var i = 0, optionsCount = options.length; i < optionsCount; i++){ + var side = !i ? "b":"a", + sliderTheme = !i ? " ui-btn-down-" + trackTheme :( " " + $.mobile.activeBtnClass ), + sliderLabel = document.createElement('div'), + sliderImg = document.createElement('span'); + + sliderImg.className = ['ui-slider-label ui-slider-label-',side,sliderTheme," ui-btn-corner-all"].join(""); + sliderImg.setAttribute('role','img'); + sliderImg.appendChild(document.createTextNode(options[i].innerHTML)); + $(sliderImg).prependTo( slider ); + } + + self._labels = $( ".ui-slider-label", slider ); + + } + + label.addClass( "ui-slider" ); + + // monitor the input for updated values + control.addClass( cType === "input" ? "ui-slider-input" : "ui-slider-switch" ) + .change( function() { + // if the user dragged the handle, the "change" event was triggered from inside refresh(); don't call refresh() again + if (!self.mouseMoved) { + self.refresh( val(), true ); + } + }) + .keyup( function() { // necessary? + self.refresh( val(), true, true ); + }) + .blur( function() { + self.refresh( val(), true ); + }); + + // prevent screen drag when slider activated + $( document ).bind( "vmousemove", function( event ) { + if ( self.dragging ) { + // self.mouseMoved must be updated before refresh() because it will be used in the control "change" event + self.mouseMoved = true; + + if ( cType === "select" ) { + // make the handle move in sync with the mouse + handle.removeClass( "ui-slider-handle-snapping" ); + } + + self.refresh( event ); + + // only after refresh() you can calculate self.userModified + self.userModified = self.beforeStart !== control[0].selectedIndex; + return false; + } + }); + + slider.bind( "vmousedown", function( event ) { + self.dragging = true; + self.userModified = false; + self.mouseMoved = false; + + if ( cType === "select" ) { + self.beforeStart = control[0].selectedIndex; + } + + self.refresh( event ); + return false; + }) + .bind( "vclick", false ); + + slider.add( document ) + .bind( "vmouseup", function() { + if ( self.dragging ) { + + self.dragging = false; + + if ( cType === "select") { + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + if ( self.mouseMoved ) { + + // this is a drag, change the value only if user dragged enough + if ( self.userModified ) { + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + else { + self.refresh( self.beforeStart ); + } + + } + else { + // this is just a click, change the value + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + + } + + self.mouseMoved = false; + + return false; + } + }); + + slider.insertAfter( control ); + + // Only add focus class to toggle switch, sliders get it automatically from ui-btn + if( cType == 'select' ) { + this.handle.bind({ + focus: function() { + slider.addClass( $.mobile.focusClass ); + }, + + blur: function() { + slider.removeClass( $.mobile.focusClass ); + } + }); + } + + this.handle.bind({ + // NOTE force focus on handle + vmousedown: function() { + $( this ).focus(); + }, + + vclick: false, + + keydown: function( event ) { + var index = val(); + + if ( self.options.disabled ) { + return; + } + + // In all cases prevent the default and mark the handle as active + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + case $.mobile.keyCode.END: + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + event.preventDefault(); + + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + } + break; + } + + // move the slider according to the keypress + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + self.refresh( min ); + break; + case $.mobile.keyCode.END: + self.refresh( max ); + break; + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + self.refresh( index + step ); + break; + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + self.refresh( index - step ); + break; + } + }, // remove active mark + + keyup: function( event ) { + if ( self._keySliding ) { + self._keySliding = false; + $( this ).removeClass( "ui-state-active" ); + } + } + }); + + this.refresh(undefined, undefined, true); + }, + + refresh: function( val, isfromControl, preventInputUpdate ) { + + if ( this.options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + var control = this.element, percent, + cType = control[0].nodeName.toLowerCase(), + min = cType === "input" ? parseFloat( control.attr( "min" ) ) : 0, + max = cType === "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length - 1, + step = (cType === "input" && parseFloat( control.attr( "step" ) ) > 0) ? parseFloat(control.attr("step")) : 1; + + if ( typeof val === "object" ) { + var data = val, + // a slight tolerance helped get to the ends of the slider + tol = 8; + if ( !this.dragging || + data.pageX < this.slider.offset().left - tol || + data.pageX > this.slider.offset().left + this.slider.width() + tol ) { + return; + } + percent = Math.round( ( ( data.pageX - this.slider.offset().left ) / this.slider.width() ) * 100 ); + } else { + if ( val == null ) { + val = cType === "input" ? parseFloat( control.val() || 0 ) : control[0].selectedIndex; + } + percent = ( parseFloat( val ) - min ) / ( max - min ) * 100; + } + + if ( isNaN( percent ) ) { + return; + } + + if ( percent < 0 ) { + percent = 0; + } + + if ( percent > 100 ) { + percent = 100; + } + + var newval = ( percent / 100 ) * ( max - min ) + min; + + //from jQuery UI slider, the following source will round to the nearest step + var valModStep = ( newval - min ) % step; + var alignValue = newval - valModStep; + + if ( Math.abs( valModStep ) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see jQueryUI: #4124) + newval = parseFloat( alignValue.toFixed(5) ); + + if ( newval < min ) { + newval = min; + } + + if ( newval > max ) { + newval = max; + } + + this.handle.css( "left", percent + "%" ); + this.handle.attr( { + "aria-valuenow": cType === "input" ? newval : control.find( "option" ).eq( newval ).attr( "value" ), + "aria-valuetext": cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText(), + title: cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText() + }); + this.valuebg && this.valuebg.css( "width", percent + "%" ); + + // drag the label widths + if ( this._labels ) { + var handlePercent = this.handle.width() / this.slider.width() * 100, + aPercent = percent && handlePercent + ( 100 - handlePercent ) * percent / 100, + bPercent = percent === 100 ? 0 : Math.min( handlePercent + 100 - aPercent, 100 ); + + this._labels.each(function(){ + var ab = $(this).is( ".ui-slider-label-a" ); + $( this ).width( ( ab ? aPercent : bPercent ) + "%" ); + }); + } + + if ( !preventInputUpdate ) { + var valueChanged = false; + + // update control"s value + if ( cType === "input" ) { + valueChanged = control.val() !== newval; + control.val( newval ); + } else { + valueChanged = control[ 0 ].selectedIndex !== newval; + control[ 0 ].selectedIndex = newval; + } + if ( !isfromControl && valueChanged ) { + control.trigger( "change" ); + } + } + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.slider.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.slider.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + } + +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.slider.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.selectmenu", $.mobile.widget, { + options: { + theme: null, + disabled: false, + icon: "arrow-d", + iconpos: "right", + inline: false, + corners: true, + shadow: true, + iconshadow: true, + overlayTheme: "a", + hidePlaceholderMenuItems: true, + closeText: "Close", + nativeMenu: true, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "select:not(:jqmData(role='slider'))", + mini: false + }, + + _button: function(){ + return $( "<div/>" ); + }, + + _setDisabled: function( value ) { + this.element.attr( "disabled", value ); + this.button.attr( "aria-disabled", value ); + return this._setOption( "disabled", value ); + }, + + _focusButton : function() { + var self = this; + + setTimeout( function() { + self.button.focus(); + }, 40); + }, + + _selectOptions: function() { + return this.select.find( "option" ); + }, + + // setup items that are generally necessary for select menu extension + _preExtension: function(){ + var classes = ""; + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~this.element[0].className.indexOf( "ui-btn-left" ) ) { + classes = " ui-btn-left"; + } + + if( !!~this.element[0].className.indexOf( "ui-btn-right" ) ) { + classes = " ui-btn-right"; + } + + this.select = this.element.wrap( "<div class='ui-select" + classes + "'>" ); + this.selectID = this.select.attr( "id" ); + this.label = $( "label[for='"+ this.selectID +"']" ).addClass( "ui-select" ); + this.isMultiple = this.select[ 0 ].multiple; + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.select, "c" ); + } + }, + + _create: function() { + this._preExtension(); + + // Allows for extension of the native select for custom selects and other plugins + // see select.custom for example extension + // TODO explore plugin registration + this._trigger( "beforeCreate" ); + + this.button = this._button(); + + var self = this, + + options = this.options, + + // IE throws an exception at options.item() function when + // there is no selected item + // select first in this case + selectedIndex = this.select[ 0 ].selectedIndex == -1 ? 0 : this.select[ 0 ].selectedIndex, + + // TODO values buttonId and menuId are undefined here + button = this.button + .text( $( this.select[ 0 ].options.item( selectedIndex ) ).text() ) + .insertBefore( this.select ) + .buttonMarkup( { + theme: options.theme, + icon: options.icon, + iconpos: options.iconpos, + inline: options.inline, + corners: options.corners, + shadow: options.shadow, + iconshadow: options.iconshadow, + mini: options.mini + }); + + // Opera does not properly support opacity on select elements + // In Mini, it hides the element, but not its text + // On the desktop,it seems to do the opposite + // for these reasons, using the nativeMenu option results in a full native select in Opera + if ( options.nativeMenu && window.opera && window.opera.version ) { + this.select.addClass( "ui-select-nativeonly" ); + } + + // Add counter for multi selects + if ( this.isMultiple ) { + this.buttonCount = $( "<span>" ) + .addClass( "ui-li-count ui-btn-up-c ui-btn-corner-all" ) + .hide() + .appendTo( button.addClass('ui-li-has-count') ); + } + + // Disable if specified + if ( options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + // Events on native select + this.select.change( function() { + self.refresh(); + }); + + this.build(); + }, + + build: function() { + var self = this; + + this.select + .appendTo( self.button ) + .bind( "vmousedown", function() { + // Add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + }) + .bind( "focus", function() { + self.button.addClass( $.mobile.focusClass ); + }) + .bind( "blur", function() { + self.button.removeClass( $.mobile.focusClass ); + }) + .bind( "focus vmouseover", function() { + self.button.trigger( "vmouseover" ); + }) + .bind( "vmousemove", function() { + // Remove active class on scroll/touchmove + self.button.removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur vmouseout", function() { + self.button.trigger( "vmouseout" ) + .removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur", function() { + self.button.removeClass( "ui-btn-down-" + self.options.theme ); + }); + + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + self.button.bind( "vmousedown", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "mouseup", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + }, + + selected: function() { + return this._selectOptions().filter( ":selected" ); + }, + + selectedIndices: function() { + var self = this; + + return this.selected().map( function() { + return self._selectOptions().index( this ); + }).get(); + }, + + setButtonText: function() { + var self = this, selected = this.selected(); + + this.button.find( ".ui-btn-text" ).text( function() { + if ( !self.isMultiple ) { + return selected.text(); + } + + return selected.length ? selected.map( function() { + return $( this ).text(); + }).get().join( ", " ) : self.placeholder; + }); + }, + + setButtonCount: function() { + var selected = this.selected(); + + // multiple count inside button + if ( this.isMultiple ) { + this.buttonCount[ selected.length > 1 ? "show" : "hide" ]().text( selected.length ); + } + }, + + refresh: function() { + this.setButtonText(); + this.setButtonCount(); + }, + + // open and close preserved in native selects + // to simplify users code when looping over selects + open: $.noop, + close: $.noop, + + disable: function() { + this._setDisabled( true ); + this.button.addClass( "ui-disabled" ); + }, + + enable: function() { + this._setDisabled( false ); + this.button.removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.selectmenu.prototype.enhanceWithin( e.target, true ); +}); +})( jQuery ); + +/* +* custom "selectmenu" plugin +*/ + +(function( $, undefined ) { + var extendSelect = function( widget ){ + + var select = widget.select, + selectID = widget.selectID, + label = widget.label, + thisPage = widget.select.closest( ".ui-page" ), + screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"} ).appendTo( thisPage ), + selectOptions = widget._selectOptions(), + isMultiple = widget.isMultiple = widget.select[ 0 ].multiple, + buttonId = selectID + "-button", + menuId = selectID + "-menu", + menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ widget.options.theme +"' data-" +$.mobile.ns + "overlay-theme='"+ widget.options.overlayTheme +"'>" + + "<div data-" + $.mobile.ns + "role='header'>" + + "<div class='ui-title'>" + label.getEncodedText() + "</div>"+ + "</div>"+ + "<div data-" + $.mobile.ns + "role='content'></div>"+ + "</div>" ), + + listbox = $("<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-" + widget.options.overlayTheme + " " + $.mobile.defaultDialogTransition } ).insertAfter(screen), + + list = $( "<ul>", { + "class": "ui-selectmenu-list", + "id": menuId, + "role": "listbox", + "aria-labelledby": buttonId + }).attr( "data-" + $.mobile.ns + "theme", widget.options.theme ).appendTo( listbox ), + + header = $( "<div>", { + "class": "ui-header ui-bar-" + widget.options.theme + }).prependTo( listbox ), + + headerTitle = $( "<h1>", { + "class": "ui-title" + }).appendTo( header ), + + menuPageContent, + menuPageClose, + headerClose; + + if( widget.isMultiple ) { + headerClose = $( "<a>", { + "text": widget.options.closeText, + "href": "#", + "class": "ui-btn-left" + }).attr( "data-" + $.mobile.ns + "iconpos", "notext" ).attr( "data-" + $.mobile.ns + "icon", "delete" ).appendTo( header ).buttonMarkup(); + } + + $.extend( widget, { + select: widget.select, + selectID: selectID, + buttonId: buttonId, + menuId: menuId, + thisPage: thisPage, + menuPage: menuPage, + label: label, + screen: screen, + selectOptions: selectOptions, + isMultiple: isMultiple, + theme: widget.options.theme, + listbox: listbox, + list: list, + header: header, + headerTitle: headerTitle, + headerClose: headerClose, + menuPageContent: menuPageContent, + menuPageClose: menuPageClose, + placeholder: "", + + build: function() { + var self = this; + + // Create list from select, update state + self.refresh(); + + self.select.attr( "tabindex", "-1" ).focus(function() { + $( this ).blur(); + self.button.focus(); + }); + + // Button events + self.button.bind( "vclick keydown" , function( event ) { + if ( event.type == "vclick" || + event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || + event.keyCode === $.mobile.keyCode.SPACE ) ) { + + self.open(); + event.preventDefault(); + } + }); + + // Events for list items + self.list.attr( "role", "listbox" ) + .bind( "focusin", function( e ){ + $( e.target ) + .attr( "tabindex", "0" ) + .trigger( "vmouseover" ); + + }) + .bind( "focusout", function( e ){ + $( e.target ) + .attr( "tabindex", "-1" ) + .trigger( "vmouseout" ); + }) + .delegate( "li:not(.ui-disabled, .ui-li-divider)", "click", function( event ) { + + // index of option tag to be selected + var oldIndex = self.select[ 0 ].selectedIndex, + newIndex = self.list.find( "li:not(.ui-li-divider)" ).index( this ), + option = self._selectOptions().eq( newIndex )[ 0 ]; + + // toggle selected status on the tag for multi selects + option.selected = self.isMultiple ? !option.selected : true; + + // toggle checkbox class for multiple selects + if ( self.isMultiple ) { + $( this ).find( ".ui-icon" ) + .toggleClass( "ui-icon-checkbox-on", option.selected ) + .toggleClass( "ui-icon-checkbox-off", !option.selected ); + } + + // trigger change if value changed + if ( self.isMultiple || oldIndex !== newIndex ) { + self.select.trigger( "change" ); + } + + //hide custom select for single selects only + if ( !self.isMultiple ) { + self.close(); + } + + event.preventDefault(); + }) + .keydown(function( event ) { //keyboard events for menu items + var target = $( event.target ), + li = target.closest( "li" ), + prev, next; + + // switch logic based on which key was pressed + switch ( event.keyCode ) { + // up or left arrow keys + case 38: + prev = li.prev().not( ".ui-selectmenu-placeholder" ); + + if( prev.is( ".ui-li-divider" ) ) { + prev = prev.prev(); + } + + // if there's a previous option, focus it + if ( prev.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + prev.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // down or right arrow keys + case 40: + next = li.next(); + + if( next.is( ".ui-li-divider" ) ) { + next = next.next(); + } + + // if there's a next option, focus it + if ( next.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + next.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // If enter or space is pressed, trigger click + case 13: + case 32: + target.trigger( "click" ); + + return false; + break; + } + }); + + // button refocus ensures proper height calculation + // by removing the inline style and ensuring page inclusion + self.menuPage.bind( "pagehide", function() { + self.list.appendTo( self.listbox ); + self._focusButton(); + + // TODO centralize page removal binding / handling in the page plugin. + // Suggestion from @jblas to do refcounting + // + // TODO extremely confusing dependency on the open method where the pagehide.remove + // bindings are stripped to prevent the parent page from disappearing. The way + // we're keeping pages in the DOM right now sucks + // + // rebind the page remove that was unbound in the open function + // to allow for the parent page removal from actions other than the use + // of a dialog sized custom select + // + // doing this here provides for the back button on the custom select dialog + $.mobile._bindPageRemove.call( self.thisPage ); + }); + + // Events on "screen" overlay + self.screen.bind( "vclick", function( event ) { + self.close(); + }); + + // Close button on small overlays + if( self.isMultiple ){ + self.headerClose.click( function() { + if ( self.menuType == "overlay" ) { + self.close(); + return false; + } + }); + } + + // track this dependency so that when the parent page + // is removed on pagehide it will also remove the menupage + self.thisPage.addDependents( this.menuPage ); + }, + + _isRebuildRequired: function() { + var list = this.list.find( "li" ), + options = this._selectOptions(); + + // TODO exceedingly naive method to determine difference + // ignores value changes etc in favor of a forcedRebuild + // from the user in the refresh method + return options.text() !== list.text(); + }, + + refresh: function( forceRebuild , foo ){ + var self = this, + select = this.element, + isMultiple = this.isMultiple, + options = this._selectOptions(), + selected = this.selected(), + // return an array of all selected index's + indicies = this.selectedIndices(); + + if ( forceRebuild || this._isRebuildRequired() ) { + self._buildList(); + } + + self.setButtonText(); + self.setButtonCount(); + + self.list.find( "li:not(.ui-li-divider)" ) + .removeClass( $.mobile.activeBtnClass ) + .attr( "aria-selected", false ) + .each(function( i ) { + + if ( $.inArray( i, indicies ) > -1 ) { + var item = $( this ); + + // Aria selected attr + item.attr( "aria-selected", true ); + + // Multiple selects: add the "on" checkbox state to the icon + if ( self.isMultiple ) { + item.find( ".ui-icon" ).removeClass( "ui-icon-checkbox-off" ).addClass( "ui-icon-checkbox-on" ); + } else { + if( item.is( ".ui-selectmenu-placeholder" ) ) { + item.next().addClass( $.mobile.activeBtnClass ); + } else { + item.addClass( $.mobile.activeBtnClass ); + } + } + } + }); + }, + + close: function() { + if ( this.options.disabled || !this.isOpen ) { + return; + } + + var self = this; + + if ( self.menuType == "page" ) { + // doesn't solve the possible issue with calling change page + // where the objects don't define data urls which prevents dialog key + // stripping - changePage has incoming refactor + window.history.back(); + } else { + self.screen.addClass( "ui-screen-hidden" ); + self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass( "in" ); + self.list.appendTo( self.listbox ); + self._focusButton(); + } + + // allow the dialog to be closed again + self.isOpen = false; + }, + + open: function() { + if ( this.options.disabled ) { + return; + } + + var self = this, + $window = $( window ), + selfListParent = self.list.parent(), + menuHeight = selfListParent.outerHeight(), + menuWidth = selfListParent.outerWidth(), + activePage = $( ".ui-page-active" ), + tScrollElem = activePage, + scrollTop = $window.scrollTop(), + btnOffset = self.button.offset().top, + screenHeight = $window.height(), + screenWidth = $window.width(); + + //add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + + //remove after delay + setTimeout( function() { + self.button.removeClass( $.mobile.activeBtnClass ); + }, 300); + + function focusMenuItem() { + self.list.find( "." + $.mobile.activeBtnClass + " a" ).focus(); + } + + if ( menuHeight > screenHeight - 80 || !$.support.scrollTop ) { + + self.menuPage.appendTo( $.mobile.pageContainer ).page(); + self.menuPageContent = menuPage.find( ".ui-content" ); + self.menuPageClose = menuPage.find( ".ui-header a" ); + + // prevent the parent page from being removed from the DOM, + // otherwise the results of selecting a list item in the dialog + // fall into a black hole + self.thisPage.unbind( "pagehide.remove" ); + + //for WebOS/Opera Mini (set lastscroll using button offset) + if ( scrollTop == 0 && btnOffset > screenHeight ) { + self.thisPage.one( "pagehide", function() { + $( this ).jqmData( "lastScroll", btnOffset ); + }); + } + + self.menuPage.one( "pageshow", function() { + focusMenuItem(); + self.isOpen = true; + }); + + self.menuType = "page"; + self.menuPageContent.append( self.list ); + self.menuPage.find("div .ui-title").text(self.label.text()); + $.mobile.changePage( self.menuPage, { + transition: $.mobile.defaultDialogTransition + }); + } else { + self.menuType = "overlay"; + + self.screen.height( $(document).height() ) + .removeClass( "ui-screen-hidden" ); + + // Try and center the overlay over the button + var roomtop = btnOffset - scrollTop, + roombot = scrollTop + screenHeight - btnOffset, + halfheight = menuHeight / 2, + maxwidth = parseFloat( self.list.parent().css( "max-width" ) ), + newtop, newleft; + + if ( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ) { + newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight; + } else { + // 30px tolerance off the edges + newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30; + } + + // If the menuwidth is smaller than the screen center is + if ( menuWidth < maxwidth ) { + newleft = ( screenWidth - menuWidth ) / 2; + } else { + + //otherwise insure a >= 30px offset from the left + newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2; + + // 30px tolerance off the edges + if ( newleft < 30 ) { + newleft = 30; + } else if ( (newleft + menuWidth) > screenWidth ) { + newleft = screenWidth - menuWidth - 30; + } + } + + self.listbox.append( self.list ) + .removeClass( "ui-selectmenu-hidden" ) + .css({ + top: newtop, + left: newleft + }) + .addClass( "in" ); + + focusMenuItem(); + + // duplicate with value set in page show for dialog sized selects + self.isOpen = true; + } + }, + + _buildList: function() { + var self = this, + o = this.options, + placeholder = this.placeholder, + needPlaceholder = true, + optgroups = [], + lis = [], + dataIcon = self.isMultiple ? "checkbox-off" : "false"; + + self.list.empty().filter( ".ui-listview" ).listview( "destroy" ); + + var $options = self.select.find("option"), + numOptions = $options.length, + select = this.select[ 0 ], + dataPrefix = 'data-' + $.mobile.ns, + dataIndexAttr = dataPrefix + 'option-index', + dataIconAttr = dataPrefix + 'icon', + dataRoleAttr = dataPrefix + 'role', + fragment = document.createDocumentFragment(), + optGroup; + + for (var i = 0; i < numOptions;i++){ + var option = $options[i], + $option = $(option), + parent = option.parentNode, + text = $option.text(), + anchor = document.createElement('a'), + classes = []; + + anchor.setAttribute('href','#'); + anchor.appendChild(document.createTextNode(text)); + + // Are we inside an optgroup? + if (parent !== select && parent.nodeName.toLowerCase() === "optgroup"){ + var optLabel = parent.getAttribute('label'); + if ( optLabel != optGroup) { + var divider = document.createElement('li'); + divider.setAttribute(dataRoleAttr,'list-divider'); + divider.setAttribute('role','option'); + divider.setAttribute('tabindex','-1'); + divider.appendChild(document.createTextNode(optLabel)); + fragment.appendChild(divider); + optGroup = optLabel; + } + } + + if (needPlaceholder && (!option.getAttribute( "value" ) || text.length == 0 || $option.jqmData( "placeholder" ))) { + needPlaceholder = false; + if ( o.hidePlaceholderMenuItems ) { + classes.push( "ui-selectmenu-placeholder" ); + } + if (!placeholder) { + placeholder = self.placeholder = text; + } + } + + var item = document.createElement('li'); + if ( option.disabled ) { + classes.push( "ui-disabled" ); + item.setAttribute('aria-disabled',true); + } + item.setAttribute(dataIndexAttr,i); + item.setAttribute(dataIconAttr,dataIcon); + item.className = classes.join(" "); + item.setAttribute('role','option'); + anchor.setAttribute('tabindex','-1'); + item.appendChild(anchor); + fragment.appendChild(item); + } + + self.list[0].appendChild(fragment); + + // Hide header if it's not a multiselect and there's no placeholder + if ( !this.isMultiple && !placeholder.length ) { + this.header.hide(); + } else { + this.headerTitle.text( this.placeholder ); + } + + // Now populated, create listview + self.list.listview(); + }, + + _button: function(){ + return $( "<a>", { + "href": "#", + "role": "button", + // TODO value is undefined at creation + "id": this.buttonId, + "aria-haspopup": "true", + + // TODO value is undefined at creation + "aria-owns": this.menuId + }); + } + }); + }; + + // issue #3894 - core doesn't triggered events on disabled delegates + $( document ).bind( "selectmenubeforecreate", function( event ){ + var selectmenuWidget = $( event.target ).data( "selectmenu" ); + + if( !selectmenuWidget.options.nativeMenu ){ + extendSelect( selectmenuWidget ); + } + }); +})( jQuery ); + +(function( $, undefined ) { + + + $.widget( "mobile.fixedtoolbar", $.mobile.widget, { + options: { + visibleOnPageShow: true, + disablePageZoom: true, + transition: "slide", //can be none, fade, slide (slide maps to slideup or slidedown) + fullscreen: false, + tapToggle: true, + tapToggleBlacklist: "a, input, select, textarea, .ui-header-fixed, .ui-footer-fixed", + hideDuringFocus: "input, textarea, select", + updatePagePadding: true, + trackPersistentToolbars: true, + + // Browser detection! Weeee, here we go... + // Unfortunately, position:fixed is costly, not to mention probably impossible, to feature-detect accurately. + // Some tests exist, but they currently return false results in critical devices and browsers, which could lead to a broken experience. + // Testing fixed positioning is also pretty obtrusive to page load, requiring injected elements and scrolling the window + // The following function serves to rule out some popular browsers with known fixed-positioning issues + // This is a plugin option like any other, so feel free to improve or overwrite it + supportBlacklist: function(){ + var w = window, + ua = navigator.userAgent, + platform = navigator.platform, + // Rendering engine is Webkit, and capture major version + wkmatch = ua.match( /AppleWebKit\/([0-9]+)/ ), + wkversion = !!wkmatch && wkmatch[ 1 ], + ffmatch = ua.match( /Fennec\/([0-9]+)/ ), + ffversion = !!ffmatch && ffmatch[ 1 ], + operammobilematch = ua.match( /Opera Mobi\/([0-9]+)/ ), + omversion = !!operammobilematch && operammobilematch[ 1 ]; + + if( + // iOS 4.3 and older : Platform is iPhone/Pad/Touch and Webkit version is less than 534 (ios5) + ( ( platform.indexOf( "iPhone" ) > -1 || platform.indexOf( "iPad" ) > -1 || platform.indexOf( "iPod" ) > -1 ) && wkversion && wkversion < 534 ) + || + // Opera Mini + ( w.operamini && ({}).toString.call( w.operamini ) === "[object OperaMini]" ) + || + ( operammobilematch && omversion < 7458 ) + || + //Android lte 2.1: Platform is Android and Webkit version is less than 533 (Android 2.2) + ( ua.indexOf( "Android" ) > -1 && wkversion && wkversion < 533 ) + || + // Firefox Mobile before 6.0 - + ( ffversion && ffversion < 6 ) + || + // WebOS less than 3 + ( "palmGetResource" in window && wkversion && wkversion < 534 ) + || + // MeeGo + ( ua.indexOf( "MeeGo" ) > -1 && ua.indexOf( "NokiaBrowser/8.5.0" ) > -1 ) + ){ + return true; + } + + return false; + }, + initSelector: ":jqmData(position='fixed')" + }, + + _create: function() { + + var self = this, + o = self.options, + $el = self.element, + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer", + $page = $el.closest(".ui-page"); + + // Feature detecting support for + if( o.supportBlacklist() ){ + self.destroy(); + return; + } + + $el.addClass( "ui-"+ tbtype +"-fixed" ); + + // "fullscreen" overlay positioning + if( o.fullscreen ){ + $el.addClass( "ui-"+ tbtype +"-fullscreen" ); + $page.addClass( "ui-page-" + tbtype + "-fullscreen" ); + } + // If not fullscreen, add class to page to set top or bottom padding + else{ + $page.addClass( "ui-page-" + tbtype + "-fixed" ); + } + + self._addTransitionClass(); + self._bindPageEvents(); + self._bindToggleHandlers(); + }, + + _addTransitionClass: function(){ + var tclass = this.options.transition; + + if( tclass && tclass !== "none" ){ + // use appropriate slide for header or footer + if( tclass === "slide" ){ + tclass = this.element.is( ".ui-header" ) ? "slidedown" : "slideup"; + } + + this.element.addClass( tclass ); + } + }, + + _bindPageEvents: function(){ + var self = this, + o = self.options, + $el = self.element; + + //page event bindings + // Fixed toolbars require page zoom to be disabled, otherwise usability issues crop up + // This method is meant to disable zoom while a fixed-positioned toolbar page is visible + $el.closest( ".ui-page" ) + .bind( "pagebeforeshow", function(){ + if( o.disablePageZoom ){ + $.mobile.zoom.disable( true ); + } + if( !o.visibleOnPageShow ){ + self.hide( true ); + } + } ) + .bind( "webkitAnimationStart animationstart updatelayout", function(){ + if( o.updatePagePadding ){ + self.updatePagePadding(); + } + }) + .bind( "pageshow", function(){ + self.updatePagePadding(); + if( o.updatePagePadding ){ + $( window ).bind( "throttledresize." + self.widgetName, function(){ + self.updatePagePadding(); + }); + } + }) + .bind( "pagebeforehide", function( e, ui ){ + if( o.disablePageZoom ){ + $.mobile.zoom.enable( true ); + } + if( o.updatePagePadding ){ + $( window ).unbind( "throttledresize." + self.widgetName ); + } + + if( o.trackPersistentToolbars ){ + var thisFooter = $( ".ui-footer-fixed:jqmData(id)", this ), + thisHeader = $( ".ui-header-fixed:jqmData(id)", this ), + nextFooter = thisFooter.length && ui.nextPage && $( ".ui-footer-fixed:jqmData(id='" + thisFooter.jqmData( "id" ) + "')", ui.nextPage ), + nextHeader = thisHeader.length && ui.nextPage && $( ".ui-header-fixed:jqmData(id='" + thisHeader.jqmData( "id" ) + "')", ui.nextPage ); + + nextFooter = nextFooter || $(); + + if( nextFooter.length || nextHeader.length ){ + + nextFooter.add( nextHeader ).appendTo( $.mobile.pageContainer ); + + ui.nextPage.one( "pageshow", function(){ + nextFooter.add( nextHeader ).appendTo( this ); + }); + } + } + }); + }, + + _visible: true, + + // This will set the content element's top or bottom padding equal to the toolbar's height + updatePagePadding: function() { + var $el = this.element, + header = $el.is( ".ui-header" ); + + // This behavior only applies to "fixed", not "fullscreen" + if( this.options.fullscreen ){ return; } + + $el.closest( ".ui-page" ).css( "padding-" + ( header ? "top" : "bottom" ), $el.outerHeight() ); + }, + + _useTransition: function( notransition ){ + var $win = $( window ), + $el = this.element, + scroll = $win.scrollTop(), + elHeight = $el.height(), + pHeight = $el.closest( ".ui-page" ).height(), + viewportHeight = $.mobile.getScreenHeight(), + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer"; + + return !notransition && + ( this.options.transition && this.options.transition !== "none" && + ( + ( tbtype === "header" && !this.options.fullscreen && scroll > elHeight ) || + ( tbtype === "footer" && !this.options.fullscreen && scroll + viewportHeight < pHeight - elHeight ) + ) || this.options.fullscreen + ); + }, + + show: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element; + + if( this._useTransition( notransition ) ){ + $el + .removeClass( "out " + hideClass ) + .addClass( "in" ); + } + else { + $el.removeClass( hideClass ); + } + this._visible = true; + }, + + hide: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element, + // if it's a slide transition, our new transitions need the reverse class as well to slide outward + outclass = "out" + ( this.options.transition === "slide" ? " reverse" : "" ); + + if( this._useTransition( notransition ) ){ + $el + .addClass( outclass ) + .removeClass( "in" ) + .animationComplete( function(){ + $el.addClass( hideClass ).removeClass( outclass ); + }); + } + else { + $el.addClass( hideClass ).removeClass( outclass ); + } + this._visible = false; + }, + + toggle: function(){ + this[ this._visible ? "hide" : "show" ](); + }, + + _bindToggleHandlers: function(){ + var self = this, + o = self.options, + $el = self.element; + + // tap toggle + $el.closest( ".ui-page" ) + .bind( "vclick", function( e ){ + if( o.tapToggle && !$( e.target ).closest( o.tapToggleBlacklist ).length ){ + self.toggle(); + } + }) + .bind( "focusin focusout", function( e ){ + if( screen.width < 500 && $( e.target ).is( o.hideDuringFocus ) && !$( e.target ).closest( ".ui-header-fixed, .ui-footer-fixed" ).length ){ + self[ ( e.type === "focusin" && self._visible ) ? "hide" : "show" ](); + } + }); + }, + + destroy: function(){ + this.element.removeClass( "ui-header-fixed ui-footer-fixed ui-header-fullscreen ui-footer-fullscreen in out fade slidedown slideup ui-fixed-hidden" ); + this.element.closest( ".ui-page" ).removeClass( "ui-page-header-fixed ui-page-footer-fixed ui-page-header-fullscreen ui-page-footer-fullscreen" ); + } + + }); + + //auto self-init widgets + $( document ) + .bind( "pagecreate create", function( e ){ + + // DEPRECATED in 1.1: support for data-fullscreen=true|false on the page element. + // This line ensures it still works, but we recommend moving the attribute to the toolbars themselves. + if( $( e.target ).jqmData( "fullscreen" ) ){ + $( $.mobile.fixedtoolbar.prototype.options.initSelector, e.target ).not( ":jqmData(fullscreen)" ).jqmData( "fullscreen", true ); + } + + $.mobile.fixedtoolbar.prototype.enhanceWithin( e.target ); + }); + +})( jQuery ); + +( function( $, window ) { + + // This fix addresses an iOS bug, so return early if the UA claims it's something else. + if( !(/iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1 ) ){ + return; + } + + var zoom = $.mobile.zoom, + evt, x, y, z, aig; + + function checkTilt( e ){ + evt = e.originalEvent; + aig = evt.accelerationIncludingGravity; + + x = Math.abs( aig.x ); + y = Math.abs( aig.y ); + z = Math.abs( aig.z ); + + // If portrait orientation and in one of the danger zones + if( !window.orientation && ( x > 7 || ( ( z > 6 && y < 8 || z < 8 && y > 6 ) && x > 5 ) ) ){ + if( zoom.enabled ){ + zoom.disable(); + } + } + else if( !zoom.enabled ){ + zoom.enable(); + } + } + + $( window ) + .bind( "orientationchange.iosorientationfix", zoom.enable ) + .bind( "devicemotion.iosorientationfix", checkTilt ); + +}( jQuery, this )); + +( function( $, window, undefined ) { + var $html = $( "html" ), + $head = $( "head" ), + $window = $( window ); + + // trigger mobileinit event - useful hook for configuring $.mobile settings before they're used + $( window.document ).trigger( "mobileinit" ); + + // support conditions + // if device support condition(s) aren't met, leave things as they are -> a basic, usable experience, + // otherwise, proceed with the enhancements + if ( !$.mobile.gradeA() ) { + return; + } + + // override ajaxEnabled on platforms that have known conflicts with hash history updates + // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini) + if ( $.mobile.ajaxBlacklist ) { + $.mobile.ajaxEnabled = false; + } + + // Add mobile, initial load "rendering" classes to docEl + $html.addClass( "ui-mobile ui-mobile-rendering" ); + + // This is a fallback. If anything goes wrong (JS errors, etc), or events don't fire, + // this ensures the rendering class is removed after 5 seconds, so content is visible and accessible + setTimeout( hideRenderingClass, 5000 ); + + // loading div which appears during Ajax requests + // will not appear if $.mobile.loadingMessage is false + var loaderClass = "ui-loader", + $loader = $( "<div class='" + loaderClass + "'><span class='ui-icon ui-icon-loading'></span><h1></h1></div>" ); + + // For non-fixed supportin browsers. Position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top + function fakeFixLoader(){ + var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); + + $loader + .css({ + top: $.support.scrollTop && $window.scrollTop() + $window.height() / 2 || + activeBtn.length && activeBtn.offset().top || 100 + }); + } + + // check position of loader to see if it appears to be "fixed" to center + // if not, use abs positioning + function checkLoaderPosition(){ + var offset = $loader.offset(), + scrollTop = $window.scrollTop(), + screenHeight = $.mobile.getScreenHeight(); + + if( offset.top < scrollTop || (offset.top - scrollTop) > screenHeight ) { + $loader.addClass( "ui-loader-fakefix" ); + fakeFixLoader(); + $window + .unbind( "scroll", checkLoaderPosition ) + .bind( "scroll", fakeFixLoader ); + } + } + + //remove initial build class (only present on first pageshow) + function hideRenderingClass(){ + $html.removeClass( "ui-mobile-rendering" ); + } + + $.extend($.mobile, { + // turn on/off page loading message. + showPageLoadingMsg: function( theme, msgText, textonly ) { + $html.addClass( "ui-loading" ); + + if ( $.mobile.loadingMessage ) { + // text visibility from argument takes priority + var textVisible = textonly || $.mobile.loadingMessageTextVisible; + + theme = theme || $.mobile.loadingMessageTheme, + + $loader + .attr( "class", loaderClass + " ui-corner-all ui-body-" + ( theme || "a" ) + " ui-loader-" + ( textVisible ? "verbose" : "default" ) + ( textonly ? " ui-loader-textonly" : "" ) ) + .find( "h1" ) + .text( msgText || $.mobile.loadingMessage ) + .end() + .appendTo( $.mobile.pageContainer ); + + checkLoaderPosition(); + $window.bind( "scroll", checkLoaderPosition ); + } + }, + + hidePageLoadingMsg: function() { + $html.removeClass( "ui-loading" ); + + if( $.mobile.loadingMessage ){ + $loader.removeClass( "ui-loader-fakefix" ); + } + + $( window ).unbind( "scroll", fakeFixLoader ); + $( window ).unbind( "scroll", checkLoaderPosition ); + }, + + // find and enhance the pages in the dom and transition to the first page. + initializePage: function() { + // find present pages + var $pages = $( ":jqmData(role='page'), :jqmData(role='dialog')" ); + + // if no pages are found, create one with body's inner html + if ( !$pages.length ) { + $pages = $( "body" ).wrapInner( "<div data-" + $.mobile.ns + "role='page'></div>" ).children( 0 ); + } + + // add dialogs, set data-url attrs + $pages.each(function() { + var $this = $(this); + + // unless the data url is already set set it to the pathname + if ( !$this.jqmData("url") ) { + $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) || location.pathname + location.search ); + } + }); + + // define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback) + $.mobile.firstPage = $pages.first(); + + // define page container + $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" ); + + // alert listeners that the pagecontainer has been determined for binding + // to events triggered on it + $window.trigger( "pagecontainercreate" ); + + // cue page loading message + $.mobile.showPageLoadingMsg(); + + //remove initial build class (only present on first pageshow) + hideRenderingClass(); + + // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM + if ( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ) { + $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } ); + } + // otherwise, trigger a hashchange to load a deeplink + else { + $window.trigger( "hashchange", [ true ] ); + } + } + }); + + // initialize events now, after mobileinit has occurred + $.mobile._registerInternalEvents(); + + // check which scrollTop value should be used by scrolling to 1 immediately at domready + // then check what the scroll top is. Android will report 0... others 1 + // note that this initial scroll won't hide the address bar. It's just for the check. + $(function() { + window.scrollTo( 0, 1 ); + + // if defaultHomeScroll hasn't been set yet, see if scrollTop is 1 + // it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar) + // so if it's 1, use 0 from now on + $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1; + + + // TODO: Implement a proper registration mechanism with dependency handling in order to not have exceptions like the one below + //auto self-init widgets for those widgets that have a soft dependency on others + if ( $.fn.controlgroup ) { + $( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='controlgroup')", e.target ) + .jqmEnhanceable() + .controlgroup({ excludeInvisible: false }); + }); + } + + //dom-ready inits + if( $.mobile.autoInitializePage ){ + $.mobile.initializePage(); + } + + // window load event + // hide iOS browser chrome on load + $window.load( $.mobile.silentScroll ); + }); +}( jQuery, this )); + + +})); diff --git a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js deleted file mode 100644 index 78ae1d6..0000000 --- a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js +++ /dev/null @@ -1,141 +0,0 @@ -/*! - * jQuery UI 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); -b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, -"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", -function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, -outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); -return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= -0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); -;/*! - * jQuery UI Widget 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, -a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; -e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, -this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, -widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, -enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -;/*! - * jQuery UI Mouse 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ -this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== -false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& -!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= -1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a= -a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); -;/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& -a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); -;
\ No newline at end of file diff --git a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js new file mode 100644 index 0000000..42413ed --- /dev/null +++ b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js @@ -0,0 +1,1937 @@ +/*! + * jQuery UI 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.21", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/*! + * jQuery UI Position 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); +/*! + * jQuery UI Dialog 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.21", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); |