diff options
author | Antonio Gallo <tonicucoz@gmail.com> | 2012-06-08 06:35:20 +0000 |
---|---|---|
committer | Antonio Gallo <tonicucoz@gmail.com> | 2012-06-08 06:35:20 +0000 |
commit | 856f5652ea6800aa747f1b4d0337401c6a841f3e (patch) | |
tree | fb46084a1d09304285afeb25ede1c8900bc7fbe1 /h-source/Public | |
parent | 3c2c5a06170ad879a11c56b724512d24d32bff42 (diff) |
added Javascript license information file (for LibreJS) and replaced the minified version of each Javascript with the full version to improve clearness (also updating to the last release)
Diffstat (limited to 'h-source/Public')
-rw-r--r-- | h-source/Public/Js/functions.js | 6 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.0.min.js | 172 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.1.0.css (renamed from h-source/Public/Js/jquery/jquery.mobile-1.0.css) | 1618 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/jquery.mobile-1.1.0.js | 7551 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js | 141 | ||||
-rw-r--r-- | h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js | 1937 |
6 files changed, 10406 insertions, 1019 deletions
diff --git a/h-source/Public/Js/functions.js b/h-source/Public/Js/functions.js index 9111ba4..5b426d2 100644 --- a/h-source/Public/Js/functions.js +++ b/h-source/Public/Js/functions.js @@ -1,5 +1,8 @@ <!-- +// @licstart The following is the entire license notice for the +// JavaScript code in this page. + // h-source, a web software to build a community of people that want to share their hardware information. // Copyright (C) 2010 Antonio Gallo (h-source-copyright.txt) // @@ -18,6 +21,9 @@ // You should have received a copy of the GNU General Public License // along with h-source. If not, see <http://www.gnu.org/licenses/>. +// @licend The above is the entire license notice +// for the JavaScript code in this page. + function dist_list_helper() { var dist_list = ""; diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js b/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js deleted file mode 100644 index 0fca54b..0000000 --- a/h-source/Public/Js/jquery/jquery.mobile-1.0.min.js +++ /dev/null @@ -1,172 +0,0 @@ -/*! jQuery Mobile v1.0 jquerymobile.com | jquery.org/license */ -(function(a,e){if(a.cleanData){var b=a.cleanData;a.cleanData=function(f){for(var c=0,h;(h=f[c])!=null;c++)a(h).triggerHandler("remove");b(f)}}else{var d=a.fn.remove;a.fn.remove=function(b,c){return this.each(function(){c||(!b||a.filter(b,[this]).length)&&a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return d.call(a(this),b,c)})}}a.widget=function(b,c,h){var d=b.split(".")[0],e,b=b.split(".")[1];e=d+"-"+b;if(!h)h=c,c=a.Widget;a.expr[":"][e]=function(c){return!!a.data(c, -b)};a[d]=a[d]||{};a[d][b]=function(a,b){arguments.length&&this._createWidget(a,b)};c=new c;c.options=a.extend(true,{},c.options);a[d][b].prototype=a.extend(true,c,{namespace:d,widgetName:b,widgetEventPrefix:a[d][b].prototype.widgetEventPrefix||b,widgetBaseClass:e},h);a.widget.bridge(b,a[d][b])};a.widget.bridge=function(b,c){a.fn[b]=function(d){var g=typeof d==="string",i=Array.prototype.slice.call(arguments,1),k=this,d=!g&&i.length?a.extend.apply(null,[true,d].concat(i)):d;if(g&&d.charAt(0)==="_")return k; -g?this.each(function(){var c=a.data(this,b);if(!c)throw"cannot call methods on "+b+" prior to initialization; attempted to call method '"+d+"'";if(!a.isFunction(c[d]))throw"no such method '"+d+"' for "+b+" widget instance";var g=c[d].apply(c,i);if(g!==c&&g!==e)return k=g,false}):this.each(function(){var e=a.data(this,b);e?e.option(d||{})._init():a.data(this,b,new c(d,this))});return k}};a.Widget=function(a,b){arguments.length&&this._createWidget(a,b)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"", -options:{disabled:false},_createWidget:function(b,c){a.data(c,this.widgetName,this);this.element=a(c);this.options=a.extend(true,{},this.options,this._getCreateOptions(),b);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){var b={};a.metadata&&(b=a.metadata.get(element)[this.widgetName]);return b},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName); -this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(b,c){var d=b;if(arguments.length===0)return a.extend({},this.options);if(typeof b==="string"){if(c===e)return this.options[b];d={};d[b]=c}this._setOptions(d);return this},_setOptions:function(b){var c=this;a.each(b,function(a,b){c._setOption(a,b)});return this},_setOption:function(a,b){this.options[a]=b;a==="disabled"&& -this.widget()[b?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",b);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(b,c,d){var e=this.options[b],c=a.Event(c);c.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase();d=d||{};if(c.originalEvent)for(var b=a.event.props.length,i;b;)i=a.event.props[--b],c[i]=c.originalEvent[i];this.element.trigger(c, -d);return!(a.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -(function(a,e){a.widget("mobile.widget",{_createWidget:function(){a.Widget.prototype._createWidget.apply(this,arguments);this._trigger("init")},_getCreateOptions:function(){var b=this.element,d={};a.each(this.options,function(a){var c=b.jqmData(a.replace(/[A-Z]/g,function(a){return"-"+a.toLowerCase()}));c!==e&&(d[a]=c)});return d},enhanceWithin:function(b){var d=a(b).closest(":jqmData(role='page')").data("page"),d=d&&d.keepNativeSelector()||"";a(this.options.initSelector,b).not(d)[this.widgetName]()}})})(jQuery); -(function(a){a(window);var e=a("html");a.mobile.media=function(){var b={},d=a("<div id='jquery-mediatest'>"),f=a("<body>").append(d);return function(a){if(!(a in b)){var h=document.createElement("style"),g="@media "+a+" { #jquery-mediatest { position:absolute; } }";h.type="text/css";h.styleSheet?h.styleSheet.cssText=g:h.appendChild(document.createTextNode(g));e.prepend(f).prepend(h);b[a]=d.css("position")==="absolute";f.add(h).remove()}return b[a]}}()})(jQuery); -(function(a,e){function b(a){var b=a.charAt(0).toUpperCase()+a.substr(1),a=(a+" "+c.join(b+" ")+b).split(" "),d;for(d in a)if(f[a[d]]!==e)return true}var d=a("<body>").prependTo("html"),f=d[0].style,c=["Webkit","Moz","O"],h="palmGetResource"in window,g=window.operamini&&{}.toString.call(window.operamini)==="[object OperaMini]",i=window.blackberry;a.mobile.browser={};a.mobile.browser.ie=function(){for(var a=3,b=document.createElement("div"),c=b.all||[];b.innerHTML="<\!--[if gt IE "+ ++a+"]><br><![endif]--\>", -c[0];);return a>4?a:!a}();a.extend(a.support,{orientation:"orientation"in window&&"onorientationchange"in window,touch:"ontouchend"in document,cssTransitions:"WebKitTransitionEvent"in window,pushState:"pushState"in history&&"replaceState"in history,mediaquery:a.mobile.media("only all"),cssPseudoElement:!!b("content"),touchOverflow:!!b("overflowScrolling"),boxShadow:!!b("boxShadow")&&!i,scrollTop:("pageXOffset"in window||"scrollTop"in document.documentElement||"scrollTop"in d[0])&&!h&&!g,dynamicBaseTag:function(){var b= -location.protocol+"//"+location.host+location.pathname+"ui-dir/",c=a("head base"),f=null,e="",h;c.length?e=c.attr("href"):c=f=a("<base>",{href:b}).appendTo("head");h=a("<a href='testurl' />").prependTo(d)[0].href;c[0].href=e||location.pathname;f&&f.remove();return h.indexOf(b)===0}()});d.remove();h=function(){var a=window.navigator.userAgent;return a.indexOf("Nokia")>-1&&(a.indexOf("Symbian/3")>-1||a.indexOf("Series60/5")>-1)&&a.indexOf("AppleWebKit")>-1&&a.match(/(BrowserNG|NokiaBrowser)\/7\.[0-3]/)}(); -a.mobile.ajaxBlacklist=window.blackberry&&!window.WebKitPoint||g||h;h&&a(function(){a("head link[rel='stylesheet']").attr("rel","alternate stylesheet").attr("rel","stylesheet")});a.support.boxShadow||a("html").addClass("ui-mobile-nosupport-boxshadow")})(jQuery); -(function(a,e,b,d){function f(a){for(;a&&typeof a.originalEvent!=="undefined";)a=a.originalEvent;return a}function c(b){for(var c={},f,d;b;){f=a.data(b,n);for(d in f)if(f[d])c[d]=c.hasVirtualBinding=true;b=b.parentNode}return c}function h(){v&&(clearTimeout(v),v=0);v=setTimeout(function(){E=v=0;u.length=0;D=false;y=true},a.vmouse.resetTimerDuration)}function g(b,c,r){var e,h;if(!(h=r&&r[b])){if(r=!r)a:{for(r=c.target;r;){if((h=a.data(r,n))&&(!b||h[b]))break a;r=r.parentNode}r=null}h=r}if(h){e=c;var r= -e.type,j,g;e=a.Event(e);e.type=b;h=e.originalEvent;j=a.event.props;if(h)for(g=j.length;g;)b=j[--g],e[b]=h[b];if(r.search(/mouse(down|up)|click/)>-1&&!e.which)e.which=1;if(r.search(/^touch/)!==-1&&(b=f(h),r=b.touches,b=b.changedTouches,r=r&&r.length?r[0]:b&&b.length?b[0]:d))for(h=0,len=z.length;h<len;h++)b=z[h],e[b]=r[b];a(c.target).trigger(e)}return e}function i(b){var c=a.data(b.target,A);if(!D&&(!E||E!==c))if(c=g("v"+b.type,b))c.isDefaultPrevented()&&b.preventDefault(),c.isPropagationStopped()&& -b.stopPropagation(),c.isImmediatePropagationStopped()&&b.stopImmediatePropagation()}function k(b){var d=f(b).touches,e;if(d&&d.length===1&&(e=b.target,d=c(e),d.hasVirtualBinding))E=r++,a.data(e,A,E),v&&(clearTimeout(v),v=0),w=y=false,e=f(b).touches[0],x=e.pageX,t=e.pageY,g("vmouseover",b,d),g("vmousedown",b,d)}function l(a){y||(w||g("vmousecancel",a,c(a.target)),w=true,h())}function o(b){if(!y){var d=f(b).touches[0],r=w,e=a.vmouse.moveDistanceThreshold;w=w||Math.abs(d.pageX-x)>e||Math.abs(d.pageY- -t)>e;flags=c(b.target);w&&!r&&g("vmousecancel",b,flags);g("vmousemove",b,flags);h()}}function m(a){if(!y){y=true;var b=c(a.target),d;g("vmouseup",a,b);if(!w&&(d=g("vclick",a,b))&&d.isDefaultPrevented())d=f(a).changedTouches[0],u.push({touchID:E,x:d.clientX,y:d.clientY}),D=true;g("vmouseout",a,b);w=false;h()}}function p(b){var b=a.data(b,n),c;if(b)for(c in b)if(b[c])return true;return false}function j(){}function q(b){var c=b.substr(1);return{setup:function(){p(this)||a.data(this,n,{});a.data(this, -n)[b]=true;s[b]=(s[b]||0)+1;s[b]===1&&B.bind(c,i);a(this).bind(c,j);if(C)s.touchstart=(s.touchstart||0)+1,s.touchstart===1&&B.bind("touchstart",k).bind("touchend",m).bind("touchmove",o).bind("scroll",l)},teardown:function(){--s[b];s[b]||B.unbind(c,i);C&&(--s.touchstart,s.touchstart||B.unbind("touchstart",k).unbind("touchmove",o).unbind("touchend",m).unbind("scroll",l));var d=a(this),f=a.data(this,n);f&&(f[b]=false);d.unbind(c,j);p(this)||d.removeData(n)}}}var n="virtualMouseBindings",A="virtualTouchID", -e="vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),z="clientX clientY pageX pageY screenX screenY".split(" "),s={},v=0,x=0,t=0,w=false,u=[],D=false,y=false,C="addEventListener"in b,B=a(b),r=1,E=0;a.vmouse={moveDistanceThreshold:10,clickDistanceThreshold:10,resetTimerDuration:1500};for(var F=0;F<e.length;F++)a.event.special[e[F]]=q(e[F]);C&&b.addEventListener("click",function(b){var c=u.length,d=b.target,f,r,e,h,j;if(c){f=b.clientX;r=b.clientY;threshold=a.vmouse.clickDistanceThreshold; -for(e=d;e;){for(h=0;h<c;h++)if(j=u[h],e===d&&Math.abs(j.x-f)<threshold&&Math.abs(j.y-r)<threshold||a.data(e,A)===j.touchID){b.preventDefault();b.stopPropagation();return}e=e.parentNode}}},true)})(jQuery,window,document); -(function(a,e,b){function d(b,c,d){var f=d.type;d.type=c;a.event.handle.call(b,d);d.type=f}a.each("touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split(" "),function(b,c){a.fn[c]=function(a){return a?this.bind(c,a):this.trigger(c)};a.attrFn[c]=true});var f=a.support.touch,c=f?"touchstart":"mousedown",h=f?"touchend":"mouseup",g=f?"touchmove":"mousemove";a.event.special.scrollstart={enabled:true,setup:function(){function b(a, -e){f=e;d(c,f?"scrollstart":"scrollstop",a)}var c=this,f,e;a(c).bind("touchmove scroll",function(c){a.event.special.scrollstart.enabled&&(f||b(c,true),clearTimeout(e),e=setTimeout(function(){b(c,false)},50))})}};a.event.special.tap={setup:function(){var b=this,c=a(b);c.bind("vmousedown",function(f){function e(){clearTimeout(q)}function h(){e();c.unbind("vclick",g).unbind("vmouseup",e).unbind("vmousecancel",h)}function g(a){h();j==a.target&&d(b,"tap",a)}if(f.which&&f.which!==1)return false;var j=f.target, -q;c.bind("vmousecancel",h).bind("vmouseup",e).bind("vclick",g);q=setTimeout(function(){d(b,"taphold",a.Event("taphold"))},750)})}};a.event.special.swipe={scrollSupressionThreshold:10,durationThreshold:1E3,horizontalDistanceThreshold:30,verticalDistanceThreshold:75,setup:function(){var d=a(this);d.bind(c,function(c){function f(b){if(m){var c=b.originalEvent.touches?b.originalEvent.touches[0]:b;p={time:(new Date).getTime(),coords:[c.pageX,c.pageY]};Math.abs(m.coords[0]-p.coords[0])>a.event.special.swipe.scrollSupressionThreshold&& -b.preventDefault()}}var e=c.originalEvent.touches?c.originalEvent.touches[0]:c,m={time:(new Date).getTime(),coords:[e.pageX,e.pageY],origin:a(c.target)},p;d.bind(g,f).one(h,function(){d.unbind(g,f);m&&p&&p.time-m.time<a.event.special.swipe.durationThreshold&&Math.abs(m.coords[0]-p.coords[0])>a.event.special.swipe.horizontalDistanceThreshold&&Math.abs(m.coords[1]-p.coords[1])<a.event.special.swipe.verticalDistanceThreshold&&m.origin.trigger("swipe").trigger(m.coords[0]>p.coords[0]?"swipeleft":"swiperight"); -m=p=b})})}};(function(a,b){function c(){var a=f();a!==e&&(e=a,d.trigger("orientationchange"))}var d=a(b),f,e;a.event.special.orientationchange={setup:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;e=f();d.bind("throttledresize",c)},teardown:function(){if(a.support.orientation&&a.mobile.orientationChangeEnabled)return false;d.unbind("throttledresize",c)},add:function(a){var b=a.handler;a.handler=function(a){a.orientation=f();return b.apply(this,arguments)}}};a.event.special.orientationchange.orientation= -f=function(){var c=true,c=document.documentElement;return(c=a.support.orientation?b.orientation%180==0:c&&c.clientWidth/c.clientHeight<1.1)?"portrait":"landscape"}})(jQuery,e);(function(){a.event.special.throttledresize={setup:function(){a(this).bind("resize",b)},teardown:function(){a(this).unbind("resize",b)}};var b=function(){f=(new Date).getTime();e=f-c;e>=250?(c=f,a(this).trigger("throttledresize")):(d&&clearTimeout(d),d=setTimeout(b,250-e))},c=0,d,f,e})();a.each({scrollstop:"scrollstart",taphold:"tap", -swipeleft:"swipe",swiperight:"swipe"},function(b,c){a.event.special[b]={setup:function(){a(this).bind(c,a.noop)}}})})(jQuery,this); -(function(a,e,b){function d(a){a=a||location.href;return"#"+a.replace(/^[^#]*#?(.*)$/,"$1")}var f="hashchange",c=document,h,g=a.event.special,i=c.documentMode,k="on"+f in e&&(i===b||i>7);a.fn[f]=function(a){return a?this.bind(f,a):this.trigger(f)};a.fn[f].delay=50;g[f]=a.extend(g[f],{setup:function(){if(k)return false;a(h.start)},teardown:function(){if(k)return false;a(h.stop)}});h=function(){function h(){var b=d(),c=n(p);if(b!==p)q(p=b,c),a(e).trigger(f);else if(c!==p)location.href=location.href.replace(/#.*/, -"")+c;i=setTimeout(h,a.fn[f].delay)}var g={},i,p=d(),j=function(a){return a},q=j,n=j;g.start=function(){i||h()};g.stop=function(){i&&clearTimeout(i);i=b};a.browser.msie&&!k&&function(){var b,e;g.start=function(){if(!b)e=(e=a.fn[f].src)&&e+d(),b=a('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){e||q(d());h()}).attr("src",e||"javascript:0").insertAfter("body")[0].contentWindow,c.onpropertychange=function(){try{if(event.propertyName==="title")b.document.title=c.title}catch(a){}}}; -g.stop=j;n=function(){return d(b.location.href)};q=function(d,e){var h=b.document,g=a.fn[f].domain;if(d!==e)h.title=c.title,h.open(),g&&h.write('<script>document.domain="'+g+'"<\/script>'),h.close(),b.location.hash=d}}();return g}()})(jQuery,this); -(function(a){a.widget("mobile.page",a.mobile.widget,{options:{theme:"c",domCache:false,keepNativeDefault:":jqmData(role='none'), :jqmData(role='nojs')"},_create:function(){this._trigger("beforecreate");this.element.attr("tabindex","0").addClass("ui-page ui-body-"+this.options.theme)},keepNativeSelector:function(){var e=this.options;return e.keepNative&&a.trim(e.keepNative)&&e.keepNative!==e.keepNativeDefault?[e.keepNative,e.keepNativeDefault].join(", "):e.keepNativeDefault}})})(jQuery); -(function(a,e){var b={};a.extend(a.mobile,{ns:"",subPageUrlKey:"ui-page",activePageClass:"ui-page-active",activeBtnClass:"ui-btn-active",ajaxEnabled:true,hashListeningEnabled:true,linkBindingEnabled:true,defaultPageTransition:"slide",minScrollBack:250,defaultDialogTransition:"pop",loadingMessage:"loading",pageLoadErrorMessage:"Error Loading Page",autoInitializePage:true,pushStateEnabled:true,orientationChangeEnabled:true,gradeA:function(){return a.support.mediaquery||a.mobile.browser.ie&&a.mobile.browser.ie>= -7},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91},silentScroll:function(b){if(a.type(b)!=="number")b=a.mobile.defaultHomeScroll;a.event.special.scrollstart.enabled=false; -setTimeout(function(){e.scrollTo(0,b);a(document).trigger("silentscroll",{x:0,y:b})},20);setTimeout(function(){a.event.special.scrollstart.enabled=true},150)},nsNormalizeDict:b,nsNormalize:function(c){return!c?void 0:b[c]||(b[c]=a.camelCase(a.mobile.ns+c))},getInheritedTheme:function(a,b){for(var d=a[0],f="",e=/ui-(bar|body)-([a-z])\b/,l,o;d;){l=d.className||"";if((o=e.exec(l))&&(f=o[2]))break;d=d.parentNode}return f||b||"a"}});a.fn.jqmData=function(b,d){var f;typeof b!="undefined"&&(f=this.data(b? -a.mobile.nsNormalize(b):b,d));return f};a.jqmData=function(b,d,f){var e;typeof d!="undefined"&&(e=a.data(b,d?a.mobile.nsNormalize(d):d,f));return e};a.fn.jqmRemoveData=function(b){return this.removeData(a.mobile.nsNormalize(b))};a.jqmRemoveData=function(b,d){return a.removeData(b,a.mobile.nsNormalize(d))};a.fn.removeWithDependents=function(){a.removeWithDependents(this)};a.removeWithDependents=function(b){b=a(b);(b.jqmData("dependents")||a()).remove();b.remove()};a.fn.addDependents=function(b){a.addDependents(a(this), -b)};a.addDependents=function(b,d){var f=a(b).jqmData("dependents")||a();a(b).jqmData("dependents",a.merge(f,d))};a.fn.getEncodedText=function(){return a("<div/>").text(a(this).text()).html()};var d=a.find,f=/:jqmData\(([^)]*)\)/g;a.find=function(b,e,g,i){b=b.replace(f,"[data-"+(a.mobile.ns||"")+"$1]");return d.call(this,b,e,g,i)};a.extend(a.find,d);a.find.matches=function(b,d){return a.find(b,null,null,d)};a.find.matchesSelector=function(b,d){return a.find(d,null,null,[b]).length>0}})(jQuery,this); -(function(a,e){function b(a){var b=a.find(".ui-title:eq(0)");b.length?b.focus():a.focus()}function d(b){q&&(!q.closest(".ui-page-active").length||b)&&q.removeClass(a.mobile.activeBtnClass);q=null}function f(){z=false;A.length>0&&a.mobile.changePage.apply(null,A.pop())}function c(c,d,f,e){var g=a.mobile.urlHistory.getActive(),j=a.support.touchOverflow&&a.mobile.touchOverflowEnabled,i=g.lastScroll||(j?0:a.mobile.defaultHomeScroll),g=h();window.scrollTo(0,a.mobile.defaultHomeScroll);d&&d.data("page")._trigger("beforehide", -null,{nextPage:c});j||c.height(g+i);c.data("page")._trigger("beforeshow",null,{prevPage:d||a("")});a.mobile.hidePageLoadingMsg();j&&i&&(c.addClass("ui-mobile-pre-transition"),b(c),c.is(".ui-native-fixed")?c.find(".ui-content").scrollTop(i):c.scrollTop(i));f=(a.mobile.transitionHandlers[f||"none"]||a.mobile.defaultTransitionHandler)(f,e,c,d);f.done(function(){j||(c.height(""),b(c));j||a.mobile.silentScroll(i);d&&(j||d.height(""),d.data("page")._trigger("hide",null,{nextPage:c}));c.data("page")._trigger("show", -null,{prevPage:d||a("")})});return f}function h(){var b=a.event.special.orientationchange.orientation()==="portrait",c=b?screen.availHeight:screen.availWidth,b=Math.max(b?480:320,a(window).height());return Math.min(c,b)}function g(){(!a.support.touchOverflow||!a.mobile.touchOverflowEnabled)&&a("."+a.mobile.activePageClass).css("min-height",h())}function i(b,c){c&&b.attr("data-"+a.mobile.ns+"role",c);b.page()}function k(a){for(;a;){if(typeof a.nodeName==="string"&&a.nodeName.toLowerCase()=="a")break; -a=a.parentNode}return a}function l(b){var b=a(b).closest(".ui-page").jqmData("url"),c=t.hrefNoHash;if(!b||!j.isPath(b))b=c;return j.makeUrlAbsolute(b,c)}var o=a(window),m=a("html"),p=a("head"),j={urlParseRE:/^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,parseUrl:function(b){if(a.type(b)==="object")return b;b=j.urlParseRE.exec(b||"")||[];return{href:b[0]||"",hrefNoHash:b[1]|| -"",hrefNoSearch:b[2]||"",domain:b[3]||"",protocol:b[4]||"",doubleSlash:b[5]||"",authority:b[6]||"",username:b[8]||"",password:b[9]||"",host:b[10]||"",hostname:b[11]||"",port:b[12]||"",pathname:b[13]||"",directory:b[14]||"",filename:b[15]||"",search:b[16]||"",hash:b[17]||""}},makePathAbsolute:function(a,b){if(a&&a.charAt(0)==="/")return a;for(var a=a||"",c=(b=b?b.replace(/^\/|(\/[^\/]*|[^\/]+)$/g,""):"")?b.split("/"):[],d=a.split("/"),f=0;f<d.length;f++){var e=d[f];switch(e){case ".":break;case "..":c.length&& -c.pop();break;default:c.push(e)}}return"/"+c.join("/")},isSameDomain:function(a,b){return j.parseUrl(a).domain===j.parseUrl(b).domain},isRelativeUrl:function(a){return j.parseUrl(a).protocol===""},isAbsoluteUrl:function(a){return j.parseUrl(a).protocol!==""},makeUrlAbsolute:function(a,b){if(!j.isRelativeUrl(a))return a;var c=j.parseUrl(a),d=j.parseUrl(b),f=c.protocol||d.protocol,e=c.protocol?c.doubleSlash:c.doubleSlash||d.doubleSlash,h=c.authority||d.authority,g=c.pathname!=="",i=j.makePathAbsolute(c.pathname|| -d.filename,d.pathname);return f+e+h+i+(c.search||!g&&d.search||"")+c.hash},addSearchParams:function(b,c){var d=j.parseUrl(b),f=typeof c==="object"?a.param(c):c,e=d.search||"?";return d.hrefNoSearch+e+(e.charAt(e.length-1)!=="?"?"&":"")+f+(d.hash||"")},convertUrlToDataUrl:function(a){var b=j.parseUrl(a);if(j.isEmbeddedPage(b))return b.hash.split(s)[0].replace(/^#/,"");else if(j.isSameDomain(b,t))return b.hrefNoHash.replace(t.domain,"");return a},get:function(a){if(a===e)a=location.hash;return j.stripHash(a).replace(/[^\/]*\.[^\/*]+$/, -"")},getFilePath:function(b){var c="&"+a.mobile.subPageUrlKey;return b&&b.split(c)[0].split(s)[0]},set:function(a){location.hash=a},isPath:function(a){return/\//.test(a)},clean:function(a){return a.replace(t.domain,"")},stripHash:function(a){return a.replace(/^#/,"")},cleanHash:function(a){return j.stripHash(a.replace(/\?.*$/,"").replace(s,""))},isExternal:function(a){a=j.parseUrl(a);return a.protocol&&a.domain!==x.domain?true:false},hasProtocol:function(a){return/^(:?\w+:)/.test(a)},isFirstPageUrl:function(b){var b= -j.parseUrl(j.makeUrlAbsolute(b,t)),c=a.mobile.firstPage,c=c&&c[0]?c[0].id:e;return(b.hrefNoHash===x.hrefNoHash||w&&b.hrefNoHash===t.hrefNoHash)&&(!b.hash||b.hash==="#"||c&&b.hash.replace(/^#/,"")===c)},isEmbeddedPage:function(a){a=j.parseUrl(a);return a.protocol!==""?a.hash&&(a.hrefNoHash===x.hrefNoHash||w&&a.hrefNoHash===t.hrefNoHash):/^#/.test(a.href)}},q=null,n={stack:[],activeIndex:0,getActive:function(){return n.stack[n.activeIndex]},getPrev:function(){return n.stack[n.activeIndex-1]},getNext:function(){return n.stack[n.activeIndex+ -1]},addNew:function(a,b,c,d,f){n.getNext()&&n.clearForward();n.stack.push({url:a,transition:b,title:c,pageUrl:d,role:f});n.activeIndex=n.stack.length-1},clearForward:function(){n.stack=n.stack.slice(0,n.activeIndex+1)},directHashChange:function(b){var c,d,f;this.getActive();a.each(n.stack,function(a,e){b.currentUrl===e.url&&(c=a<n.activeIndex,d=!c,f=a)});this.activeIndex=f!==e?f:this.activeIndex;c?(b.either||b.isBack)(true):d&&(b.either||b.isForward)(false)},ignoreNextHashChange:false},A=[],z=false, -s="&ui-state=dialog",v=p.children("base"),x=j.parseUrl(location.href),t=v.length?j.parseUrl(j.makeUrlAbsolute(v.attr("href"),x.href)):x,w=x.hrefNoHash!==t.hrefNoHash,u=a.support.dynamicBaseTag?{element:v.length?v:a("<base>",{href:t.hrefNoHash}).prependTo(p),set:function(a){u.element.attr("href",j.makeUrlAbsolute(a,t))},reset:function(){u.element.attr("href",t.hrefNoHash)}}:e,D=true,y,C,B;y=function(){var b=o;a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&(b=a(".ui-page-active"),b=b.is(".ui-native-fixed")? -b.find(".ui-content"):b);return b};C=function(b){if(D){var c=a.mobile.urlHistory.getActive();if(c)b=b&&b.scrollTop(),c.lastScroll=b<a.mobile.minScrollBack?a.mobile.defaultHomeScroll:b}};B=function(){setTimeout(C,100,a(this))};o.bind(a.support.pushState?"popstate":"hashchange",function(){D=false});o.one(a.support.pushState?"popstate":"hashchange",function(){D=true});o.one("pagecontainercreate",function(){a.mobile.pageContainer.bind("pagechange",function(){var a=y();D=true;a.unbind("scrollstop",B); -a.bind("scrollstop",B)})});y().bind("scrollstop",B);a.mobile.getScreenHeight=h;a.fn.animationComplete=function(b){return a.support.cssTransitions?a(this).one("webkitAnimationEnd",b):(setTimeout(b,0),a(this))};a.mobile.path=j;a.mobile.base=u;a.mobile.urlHistory=n;a.mobile.dialogHashKey=s;a.mobile.noneTransitionHandler=function(b,c,d,f){f&&f.removeClass(a.mobile.activePageClass);d.addClass(a.mobile.activePageClass);return a.Deferred().resolve(b,c,d,f).promise()};a.mobile.defaultTransitionHandler=a.mobile.noneTransitionHandler; -a.mobile.transitionHandlers={none:a.mobile.defaultTransitionHandler};a.mobile.allowCrossDomainPages=false;a.mobile.getDocumentUrl=function(b){return b?a.extend({},x):x.href};a.mobile.getDocumentBase=function(b){return b?a.extend({},t):t.href};a.mobile._bindPageRemove=function(){var b=a(this);!b.data("page").options.domCache&&b.is(":jqmData(external-page='true')")&&b.bind("pagehide.remove",function(){var b=a(this),c=new a.Event("pageremove");b.trigger(c);c.isDefaultPrevented()||b.removeWithDependents()})}; -a.mobile.loadPage=function(b,c){var d=a.Deferred(),f=a.extend({},a.mobile.loadPage.defaults,c),h=null,g=null,m=j.makeUrlAbsolute(b,a.mobile.activePage&&l(a.mobile.activePage)||t.hrefNoHash);if(f.data&&f.type==="get")m=j.addSearchParams(m,f.data),f.data=e;if(f.data&&f.type==="post")f.reloadPage=true;var s=j.getFilePath(m),p=j.convertUrlToDataUrl(m);f.pageContainer=f.pageContainer||a.mobile.pageContainer;h=f.pageContainer.children(":jqmData(url='"+p+"')");h.length===0&&p&&!j.isPath(p)&&(h=f.pageContainer.children("#"+ -p).attr("data-"+a.mobile.ns+"url",p));if(h.length===0)if(a.mobile.firstPage&&j.isFirstPageUrl(s))a.mobile.firstPage.parent().length&&(h=a(a.mobile.firstPage));else if(j.isEmbeddedPage(s))return d.reject(m,c),d.promise();u&&u.reset();if(h.length){if(!f.reloadPage)return i(h,f.role),d.resolve(m,c,h),d.promise();g=h}var n=f.pageContainer,k=new a.Event("pagebeforeload"),q={url:b,absUrl:m,dataUrl:p,deferred:d,options:f};n.trigger(k,q);if(k.isDefaultPrevented())return d.promise();if(f.showLoadMsg)var v= -setTimeout(function(){a.mobile.showPageLoadingMsg()},f.loadMsgDelay);!a.mobile.allowCrossDomainPages&&!j.isSameDomain(x,m)?d.reject(m,c):a.ajax({url:s,type:f.type,data:f.data,dataType:"html",success:function(e,n,k){var o=a("<div></div>"),l=e.match(/<title[^>]*>([^<]*)/)&&RegExp.$1,t=RegExp("\\bdata-"+a.mobile.ns+"url=[\"']?([^\"'>]*)[\"']?");RegExp("(<[^>]+\\bdata-"+a.mobile.ns+"role=[\"']?page[\"']?[^>]*>)").test(e)&&RegExp.$1&&t.test(RegExp.$1)&&RegExp.$1&&(b=s=j.getFilePath(RegExp.$1));u&&u.set(s); -o.get(0).innerHTML=e;h=o.find(":jqmData(role='page'), :jqmData(role='dialog')").first();h.length||(h=a("<div data-"+a.mobile.ns+"role='page'>"+e.split(/<\/?body[^>]*>/gmi)[1]+"</div>"));l&&!h.jqmData("title")&&(~l.indexOf("&")&&(l=a("<div>"+l+"</div>").text()),h.jqmData("title",l));if(!a.support.dynamicBaseTag){var x=j.get(s);h.find("[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]").each(function(){var b=a(this).is("[href]")?"href":a(this).is("[src]")?"src":"action",c=a(this).attr(b), -c=c.replace(location.protocol+"//"+location.host+location.pathname,"");/^(\w+:|#|\/)/.test(c)||a(this).attr(b,x+c)})}h.attr("data-"+a.mobile.ns+"url",j.convertUrlToDataUrl(s)).attr("data-"+a.mobile.ns+"external-page",true).appendTo(f.pageContainer);h.one("pagecreate",a.mobile._bindPageRemove);i(h,f.role);m.indexOf("&"+a.mobile.subPageUrlKey)>-1&&(h=f.pageContainer.children(":jqmData(url='"+p+"')"));f.showLoadMsg&&(clearTimeout(v),a.mobile.hidePageLoadingMsg());q.xhr=k;q.textStatus=n;q.page=h;f.pageContainer.trigger("pageload", -q);d.resolve(m,c,h,g)},error:function(b,e,h){u&&u.set(j.get());q.xhr=b;q.textStatus=e;q.errorThrown=h;b=new a.Event("pageloadfailed");f.pageContainer.trigger(b,q);b.isDefaultPrevented()||(f.showLoadMsg&&(clearTimeout(v),a.mobile.hidePageLoadingMsg(),a("<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+a.mobile.pageLoadErrorMessage+"</h1></div>").css({display:"block",opacity:0.96,top:o.scrollTop()+100}).appendTo(f.pageContainer).delay(800).fadeOut(400,function(){a(this).remove()})), -d.reject(m,c))}});return d.promise()};a.mobile.loadPage.defaults={type:"get",data:e,reloadPage:false,role:e,showLoadMsg:false,pageContainer:e,loadMsgDelay:50};a.mobile.changePage=function(b,h){if(z)A.unshift(arguments);else{var g=a.extend({},a.mobile.changePage.defaults,h);g.pageContainer=g.pageContainer||a.mobile.pageContainer;g.fromPage=g.fromPage||a.mobile.activePage;var p=g.pageContainer,k=new a.Event("pagebeforechange"),q={toPage:b,options:g};p.trigger(k,q);if(!k.isDefaultPrevented())if(b=q.toPage, -z=true,typeof b=="string")a.mobile.loadPage(b,g).done(function(b,c,d,f){z=false;c.duplicateCachedPage=f;a.mobile.changePage(d,c)}).fail(function(){z=false;d(true);f();g.pageContainer.trigger("pagechangefailed",q)});else{if(b[0]===a.mobile.firstPage[0]&&!g.dataUrl)g.dataUrl=x.hrefNoHash;var k=g.fromPage,l=g.dataUrl&&j.convertUrlToDataUrl(g.dataUrl)||b.jqmData("url"),v=l;j.getFilePath(l);var o=n.getActive(),t=n.activeIndex===0,w=0,u=document.title,y=g.role==="dialog"||b.jqmData("role")==="dialog";if(k&& -k[0]===b[0]&&!g.allowSamePageTransition)z=false,p.trigger("pagechange",q);else{i(b,g.role);g.fromHashChange&&n.directHashChange({currentUrl:l,isBack:function(){w=-1},isForward:function(){w=1}});try{document.activeElement&&document.activeElement.nodeName.toLowerCase()!="body"?a(document.activeElement).blur():a("input:focus, textarea:focus, select:focus").blur()}catch(B){}y&&o&&(l=(o.url||"")+s);if(g.changeHash!==false&&l)n.ignoreNextHashChange=true,j.set(l);var C=!o?u:b.jqmData("title")||b.children(":jqmData(role='header')").find(".ui-title").getEncodedText(); -C&&u==document.title&&(u=C);b.jqmData("title")||b.jqmData("title",u);g.transition=g.transition||(w&&!t?o.transition:e)||(y?a.mobile.defaultDialogTransition:a.mobile.defaultPageTransition);w||n.addNew(l,g.transition,u,v,g.role);document.title=n.getActive().title;a.mobile.activePage=b;g.reverse=g.reverse||w<0;c(b,k,g.transition,g.reverse).done(function(){d();g.duplicateCachedPage&&g.duplicateCachedPage.remove();m.removeClass("ui-mobile-rendering");f();p.trigger("pagechange",q)})}}}};a.mobile.changePage.defaults= -{transition:e,reverse:false,changeHash:true,fromHashChange:false,role:e,duplicateCachedPage:e,pageContainer:e,showLoadMsg:true,dataUrl:e,fromPage:e,allowSamePageTransition:false};a.mobile._registerInternalEvents=function(){a("form").live("submit",function(b){var c=a(this);if(a.mobile.ajaxEnabled&&!c.is(":jqmData(ajax='false')")){var d=c.attr("method"),f=c.attr("target"),e=c.attr("action");if(!e&&(e=l(c),e===t.hrefNoHash))e=x.hrefNoSearch;e=j.makeUrlAbsolute(e,l(c));!j.isExternal(e)&&!f&&(a.mobile.changePage(e, -{type:d&&d.length&&d.toLowerCase()||"get",data:c.serialize(),transition:c.jqmData("transition"),direction:c.jqmData("direction"),reloadPage:true}),b.preventDefault())}});a(document).bind("vclick",function(b){if(!(b.which>1)&&a.mobile.linkBindingEnabled&&(b=k(b.target))&&j.parseUrl(b.getAttribute("href")||"#").hash!=="#")d(true),q=a(b).closest(".ui-btn").not(".ui-disabled"),q.addClass(a.mobile.activeBtnClass),a("."+a.mobile.activePageClass+" .ui-btn").not(b).blur()});a(document).bind("click",function(b){if(a.mobile.linkBindingEnabled){var c= -k(b.target);if(c&&!(b.which>1)){var f=a(c),h=function(){window.setTimeout(function(){d(true)},200)};if(f.is(":jqmData(rel='back')"))return window.history.back(),false;var g=l(f),c=j.makeUrlAbsolute(f.attr("href")||"#",g);if(!a.mobile.ajaxEnabled&&!j.isEmbeddedPage(c))h();else{if(c.search("#")!=-1)if(c=c.replace(/[^#]*#/,""))c=j.isPath(c)?j.makeUrlAbsolute(c,g):j.makeUrlAbsolute("#"+c,x.hrefNoHash);else{b.preventDefault();return}var g=f.is("[rel='external']")||f.is(":jqmData(ajax='false')")||f.is("[target]"), -i=a.mobile.allowCrossDomainPages&&x.protocol==="file:"&&c.search(/^https?:/)!=-1;g||j.isExternal(c)&&!i?h():(h=f.jqmData("transition"),g=(g=f.jqmData("direction"))&&g==="reverse"||f.jqmData("back"),f=f.attr("data-"+a.mobile.ns+"rel")||e,a.mobile.changePage(c,{transition:h,reverse:g,role:f}),b.preventDefault())}}}});a(".ui-page").live("pageshow.prefetch",function(){var b=[];a(this).find("a:jqmData(prefetch)").each(function(){var c=a(this),f=c.attr("href");f&&a.inArray(f,b)===-1&&(b.push(f),a.mobile.loadPage(f, -{role:c.attr("data-"+a.mobile.ns+"rel")}))})});a.mobile._handleHashChange=function(b){var c=j.stripHash(b),f={transition:a.mobile.urlHistory.stack.length===0?"none":e,changeHash:false,fromHashChange:true};if(!a.mobile.hashListeningEnabled||n.ignoreNextHashChange)n.ignoreNextHashChange=false;else{if(n.stack.length>1&&c.indexOf(s)>-1)if(a.mobile.activePage.is(".ui-dialog"))n.directHashChange({currentUrl:c,either:function(b){var d=a.mobile.urlHistory.getActive();c=d.pageUrl;a.extend(f,{role:d.role,transition:d.transition, -reverse:b})}});else{n.directHashChange({currentUrl:c,isBack:function(){window.history.back()},isForward:function(){window.history.forward()}});return}c?(c=typeof c==="string"&&!j.isPath(c)?j.makeUrlAbsolute("#"+c,t):c,a.mobile.changePage(c,f)):a.mobile.changePage(a.mobile.firstPage,f)}};o.bind("hashchange",function(){a.mobile._handleHashChange(location.hash)});a(document).bind("pageshow",g);a(window).bind("throttledresize",g)}})(jQuery); -(function(a,e){var b={},d=a(e),f=a.mobile.path.parseUrl(location.href);a.extend(b,{initialFilePath:f.pathname+f.search,initialHref:f.hrefNoHash,hashchangeFired:false,state:function(){return{hash:location.hash||"#"+b.initialFilePath,title:document.title,initialHref:b.initialHref}},resetUIKeys:function(b){var f="&"+a.mobile.subPageUrlKey,d=b.indexOf(a.mobile.dialogHashKey);d>-1?b=b.slice(0,d)+"#"+b.slice(d):b.indexOf(f)>-1&&(b=b.split(f).join("#"+f));return b},nextHashChangePrevented:function(c){a.mobile.urlHistory.ignoreNextHashChange= -c;b.onHashChangeDisabled=c},onHashChange:function(){if(!b.onHashChangeDisabled){var c,f;c=location.hash;var d=a.mobile.path.isPath(c),e=d?location.href:a.mobile.getDocumentUrl();c=d?c.replace("#",""):c;f=b.state();c=a.mobile.path.makeUrlAbsolute(c,e);d&&(c=b.resetUIKeys(c));history.replaceState(f,document.title,c)}},onPopState:function(c){var f=c.originalEvent.state;f&&(b.nextHashChangePrevented(true),setTimeout(function(){b.nextHashChangePrevented(false);a.mobile._handleHashChange(f.hash)},100))}, -init:function(){d.bind("hashchange",b.onHashChange);d.bind("popstate",b.onPopState);location.hash===""&&history.replaceState(b.state(),document.title,location.href)}});a(function(){a.mobile.pushStateEnabled&&a.support.pushState&&b.init()})})(jQuery,this); -(function(a){function e(b,d,f,c){var e=new a.Deferred,g=d?" reverse":"",i="ui-mobile-viewport-transitioning viewport-"+b;f.animationComplete(function(){f.add(c).removeClass("out in reverse "+b);c&&c[0]!==f[0]&&c.removeClass(a.mobile.activePageClass);f.parent().removeClass(i);e.resolve(b,d,f,c)});f.parent().addClass(i);c&&c.addClass(b+" out"+g);f.addClass(a.mobile.activePageClass+" "+b+" in"+g);return e.promise()}a.mobile.css3TransitionHandler=e;if(a.mobile.defaultTransitionHandler===a.mobile.noneTransitionHandler)a.mobile.defaultTransitionHandler= -e})(jQuery,this); -(function(a){a.mobile.page.prototype.options.degradeInputs={color:false,date:false,datetime:false,"datetime-local":false,email:false,month:false,number:false,range:"number",search:"text",tel:false,time:false,url:false,week:false};a(document).bind("pagecreate create",function(e){var b=a(e.target).closest(':jqmData(role="page")').data("page"),d;if(b)d=b.options,a(e.target).find("input").not(b.keepNativeSelector()).each(function(){var b=a(this),c=this.getAttribute("type"),e=d.degradeInputs[c]||"text"; -if(d.degradeInputs[c]){var g=a("<div>").html(b.clone()).html(),i=g.indexOf(" type=")>-1;b.replaceWith(g.replace(i?/\s+type=["']?\w+['"]?/:/\/?>/,' type="'+e+'" data-'+a.mobile.ns+'type="'+c+'"'+(i?"":">")))}})})})(jQuery); -(function(a,e){a.widget("mobile.dialog",a.mobile.widget,{options:{closeBtnText:"Close",overlayTheme:"a",initSelector:":jqmData(role='dialog')"},_create:function(){var b=this,d=this.element,f=a("<a href='#' data-"+a.mobile.ns+"icon='delete' data-"+a.mobile.ns+"iconpos='notext'>"+this.options.closeBtnText+"</a>");d.addClass("ui-overlay-"+this.options.overlayTheme);d.attr("role","dialog").addClass("ui-dialog").find(":jqmData(role='header')").addClass("ui-corner-top ui-overlay-shadow").prepend(f).end().find(":jqmData(role='content'),:jqmData(role='footer')").addClass("ui-overlay-shadow").last().addClass("ui-corner-bottom"); -f.bind("vclick",function(){b.close()});d.bind("vclick submit",function(b){var b=a(b.target).closest(b.type==="vclick"?"a":"form"),f;b.length&&!b.jqmData("transition")&&(f=a.mobile.urlHistory.getActive()||{},b.attr("data-"+a.mobile.ns+"transition",f.transition||a.mobile.defaultDialogTransition).attr("data-"+a.mobile.ns+"direction","reverse"))}).bind("pagehide",function(){a(this).find("."+a.mobile.activeBtnClass).removeClass(a.mobile.activeBtnClass)})},close:function(){e.history.back()}});a(a.mobile.dialog.prototype.options.initSelector).live("pagecreate", -function(){a(this).dialog()})})(jQuery,this); -(function(a){a.mobile.page.prototype.options.backBtnText="Back";a.mobile.page.prototype.options.addBackBtn=false;a.mobile.page.prototype.options.backBtnTheme=null;a.mobile.page.prototype.options.headerTheme="a";a.mobile.page.prototype.options.footerTheme="a";a.mobile.page.prototype.options.contentTheme=null;a(":jqmData(role='page'), :jqmData(role='dialog')").live("pagecreate",function(){var e=a(this),b=e.data("page").options,d=e.jqmData("role"),f=b.theme;a(":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", -this).each(function(){var c=a(this),e=c.jqmData("role"),g=c.jqmData("theme"),i=g||b.contentTheme||d==="dialog"&&f,k;c.addClass("ui-"+e);if(e==="header"||e==="footer"){var l=g||(e==="header"?b.headerTheme:b.footerTheme)||f;c.addClass("ui-bar-"+l).attr("role",e==="header"?"banner":"contentinfo");g=c.children("a");i=g.hasClass("ui-btn-left");k=g.hasClass("ui-btn-right");i=i||g.eq(0).not(".ui-btn-right").addClass("ui-btn-left").length;k||g.eq(1).addClass("ui-btn-right");b.addBackBtn&&e==="header"&&a(".ui-page").length> -1&&c.jqmData("url")!==a.mobile.path.stripHash(location.hash)&&!i&&a("<a href='#' class='ui-btn-left' data-"+a.mobile.ns+"rel='back' data-"+a.mobile.ns+"icon='arrow-l'>"+b.backBtnText+"</a>").attr("data-"+a.mobile.ns+"theme",b.backBtnTheme||l).prependTo(c);c.children("h1, h2, h3, h4, h5, h6").addClass("ui-title").attr({tabindex:"0",role:"heading","aria-level":"1"})}else e==="content"&&(i&&c.addClass("ui-body-"+i),c.attr("role","main"))})})})(jQuery); -(function(a){a.widget("mobile.collapsible",a.mobile.widget,{options:{expandCueText:" click to expand contents",collapseCueText:" click to collapse contents",collapsed:true,heading:"h1,h2,h3,h4,h5,h6,legend",theme:null,contentTheme:null,iconTheme:"d",initSelector:":jqmData(role='collapsible')"},_create:function(){var e=this.element,b=this.options,d=e.addClass("ui-collapsible"),f=e.children(b.heading).first(),c=d.wrapInner("<div class='ui-collapsible-content'></div>").find(".ui-collapsible-content"), -h=e.closest(":jqmData(role='collapsible-set')").addClass("ui-collapsible-set"),e=h.children(":jqmData(role='collapsible')");f.is("legend")&&(f=a("<div role='heading'>"+f.html()+"</div>").insertBefore(f),f.next().remove());if(h.length){if(!b.theme)b.theme=h.jqmData("theme");if(!b.contentTheme)b.contentTheme=h.jqmData("content-theme")}c.addClass(b.contentTheme?"ui-body-"+b.contentTheme:"");f.insertBefore(c).addClass("ui-collapsible-heading").append("<span class='ui-collapsible-heading-status'></span>").wrapInner("<a href='#' class='ui-collapsible-heading-toggle'></a>").find("a").first().buttonMarkup({shadow:false, -corners:false,iconPos:"left",icon:"plus",theme:b.theme});h.length?(h.jqmData("collapsiblebound")||h.jqmData("collapsiblebound",true).bind("expand",function(b){a(b.target).closest(".ui-collapsible").siblings(".ui-collapsible").trigger("collapse")}),e.first().find("a").first().addClass("ui-corner-top").find(".ui-btn-inner").addClass("ui-corner-top"),e.last().jqmData("collapsible-last",true).find("a").first().addClass("ui-corner-bottom").find(".ui-btn-inner").addClass("ui-corner-bottom"),d.jqmData("collapsible-last")&& -f.find("a").first().add(f.find(".ui-btn-inner")).addClass("ui-corner-bottom")):f.find("a").first().add(f.find(".ui-btn-inner")).addClass("ui-corner-top ui-corner-bottom");d.bind("expand collapse",function(e){if(!e.isDefaultPrevented()){e.preventDefault();var i=a(this),e=e.type==="collapse",k=b.contentTheme;f.toggleClass("ui-collapsible-heading-collapsed",e).find(".ui-collapsible-heading-status").text(e?b.expandCueText:b.collapseCueText).end().find(".ui-icon").toggleClass("ui-icon-minus",!e).toggleClass("ui-icon-plus", -e);i.toggleClass("ui-collapsible-collapsed",e);c.toggleClass("ui-collapsible-content-collapsed",e).attr("aria-hidden",e);if(k&&(!h.length||d.jqmData("collapsible-last")))f.find("a").first().add(f.find(".ui-btn-inner")).toggleClass("ui-corner-bottom",e),c.toggleClass("ui-corner-bottom",!e);c.trigger("updatelayout")}}).trigger(b.collapsed?"collapse":"expand");f.bind("click",function(a){var b=f.is(".ui-collapsible-heading-collapsed")?"expand":"collapse";d.trigger(b);a.preventDefault()})}});a(document).bind("pagecreate create", -function(e){a(a.mobile.collapsible.prototype.options.initSelector,e.target).collapsible()})})(jQuery);(function(a){a.fn.fieldcontain=function(){return this.addClass("ui-field-contain ui-body ui-br")};a(document).bind("pagecreate create",function(e){a(":jqmData(role='fieldcontain')",e.target).fieldcontain()})})(jQuery); -(function(a){a.fn.grid=function(e){return this.each(function(){var b=a(this),d=a.extend({grid:null},e),f=b.children(),c={solo:1,a:2,b:3,c:4,d:5},d=d.grid;if(!d)if(f.length<=5)for(var h in c)c[h]===f.length&&(d=h);else d="a";c=c[d];b.addClass("ui-grid-"+d);f.filter(":nth-child("+c+"n+1)").addClass("ui-block-a");c>1&&f.filter(":nth-child("+c+"n+2)").addClass("ui-block-b");c>2&&f.filter(":nth-child(3n+3)").addClass("ui-block-c");c>3&&f.filter(":nth-child(4n+4)").addClass("ui-block-d");c>4&&f.filter(":nth-child(5n+5)").addClass("ui-block-e")})}})(jQuery); -(function(a,e){a.widget("mobile.navbar",a.mobile.widget,{options:{iconpos:"top",grid:null,initSelector:":jqmData(role='navbar')"},_create:function(){var b=this.element,d=b.find("a"),f=d.filter(":jqmData(icon)").length?this.options.iconpos:e;b.addClass("ui-navbar").attr("role","navigation").find("ul").grid({grid:this.options.grid});f||b.addClass("ui-navbar-noicons");d.buttonMarkup({corners:false,shadow:false,iconpos:f});b.delegate("a","vclick",function(){d.not(".ui-state-persist").removeClass(a.mobile.activeBtnClass); -a(this).addClass(a.mobile.activeBtnClass)})}});a(document).bind("pagecreate create",function(b){a(a.mobile.navbar.prototype.options.initSelector,b.target).navbar()})})(jQuery); -(function(a){var e={};a.widget("mobile.listview",a.mobile.widget,{options:{theme:null,countTheme:"c",headerTheme:"b",dividerTheme:"b",splitIcon:"arrow-r",splitTheme:"b",inset:false,initSelector:":jqmData(role='listview')"},_create:function(){var a=this;a.element.addClass(function(d,f){return f+" ui-listview "+(a.options.inset?" ui-listview-inset ui-corner-all ui-shadow ":"")});a.refresh(true)},_removeCorners:function(a,d){a=a.add(a.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb"));d==="top"?a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl"): -d==="bottom"?a.removeClass("ui-corner-bottom ui-corner-br ui-corner-bl"):a.removeClass("ui-corner-top ui-corner-tr ui-corner-tl ui-corner-bottom ui-corner-br ui-corner-bl")},_refreshCorners:function(a){var d,f;this.options.inset&&(d=this.element.children("li"),f=a?d.not(".ui-screen-hidden"):d.filter(":visible"),this._removeCorners(d),d=f.first().addClass("ui-corner-top"),d.add(d.find(".ui-btn-inner").not(".ui-li-link-alt span:first-child")).addClass("ui-corner-top").end().find(".ui-li-link-alt, .ui-li-link-alt span:first-child").addClass("ui-corner-tr").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-tl"), -f=f.last().addClass("ui-corner-bottom"),f.add(f.find(".ui-btn-inner")).find(".ui-li-link-alt").addClass("ui-corner-br").end().find(".ui-li-thumb").not(".ui-li-icon").addClass("ui-corner-bl"));a||this.element.trigger("updatelayout")},_findFirstElementByTagName:function(a,d,f,c){var e={};for(e[f]=e[c]=true;a;){if(e[a.nodeName])return a;a=a[d]}return null},_getChildrenByTagName:function(b,d,f){var c=[],e={};e[d]=e[f]=true;for(b=b.firstChild;b;)e[b.nodeName]&&c.push(b),b=b.nextSibling;return a(c)},_addThumbClasses:function(b){var d, -f,c=b.length;for(d=0;d<c;d++)f=a(this._findFirstElementByTagName(b[d].firstChild,"nextSibling","img","IMG")),f.length&&(f.addClass("ui-li-thumb"),a(this._findFirstElementByTagName(f[0].parentNode,"parentNode","li","LI")).addClass(f.is(".ui-li-icon")?"ui-li-has-icon":"ui-li-has-thumb"))},refresh:function(b){this.parentPage=this.element.closest(".ui-page");this._createSubPages();var d=this.options,f=this.element,c=f.jqmData("dividertheme")||d.dividerTheme,e=f.jqmData("splittheme"),g=f.jqmData("spliticon"), -i=this._getChildrenByTagName(f[0],"li","LI"),k=a.support.cssPseudoElement||!a.nodeName(f[0],"ol")?0:1,l={},o,m,p,j,q;k&&f.find(".ui-li-dec").remove();if(!d.theme)d.theme=a.mobile.getInheritedTheme(this.element,"c");for(var n=0,A=i.length;n<A;n++){o=i.eq(n);m="ui-li";if(b||!o.hasClass("ui-li"))p=o.jqmData("theme")||d.theme,j=this._getChildrenByTagName(o[0],"a","A"),j.length?(q=o.jqmData("icon"),o.buttonMarkup({wrapperEls:"div",shadow:false,corners:false,iconpos:"right",icon:j.length>1||q===false?false: -q||"arrow-r",theme:p}),q!=false&&j.length==1&&o.addClass("ui-li-has-arrow"),j.first().addClass("ui-link-inherit"),j.length>1&&(m+=" ui-li-has-alt",j=j.last(),q=e||j.jqmData("theme")||d.splitTheme,j.appendTo(o).attr("title",j.getEncodedText()).addClass("ui-li-link-alt").empty().buttonMarkup({shadow:false,corners:false,theme:p,icon:false,iconpos:false}).find(".ui-btn-inner").append(a(document.createElement("span")).buttonMarkup({shadow:true,corners:true,theme:q,iconpos:"notext",icon:g||j.jqmData("icon")|| -d.splitIcon})))):o.jqmData("role")==="list-divider"?(m+=" ui-li-divider ui-btn ui-bar-"+c,o.attr("role","heading"),k&&(k=1)):m+=" ui-li-static ui-body-"+p;k&&m.indexOf("ui-li-divider")<0&&(p=o.is(".ui-li-static:first")?o:o.find(".ui-link-inherit"),p.addClass("ui-li-jsnumbering").prepend("<span class='ui-li-dec'>"+k++ +". </span>"));l[m]||(l[m]=[]);l[m].push(o[0])}for(m in l)a(l[m]).addClass(m).children(".ui-btn-inner").addClass(m);f.find("h1, h2, h3, h4, h5, h6").addClass("ui-li-heading").end().find("p, dl").addClass("ui-li-desc").end().find(".ui-li-aside").each(function(){var b= -a(this);b.prependTo(b.parent())}).end().find(".ui-li-count").each(function(){a(this).closest("li").addClass("ui-li-has-count")}).addClass("ui-btn-up-"+(f.jqmData("counttheme")||this.options.countTheme)+" ui-btn-corner-all");this._addThumbClasses(i);this._addThumbClasses(f.find(".ui-link-inherit"));this._refreshCorners(b)},_idStringEscape:function(a){return a.replace(/[^a-zA-Z0-9]/g,"-")},_createSubPages:function(){var b=this.element,d=b.closest(".ui-page"),f=d.jqmData("url"),c=f||d[0][a.expando], -h=b.attr("id"),g=this.options,i="data-"+a.mobile.ns,k=this,l=d.find(":jqmData(role='footer')").jqmData("id"),o;typeof e[c]==="undefined"&&(e[c]=-1);h=h||++e[c];a(b.find("li>ul, li>ol").toArray().reverse()).each(function(c){var d=a(this),e=d.attr("id")||h+"-"+c,c=d.parent(),k=a(d.prevAll().toArray().reverse()),k=k.length?k:a("<span>"+a.trim(c.contents()[0].nodeValue)+"</span>"),n=k.first().getEncodedText(),e=(f||"")+"&"+a.mobile.subPageUrlKey+"="+e,A=d.jqmData("theme")||g.theme,z=d.jqmData("counttheme")|| -b.jqmData("counttheme")||g.countTheme;o=true;d.detach().wrap("<div "+i+"role='page' "+i+"url='"+e+"' "+i+"theme='"+A+"' "+i+"count-theme='"+z+"'><div "+i+"role='content'></div></div>").parent().before("<div "+i+"role='header' "+i+"theme='"+g.headerTheme+"'><div class='ui-title'>"+n+"</div></div>").after(l?a("<div "+i+"role='footer' "+i+"id='"+l+"'>"):"").parent().appendTo(a.mobile.pageContainer).page();d=c.find("a:first");d.length||(d=a("<a/>").html(k||n).prependTo(c.empty()));d.attr("href","#"+e)}).listview(); -o&&d.is(":jqmData(external-page='true')")&&d.data("page").options.domCache===false&&d.unbind("pagehide.remove").bind("pagehide.remove",function(b,c){var e=c.nextPage;c.nextPage&&(e=e.jqmData("url"),e.indexOf(f+"&"+a.mobile.subPageUrlKey)!==0&&(k.childPages().remove(),d.remove()))})},childPages:function(){var b=this.parentPage.jqmData("url");return a(":jqmData(url^='"+b+"&"+a.mobile.subPageUrlKey+"')")}});a(document).bind("pagecreate create",function(b){a(a.mobile.listview.prototype.options.initSelector, -b.target).listview()})})(jQuery); -(function(a){a.mobile.listview.prototype.options.filter=false;a.mobile.listview.prototype.options.filterPlaceholder="Filter items...";a.mobile.listview.prototype.options.filterTheme="c";a.mobile.listview.prototype.options.filterCallback=function(a,b){return a.toLowerCase().indexOf(b)===-1};a(":jqmData(role='listview')").live("listviewcreate",function(){var e=a(this),b=e.data("listview");if(b.options.filter){var d=a("<form>",{"class":"ui-listview-filter ui-bar-"+b.options.filterTheme,role:"search"}); -a("<input>",{placeholder:b.options.filterPlaceholder}).attr("data-"+a.mobile.ns+"type","search").jqmData("lastval","").bind("keyup change",function(){var d=a(this),c=this.value.toLowerCase(),h=null,h=d.jqmData("lastval")+"",g=false,i="";d.jqmData("lastval",c);i=c.substr(0,h.length-1).replace(h,"");h=c.length<h.length||i.length!=c.length-h.length?e.children():e.children(":not(.ui-screen-hidden)");if(c){for(var k=h.length-1;k>=0;k--)d=a(h[k]),i=d.jqmData("filtertext")||d.text(),d.is("li:jqmData(role=list-divider)")? -(d.toggleClass("ui-filter-hidequeue",!g),g=false):b.options.filterCallback(i,c)?d.toggleClass("ui-filter-hidequeue",true):g=true;h.filter(":not(.ui-filter-hidequeue)").toggleClass("ui-screen-hidden",false);h.filter(".ui-filter-hidequeue").toggleClass("ui-screen-hidden",true).toggleClass("ui-filter-hidequeue",false)}else h.toggleClass("ui-screen-hidden",false);b._refreshCorners()}).appendTo(d).textinput();a(this).jqmData("inset")&&d.addClass("ui-listview-filter-inset");d.bind("submit",function(){return false}).insertBefore(e)}})})(jQuery); -(function(a){a(document).bind("pagecreate create",function(e){a(":jqmData(role='nojs')",e.target).addClass("ui-nojs")})})(jQuery); -(function(a,e){a.widget("mobile.checkboxradio",a.mobile.widget,{options:{theme:null,initSelector:"input[type='checkbox'],input[type='radio']"},_create:function(){var b=this,d=this.element,f=d.closest("form,fieldset,:jqmData(role='page')").find("label[for='"+d[0].id+"']"),c=d.attr("type"),h=c+"-on",g=c+"-off",i=d.parents(":jqmData(type='horizontal')").length?e:g;if(!(c!=="checkbox"&&c!=="radio")){a.extend(this,{label:f,inputtype:c,checkedClass:"ui-"+h+(i?"":" "+a.mobile.activeBtnClass),uncheckedClass:"ui-"+ -g,checkedicon:"ui-icon-"+h,uncheckedicon:"ui-icon-"+g});if(!this.options.theme)this.options.theme=this.element.jqmData("theme");f.buttonMarkup({theme:this.options.theme,icon:i,shadow:false});d.add(f).wrapAll("<div class='ui-"+c+"'></div>");f.bind({vmouseover:function(b){a(this).parent().is(".ui-disabled")&&b.stopPropagation()},vclick:function(a){if(d.is(":disabled"))a.preventDefault();else return b._cacheVals(),d.prop("checked",c==="radio"&&true||!d.prop("checked")),d.triggerHandler("click"),b._getInputSet().not(d).prop("checked", -false),b._updateAll(),false}});d.bind({vmousedown:function(){b._cacheVals()},vclick:function(){var c=a(this);c.is(":checked")?(c.prop("checked",true),b._getInputSet().not(c).prop("checked",false)):c.prop("checked",false);b._updateAll()},focus:function(){f.addClass("ui-focus")},blur:function(){f.removeClass("ui-focus")}});this.refresh()}},_cacheVals:function(){this._getInputSet().each(function(){var b=a(this);b.jqmData("cacheVal",b.is(":checked"))})},_getInputSet:function(){return this.inputtype== -"checkbox"?this.element:this.element.closest("form,fieldset,:jqmData(role='page')").find("input[name='"+this.element.attr("name")+"'][type='"+this.inputtype+"']")},_updateAll:function(){var b=this;this._getInputSet().each(function(){var d=a(this);(d.is(":checked")||b.inputtype==="checkbox")&&d.trigger("change")}).checkboxradio("refresh")},refresh:function(){var b=this.element,d=this.label,f=d.find(".ui-icon");a(b[0]).prop("checked")?(d.addClass(this.checkedClass).removeClass(this.uncheckedClass), -f.addClass(this.checkedicon).removeClass(this.uncheckedicon)):(d.removeClass(this.checkedClass).addClass(this.uncheckedClass),f.removeClass(this.checkedicon).addClass(this.uncheckedicon));b.is(":disabled")?this.disable():this.enable()},disable:function(){this.element.prop("disabled",true).parent().addClass("ui-disabled")},enable:function(){this.element.prop("disabled",false).parent().removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(b){a.mobile.checkboxradio.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a,e){a.widget("mobile.button",a.mobile.widget,{options:{theme:null,icon:null,iconpos:null,inline:null,corners:true,shadow:true,iconshadow:true,initSelector:"button, [type='button'], [type='submit'], [type='reset'], [type='image']"},_create:function(){var b=this.element,d=this.options,f,c;this.button=a("<div></div>").text(b.text()||b.val()).insertBefore(b).buttonMarkup({theme:d.theme,icon:d.icon,iconpos:d.iconpos,inline:d.inline,corners:d.corners,shadow:d.shadow,iconshadow:d.iconshadow}).append(b.addClass("ui-btn-hidden")); -d=b.attr("type");f=b.attr("name");d!=="button"&&d!=="reset"&&f&&b.bind("vclick",function(){c===e&&(c=a("<input>",{type:"hidden",name:b.attr("name"),value:b.attr("value")}).insertBefore(b),a(document).one("submit",function(){c.remove();c=e}))});this.refresh()},enable:function(){this.element.attr("disabled",false);this.button.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.button.addClass("ui-disabled").attr("aria-disabled", -true);return this._setOption("disabled",true)},refresh:function(){var a=this.element;a.prop("disabled")?this.disable():this.enable();this.button.data("textWrapper").text(a.text()||a.val())}});a(document).bind("pagecreate create",function(b){a.mobile.button.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a,e){a.widget("mobile.slider",a.mobile.widget,{options:{theme:null,trackTheme:null,disabled:false,initSelector:"input[type='range'], :jqmData(type='range'), :jqmData(role='slider')"},_create:function(){var b=this,d=this.element,f=a.mobile.getInheritedTheme(d,"c"),c=this.options.theme||f,h=this.options.trackTheme||f,g=d[0].nodeName.toLowerCase(),f=g=="select"?"ui-slider-switch":"",i=d.attr("id"),k=i+"-label",i=a("[for='"+i+"']").attr("id",k),l=function(){return g=="input"?parseFloat(d.val()): -d[0].selectedIndex},o=g=="input"?parseFloat(d.attr("min")):0,m=g=="input"?parseFloat(d.attr("max")):d.find("option").length-1,p=window.parseFloat(d.attr("step")||1),j=a("<div class='ui-slider "+f+" ui-btn-down-"+h+" ui-btn-corner-all' role='application'></div>"),q=a("<a href='#' class='ui-slider-handle'></a>").appendTo(j).buttonMarkup({corners:true,theme:c,shadow:true}).attr({role:"slider","aria-valuemin":o,"aria-valuemax":m,"aria-valuenow":l(),"aria-valuetext":l(),title:l(),"aria-labelledby":k}); -a.extend(this,{slider:j,handle:q,dragging:false,beforeStart:null,userModified:false,mouseMoved:false});g=="select"&&(j.wrapInner("<div class='ui-slider-inneroffset'></div>"),q.addClass("ui-slider-handle-snapping"),d.find("option"),d.find("option").each(function(b){var c=!b?"b":"a",d=!b?"right":"left",b=!b?" ui-btn-down-"+h:" "+a.mobile.activeBtnClass;a("<div class='ui-slider-labelbg ui-slider-labelbg-"+c+b+" ui-btn-corner-"+d+"'></div>").prependTo(j);a("<span class='ui-slider-label ui-slider-label-"+ -c+b+" ui-btn-corner-"+d+"' role='img'>"+a(this).getEncodedText()+"</span>").prependTo(q)}));i.addClass("ui-slider");d.addClass(g==="input"?"ui-slider-input":"ui-slider-switch").change(function(){b.mouseMoved||b.refresh(l(),true)}).keyup(function(){b.refresh(l(),true,true)}).blur(function(){b.refresh(l(),true)});a(document).bind("vmousemove",function(a){if(b.dragging)return b.mouseMoved=true,g==="select"&&q.removeClass("ui-slider-handle-snapping"),b.refresh(a),b.userModified=b.beforeStart!==d[0].selectedIndex, -false});j.bind("vmousedown",function(a){b.dragging=true;b.userModified=false;b.mouseMoved=false;if(g==="select")b.beforeStart=d[0].selectedIndex;b.refresh(a);return false});j.add(document).bind("vmouseup",function(){if(b.dragging)return b.dragging=false,g==="select"&&(q.addClass("ui-slider-handle-snapping"),b.mouseMoved?b.userModified?b.refresh(b.beforeStart==0?1:0):b.refresh(b.beforeStart):b.refresh(b.beforeStart==0?1:0)),b.mouseMoved=false});j.insertAfter(d);this.handle.bind("vmousedown",function(){a(this).focus()}).bind("vclick", -false);this.handle.bind("keydown",function(c){var d=l();if(!b.options.disabled){switch(c.keyCode){case a.mobile.keyCode.HOME:case a.mobile.keyCode.END:case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:if(c.preventDefault(),!b._keySliding)b._keySliding=true,a(this).addClass("ui-state-active")}switch(c.keyCode){case a.mobile.keyCode.HOME:b.refresh(o);break;case a.mobile.keyCode.END:b.refresh(m); -break;case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:b.refresh(d+p);break;case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:b.refresh(d-p)}}}).keyup(function(){if(b._keySliding)b._keySliding=false,a(this).removeClass("ui-state-active")});this.refresh(e,e,true)},refresh:function(a,d,f){(this.options.disabled||this.element.attr("disabled"))&&this.disable();var c=this.element,e,g=c[0].nodeName.toLowerCase(),i=g==="input"?parseFloat(c.attr("min")): -0,k=g==="input"?parseFloat(c.attr("max")):c.find("option").length-1;if(typeof a==="object"){if(!this.dragging||a.pageX<this.slider.offset().left-8||a.pageX>this.slider.offset().left+this.slider.width()+8)return;e=Math.round((a.pageX-this.slider.offset().left)/this.slider.width()*100)}else a==null&&(a=g==="input"?parseFloat(c.val()):c[0].selectedIndex),e=(parseFloat(a)-i)/(k-i)*100;if(!isNaN(e)&&(e<0&&(e=0),e>100&&(e=100),a=Math.round(e/100*(k-i))+i,a<i&&(a=i),a>k&&(a=k),this.handle.css("left",e+"%"), -this.handle.attr({"aria-valuenow":g==="input"?a:c.find("option").eq(a).attr("value"),"aria-valuetext":g==="input"?a:c.find("option").eq(a).getEncodedText(),title:a}),g==="select"&&(a===0?this.slider.addClass("ui-slider-switch-a").removeClass("ui-slider-switch-b"):this.slider.addClass("ui-slider-switch-b").removeClass("ui-slider-switch-a")),!f))f=false,g==="input"?(f=c.val()!==a,c.val(a)):(f=c[0].selectedIndex!==a,c[0].selectedIndex=a),!d&&f&&c.trigger("change")},enable:function(){this.element.attr("disabled", -false);this.slider.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.slider.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)}});a(document).bind("pagecreate create",function(b){a.mobile.slider.prototype.enhanceWithin(b.target)})})(jQuery); -(function(a){a.widget("mobile.textinput",a.mobile.widget,{options:{theme:null,initSelector:"input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])"},_create:function(){var e=this.element, -b=this.options.theme||a.mobile.getInheritedTheme(this.element,"c"),d=" ui-body-"+b,f,c;a("label[for='"+e.attr("id")+"']").addClass("ui-input-text");f=e.addClass("ui-input-text ui-body-"+b);typeof e[0].autocorrect!=="undefined"&&!a.support.touchOverflow&&(e[0].setAttribute("autocorrect","off"),e[0].setAttribute("autocomplete","off"));e.is("[type='search'],:jqmData(type='search')")?(f=e.wrap("<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield"+d+"'></div>").parent(), -c=a("<a href='#' class='ui-input-clear' title='clear text'>clear text</a>").tap(function(a){e.val("").focus();e.trigger("change");c.addClass("ui-input-clear-hidden");a.preventDefault()}).appendTo(f).buttonMarkup({icon:"delete",iconpos:"notext",corners:true,shadow:true}),b=function(){setTimeout(function(){c.toggleClass("ui-input-clear-hidden",!e.val())},0)},b(),e.bind("paste cut keyup focus change blur",b)):e.addClass("ui-corner-all ui-shadow-inset"+d);e.focus(function(){f.addClass("ui-focus")}).blur(function(){f.removeClass("ui-focus")}); -if(e.is("textarea")){var h=function(){var a=e[0].scrollHeight;e[0].clientHeight<a&&e.height(a+15)},g;e.keyup(function(){clearTimeout(g);g=setTimeout(h,100)});a.trim(e.val())&&(a(window).load(h),a(document).one("pagechange",h))}},disable:function(){(this.element.attr("disabled",true).is("[type='search'],:jqmData(type='search')")?this.element.parent():this.element).addClass("ui-disabled")},enable:function(){(this.element.attr("disabled",false).is("[type='search'],:jqmData(type='search')")?this.element.parent(): -this.element).removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(e){a.mobile.textinput.prototype.enhanceWithin(e.target)})})(jQuery); -(function(a){var e=function(b){var d=b.selectID,f=b.label,c=b.select.closest(".ui-page"),e=a("<div>",{"class":"ui-selectmenu-screen ui-screen-hidden"}).appendTo(c),g=b._selectOptions(),i=b.isMultiple=b.select[0].multiple,k=d+"-button",l=d+"-menu",o=a("<div data-"+a.mobile.ns+"role='dialog' data-"+a.mobile.ns+"theme='"+b.options.theme+"' data-"+a.mobile.ns+"overlay-theme='"+b.options.overlayTheme+"'><div data-"+a.mobile.ns+"role='header'><div class='ui-title'>"+f.getEncodedText()+"</div></div><div data-"+ -a.mobile.ns+"role='content'></div></div>").appendTo(a.mobile.pageContainer).page(),m=a("<div>",{"class":"ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-"+b.options.overlayTheme+" "+a.mobile.defaultDialogTransition}).insertAfter(e),p=a("<ul>",{"class":"ui-selectmenu-list",id:l,role:"listbox","aria-labelledby":k}).attr("data-"+a.mobile.ns+"theme",b.options.theme).appendTo(m),j=a("<div>",{"class":"ui-header ui-bar-"+b.options.theme}).prependTo(m),q=a("<h1>",{"class":"ui-title"}).appendTo(j), -n=a("<a>",{text:b.options.closeText,href:"#","class":"ui-btn-left"}).attr("data-"+a.mobile.ns+"iconpos","notext").attr("data-"+a.mobile.ns+"icon","delete").appendTo(j).buttonMarkup(),A=o.find(".ui-content"),z=o.find(".ui-header a");a.extend(b,{select:b.select,selectID:d,buttonId:k,menuId:l,thisPage:c,menuPage:o,label:f,screen:e,selectOptions:g,isMultiple:i,theme:b.options.theme,listbox:m,list:p,header:j,headerTitle:q,headerClose:n,menuPageContent:A,menuPageClose:z,placeholder:"",build:function(){var b= -this;b.refresh();b.select.attr("tabindex","-1").focus(function(){a(this).blur();b.button.focus()});b.button.bind("vclick keydown",function(c){if(c.type=="vclick"||c.keyCode&&(c.keyCode===a.mobile.keyCode.ENTER||c.keyCode===a.mobile.keyCode.SPACE))b.open(),c.preventDefault()});b.list.attr("role","listbox").delegate(".ui-li>a","focusin",function(){a(this).attr("tabindex","0")}).delegate(".ui-li>a","focusout",function(){a(this).attr("tabindex","-1")}).delegate("li:not(.ui-disabled, .ui-li-divider)", -"click",function(c){var d=b.select[0].selectedIndex,f=b.list.find("li:not(.ui-li-divider)").index(this),e=b._selectOptions().eq(f)[0];e.selected=b.isMultiple?!e.selected:true;b.isMultiple&&a(this).find(".ui-icon").toggleClass("ui-icon-checkbox-on",e.selected).toggleClass("ui-icon-checkbox-off",!e.selected);(b.isMultiple||d!==f)&&b.select.trigger("change");b.isMultiple||b.close();c.preventDefault()}).keydown(function(b){var c=a(b.target),d=c.closest("li");switch(b.keyCode){case 38:return b=d.prev(), -b.length&&(c.blur().attr("tabindex","-1"),b.find("a").first().focus()),false;case 40:return b=d.next(),b.length&&(c.blur().attr("tabindex","-1"),b.find("a").first().focus()),false;case 13:case 32:return c.trigger("click"),false}});b.menuPage.bind("pagehide",function(){b.list.appendTo(b.listbox);b._focusButton();a.mobile._bindPageRemove.call(b.thisPage)});b.screen.bind("vclick",function(){b.close()});b.headerClose.click(function(){if(b.menuType=="overlay")return b.close(),false});b.thisPage.addDependents(this.menuPage)}, -_isRebuildRequired:function(){var a=this.list.find("li");return this._selectOptions().text()!==a.text()},refresh:function(b){var c=this;this._selectOptions();this.selected();var d=this.selectedIndices();(b||this._isRebuildRequired())&&c._buildList();c.setButtonText();c.setButtonCount();c.list.find("li:not(.ui-li-divider)").removeClass(a.mobile.activeBtnClass).attr("aria-selected",false).each(function(b){a.inArray(b,d)>-1&&(b=a(this),b.attr("aria-selected",true),c.isMultiple?b.find(".ui-icon").removeClass("ui-icon-checkbox-off").addClass("ui-icon-checkbox-on"): -b.addClass(a.mobile.activeBtnClass))})},close:function(){if(!this.options.disabled&&this.isOpen)this.menuType=="page"?window.history.back():(this.screen.addClass("ui-screen-hidden"),this.listbox.addClass("ui-selectmenu-hidden").removeAttr("style").removeClass("in"),this.list.appendTo(this.listbox),this._focusButton()),this.isOpen=false},open:function(){if(!this.options.disabled){var b=this,c=b.list.parent().outerHeight(),d=b.list.parent().outerWidth(),f=a(".ui-page-active"),e=a.support.touchOverflow&& -a.mobile.touchOverflowEnabled,f=f.is(".ui-native-fixed")?f.find(".ui-content"):f;scrollTop=e?f.scrollTop():a(window).scrollTop();btnOffset=b.button.offset().top;screenHeight=window.innerHeight;screenWidth=window.innerWidth;b.button.addClass(a.mobile.activeBtnClass);setTimeout(function(){b.button.removeClass(a.mobile.activeBtnClass)},300);if(c>screenHeight-80||!a.support.scrollTop){b.thisPage.unbind("pagehide.remove");if(scrollTop==0&&btnOffset>screenHeight)b.thisPage.one("pagehide",function(){a(this).jqmData("lastScroll", -btnOffset)});b.menuPage.one("pageshow",function(){a(window).one("silentscroll",function(){b.list.find(a.mobile.activeBtnClass).focus()});b.isOpen=true});b.menuType="page";b.menuPageContent.append(b.list);b.menuPage.find("div .ui-title").text(b.label.text());a.mobile.changePage(b.menuPage,{transition:a.mobile.defaultDialogTransition})}else{b.menuType="overlay";b.screen.height(a(document).height()).removeClass("ui-screen-hidden");var f=btnOffset-scrollTop,h=scrollTop+screenHeight-btnOffset,g=c/2,e= -parseFloat(b.list.parent().css("max-width")),c=f>c/2&&h>c/2?btnOffset+b.button.outerHeight()/2-g:f>h?scrollTop+screenHeight-c-30:scrollTop+30;d<e?e=(screenWidth-d)/2:(e=b.button.offset().left+b.button.outerWidth()/2-d/2,e<30?e=30:e+d>screenWidth&&(e=screenWidth-d-30));b.listbox.append(b.list).removeClass("ui-selectmenu-hidden").css({top:c,left:e}).addClass("in");b.list.find(a.mobile.activeBtnClass).focus();b.isOpen=true}}},_buildList:function(){var b=this,c=this.options,d=this.placeholder,f=[],e= -[],h=b.isMultiple?"checkbox-off":"false";b.list.empty().filter(".ui-listview").listview("destroy");b.select.find("option").each(function(g){var j=a(this),i=j.parent(),m=j.getEncodedText(),p="<a href='#'>"+m+"</a>",k=[],n=[];i.is("optgroup")&&(i=i.attr("label"),a.inArray(i,f)===-1&&(e.push("<li data-"+a.mobile.ns+"role='list-divider'>"+i+"</li>"),f.push(i)));if(!this.getAttribute("value")||m.length==0||j.jqmData("placeholder"))c.hidePlaceholderMenuItems&&k.push("ui-selectmenu-placeholder"),d=b.placeholder= -m;this.disabled&&(k.push("ui-disabled"),n.push("aria-disabled='true'"));e.push("<li data-"+a.mobile.ns+"option-index='"+g+"' data-"+a.mobile.ns+"icon='"+h+"' class='"+k.join(" ")+"' "+n.join(" ")+">"+p+"</li>")});b.list.html(e.join(" "));b.list.find("li").attr({role:"option",tabindex:"-1"}).first().attr("tabindex","0");this.isMultiple||this.headerClose.hide();!this.isMultiple&&!d.length?this.header.hide():this.headerTitle.text(this.placeholder);b.list.listview()},_button:function(){return a("<a>", -{href:"#",role:"button",id:this.buttonId,"aria-haspopup":"true","aria-owns":this.menuId})}})};a("select").live("selectmenubeforecreate",function(){var b=a(this).data("selectmenu");b.options.nativeMenu||e(b)})})(jQuery); -(function(a){a.widget("mobile.selectmenu",a.mobile.widget,{options:{theme:null,disabled:false,icon:"arrow-d",iconpos:"right",inline:null,corners:true,shadow:true,iconshadow:true,menuPageTheme:"b",overlayTheme:"a",hidePlaceholderMenuItems:true,closeText:"Close",nativeMenu:true,initSelector:"select:not(:jqmData(role='slider'))"},_button:function(){return a("<div/>")},_setDisabled:function(a){this.element.attr("disabled",a);this.button.attr("aria-disabled",a);return this._setOption("disabled",a)},_focusButton:function(){var a= -this;setTimeout(function(){a.button.focus()},40)},_selectOptions:function(){return this.select.find("option")},_preExtension:function(){this.select=this.element.wrap("<div class='ui-select'>");this.selectID=this.select.attr("id");this.label=a("label[for='"+this.selectID+"']").addClass("ui-select");this.isMultiple=this.select[0].multiple;if(!this.options.theme)this.options.theme=a.mobile.getInheritedTheme(this.select,"c")},_create:function(){this._preExtension();this._trigger("beforeCreate");this.button= -this._button();var e=this,b=this.options,d=this.button.text(a(this.select[0].options.item(this.select[0].selectedIndex==-1?0:this.select[0].selectedIndex)).text()).insertBefore(this.select).buttonMarkup({theme:b.theme,icon:b.icon,iconpos:b.iconpos,inline:b.inline,corners:b.corners,shadow:b.shadow,iconshadow:b.iconshadow});b.nativeMenu&&window.opera&&window.opera.version&&this.select.addClass("ui-select-nativeonly");if(this.isMultiple)this.buttonCount=a("<span>").addClass("ui-li-count ui-btn-up-c ui-btn-corner-all").hide().appendTo(d.addClass("ui-li-has-count")); -(b.disabled||this.element.attr("disabled"))&&this.disable();this.select.change(function(){e.refresh()});this.build()},build:function(){var e=this;this.select.appendTo(e.button).bind("vmousedown",function(){e.button.addClass(a.mobile.activeBtnClass)}).bind("focus vmouseover",function(){e.button.trigger("vmouseover")}).bind("vmousemove",function(){e.button.removeClass(a.mobile.activeBtnClass)}).bind("change blur vmouseout",function(){e.button.trigger("vmouseout").removeClass(a.mobile.activeBtnClass)}).bind("change blur", -function(){e.button.removeClass("ui-btn-down-"+e.options.theme)})},selected:function(){return this._selectOptions().filter(":selected")},selectedIndices:function(){var a=this;return this.selected().map(function(){return a._selectOptions().index(this)}).get()},setButtonText:function(){var e=this,b=this.selected();this.button.find(".ui-btn-text").text(function(){return!e.isMultiple?b.text():b.length?b.map(function(){return a(this).text()}).get().join(", "):e.placeholder})},setButtonCount:function(){var a= -this.selected();this.isMultiple&&this.buttonCount[a.length>1?"show":"hide"]().text(a.length)},refresh:function(){this.setButtonText();this.setButtonCount()},open:a.noop,close:a.noop,disable:function(){this._setDisabled(true);this.button.addClass("ui-disabled")},enable:function(){this._setDisabled(false);this.button.removeClass("ui-disabled")}});a(document).bind("pagecreate create",function(e){a.mobile.selectmenu.prototype.enhanceWithin(e.target)})})(jQuery); -(function(a,e){function b(b){for(var c;b;){if((c=typeof b.className==="string"&&b.className.split(" "))&&a.inArray("ui-btn",c)>-1&&a.inArray("ui-disabled",c)<0)break;b=b.parentNode}return b}a.fn.buttonMarkup=function(b){for(var b=b||{},c=0;c<this.length;c++){var h=this.eq(c),g=h[0],i=a.extend({},a.fn.buttonMarkup.defaults,{icon:b.icon!==e?b.icon:h.jqmData("icon"),iconpos:b.iconpos!==e?b.iconpos:h.jqmData("iconpos"),theme:b.theme!==e?b.theme:h.jqmData("theme"),inline:b.inline!==e?b.inline:h.jqmData("inline"), -shadow:b.shadow!==e?b.shadow:h.jqmData("shadow"),corners:b.corners!==e?b.corners:h.jqmData("corners"),iconshadow:b.iconshadow!==e?b.iconshadow:h.jqmData("iconshadow")},b),k="ui-btn-inner",l,o,m=document.createElement(i.wrapperEls),p=document.createElement(i.wrapperEls),j=i.icon?document.createElement("span"):null;d&&d();if(!i.theme)i.theme=a.mobile.getInheritedTheme(h,"c");l="ui-btn ui-btn-up-"+i.theme;i.inline&&(l+=" ui-btn-inline");if(i.icon)i.icon="ui-icon-"+i.icon,i.iconpos=i.iconpos||"left", -o="ui-icon "+i.icon,i.iconshadow&&(o+=" ui-icon-shadow");i.iconpos&&(l+=" ui-btn-icon-"+i.iconpos,i.iconpos=="notext"&&!h.attr("title")&&h.attr("title",h.getEncodedText()));i.corners&&(l+=" ui-btn-corner-all",k+=" ui-btn-corner-all");i.shadow&&(l+=" ui-shadow");g.setAttribute("data-"+a.mobile.ns+"theme",i.theme);h.addClass(l);m.className=k;m.setAttribute("aria-hidden","true");p.className="ui-btn-text";m.appendChild(p);if(j)j.className=o,m.appendChild(j);for(;g.firstChild;)p.appendChild(g.firstChild); -g.appendChild(m);a.data(g,"textWrapper",a(p))}return this};a.fn.buttonMarkup.defaults={corners:true,shadow:true,iconshadow:true,inline:false,wrapperEls:"span"};var d=function(){a(document).bind({vmousedown:function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-up-"+c).addClass("ui-btn-down-"+c))},"vmousecancel vmouseup":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-down-"+c).addClass("ui-btn-up-"+ -c))},"vmouseover focus":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-up-"+c).addClass("ui-btn-hover-"+c))},"vmouseout blur":function(d){var d=b(d.target),c;d&&(d=a(d),c=d.attr("data-"+a.mobile.ns+"theme"),d.removeClass("ui-btn-hover-"+c+" ui-btn-down-"+c).addClass("ui-btn-up-"+c))}});d=null};a(document).bind("pagecreate create",function(b){a(":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", -b.target).not(".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')").buttonMarkup()})})(jQuery); -(function(a){a.fn.controlgroup=function(e){return this.each(function(){function b(a){a.removeClass("ui-btn-corner-all ui-shadow").eq(0).addClass(h[0]).end().last().addClass(h[1]).addClass("ui-controlgroup-last")}var d=a(this),f=a.extend({direction:d.jqmData("type")||"vertical",shadow:false,excludeInvisible:true},e),c=d.children("legend"),h=f.direction=="horizontal"?["ui-corner-left","ui-corner-right"]:["ui-corner-top","ui-corner-bottom"];d.find("input").first().attr("type");c.length&&(d.wrapInner("<div class='ui-controlgroup-controls'></div>"), -a("<div role='heading' class='ui-controlgroup-label'>"+c.html()+"</div>").insertBefore(d.children(0)),c.remove());d.addClass("ui-corner-all ui-controlgroup ui-controlgroup-"+f.direction);b(d.find(".ui-btn"+(f.excludeInvisible?":visible":"")));b(d.find(".ui-btn-inner"));f.shadow&&d.addClass("ui-shadow")})};a(document).bind("pagecreate create",function(e){a(":jqmData(role='controlgroup')",e.target).controlgroup({excludeInvisible:false})})})(jQuery); -(function(a){a(document).bind("pagecreate create",function(e){a(e.target).find("a").not(".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')").addClass("ui-link")})})(jQuery); -(function(a,e){a.fn.fixHeaderFooter=function(){return!a.support.scrollTop||a.support.touchOverflow&&a.mobile.touchOverflowEnabled?this:this.each(function(){var b=a(this);b.jqmData("fullscreen")&&b.addClass("ui-page-fullscreen");b.find(".ui-header:jqmData(position='fixed')").addClass("ui-header-fixed ui-fixed-inline fade");b.find(".ui-footer:jqmData(position='fixed')").addClass("ui-footer-fixed ui-fixed-inline fade")})};a.mobile.fixedToolbars=function(){function b(){!i&&g==="overlay"&&(h||a.mobile.fixedToolbars.hide(true), -a.mobile.fixedToolbars.startShowTimer())}function d(a){var b=0,c,d;if(a){d=document.body;c=a.offsetParent;for(b=a.offsetTop;a&&a!=d;){b+=a.scrollTop||0;if(a==c)b+=c.offsetTop,c=a.offsetParent;a=a.parentNode}}return b}function f(b){var c=a(window).scrollTop(),e=d(b[0]),f=b.css("top")=="auto"?0:parseFloat(b.css("top")),h=window.innerHeight,g=b.outerHeight(),i=b.parents(".ui-page:not(.ui-page-fullscreen)").length;return b.is(".ui-header-fixed")?(f=c-e+f,f<e&&(f=0),b.css("top",i?f:c)):b.css("top",i?c+ -h-g-(e-f):c+h-g)}if(a.support.scrollTop&&(!a.support.touchOverflow||!a.mobile.touchOverflowEnabled)){var c,h,g="inline",i=false,k=null,l=false,o=true;a(function(){var c=a(document),d=a(window);c.bind("vmousedown",function(){o&&(k=g)}).bind("vclick",function(b){o&&!a(b.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length&&!l&&(a.mobile.fixedToolbars.toggle(k),k=null)}).bind("silentscroll",b);(c.scrollTop()===0?d:c).bind("scrollstart",function(){l=true;k=== -null&&(k=g);var b=k=="overlay";if(i=b||!!h)a.mobile.fixedToolbars.clearShowTimer(),b&&a.mobile.fixedToolbars.hide(true)}).bind("scrollstop",function(b){a(b.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length||(l=false,i&&(a.mobile.fixedToolbars.startShowTimer(),i=false),k=null)});d.bind("resize updatelayout",b)});a(".ui-page").live("pagebeforeshow",function(b,d){var e=a(b.target).find(":jqmData(role='footer')"),h=e.data("id"),g=d.prevPage,g=g&&g.find(":jqmData(role='footer')"), -g=g.length&&g.jqmData("id")===h;h&&g&&(c=e,f(c.removeClass("fade in out").appendTo(a.mobile.pageContainer)))}).live("pageshow",function(){var b=a(this);c&&c.length&&setTimeout(function(){f(c.appendTo(b).addClass("fade"));c=null},500);a.mobile.fixedToolbars.show(true,this)});a(".ui-collapsible-contain").live("collapse expand",b);return{show:function(b,c){a.mobile.fixedToolbars.clearShowTimer();g="overlay";return(c?a(c):a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var c= -a(this),e=a(window).scrollTop(),h=d(c[0]),g=window.innerHeight,i=c.outerHeight(),e=c.is(".ui-header-fixed")&&e<=h+i||c.is(".ui-footer-fixed")&&h<=e+g;c.addClass("ui-fixed-overlay").removeClass("ui-fixed-inline");!e&&!b&&c.animationComplete(function(){c.removeClass("in")}).addClass("in");f(c)})},hide:function(b){g="inline";return(a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var c=a(this), -d=c.css("top"),d=d=="auto"?0:parseFloat(d);c.addClass("ui-fixed-inline").removeClass("ui-fixed-overlay");if(d<0||c.is(".ui-header-fixed")&&d!==0)b?c.css("top",0):c.css("top")!=="auto"&&parseFloat(c.css("top"))!==0&&c.animationComplete(function(){c.removeClass("out reverse").css("top",0)}).addClass("out reverse")})},startShowTimer:function(){a.mobile.fixedToolbars.clearShowTimer();var b=[].slice.call(arguments);h=setTimeout(function(){h=e;a.mobile.fixedToolbars.show.apply(null,b)},100)},clearShowTimer:function(){h&& -clearTimeout(h);h=e},toggle:function(b){b&&(g=b);return g==="overlay"?a.mobile.fixedToolbars.hide():a.mobile.fixedToolbars.show()},setTouchToggleEnabled:function(a){o=a}}}}();a(document).bind("pagecreate create",function(b){a(":jqmData(position='fixed')",b.target).length&&a(b.target).each(function(){if(!a.support.scrollTop||a.support.touchOverflow&&a.mobile.touchOverflowEnabled)return this;var b=a(this);b.jqmData("fullscreen")&&b.addClass("ui-page-fullscreen");b.find(".ui-header:jqmData(position='fixed')").addClass("ui-header-fixed ui-fixed-inline fade"); -b.find(".ui-footer:jqmData(position='fixed')").addClass("ui-footer-fixed ui-fixed-inline fade")})})})(jQuery); -(function(a){a.mobile.touchOverflowEnabled=false;a.mobile.touchOverflowZoomEnabled=false;a(document).bind("pagecreate",function(e){a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&(e=a(e.target),e.is(":jqmData(role='page')")&&e.each(function(){var b=a(this),d=b.find(":jqmData(role='header'), :jqmData(role='footer')").filter(":jqmData(position='fixed')"),e=b.jqmData("fullscreen"),c=d.length?b.find(".ui-content"):b;b.addClass("ui-mobile-touch-overflow");c.bind("scrollstop",function(){c.scrollTop()> -0&&window.scrollTo(0,a.mobile.defaultHomeScroll)});d.length&&(b.addClass("ui-native-fixed"),e&&(b.addClass("ui-native-fullscreen"),d.addClass("fade in"),a(document).bind("vclick",function(){d.removeClass("ui-native-bars-hidden").toggleClass("in out").animationComplete(function(){a(this).not(".in").addClass("ui-native-bars-hidden")})})))}))})})(jQuery); -(function(a,e){function b(){var b=a("meta[name='viewport']");b.length?b.attr("content",b.attr("content")+", user-scalable=no"):a("head").prepend("<meta>",{name:"viewport",content:"user-scalable=no"})}var d=a("html");a("head");var f=a(e);a(e.document).trigger("mobileinit");if(a.mobile.gradeA()){if(a.mobile.ajaxBlacklist)a.mobile.ajaxEnabled=false;d.addClass("ui-mobile ui-mobile-rendering");var c=a("<div class='ui-loader ui-body-a ui-corner-all'><span class='ui-icon ui-icon-loading spin'></span><h1></h1></div>"); -a.extend(a.mobile,{showPageLoadingMsg:function(){if(a.mobile.loadingMessage){var b=a("."+a.mobile.activeBtnClass).first();c.find("h1").text(a.mobile.loadingMessage).end().appendTo(a.mobile.pageContainer).css({top:a.support.scrollTop&&f.scrollTop()+f.height()/2||b.length&&b.offset().top||100})}d.addClass("ui-loading")},hidePageLoadingMsg:function(){d.removeClass("ui-loading")},initializePage:function(){var b=a(":jqmData(role='page')");b.length||(b=a("body").wrapInner("<div data-"+a.mobile.ns+"role='page'></div>").children(0)); -b.add(":jqmData(role='dialog')").each(function(){var b=a(this);b.jqmData("url")||b.attr("data-"+a.mobile.ns+"url",b.attr("id")||location.pathname+location.search)});a.mobile.firstPage=b.first();a.mobile.pageContainer=b.first().parent().addClass("ui-mobile-viewport");f.trigger("pagecontainercreate");a.mobile.showPageLoadingMsg();!a.mobile.hashListeningEnabled||!a.mobile.path.stripHash(location.hash)?a.mobile.changePage(a.mobile.firstPage,{transition:"none",reverse:true,changeHash:false,fromHashChange:true}): -f.trigger("hashchange",[true])}});a.support.touchOverflow&&a.mobile.touchOverflowEnabled&&!a.mobile.touchOverflowZoomEnabled&&b();a.mobile._registerInternalEvents();a(function(){e.scrollTo(0,1);a.mobile.defaultHomeScroll=!a.support.scrollTop||a(e).scrollTop()===1?0:1;a.mobile.autoInitializePage&&a.mobile.initializePage();f.load(a.mobile.silentScroll)})}})(jQuery,this); diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.0.css b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.css index 5d34136..06dbf8f 100644 --- a/h-source/Public/Js/jquery/jquery.mobile-1.0.css +++ b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.css @@ -1,5 +1,5 @@ /* -* jQuery Mobile Framework 1.0 +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 * http://jquerymobile.com * * Copyright 2011 (c) jQuery Project @@ -8,22 +8,20 @@ * */ /* Swatches */ - /* A -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-a { - border: 1px solid #2A2A2A /*{a-bar-border}*/; + border: 1px solid #333 /*{a-bar-border}*/; background: #111111 /*{a-bar-background-color}*/; color: #ffffff /*{a-bar-color}*/; font-weight: bold; text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000000 /*{a-bar-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #3c3c3c /*{a-bar-background-start}*/), to( #111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); + background-image: -webkit-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); } .ui-bar-a, .ui-bar-a input, @@ -35,36 +33,36 @@ .ui-bar-a .ui-link-inherit { color: #fff /*{a-bar-color}*/; } - .ui-bar-a .ui-link { color: #7cc4e7 /*{a-bar-link-color}*/; font-weight: bold; } - .ui-bar-a .ui-link:hover { color: #2489CE /*{a-bar-link-hover}*/; } - .ui-bar-a .ui-link:active { color: #2489CE /*{a-bar-link-active}*/; } - .ui-bar-a .ui-link:visited { color: #2489CE /*{a-bar-link-visited}*/; } .ui-body-a, -.ui-dialog.ui-overlay-a { - border: 1px solid #2A2A2A /*{a-body-border}*/; - background: #222222 /*{a-body-background-color}*/; +.ui-overlay-a { + border: 1px solid #444 /*{a-body-border}*/; + background: #222 /*{a-body-background-color}*/; color: #fff /*{a-body-color}*/; - text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #000 /*{a-body-shadow-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 1px /*{a-body-shadow-radius}*/ #111 /*{a-body-shadow-color}*/; font-weight: normal; - background-image: -webkit-gradient(linear, left top, left bottom, from( #666 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #444 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; } .ui-body-a, .ui-body-a input, @@ -76,36 +74,31 @@ .ui-body-a .ui-link-inherit { color: #fff /*{a-body-color}*/; } - .ui-body-a .ui-link { color: #2489CE /*{a-body-link-color}*/; font-weight: bold; } - .ui-body-a .ui-link:hover { color: #2489CE /*{a-body-link-hover}*/; } - .ui-body-a .ui-link:active { color: #2489CE /*{a-body-link-active}*/; } - .ui-body-a .ui-link:visited { color: #2489CE /*{a-body-link-visited}*/; } - .ui-btn-up-a { - border: 1px solid #222 /*{a-bup-border}*/; - background: #333333 /*{a-bup-background-color}*/; + border: 1px solid #111 /*{a-bup-border}*/; + background: #333 /*{a-bup-background-color}*/; font-weight: bold; color: #fff /*{a-bup-color}*/; - text-shadow: 0 /*{a-bup-shadow-x}*/ -1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #000 /*{a-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #555 /*{a-bup-background-start}*/), to( #333 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #111 /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444444 /*{a-bup-background-start}*/), to( #2d2d2d /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); } .ui-btn-up-a a.ui-link-inherit { color: #fff /*{a-bup-color}*/; @@ -115,29 +108,29 @@ background: #444444 /*{a-bhover-background-color}*/; font-weight: bold; color: #fff /*{a-bhover-color}*/; - text-shadow: 0 /*{a-bhover-shadow-x}*/ -1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #000 /*{a-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #666 /*{a-bhover-background-start}*/), to( #444 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #111 /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #555555 /*{a-bhover-background-start}*/), to( #383838 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); } .ui-btn-hover-a a.ui-link-inherit { color: #fff /*{a-bhover-color}*/; } .ui-btn-down-a { border: 1px solid #000 /*{a-bdown-border}*/; - background: #3d3d3d /*{a-bdown-background-color}*/; + background: #222 /*{a-bdown-background-color}*/; font-weight: bold; color: #fff /*{a-bdown-color}*/; - text-shadow: 0 /*{a-bdown-shadow-x}*/ -1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #000 /*{a-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #333 /*{a-bdown-background-start}*/), to( #5a5a5a /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #111 /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #202020 /*{a-bdown-background-start}*/), to( #2c2c2c /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); } .ui-btn-down-a a.ui-link-inherit { color: #fff /*{a-bdown-color}*/; @@ -148,23 +141,20 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* B -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-b { border: 1px solid #456f9a /*{b-bar-border}*/; background: #5e87b0 /*{b-bar-background-color}*/; color: #fff /*{b-bar-color}*/; font-weight: bold; - text-shadow: 0 /*{b-bar-shadow-x}*/ -1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #254f7a /*{b-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #81a8ce /*{b-bar-background-start}*/), to( #5e87b0 /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #3e6790 /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bar-background-start}*/), to( #497bae /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); } .ui-bar-b, .ui-bar-b input, @@ -180,31 +170,32 @@ color: #ddf0f8 /*{b-bar-link-color}*/; font-weight: bold; } - .ui-bar-b .ui-link:hover { color: #ddf0f8 /*{b-bar-link-hover}*/; } - .ui-bar-b .ui-link:active { color: #ddf0f8 /*{b-bar-link-active}*/; } - .ui-bar-b .ui-link:visited { color: #ddf0f8 /*{b-bar-link-visited}*/; } .ui-body-b, -.ui-dialog.ui-overlay-b { - border: 1px solid #C6C6C6 /*{b-body-border}*/; - background: #cccccc /*{b-body-background-color}*/; - color: #333333 /*{b-body-color}*/; +.ui-overlay-b { + border: 1px solid #999 /*{b-body-border}*/; + background: #f3f3f3 /*{b-body-background-color}*/; + color: #222222 /*{b-body-color}*/; text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/; font-weight: normal; - background-image: -webkit-gradient(linear, left top, left bottom, from( #e6e6e6 /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; } .ui-body-b, .ui-body-b input, @@ -216,52 +207,47 @@ .ui-body-b .ui-link-inherit { color: #333333 /*{b-body-color}*/; } - .ui-body-b .ui-link { color: #2489CE /*{b-body-link-color}*/; font-weight: bold; } - .ui-body-b .ui-link:hover { color: #2489CE /*{b-body-link-hover}*/; } - .ui-body-b .ui-link:active { color: #2489CE /*{b-body-link-active}*/; } - .ui-body-b .ui-link:visited { color: #2489CE /*{b-body-link-visited}*/; } - .ui-btn-up-b { - border: 1px solid #145072 /*{b-bup-border}*/; - background: #2567ab /*{b-bup-background-color}*/; + border: 1px solid #044062 /*{b-bup-border}*/; + background: #396b9e /*{b-bup-background-color}*/; font-weight: bold; color: #fff /*{b-bup-color}*/; - text-shadow: 0 /*{b-bup-shadow-x}*/ -1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #145072 /*{b-bup-shadow-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #194b7e /*{b-bup-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #5f9cc5 /*{b-bup-background-start}*/), to( #396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); + background-image: -webkit-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); } .ui-btn-up-b a.ui-link-inherit { color: #fff /*{b-bup-color}*/; } .ui-btn-hover-b { - border: 1px solid #00516e /*{b-bhover-border}*/; + border: 1px solid #00415e /*{b-bhover-border}*/; background: #4b88b6 /*{b-bhover-background-color}*/; font-weight: bold; color: #fff /*{b-bhover-color}*/; - text-shadow: 0 /*{b-bhover-shadow-x}*/ -1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #014D68 /*{b-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #72b0d4 /*{b-bhover-background-start}*/), to( #4b88b6 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #194b7e /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bhover-background-start}*/), to( #4272a4 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); } .ui-btn-hover-b a.ui-link-inherit { color: #fff /*{b-bhover-color}*/; @@ -271,13 +257,13 @@ background: #4e89c5 /*{b-bdown-background-color}*/; font-weight: bold; color: #fff /*{b-bdown-color}*/; - text-shadow: 0 /*{b-bdown-shadow-x}*/ -1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #225377 /*{b-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #396b9e /*{b-bdown-background-start}*/), to( #4e89c5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #194b7e /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #295b8e /*{b-bdown-background-start}*/), to( #3e79b5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); } .ui-btn-down-b a.ui-link-inherit { color: #fff /*{b-bdown-color}*/; @@ -288,25 +274,21 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* C -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-c { border: 1px solid #B3B3B3 /*{c-bar-border}*/; - background: #e9eaeb /*{c-bar-background-color}*/; + background: #eeeeee /*{c-bar-background-color}*/; color: #3E3E3E /*{c-bar-color}*/; font-weight: bold; text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #e9eaeb /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); -} - + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #ddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); +} .ui-bar-c .ui-link-inherit { color: #3E3E3E /*{c-bar-color}*/; } @@ -314,19 +296,15 @@ color: #7cc4e7 /*{c-bar-link-color}*/; font-weight: bold; } - .ui-bar-c .ui-link:hover { color: #2489CE /*{c-bar-link-hover}*/; } - .ui-bar-c .ui-link:active { color: #2489CE /*{c-bar-link-active}*/; } - .ui-bar-c .ui-link:visited { color: #2489CE /*{c-bar-link-visited}*/; } - .ui-bar-c, .ui-bar-c input, .ui-bar-c select, @@ -335,17 +313,21 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } .ui-body-c, -.ui-dialog.ui-overlay-c { - border: 1px solid #B3B3B3 /*{c-body-border}*/; +.ui-overlay-c { + border: 1px solid #aaa /*{c-body-border}*/; color: #333333 /*{c-body-color}*/; text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/; - background: #f0f0f0 /*{c-body-background-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{c-body-background-start}*/), to( #ddd /*{c-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eeeeee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; } .ui-body-c, .ui-body-c input, @@ -354,73 +336,66 @@ .ui-body-c button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-body-c .ui-link-inherit { color: #333333 /*{c-body-color}*/; } - .ui-body-c .ui-link { color: #2489CE /*{c-body-link-color}*/; font-weight: bold; } - .ui-body-c .ui-link:hover { color: #2489CE /*{c-body-link-hover}*/; } - .ui-body-c .ui-link:active { color: #2489CE /*{c-body-link-active}*/; } - .ui-body-c .ui-link:visited { color: #2489CE /*{c-body-link-visited}*/; } - .ui-btn-up-c { border: 1px solid #ccc /*{c-bup-border}*/; background: #eee /*{c-bup-background-color}*/; font-weight: bold; - color: #444 /*{c-bup-color}*/; - text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 1px /*{c-bup-shadow-radius}*/ #f6f6f6 /*{c-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fdfdfd /*{c-bup-background-start}*/), to( #eee /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); + color: #222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #ffffff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); } .ui-btn-up-c a.ui-link-inherit { color: #2F3E46 /*{c-bup-color}*/; } - .ui-btn-hover-c { - border: 1px solid #bbbbbb /*{c-bhover-border}*/; - background: #dadada /*{c-bhover-background-color}*/; + border: 1px solid #bbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; font-weight: bold; - color: #101010 /*{c-bhover-color}*/; - text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 1px /*{c-bhover-shadow-radius}*/ #fff /*{c-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #ededed /*{c-bhover-background-start}*/), to( #dadada /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); + color: #222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #ffffff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); } .ui-btn-hover-c a.ui-link-inherit { color: #2F3E46 /*{c-bhover-color}*/; } .ui-btn-down-c { - border: 1px solid #808080 /*{c-bdown-border}*/; - background: #fdfdfd /*{c-bdown-background-color}*/; + border: 1px solid #bbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; font-weight: bold; - color: #111111 /*{c-bdown-color}*/; - text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 1px /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{c-bdown-background-start}*/), to( #fdfdfd /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); + color: #222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); } .ui-btn-down-c a.ui-link-inherit { color: #2F3E46 /*{c-bdown-color}*/; @@ -431,22 +406,19 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* D -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-d { - border: 1px solid #ccc /*{d-bar-border}*/; + border: 1px solid #bbb /*{d-bar-border}*/; background: #bbb /*{d-bar-background-color}*/; color: #333 /*{d-bar-color}*/; text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{d-bar-background-start}*/), to( #bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); + background-image: -webkit-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); } .ui-bar-d, .ui-bar-d input, @@ -455,7 +427,6 @@ .ui-bar-d button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-bar-d .ui-link-inherit { color: #333333 /*{d-bar-color}*/; } @@ -463,31 +434,31 @@ color: #2489CE /*{d-bar-link-color}*/; font-weight: bold; } - .ui-bar-d .ui-link:hover { color: #2489CE /*{d-bar-link-hover}*/; } - .ui-bar-d .ui-link:active { color: #2489CE /*{d-bar-link-active}*/; } - .ui-bar-d .ui-link:visited { color: #2489CE /*{d-bar-link-visited}*/; } - .ui-body-d, -.ui-dialog.ui-overlay-d { - border: 1px solid #ccc /*{d-body-border}*/; +.ui-overlay-d { + border: 1px solid #bbb /*{d-body-border}*/; color: #333333 /*{d-body-color}*/; text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/; background: #ffffff /*{d-body-background-color}*/; background-image: -webkit-gradient(linear, left top, left bottom, from( #fff), to( #fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); + background-image: -webkit-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); +} +.ui-overlay-d { + background-image: none; + border-width: 0; } .ui-body-d, .ui-body-d input, @@ -496,40 +467,34 @@ .ui-body-d button { font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } - .ui-body-d .ui-link-inherit { color: #333333 /*{d-body-color}*/; } - .ui-body-d .ui-link { color: #2489CE /*{d-body-link-color}*/; font-weight: bold; } - .ui-body-d .ui-link:hover { color: #2489CE /*{d-body-link-hover}*/; } - .ui-body-d .ui-link:active { color: #2489CE /*{d-body-link-active}*/; } - .ui-body-d .ui-link:visited { color: #2489CE /*{d-body-link-visited}*/; } - .ui-btn-up-d { - border: 1px solid #ccc /*{d-bup-border}*/; + border: 1px solid #bbb /*{d-bup-border}*/; background: #fff /*{d-bup-background-color}*/; font-weight: bold; - color: #444 /*{d-bup-color}*/; - text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 1px /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fff), to( #fff /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); + color: #333 /*{d-bup-color}*/; + text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 0 /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fafafa), to( #f6f6f6 /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); } .ui-btn-up-d a.ui-link-inherit { color: #333 /*{d-bup-color}*/; @@ -538,34 +503,34 @@ border: 1px solid #aaa /*{d-bhover-border}*/; background: #eeeeee /*{d-bhover-background-color}*/; font-weight: bold; - color: #222 /*{d-bhover-color}*/; + color: #333 /*{d-bhover-color}*/; cursor: pointer; - text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 1px /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fdfdfd), to( #eee /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); + text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 0 /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #eee), to( #fff /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); } .ui-btn-hover-d a.ui-link-inherit { - color: #222 /*{d-bhover-color}*/; + color: #333 /*{d-bhover-color}*/; } .ui-btn-down-d { - border: 1px solid #aaaaaa /*{d-bdown-border}*/; - background: #ffffff /*{d-bdown-background-color}*/; + border: 1px solid #aaa /*{d-bdown-border}*/; + background: #eee /*{d-bdown-background-color}*/; font-weight: bold; - color: #111 /*{d-bdown-color}*/; - text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 1px /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #eee /*{d-bdown-background-start}*/), to( #fff /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); + color: #333 /*{d-bdown-color}*/; + text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 0 /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #e5e5e5 /*{d-bdown-background-start}*/), to( #f2f2f2 /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); } .ui-btn-down-d a.ui-link-inherit { - color: #111 /*{d-bdown-color}*/; + color: #333 /*{d-bdown-color}*/; } .ui-btn-up-d, .ui-btn-hover-d, @@ -573,22 +538,19 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - - /* E -----------------------------------------------------------------------------------------------------------*/ - .ui-bar-e { border: 1px solid #F7C942 /*{e-bar-border}*/; background: #fadb4e /*{e-bar-background-color}*/; color: #333 /*{e-bar-color}*/; text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fadb4e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fbef7e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); } .ui-bar-e, .ui-bar-e input, @@ -604,31 +566,31 @@ color: #2489CE /*{e-bar-link-color}*/; font-weight: bold; } - .ui-bar-e .ui-link:hover { color: #2489CE /*{e-bar-link-hover}*/; } - .ui-bar-e .ui-link:active { color: #2489CE /*{e-bar-link-active}*/; } - .ui-bar-e .ui-link:visited { color: #2489CE /*{e-bar-link-visited}*/; } - .ui-body-e, -.ui-dialog.ui-overlay-e { +.ui-overlay-e { border: 1px solid #F7C942 /*{e-body-border}*/; - color: #333333 /*{e-body-color}*/; + color: #222222 /*{e-body-color}*/; text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/; - background: #faeb9e /*{e-body-background-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fff /*{e-body-background-start}*/), to( #faeb9e /*{e-body-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); + background: #fff9df /*{e-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fffadf /*{e-body-background-start}*/), to( #fff3a5 /*{e-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); +} +.ui-overlay-e { + background-image: none; + border-width: 0; } .ui-body-e, .ui-body-e input, @@ -640,69 +602,63 @@ .ui-body-e .ui-link-inherit { color: #333333 /*{e-body-color}*/; } - .ui-body-e .ui-link { color: #2489CE /*{e-body-link-color}*/; font-weight: bold; } - .ui-body-e .ui-link:hover { color: #2489CE /*{e-body-link-hover}*/; } - .ui-body-e .ui-link:active { color: #2489CE /*{e-body-link-active}*/; } - .ui-body-e .ui-link:visited { color: #2489CE /*{e-body-link-visited}*/; } - .ui-btn-up-e { - border: 1px solid #F7C942 /*{e-bup-border}*/; + border: 1px solid #F4C63f /*{e-bup-border}*/; background: #fadb4e /*{e-bup-background-color}*/; font-weight: bold; - color: #333 /*{e-bup-color}*/; + color: #222 /*{e-bup-color}*/; text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bup-background-start}*/), to( #fadb4e /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffefaa /*{e-bup-background-start}*/), to( #ffe155 /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); } .ui-btn-up-e a.ui-link-inherit { - color: #333 /*{e-bup-color}*/; + color: #222 /*{e-bup-color}*/; } .ui-btn-hover-e { - border: 1px solid #e79952 /*{e-bhover-border}*/; + border: 1px solid #F2C43d /*{e-bhover-border}*/; background: #fbe26f /*{e-bhover-background-color}*/; font-weight: bold; color: #111 /*{e-bhover-color}*/; - text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 1px /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fcf0b5 /*{e-bhover-background-start}*/), to( #fbe26f /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); -} - + text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 0 /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff5ba /*{e-bhover-background-start}*/), to( #fbdd52 /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); +} .ui-btn-hover-e a.ui-link-inherit { color: #333 /*{e-bhover-color}*/; } .ui-btn-down-e { - border: 1px solid #F7C942 /*{e-bdown-border}*/; + border: 1px solid #F2C43d /*{e-bdown-border}*/; background: #fceda7 /*{e-bdown-background-color}*/; font-weight: bold; color: #111 /*{e-bdown-color}*/; - text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 1px /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; - background-image: -webkit-gradient(linear, left top, left bottom, from( #fadb4e /*{e-bdown-background-start}*/), to( #fceda7 /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); + text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 0 /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f8d94c /*{e-bdown-background-start}*/), to( #fadb4e /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); } .ui-btn-down-e a.ui-link-inherit { color: #333 /*{e-bdown-color}*/; @@ -713,53 +669,41 @@ font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; text-decoration: none; } - /* Structure */ - /* links within "buttons" -----------------------------------------------------------------------------------------------------------*/ - a.ui-link-inherit { text-decoration: none !important; } - - /* Active class used as the "on" state across all themes -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-active { - border: 1px solid #155678 /*{global-active-border}*/; - background: #4596ce /*{global-active-background-color}*/; + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; font-weight: bold; color: #fff /*{global-active-color}*/; cursor: pointer; - text-shadow: 0 /*{global-active-shadow-x}*/ -1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #145072 /*{global-active-shadow-color}*/; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; text-decoration: none; - background-image: -webkit-gradient(linear, left top, left bottom, from( #85bae4 /*{global-active-background-start}*/), to( #5393c5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ - background-image: -webkit-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ - background-image: -moz-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* FF3.6 */ - background-image: -ms-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* IE10 */ - background-image: -o-linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Opera 11.10+ */ - background-image: linear-gradient(#85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; } .ui-btn-active a.ui-link-inherit { color: #fff /*{global-active-color}*/; } - - /* button inner top highlight -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-inner { border-top: 1px solid #fff; border-color: rgba(255,255,255,.3); } - - /* corner rounding classes -----------------------------------------------------------------------------------------------------------*/ - .ui-corner-tl { -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; @@ -822,7 +766,6 @@ a.ui-link-inherit { -webkit-border-radius: 0; border-radius: 0; } - /* Form field separator -----------------------------------------------------------------------------------------------------------*/ .ui-br { @@ -831,7 +774,6 @@ a.ui-link-inherit { border-bottom-width: 1px; border-bottom-style: solid; } - /* Interaction cues -----------------------------------------------------------------------------------------------------------*/ .ui-disabled { @@ -839,13 +781,16 @@ a.ui-link-inherit { } .ui-disabled, .ui-disabled a { + cursor: default !important; pointer-events: none; - cursor: default; } - +.ui-disabled .ui-btn-text { + -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(opacity=30)"; + filter: alpha(opacity=30); + zoom: 1; +} /* Icons -----------------------------------------------------------------------------------------------------------*/ - .ui-icon, .ui-icon-searchfield:after { background: #666 /*{global-icon-color}*/; @@ -856,21 +801,16 @@ a.ui-link-inherit { -webkit-border-radius: 9px; border-radius: 9px; } - - /* Alt icon color -----------------------------------------------------------------------------------------------------------*/ - .ui-icon-alt { background: #fff; background: rgba(255,255,255,.3); background-image: url(images/icons-18-black.png); background-repeat: no-repeat; } - /* HD/"retina" sprite -----------------------------------------------------------------------------------------------------------*/ - @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min--moz-device-pixel-ratio: 1.5), only screen and (min-resolution: 240dpi) { @@ -890,7 +830,6 @@ a.ui-link-inherit { background-image: url(images/icons-36-black.png); } } - /* plus minus */ .ui-icon-plus { background-position: -0 50%; @@ -898,12 +837,10 @@ a.ui-link-inherit { .ui-icon-minus { background-position: -36px 50%; } - /* delete/close */ .ui-icon-delete { background-position: -72px 50%; } - /* arrows */ .ui-icon-arrow-r { background-position: -108px 50%; @@ -917,7 +854,6 @@ a.ui-link-inherit { .ui-icon-arrow-d { background-position: -216px 50%; } - /* misc */ .ui-icon-check { background-position: -252px 50%; @@ -965,8 +901,6 @@ a.ui-link-inherit { .ui-icon-radio-on { background-position: -720px 50%; } - - /* checks,radios */ .ui-checkbox .ui-icon { -moz-border-radius: 3px; @@ -981,22 +915,13 @@ a.ui-link-inherit { .ui-radio-on .ui-icon { background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ } - /* loading icon */ .ui-icon-loading { - background-image: url(images/ajax-loader.png); - width: 40px; - height: 40px; - -moz-border-radius: 20px; - -webkit-border-radius: 20px; - border-radius: 20px; - background-size: 35px 35px; -} - - + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} /* Button corner classes -----------------------------------------------------------------------------------------------------------*/ - .ui-btn-corner-tl { -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; @@ -1054,7 +979,6 @@ a.ui-link-inherit { -webkit-border-radius: 1em /*{global-radii-buttons}*/; border-radius: 1em /*{global-radii-buttons}*/; } - /* radius clip workaround for cleaning up corner trapping */ .ui-corner-tl, .ui-corner-tr, @@ -1078,10 +1002,8 @@ a.ui-link-inherit { -moz-background-clip: padding; background-clip: padding-box; } - /* Overlay / modal -----------------------------------------------------------------------------------------------------------*/ - .ui-overlay { background: #666; opacity: .5; @@ -1113,51 +1035,48 @@ a.ui-link-inherit { box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); } .ui-icon-shadow { - -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); - -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); - box-shadow: 0px 1px 0 rgba(255,255,255,.4); + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; } - -/* Focus state - set here for specificity +/* Focus state - set here for specificity (note: these classes are added by JavaScript) -----------------------------------------------------------------------------------------------------------*/ - -.ui-focus { +.ui-btn:focus { + outline: 0; +} +.ui-focus, +.ui-btn:focus { -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; } - /* unset box shadow in browsers that don't do it right -----------------------------------------------------------------------------------------------------------*/ - .ui-mobile-nosupport-boxshadow * { -moz-box-shadow: none !important; -webkit-box-shadow: none !important; box-shadow: none !important; } - /* ...and bring back focus */ -.ui-mobile-nosupport-boxshadow .ui-focus { - outline-width: 2px; +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus { + outline-width: 1px; + outline-style: dotted; } /* some unsets - more probably needed */ -.ui-mobile, .ui-mobile body { height: 100%; } +.ui-mobile, .ui-mobile body { height: 99.9%; } .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } -.ui-mobile a img, .ui-mobile fieldset { border: 0; } - +.ui-mobile a img, .ui-mobile fieldset { border-width: 0; } /* responsive page widths */ .ui-mobile-viewport { margin: 0; overflow-x: visible; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } /* Issue #2066 */ body.ui-mobile-viewport, div.ui-mobile-viewport { overflow-x: hidden; } - /* "page" containers - full-screen views, one should always be in view post-pageload */ .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } .ui-mobile .ui-page-active { display: block; overflow: visible; } - /* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */ .ui-page { outline: none; } - /*orientations from js are available */ @media screen and (orientation: portrait){ .ui-mobile, .ui-mobile .ui-page { min-height: 420px; } @@ -1165,249 +1084,351 @@ div.ui-mobile-viewport { overflow-x: hidden; } @media screen and (orientation: landscape){ .ui-mobile, .ui-mobile .ui-page { min-height: 300px; } } - -/* native overflow scrolling */ -.ui-page.ui-mobile-touch-overflow, -.ui-mobile-touch-overflow.ui-native-fixed .ui-content { - overflow: auto; - height: 100%; - -webkit-overflow-scrolling: touch; - -moz-overflow-scrolling: touch; - -o-overflow-scrolling: touch; - -ms-overflow-scrolling: touch; - overflow-scrolling: touch; -} -.ui-page.ui-mobile-touch-overflow, -.ui-page.ui-mobile-touch-overflow * { - /* some level of transform keeps elements from blinking out of visibility on iOS */ - -webkit-transform: rotateY(0); -} -.ui-page.ui-mobile-pre-transition { - display: block; -} - /* loading screen */ -.ui-loading .ui-mobile-viewport { overflow: hidden !important; } .ui-loading .ui-loader { display: block; } -.ui-loading .ui-page { overflow: hidden; } -.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } -.ui-loader h1 { font-size: 15px; text-align: center; } -.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } - +.ui-loader { display: none; z-index: 9999999; position: fixed; top: 50%; box-shadow: 0 1px 1px -1px #fff; left: 50%; border:0; } +.ui-loader-default { background: none; opacity: .18; width: 46px; height: 46px; margin-left: -23px; margin-top: -23px; } +.ui-loader-verbose { width: 200px; opacity: .88; height: auto; margin-left: -110px; margin-top: -43px; padding: 10px; } +.ui-loader-default h1 { font-size: 0; width: 0; height: 0; overflow: hidden; } +.ui-loader-verbose h1 { font-size: 16px; margin: 0; text-align: center; } +.ui-loader .ui-icon { background-color: #000; display: block; margin: 0; width: 44px; height: 44px; padding: 1px; -webkit-border-radius: 36px; -moz-border-radius: 36px; border-radius: 36px; } +.ui-loader-verbose .ui-icon { margin: 0 auto 10px; opacity: .75; } +.ui-loader-textonly { padding: 15px; margin-left: -115px; } +.ui-loader-textonly .ui-icon { display: none; } +.ui-loader-fakefix { position: absolute; } /*fouc*/ .ui-mobile-rendering > * { visibility: hidden; } - /*headers, content panels*/ .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } .ui-bar { font-size: 16px; margin: 0; } .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } - -.ui-header, .ui-footer { display: block; } -.ui-page .ui-header, .ui-page .ui-footer { position: relative; } -.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } -.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } -.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } +.ui-header, .ui-footer { position: relative; border-left-width: 0; border-right-width: 0; } +.ui-header .ui-btn-left, +.ui-header .ui-btn-right, +.ui-footer .ui-btn-left, +.ui-footer .ui-btn-right { position: absolute; top: 3px; } +.ui-header .ui-btn-left, +.ui-footer .ui-btn-left { left: 5px; } +.ui-header .ui-btn-right, +.ui-footer .ui-btn-right { right: 5px; } +.ui-footer .ui-btn-icon-notext, +.ui-header .ui-btn-icon-notext { top: 6px; } +.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 30% .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } .ui-footer .ui-title { margin: .6em 15px .8em; } - /*content area*/ .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } -.ui-page-fullscreen .ui-content { padding:0; } - -/* native fixed headers and footers */ -.ui-mobile-touch-overflow.ui-page.ui-native-fixed, -.ui-mobile-touch-overflow.ui-page.ui-native-fullscreen { - overflow: visible; -} -.ui-mobile-touch-overflow.ui-native-fixed .ui-header, -.ui-mobile-touch-overflow.ui-native-fixed .ui-footer { - position: fixed; - left: 0; - right: 0; - top: 0; - z-index: 200; -} -.ui-mobile-touch-overflow.ui-page.ui-native-fixed .ui-footer { - top: auto; - bottom: 0; -} -.ui-mobile-touch-overflow.ui-native-fixed .ui-content { - padding-top: 2.5em; - padding-bottom: 3em; - top: 0; - bottom: 0; - height: auto; - position: absolute; -} -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-content { - padding-top: 0; - padding-bottom: 0; -} -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-header, -.ui-mobile-touch-overflow.ui-native-fullscreen .ui-footer { - opacity: .9; -} -.ui-native-bars-hidden { - display: none; -} - /* icons sizing */ .ui-icon { width: 18px; height: 18px; } - -/* fullscreen class on ui-content div */ -.ui-fullscreen { } -.ui-fullscreen img { max-width: 100%; } - /* non-js content hiding */ .ui-nojs { position: absolute; left: -9999px; } - /* accessible content hiding */ .ui-hide-label label, .ui-hidden-accessible { position: absolute !important; left: -9999px; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.spin { - -webkit-transform: rotate(360deg); - -webkit-animation-name: spin; - -webkit-animation-duration: 1s; - -webkit-animation-iteration-count: infinite; - -webkit-animation-timing-function: linear; -} -@-webkit-keyframes spin { - from {-webkit-transform: rotate(0deg);} - to {-webkit-transform: rotate(360deg);} -} - -/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ -Built by David Kaneda and maintained by Jonathan Stark. -*/ -.in, .out { - -webkit-animation-timing-function: ease-in-out; +/* Transitions originally inspired by those from jQtouch, nice work, folks */ +.ui-mobile-viewport-transitioning, +.ui-mobile-viewport-transitioning .ui-page { + width: 100%; + height: 100%; + overflow: hidden; +} +.in { + -webkit-animation-timing-function: ease-out; -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.out { + -webkit-animation-timing-function: ease-in; + -webkit-animation-duration: 225ms; + -moz-animation-timing-function: ease-in; + -moz-animation-duration: 225; +} +@-webkit-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-moz-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-webkit-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +@-moz-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +.fade.out { + opacity: 0; + -webkit-animation-duration: 125ms; + -webkit-animation-name: fadeout; + -moz-animation-duration: 125ms; + -moz-animation-name: fadeout; +} +.fade.in { + opacity: 1; + -webkit-animation-duration: 225ms; + -webkit-animation-name: fadein; + -moz-animation-duration: 225ms; + -moz-animation-name: fadein; +} +.pop { + -webkit-transform-origin: 50% 50%; + -moz-transform-origin: 50% 50%; +} +.pop.in { + -webkit-transform: scale(1); + -moz-transform: scale(1); + opacity: 1; + -webkit-animation-name: popin; + -moz-animation-name: popin; + -webkit-animation-duration: 350ms; + -moz-animation-duration: 350ms; +} +.pop.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + opacity: 0; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.pop.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; +} +.pop.out.reverse { + -webkit-transform: scale(.8); + -moz-transform: scale(.8); + -webkit-animation-name: popout; + -moz-animation-name: popout; +} +@-webkit-keyframes popin { + from { + -webkit-transform: scale(.8); + opacity: 0; + } + to { + -webkit-transform: scale(1); + opacity: 1; + } +} +@-moz-keyframes popin { + from { + -moz-transform: scale(.8); + opacity: 0; + } + to { + -moz-transform: scale(1); + opacity: 1; + } +} +@-webkit-keyframes popout { + from { + -webkit-transform: scale(1); + opacity: 1; + } + to { + -webkit-transform: scale(.8); + opacity: 0; + } +} +@-moz-keyframes popout { + from { + -moz-transform: scale(1); + opacity: 1; + } + to { + -moz-transform: scale(.8); + opacity: 0; + } +} +/* keyframes for slidein from sides */ +@-webkit-keyframes slideinfromright { + from { -webkit-transform: translateX(100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromright { + from { -moz-transform: translateX(100%); } + to { -moz-transform: translateX(0); } +} +@-webkit-keyframes slideinfromleft { + from { -webkit-transform: translateX(-100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromleft { + from { -moz-transform: translateX(-100%); } + to { -moz-transform: translateX(0); } +} +/* keyframes for slideout to sides */ +@-webkit-keyframes slideouttoleft { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(-100%); } +} +@-moz-keyframes slideouttoleft { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(-100%); } +} +@-webkit-keyframes slideouttoright { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(100%); } +} +@-moz-keyframes slideouttoright { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(100%); } +} +.slide.out, .slide.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; } - - .slide.out { -webkit-transform: translateX(-100%); -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; } - .slide.in { -webkit-transform: translateX(0); -webkit-animation-name: slideinfromright; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromright; } - .slide.out.reverse { -webkit-transform: translateX(100%); -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; } - .slide.in.reverse { -webkit-transform: translateX(0); -webkit-animation-name: slideinfromleft; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromleft; } - -.slideup.out { - -webkit-animation-name: dontmove; - z-index: 0; +.slidefade.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; + -webkit-animation-duration: 225ms; + -moz-animation-duration: 225ms; } - -.slideup.in { - -webkit-transform: translateY(0); - -webkit-animation-name: slideinfrombottom; - z-index: 10; +.slidefade.in { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -.slideup.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; +.slidefade.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -.slideup.out.reverse { - -webkit-transform: translateY(100%); - z-index: 10; - -webkit-animation-name: slideouttobottom; +.slidefade.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - +/* slide down */ .slidedown.out { - -webkit-animation-name: dontmove; - z-index: 0; + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; } - .slidedown.in { -webkit-transform: translateY(0); -webkit-animation-name: slideinfromtop; - z-index: 10; + -moz-transform: translateY(0); + -moz-animation-name: slideinfromtop; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; } - .slidedown.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; } - .slidedown.out.reverse { -webkit-transform: translateY(-100%); - z-index: 10; + -moz-transform: translateY(-100%); -webkit-animation-name: slideouttotop; + -moz-animation-name: slideouttotop; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; } - -@-webkit-keyframes slideinfromright { - from { -webkit-transform: translateX(100%); } - to { -webkit-transform: translateX(0); } -} - -@-webkit-keyframes slideinfromleft { - from { -webkit-transform: translateX(-100%); } - to { -webkit-transform: translateX(0); } -} - -@-webkit-keyframes slideouttoleft { - from { -webkit-transform: translateX(0); } - to { -webkit-transform: translateX(-100%); } -} - -@-webkit-keyframes slideouttoright { - from { -webkit-transform: translateX(0); } - to { -webkit-transform: translateX(100%); } -} - @-webkit-keyframes slideinfromtop { from { -webkit-transform: translateY(-100%); } to { -webkit-transform: translateY(0); } } - -@-webkit-keyframes slideinfrombottom { - from { -webkit-transform: translateY(100%); } - to { -webkit-transform: translateY(0); } -} - -@-webkit-keyframes slideouttobottom { - from { -webkit-transform: translateY(0); } - to { -webkit-transform: translateY(100%); } +@-moz-keyframes slideinfromtop { + from { -moz-transform: translateY(-100%); } + to { -moz-transform: translateY(0); } } - @-webkit-keyframes slideouttotop { from { -webkit-transform: translateY(0); } to { -webkit-transform: translateY(-100%); } } -@-webkit-keyframes fadein { - from { opacity: 0; } - to { opacity: 1; } -} - -@-webkit-keyframes fadeout { - from { opacity: 1; } - to { opacity: 0; } +@-moz-keyframes slideouttotop { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(-100%); } } - -.fade.out { - z-index: 0; +/* slide up */ +.slideup.out { -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; } - -.fade.in { - opacity: 1; - z-index: 10; +.slideup.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfrombottom; + -moz-transform: translateY(0); + -moz-animation-name: slideinfrombottom; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slideup.in.reverse { -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slideup.out.reverse { + -webkit-transform: translateY(100%); + -moz-transform: translateY(100%); + -webkit-animation-name: slideouttobottom; + -moz-animation-name: slideouttobottom; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfrombottom { + from { -webkit-transform: translateY(100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfrombottom { + from { -moz-transform: translateY(100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttobottom { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(100%); } +} +@-moz-keyframes slideouttobottom { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(100%); } } - /* The properties in this rule are only necessary for the 'flip' transition. * We need specify the perspective to create a projection matrix. This will add * some depth as the element flips. The depth number represents the distance of @@ -1416,151 +1437,294 @@ Built by David Kaneda and maintained by Jonathan Stark. */ .viewport-flip { -webkit-perspective: 1000; + -moz-perspective: 1000; position: absolute; } - -.ui-mobile-viewport-transitioning, -.ui-mobile-viewport-transitioning .ui-page { - width: 100%; - height: 100%; - overflow: hidden; -} - .flip { - -webkit-animation-duration: .65s; -webkit-backface-visibility:hidden; -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); } - .flip.out { - -webkit-transform: rotateY(-180deg) scale(.8); + -webkit-transform: rotateY(-90deg) scale(.9); -webkit-animation-name: flipouttoleft; + -webkit-animation-duration: 175ms; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -moz-animation-duration: 175ms; } - .flip.in { - -webkit-transform: rotateY(0) scale(1); - -webkit-animation-name: flipinfromleft; + -webkit-animation-name: flipintoright; + -webkit-animation-duration: 225ms; + -moz-animation-name: flipintoright; + -moz-animation-duration: 225ms; } - -/* Shake it all about */ - .flip.out.reverse { - -webkit-transform: rotateY(180deg) scale(.8); + -webkit-transform: rotateY(90deg) scale(.9); -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; } - .flip.in.reverse { - -webkit-transform: rotateY(0) scale(1); - -webkit-animation-name: flipinfromright; -} - -@-webkit-keyframes flipinfromright { - from { -webkit-transform: rotateY(-180deg) scale(.8); } - to { -webkit-transform: rotateY(0) scale(1); } + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; } - -@-webkit-keyframes flipinfromleft { - from { -webkit-transform: rotateY(180deg) scale(.8); } - to { -webkit-transform: rotateY(0) scale(1); } -} - @-webkit-keyframes flipouttoleft { - from { -webkit-transform: rotateY(0) scale(1); } - to { -webkit-transform: rotateY(-180deg) scale(.8); } + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } } - @-webkit-keyframes flipouttoright { - from { -webkit-transform: rotateY(0) scale(1); } - to { -webkit-transform: rotateY(180deg) scale(.8); } -} - - -/* Hackish, but reliable. */ - -@-webkit-keyframes dontmove { - from { opacity: 1; } - to { opacity: 1; } + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } } - -.pop { - -webkit-transform-origin: 50% 50%; +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } } - -.pop.in { - -webkit-transform: scale(1); - opacity: 1; - -webkit-animation-name: popin; - z-index: 10; +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } } - -.pop.in.reverse { - z-index: 0; - -webkit-animation-name: dontmove; +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } } - -.pop.out.reverse { - -webkit-transform: scale(.2); - opacity: 0; - -webkit-animation-name: popout; - z-index: 10; +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } } - -@-webkit-keyframes popin { - from { - -webkit-transform: scale(.2); - opacity: 0; - } - to { - -webkit-transform: scale(1); - opacity: 1; - } +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } } - -@-webkit-keyframes popout { - from { - -webkit-transform: scale(1); - opacity: 1; - } - to { - -webkit-transform: scale(.2); - opacity: 0; - } -}/* content configurations. */ +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-turn { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.turn { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -webkit-transform-origin: 0; + + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-transform-origin: 0; +} +.turn.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -webkit-animation-duration: 125ms; + -moz-animation-duration: 125ms; +} +.turn.in { + -webkit-animation-name: flipintoright; + -moz-animation-name: flipintoright; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; + +} +.turn.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.turn.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* flow transition */ +.flow { + -webkit-transform-origin: 50% 30%; + -moz-transform-origin: 50% 30%; + -webkit-box-shadow: 0 0 20px rgba(0,0,0,.4); + -moz-box-shadow: 0 0 20px rgba(0,0,0,.4); +} +.ui-dialog.flow { + -webkit-transform-origin: none; + -moz-transform-origin: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; +} +.flow.out { + -webkit-transform: translateX(-100%) scale(.7); + -webkit-animation-name: flowouttoleft; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(-100%) scale(.7); + -moz-animation-name: flowouttoleft; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.in { + -webkit-transform: translateX(0) scale(1); + -webkit-animation-name: flowinfromright; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(0) scale(1); + -moz-animation-name: flowinfromright; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: flowouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: flowouttoright; +} +.flow.in.reverse { + -webkit-animation-name: flowinfromleft; + -moz-animation-name: flowinfromleft; +} +@-webkit-keyframes flowouttoleft { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(-100%) scale(.7); } +} +@-moz-keyframes flowouttoleft { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(-100%) scale(.7); } +} +@-webkit-keyframes flowouttoright { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(100%) scale(.7); } +} +@-moz-keyframes flowouttoright { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(100%) scale(.7); } +} +@-webkit-keyframes flowinfromleft { + 0% { -webkit-transform: translateX(-100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromleft { + 0% { -moz-transform: translateX(-100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +@-webkit-keyframes flowinfromright { + 0% { -webkit-transform: translateX(100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromright { + 0% { -moz-transform: translateX(100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +/* content configurations. */ .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} - /* grid solo: 100 - single item fallback */ .ui-grid-solo .ui-block-a { width: 100%; float: none; } - /* grid a: 50/50 */ .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } .ui-grid-a .ui-block-a { clear: left; } - /* grid b: 33/33/33 */ .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } .ui-grid-b .ui-block-a { clear: left; } - /* grid c: 25/25/25/25 */ .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } .ui-grid-c .ui-block-a { clear: left; } - /* grid d: 20/20/20/20/20 */ .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } .ui-grid-d .ui-block-a { clear: left; } /* fixed page header & footer configuration */ -.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } -.ui-header-fixed, .ui-footer-fixed { +.ui-header-fixed, +.ui-footer-fixed { + left: 0; + right: 0; + width: 100%; + position: fixed; z-index: 1000; - -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ } -.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } -.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } +.ui-header-fixed { + top: 0; +} +.ui-footer-fixed { + bottom: 0; +} +.ui-header-fullscreen, +.ui-footer-fullscreen { + opacity: .9; +} +.ui-page-header-fixed { + padding-top: 2.5em; +} +.ui-page-footer-fixed { + padding-bottom: 3em; +} +.ui-page-header-fullscreen .ui-content, +.ui-page-footer-fullscreen .ui-content { + padding: 0; +} +.ui-fixed-hidden { + position: absolute; +} +.ui-page-header-fullscreen .ui-fixed-hidden, +.ui-page-footer-fullscreen .ui-fixed-hidden { + left: -99999em; +} +.ui-header-fixed .ui-btn, +.ui-footer-fixed .ui-btn { + z-index: 10; +} .ui-navbar { overflow: hidden; } .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } -.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } +.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; max-width: 100%; } .ui-navbar li .ui-btn { margin-right: -1px; } .ui-navbar li .ui-btn:last-child { margin-right: 0; } .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, @@ -1577,59 +1741,73 @@ Built by David Kaneda and maintained by Jonathan Stark. .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } -.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } -.ui-btn-inline { display: inline-block; } -.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } +.ui-mini { margin: .25em 5px; } +.ui-btn-inner { padding: .6em 20px; min-width: .75em; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } .ui-btn input, .ui-btn button { z-index: 2; } -.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } +.ui-btn-left, .ui-btn-right, .ui-btn-inline { display: inline-block; } +.ui-btn-block { display: block; } +.ui-header .ui-btn, +.ui-footer .ui-btn { display: inline-block; margin: 0; } +.ui-header .ui-btn-inner, +.ui-footer .ui-btn-inner, +.ui-mini .ui-btn-inner { font-size: 12.5px; padding: .55em 11px .5em; } +.ui-header .ui-fullsize .ui-btn-inner, +.ui-footer .ui-fullsize .ui-btn-inner { font-size: 16px; padding: .6em 25px; } .ui-btn-icon-notext { width: 24px; height: 24px; } -.ui-btn-icon-notext .ui-btn-inner { padding: 2px 1px 2px 3px; } -.ui-btn-text { position: relative; z-index: 1; } +.ui-btn-icon-notext .ui-btn-inner { padding: 0; height: 100%; } +.ui-btn-icon-notext .ui-btn-inner .ui-icon { margin: 2px 1px 2px 3px; } +.ui-btn-text { position: relative; z-index: 1; width: 100%; } .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -9999px; } -.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } +.ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-btn-icon-right .ui-btn-inner { padding-right: 40px; } +.ui-btn-icon-top .ui-btn-inner { padding-top: 40px; } +.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 40px; } .ui-header .ui-btn-icon-left .ui-btn-inner, .ui-footer .ui-btn-icon-left .ui-btn-inner, -.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } -.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } +.ui-mini .ui-btn-icon-left .ui-btn-inner { padding-left: 30px; } .ui-header .ui-btn-icon-right .ui-btn-inner, .ui-footer .ui-btn-icon-right .ui-btn-inner, -.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } -.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } +.ui-mini .ui-btn-icon-right .ui-btn-inner { padding-right: 30px; } .ui-header .ui-btn-icon-top .ui-btn-inner, .ui-footer .ui-btn-icon-top .ui-btn-inner, -.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } -.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } +.ui-mini .ui-btn-icon-top .ui-btn-inner { padding: 30px 3px .5em 3px; } .ui-header .ui-btn-icon-bottom .ui-btn-inner, .ui-footer .ui-btn-icon-bottom .ui-btn-inner, -.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } - +.ui-mini .ui-btn-icon-bottom .ui-btn-inner { padding: .55em 3px 30px 3px; } /*btn icon positioning*/ .ui-btn-icon-notext .ui-icon { display: block; z-index: 0;} -.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } -.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } +.ui-btn-icon-left .ui-btn-inner .ui-icon, .ui-btn-icon-right .ui-btn-inner .ui-icon { position: absolute; top: 50%; margin-top: -9px; } +.ui-btn-icon-top .ui-btn-inner .ui-icon, .ui-btn-icon-bottom .ui-btn-inner .ui-icon { position: absolute; left: 50%; margin-left: -9px; } .ui-btn-icon-left .ui-icon { left: 10px; } .ui-btn-icon-right .ui-icon { right: 10px; } .ui-btn-icon-top .ui-icon { top: 10px; } -.ui-btn-icon-bottom .ui-icon { bottom: 10px; } +.ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } .ui-header .ui-btn-icon-left .ui-icon, .ui-footer .ui-btn-icon-left .ui-icon, -.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } +.ui-mini.ui-btn-icon-left .ui-icon, +.ui-mini .ui-btn-icon-left .ui-icon { left: 5px; } .ui-header .ui-btn-icon-right .ui-icon, .ui-footer .ui-btn-icon-right .ui-icon, -.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } +.ui-mini.ui-btn-icon-right .ui-icon, +.ui-mini .ui-btn-icon-right .ui-icon { right: 5px; } .ui-header .ui-btn-icon-top .ui-icon, .ui-footer .ui-btn-icon-top .ui-icon, -.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } +.ui-mini.ui-btn-icon-top .ui-icon, +.ui-mini .ui-btn-icon-top .ui-icon { top: 5px; } .ui-header .ui-btn-icon-bottom .ui-icon, .ui-footer .ui-btn-icon-bottom .ui-icon, -.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } - +.ui-mini.ui-btn-icon-bottom .ui-icon, +.ui-mini .ui-btn-icon-bottom .ui-icon { bottom: 5px; } /*hiding native button,inputs */ -.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=.0001); font-size: 1px; border: none; line-height: 999px; } +.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=.0001); font-size: 1px; border: none; text-indent: -9999px; } .ui-collapsible { margin: .5em 0; } .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } .ui-collapsible-heading a { text-align: left; margin: 0; } -.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner { padding-left: 12px; padding-right: 40px; } +.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner { padding-right: 40px; text-align: center; } .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } @@ -1643,22 +1821,21 @@ Built by David Kaneda and maintained by Jonathan Stark. font-weight: normal; /* Overrides ui-btn-up-* */ } .ui-collapsible-content-collapsed { display: none; } - .ui-collapsible-set { margin: .5em 0; } .ui-collapsible-set .ui-collapsible { margin: -1px 0 0; } -.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } +.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: 0em 0 .5em; zoom: 1; } .ui-bar .ui-controlgroup { margin: 0 .3em; } -.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } +.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .4em; } .ui-controlgroup-controls { display: block; width: 100%;} .ui-controlgroup li { list-style: none; } .ui-controlgroup-vertical .ui-btn, .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } .ui-controlgroup-controls label.ui-select { position: absolute; left: -9999px; } - .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } .ui-controlgroup-horizontal { padding: 0; } -.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select { display: inline-block; margin: 0 -5px 0 0; } -.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; margin: 0 -1px 0 0; } +.ui-controlgroup-horizontal .ui-btn-inner { text-align:center; } +.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select { display: inline-block; margin: 0 -6px 0 0; } +.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; clear: none; margin: 0 -1px 0 0; } .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } @@ -1667,71 +1844,96 @@ Built by David Kaneda and maintained by Jonathan Stark. .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } */ - @media all and (min-width: 450px){ .ui-field-contain .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain .ui-controlgroup-controls { width: 60%; display: inline-block; } .ui-field-contain .ui-controlgroup .ui-select { width: 100%; } .ui-field-contain .ui-controlgroup-horizontal .ui-select { width: auto; } -} .ui-dialog { min-height: 480px; } +} +.ui-dialog { + background: none !important; /* this is to ensure that dialog theming does not apply (by default at least) on the page div */ +} +.ui-dialog-contain { width: 92.5%; max-width: 500px; margin: 10% auto 15px auto; padding: 0; } +.ui-dialog .ui-header { + margin-top: 15%; + border: none; + overflow: hidden; +} .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { - max-width: 500px; - margin: 10% auto 15px auto; - width: 85%; + display: block; position: relative; + width: auto; } .ui-dialog .ui-header, .ui-dialog .ui-footer { - padding: 0 15px; z-index: 10; + padding: 0; +} +.ui-dialog .ui-footer { + padding: 0 15px; } .ui-dialog .ui-content { padding: 15px; } -.ui-dialog .ui-content, -.ui-dialog .ui-footer { +.ui-dialog { margin-top: -15px; } -.ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } +.ui-checkbox, .ui-radio { position: relative; clear: both; margin: .2em 0 .5em; z-index: 1; } .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner { padding-left: 36px; } .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner { padding-right: 36px; } +.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner, .ui-radio .ui-btn-icon-bottom .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } -.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } -.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } +.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon { left: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon, .ui-radio .ui-mini.ui-btn-icon-left .ui-icon { left: 9px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +.ui-checkbox .ui-btn-icon-top .ui-icon, .ui-radio .ui-btn-icon-top .ui-icon { top: 10px; } +.ui-checkbox .ui-btn-icon-bottom .ui-icon, .ui-radio .ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } /* input, label positioning */ -.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }.ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } +.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; } +.ui-field-contain, fieldset.ui-field-contain { padding: .8em 0; margin: 0; border-width: 0 0 1px 0; overflow: visible; } .ui-field-contain:first-child { border-top-width: 0; } +.ui-header .ui-field-contain-left, +.ui-header .ui-field-contain-right { + position: absolute; + top: 0; + width: 25%; +} +.ui-header .ui-field-contain-left { + left: 1em; +} +.ui-header .ui-field-contain-right { + right: 1em; +} @media all and (min-width: 450px){ - .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } -} .ui-select { display: block; position: relative; } + .ui-field-contain, .ui-mobile fieldset.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } +} +.ui-select { display: block; position: relative; } .ui-select select { position: absolute; left: -9999px; top: -9999px; } -.ui-select .ui-btn { overflow: hidden; } - - -.ui-select .ui-btn { opacity: 1; } - +.ui-select .ui-btn { overflow: hidden; opacity: 1; margin: 0; } /* Fixes #2588 — When Windows Phone 7.5 (Mango) tries to calculate a numeric opacity for a select—including “inherit”—without explicitly specifying an opacity on the parent to give it context, a bug appears where clicking elsewhere on the page after opening the select will open the select again. */ .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); z-index: 2; } - .ui-select .ui-disabled { opacity: .3; } - @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } - .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } - +.ui-select .ui-mini.ui-btn-icon-right .ui-icon { right: 7px; } /* labels */ label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } - /*listbox*/ -.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden; } +.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden !important; +/* This !important is required for iPad Safari specifically. See https://github.com/jquery/jquery-mobile/issues/2647 */ } .ui-select .ui-btn-text { text-overflow: ellipsis; } - .ui-selectmenu { position: absolute; padding: 0; z-index: 1100 !important; width: 80%; max-width: 350px; padding: 6px; } .ui-selectmenu .ui-listview { margin: 0; } .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } @@ -1741,23 +1943,26 @@ label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margi .ui-selectmenu-list .ui-li .ui-icon { display: block; } .ui-li.ui-selectmenu-placeholder { display: none; } .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } - @media all and (min-width: 450px){ .ui-field-contain label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain .ui-select { width: 60%; display: inline-block; } } - /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ -.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } -input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 97%; } -input.ui-input-text { -webkit-appearance: none; } +.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; } +label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } +input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 97%; outline: 0; } +.ui-header input.ui-input-text, +.ui-footer input.ui-input-text { margin-left: 1.25%; padding: .4em 1%; width: 95.5% } /* Note that padding left/right on text inputs is factored into how the element is displayed in Firefox, but does not actually pad the text inside it. */ + input.ui-input-text { -webkit-appearance: none; } textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } .ui-input-search { padding: 0 30px; background-image: none; position: relative; } .ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; } .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -13px; } +.ui-mini .ui-input-clear { right: -3px; } .ui-input-search .ui-input-clear-hidden { display: none; } - +input.ui-mini, .ui-mini input, textarea.ui-mini { font-size: 14px; } +textarea.ui-mini { height: 45px; } /* orientation adjustments - incomplete!*/ @media all and (min-width: 450px){ .ui-field-contain label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } @@ -1769,7 +1974,8 @@ textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; .ui-hide-label textarea.ui-input-text, .ui-hide-label .ui-input-search { padding: .4em; width: 97%; } .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } -}.ui-listview { margin: 0; counter-reset: listnumbering; } +} +.ui-listview { margin: 0; counter-reset: listnumbering; } .ui-content .ui-listview { margin: -15px; } .ui-content .ui-listview-inset { margin: 1em 0; } .ui-listview, .ui-li { list-style:none; padding:0; } @@ -1794,54 +2000,54 @@ ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid .ui-li-thumb, .ui-listview .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } .ui-listview .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } .ui-li-thumb, .ui-listview .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } - .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } @media all and (min-width: 480px){ .ui-li-aside { width: 45%; } } .ui-li-divider { cursor: default; } .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } -.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } +.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 48px; } .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } .ui-li-has-alt .ui-li-count { right: 55px; } .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; } .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; z-index: -1;} .ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;} .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } - .ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; } - .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } - .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } .ui-li.ui-screen-hidden{display:none;} /* Odd iPad positioning issue. */ @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { .ui-li .ui-btn-text { overflow: visible; } -}label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +} +label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } input.ui-slider-input, .ui-field-contain input.ui-slider-input { display: inline-block; width: 50px; } select.ui-slider-switch { display: none; } -div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 60%; } -div.ui-slider-switch { width: 99.8%; } -a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } -a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } -@media all and (min-width: 480px){ - .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } +div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 65%; } +div.ui-slider-mini { height: 12px; margin-left: 10px; } +div.ui-slider-bg { border: none; height: 100%; padding-right: 8px; } +.ui-controlgroup a.ui-slider-handle, a.ui-slider-handle { position: absolute; z-index: 1; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; outline: 0; } +a.ui-slider-handle .ui-btn-inner { padding: 0; height: 100%; } +div.ui-slider-mini a.ui-slider-handle { height: 14px; width: 14px; margin: -8px 0 0 -7px; } +div.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: -9px 0 0 -9px; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } .ui-field-contain div.ui-slider { width: 43%; } + .ui-field-contain div.ui-slider-switch { width: 5.5em; } } - -div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } -div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } -a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; } -div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } -div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } -div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } -.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } -.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } - -div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } -span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } -span.ui-slider-label-a { left: -100%; margin-right: -1px } -span.ui-slider-label-b { right: -100%; margin-left: -1px } +div.ui-slider-switch { height: 32px; margin-left: 0; width: 5.8em; } +a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; -moz-transition: left 70ms linear; } +div.ui-slider-switch .ui-slider-handle { margin-top: 1px; } +.ui-slider-inneroffset { margin: 0 16px; position: relative; z-index: 1; } +div.ui-slider-switch.ui-slider-mini { width: 5em; height: 29px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset { margin: 0 15px 0 14px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-handle { width: 25px; height: 25px; margin: 1px 0 0 -13px; } +div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: 0; } +span.ui-slider-label { position: absolute; text-align: center; width: 100%; overflow: hidden; font-size: 16px; top: 0; line-height: 2; min-height: 100%; border-width: 0; white-space: nowrap; } +.ui-slider-mini span.ui-slider-label { font-size: 14px; } +span.ui-slider-label-a { z-index: 1; left: 0; text-indent: -1.5em; } +span.ui-slider-label-b { z-index: 0; right: 0; text-indent: 1.5em;} +.ui-slider-inline { width: 120px; display: inline-block; } diff --git a/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js new file mode 100644 index 0000000..c12426c --- /dev/null +++ b/h-source/Public/Js/jquery/jquery.mobile-1.1.0.js @@ -0,0 +1,7551 @@ +/* +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 +* http://jquerymobile.com +* +* Copyright 2011 (c) jQuery Project +* Dual licensed under the MIT or GPL Version 2 licenses. +* http://jquery.org/license +* +*/ +(function ( root, doc, factory ) { + if ( typeof define === "function" && define.amd ) { + // AMD. Register as an anonymous module. + define( [ "jquery" ], function ( $ ) { + factory( $, root, doc ); + return $.mobile; + }); + } else { + // Browser globals + factory( root.jQuery, root, doc ); + } +}( this, document, function ( $, window, document, undefined ) { + + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], + mouseEventProps = $.event.props.concat( mouseHookProps ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j; + + event = $.Event(event); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 + // https://github.com/jquery/jquery-mobile/issues/3280 + if ( t.search( /^(mouse|click)/ ) > -1 ) { + props = mouseEventProps; + } + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ){ + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++){ + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout(function(){ + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ){ + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data(event.target, touchTargetPropertyName); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){ + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold; + didScroll = didScroll || + ( Math.abs(t.pageX - startX) > moveThreshold || + Math.abs(t.pageY - startY) > moveThreshold ), + flags = getVirtualBindingFlags( event.target ); + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler(){} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {}); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if (activeDocHandlers[ "touchstart" ] === 1) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ){ + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ){ + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); + + + +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and +// lowered its default value to 50. Added <jQuery.fn.hashchange.domain> +// and <jQuery.fn.hashchange.src> properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function($,window,undefined){ + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the <hashchange event> section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the <hashchange event> + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the <jQuery.fn.hashchange.src> property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in <jQuery.fn.hashchange>: + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function(){ + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function(val){ return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function(){ + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function(){ + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $('<iframe tabindex="-1" title="empty"/>').hide() + + // When Iframe has completely loaded, initialize the history and + // start polling. + .one( 'load', function(){ + iframe_src || history_set( get_fragment() ); + poll(); + }) + + // Load Iframe src if specified, otherwise nothing. + .attr( 'src', iframe_src || 'javascript:0' ) + + // Append Iframe after the end of the body to prevent unnecessary + // initial page scrolling (yes, this works). + .insertAfter( 'body' )[0].contentWindow; + + // Whenever `document.title` changes, update the Iframe's title to + // prettify the back/next history menu entries. Since IE sometimes + // errors with "Unspecified error" the very first time this is set + // (yes, very useful) wrap this with a try/catch block. + doc.onpropertychange = function(){ + try { + if ( event.propertyName === 'title' ) { + iframe.document.title = doc.title; + } + } catch(e) {} + }; + + } + }; + + // Override the "stop" method since an IE6/7 Iframe was created. Even + // if there are no longer any bound event handlers, the polling loop + // is still necessary for back/next to work at all! + self.stop = fn_retval; + + // Get history by looking at the hidden Iframe's location.hash. + history_get = function() { + return get_fragment( iframe.location.href ); + }; + + // Set a new history item by opening and then closing the Iframe + // document, *then* setting its location.hash. If document.domain has + // been set, update that as well. + history_set = function( hash, history_hash ) { + var iframe_doc = iframe.document, + domain = $.fn[ str_hashchange ].domain; + + if ( hash !== history_hash ) { + // Update Iframe with any initial `document.title` that might be set. + iframe_doc.title = doc.title; + + // Opening the Iframe's document after it has been closed is what + // actually adds a history entry. + iframe_doc.open(); + + // Set document.domain for the Iframe document as well, if necessary. + domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' ); + + iframe_doc.close(); + + // Update the Iframe's hash, for great justice. + iframe.location.hash = hash; + } + }; + + })(); + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + + return self; + })(); + +})(jQuery,this); + +/*! + * jQuery UI Widget @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ); + if ( !instance ) { + throw "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'"; + } + if ( !$.isFunction( instance[options] ) ) { + throw "no such method '" + options + "' for " + name + " widget instance"; + } + var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + var options = {}; + if ( $.metadata ) { + options = $.metadata.get( element )[ this.widgetName ]; + } + return options; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target, useKeepNative ) { + this.enhance( $( this.options.initSelector, $( target )), useKeepNative ); + }, + + enhance: function( targets, useKeepNative ) { + var page, keepNative, $widgetElements = $( targets ), self = this; + + // if ignoreContentEnabled is set to true the framework should + // only enhance the selected elements when they do NOT have a + // parent with the data-namespace-ignore attribute + $widgetElements = $.mobile.enhanceable( $widgetElements ); + + if ( useKeepNative && $widgetElements.length ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + page = $.mobile.closestPageData( $widgetElements ); + keepNative = (page && page.keepNativeSelector()) || ""; + + $widgetElements = $widgetElements.not( keepNative ); + } + + $widgetElements[ this.widgetName ](); + }, + + raise: function( msg ) { + throw "Widget [" + this.widgetName + "]: " + msg; + } +}); + +})( jQuery ); + +(function( $, window, undefined ) { + + var nsNormalizeDict = {}; + + // jQuery.mobile configurable options + $.mobile = $.extend( {}, { + + // Version of the jQuery Mobile Framework + version: "1.1.0", + + // Namespace used framework-wide for data-attrs. Default is no namespace + ns: "", + + // Define the url parameter used for referencing widget-generated sub-pages. + // Translates to to example.html&ui-page=subpageIdentifier + // hash segment before &ui-page= is used to make Ajax request + subPageUrlKey: "ui-page", + + // Class assigned to page currently in view, and during transitions + activePageClass: "ui-page-active", + + // Class used for "active" button state, from CSS framework + activeBtnClass: "ui-btn-active", + + // Class used for "focus" form element state, from CSS framework + focusClass: "ui-focus", + + // Automatically handle clicks and form submissions through Ajax, when same-domain + ajaxEnabled: true, + + // Automatically load and show pages based on location.hash + hashListeningEnabled: true, + + // disable to prevent jquery from bothering with links + linkBindingEnabled: true, + + // Set default page transition - 'none' for no transitions + defaultPageTransition: "fade", + + // Set maximum window width for transitions to apply - 'false' for no limit + maxTransitionWidth: false, + + // Minimum scroll distance that will be remembered when returning to a page + minScrollBack: 250, + + // DEPRECATED: the following property is no longer in use, but defined until 2.0 to prevent conflicts + touchOverflowEnabled: false, + + // Set default dialog transition - 'none' for no transitions + defaultDialogTransition: "pop", + + // Show loading message during Ajax requests + // if false, message will not appear, but loading classes will still be toggled on html el + loadingMessage: "loading", + + // Error response message - appears when an Ajax page request fails + pageLoadErrorMessage: "Error Loading Page", + + // Should the text be visble in the loading message? + loadingMessageTextVisible: false, + + // When the text is visible, what theme does the loading box use? + loadingMessageTheme: "a", + + // For error messages, which theme does the box uses? + pageLoadErrorMessageTheme: "e", + + //automatically initialize the DOM when it's ready + autoInitializePage: true, + + pushStateEnabled: true, + + // allows users to opt in to ignoring content by marking a parent element as + // data-ignored + ignoreContentEnabled: false, + + // turn of binding to the native orientationchange due to android orientation behavior + orientationChangeEnabled: true, + + buttonMarkup: { + hoverDelay: 200 + }, + + // TODO might be useful upstream in jquery itself ? + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + }, + + // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value + silentScroll: function( ypos ) { + if ( $.type( ypos ) !== "number" ) { + ypos = $.mobile.defaultHomeScroll; + } + + // prevent scrollstart and scrollstop events + $.event.special.scrollstart.enabled = false; + + setTimeout(function() { + window.scrollTo( 0, ypos ); + $( document ).trigger( "silentscroll", { x: 0, y: ypos }); + }, 20 ); + + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + + // Expose our cache for testing purposes. + nsNormalizeDict: nsNormalizeDict, + + // Take a data attribute property, prepend the namespace + // and then camel case the attribute string. Add the result + // to our nsNormalizeDict so we don't have to do this again. + nsNormalize: function( prop ) { + if ( !prop ) { + return; + } + + return nsNormalizeDict[ prop ] || ( nsNormalizeDict[ prop ] = $.camelCase( $.mobile.ns + prop ) ); + }, + + getInheritedTheme: function( el, defaultTheme ) { + + // Find the closest parent with a theme class on it. Note that + // we are not using $.fn.closest() on purpose here because this + // method gets called quite a bit and we need it to be as fast + // as possible. + + var e = el[ 0 ], + ltr = "", + re = /ui-(bar|body|overlay)-([a-z])\b/, + c, m; + + while ( e ) { + var c = e.className || ""; + if ( ( m = re.exec( c ) ) && ( ltr = m[ 2 ] ) ) { + // We found a parent with a theme class + // on it so bail from this loop. + break; + } + e = e.parentNode; + } + + // Return the theme letter we found, if none, return the + // specified default. + + return ltr || defaultTheme || "a"; + }, + + // TODO the following $ and $.fn extensions can/probably should be moved into jquery.mobile.core.helpers + // + // Find the closest javascript page element to gather settings data jsperf test + // http://jsperf.com/single-complex-selector-vs-many-complex-selectors/edit + // possibly naive, but it shows that the parsing overhead for *just* the page selector vs + // the page and dialog selector is negligable. This could probably be speed up by + // doing a similar parent node traversal to the one found in the inherited theme code above + closestPageData: function( $target ) { + return $target + .closest(':jqmData(role="page"), :jqmData(role="dialog")') + .data("page"); + }, + + enhanceable: function( $set ) { + return this.haveParents( $set, "enhance" ); + }, + + hijackable: function( $set ) { + return this.haveParents( $set, "ajax" ); + }, + + haveParents: function( $set, attr ) { + if( !$.mobile.ignoreContentEnabled ){ + return $set; + } + + var count = $set.length, + $newSet = $(), + e, $element, excluded; + + for ( var i = 0; i < count; i++ ) { + $element = $set.eq( i ); + excluded = false; + e = $set[ i ]; + + while ( e ) { + var c = e.getAttribute ? e.getAttribute( "data-" + $.mobile.ns + attr ) : ""; + + if ( c === "false" ) { + excluded = true; + break; + } + + e = e.parentNode; + } + + if ( !excluded ) { + $newSet = $newSet.add( $element ); + } + } + + return $newSet; + } + }, $.mobile ); + + // Mobile version of data and removeData and hasData methods + // ensures all data is set and retrieved using jQuery Mobile's data namespace + $.fn.jqmData = function( prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + if ( prop ) { + prop = $.mobile.nsNormalize( prop ); + } + result = this.data.apply( this, arguments.length < 2 ? [ prop ] : [ prop, value ] ); + } + return result; + }; + + $.jqmData = function( elem, prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + result = $.data( elem, prop ? $.mobile.nsNormalize( prop ) : prop, value ); + } + return result; + }; + + $.fn.jqmRemoveData = function( prop ) { + return this.removeData( $.mobile.nsNormalize( prop ) ); + }; + + $.jqmRemoveData = function( elem, prop ) { + return $.removeData( elem, $.mobile.nsNormalize( prop ) ); + }; + + $.fn.removeWithDependents = function() { + $.removeWithDependents( this ); + }; + + $.removeWithDependents = function( elem ) { + var $elem = $( elem ); + + ( $elem.jqmData('dependents') || $() ).remove(); + $elem.remove(); + }; + + $.fn.addDependents = function( newDependents ) { + $.addDependents( $(this), newDependents ); + }; + + $.addDependents = function( elem, newDependents ) { + var dependents = $(elem).jqmData( 'dependents' ) || $(); + + $(elem).jqmData( 'dependents', $.merge(dependents, newDependents) ); + }; + + // note that this helper doesn't attempt to handle the callback + // or setting of an html elements text, its only purpose is + // to return the html encoded version of the text in all cases. (thus the name) + $.fn.getEncodedText = function() { + return $( "<div/>" ).text( $(this).text() ).html(); + }; + + // fluent helper function for the mobile namespaced equivalent + $.fn.jqmEnhanceable = function() { + return $.mobile.enhanceable( this ); + }; + + $.fn.jqmHijackable = function() { + return $.mobile.hijackable( this ); + }; + + // Monkey-patching Sizzle to filter the :jqmData selector + var oldFind = $.find, + jqmDataRE = /:jqmData\(([^)]*)\)/g; + + $.find = function( selector, context, ret, extra ) { + selector = selector.replace( jqmDataRE, "[data-" + ( $.mobile.ns || "" ) + "$1]" ); + + return oldFind.call( this, selector, context, ret, extra ); + }; + + $.extend( $.find, oldFind ); + + $.find.matches = function( expr, set ) { + return $.find( expr, null, null, set ); + }; + + $.find.matchesSelector = function( node, expr ) { + return $.find( expr, null, null, [ node ] ).length > 0; + }; +})( jQuery, this ); + + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') // tests for screen media type + $.mobile.media('screen and (min-width: 480px)') // tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') // tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "<div id='jquery-mediatest'>" ), + fakeBody = $( "<body>" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ){ + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); + +(function( $, undefined ) { + +var fakeBody = $( "<body>" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ){ + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +function validStyle( prop, value, check_vend ) { + var div = document.createElement('div'), + uc = function( txt ) { + return txt.charAt( 0 ).toUpperCase() + txt.substr( 1 ) + }, + vend_pref = function( vend ) { + return "-" + vend.charAt( 0 ).toLowerCase() + vend.substr( 1 ) + "-"; + }, + check_style = function( vend ) { + var vend_prop = vend_pref( vend ) + prop + ": " + value + ";", + uc_vend = uc( vend ), + propStyle = uc_vend + uc( prop ); + + div.setAttribute( "style", vend_prop ); + + if( !!div.style[ propStyle ] ) { + ret = true; + } + }, + check_vends = check_vend ? [ check_vend ] : vendors, + ret; + + for( i = 0; i < check_vends.length; i++ ) { + check_style( check_vends[i] ); + } + return !!ret; +} + +// Thanks to Modernizr src for this test idea. `perspective` check is limited to Moz to prevent a false positive for 3D transforms on Android. +function transform3dTest() { + var prop = "transform-3d"; + return validStyle( 'perspective', '10px', 'moz' ) || $.mobile.media( "(-" + vendors.join( "-" + prop + "),(-" ) + "-" + prop + "),(" + prop + ")" ); +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "<base>", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "<a href='testurl' />" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.extend( $.mobile, { browser: {} } ); +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + // added {} to silence closure compiler warnings. registering my dislike of all things + // overly clever here for future reference + while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ){}; + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window, + touch: "ontouchend" in document, + cssTransitions: "WebKitTransitionEvent" in window || validStyle( 'transition', 'height 100ms linear' ), + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + cssTransform3d: transform3dTest(), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function(){ + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +// Support conditions that must be met in order to proceed +// default enhanced qualifications are media query support OR IE 7+ +$.mobile.gradeA = function(){ + return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7; +}; + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); + +(function( $, window, undefined ) { + +// add new event shortcuts +$.each( ( "touchstart touchmove touchend orientationchange throttledresize " + + "tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + $.attrFn[ name ] = true; +}); + +var supportTouch = $.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + +function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; +} + +// also handles scrollstop +$.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout(function() { + trigger( event, false ); + }, 50 ); + }); + } +}; + +// also handles taphold +$.event.special.tap = { + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ); + $( document ).unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler(event) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget == event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + $( document ).bind( "vmousecancel", clearTapHandlers ); + + timer = setTimeout(function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); + }, 750 ); + }); + } +}; + +// also handles swipeleft, swiperight +$.event.special.swipe = { + scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } +}; + +(function( $, window ) { + // "Cowboy" Ben Alman + + var win = $( window ), + special_event, + get_orientation, + last_orientation, + initial_orientation_is_landscape, + initial_orientation_is_default, + portrait_map = { "0": true, "180": true }; + + // It seems that some device/browser vendors use window.orientation values 0 and 180 to + // denote the "default" orientation. For iOS devices, and most other smart-phones tested, + // the default orientation is always "portrait", but in some Android and RIM based tablets, + // the default orientation is "landscape". The following code attempts to use the window + // dimensions to figure out what the current orientation is, and then makes adjustments + // to the to the portrait_map if necessary, so that we can properly decode the + // window.orientation value whenever get_orientation() is called. + // + // Note that we used to use a media query to figure out what the orientation the browser + // thinks it is in: + // + // initial_orientation_is_landscape = $.mobile.media("all and (orientation: landscape)"); + // + // but there was an iPhone/iPod Touch bug beginning with iOS 4.2, up through iOS 5.1, + // where the browser *ALWAYS* applied the landscape media query. This bug does not + // happen on iPad. + + if ( $.support.orientation ) { + + // Check the window width and height to figure out what the current orientation + // of the device is at this moment. Note that we've initialized the portrait map + // values to 0 and 180, *AND* we purposely check for landscape so that if we guess + // wrong, , we default to the assumption that portrait is the default orientation. + // We use a threshold check below because on some platforms like iOS, the iPhone + // form-factor can report a larger width than height if the user turns on the + // developer console. The actual threshold value is somewhat arbitrary, we just + // need to make sure it is large enough to exclude the developer console case. + + var ww = window.innerWidth || $( window ).width(), + wh = window.innerHeight || $( window ).height(), + landscape_threshold = 50; + + initial_orientation_is_landscape = ww > wh && ( ww - wh ) > landscape_threshold; + + + // Now check to see if the current window.orientation is 0 or 180. + initial_orientation_is_default = portrait_map[ window.orientation ]; + + // If the initial orientation is landscape, but window.orientation reports 0 or 180, *OR* + // if the initial orientation is portrait, but window.orientation reports 90 or -90, we + // need to flip our portrait_map values because landscape is the default orientation for + // this device/browser. + if ( ( initial_orientation_is_landscape && initial_orientation_is_default ) || ( !initial_orientation_is_landscape && !initial_orientation_is_default ) ) { + portrait_map = { "-90": true, "90": true }; + } + } + + $.event.special.orientationchange = special_event = { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function(){ + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }; + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( "orientationchange" ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = portrait_map[ window.orientation ]; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + +})( jQuery, window ); + + +// throttled resize event +(function() { + + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function(){ + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; +})(); + + +$.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" +}, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.widget( "mobile.page", $.mobile.widget, { + options: { + theme: "c", + domCache: false, + keepNativeDefault: ":jqmData(role='none'), :jqmData(role='nojs')" + }, + + _create: function() { + + var self = this; + + // if false is returned by the callbacks do not create the page + if( self._trigger( "beforecreate" ) === false ){ + return false; + } + + self.element + .attr( "tabindex", "0" ) + .addClass( "ui-page ui-body-" + self.options.theme ) + .bind( "pagebeforehide", function(){ + self.removeContainerBackground(); + } ) + .bind( "pagebeforeshow", function(){ + self.setContainerBackground(); + } ); + + }, + + removeContainerBackground: function(){ + $.mobile.pageContainer.removeClass( "ui-overlay-" + $.mobile.getInheritedTheme( this.element.parent() ) ); + }, + + // set the page container background to the page theme + setContainerBackground: function( theme ){ + if( this.options.theme ){ + $.mobile.pageContainer.addClass( "ui-overlay-" + ( theme || this.options.theme ) ); + } + }, + + keepNativeSelector: function() { + var options = this.options, + keepNativeDefined = options.keepNative && $.trim(options.keepNative); + + if( keepNativeDefined && options.keepNative !== options.keepNativeDefault ){ + return [options.keepNative, options.keepNativeDefault].join(", "); + } + + return options.keepNativeDefault; + } +}); +})( jQuery ); + + +(function( $, window, undefined ) { + +var createHandler = function( sequential ){ + + // Default to sequential + if( sequential === undefined ){ + sequential = true; + } + + return function( name, reverse, $to, $from ) { + + var deferred = new $.Deferred(), + reverseClass = reverse ? " reverse" : "", + active = $.mobile.urlHistory.getActive(), + toScroll = active.lastScroll || $.mobile.defaultHomeScroll, + screenHeight = $.mobile.getScreenHeight(), + maxTransitionOverride = $.mobile.maxTransitionWidth !== false && $( window ).width() > $.mobile.maxTransitionWidth, + none = !$.support.cssTransitions || maxTransitionOverride || !name || name === "none", + toggleViewportClass = function(){ + $.mobile.pageContainer.toggleClass( "ui-mobile-viewport-transitioning viewport-" + name ); + }, + scrollPage = function(){ + // By using scrollTo instead of silentScroll, we can keep things better in order + // Just to be precautios, disable scrollstart listening like silentScroll would + $.event.special.scrollstart.enabled = false; + + window.scrollTo( 0, toScroll ); + + // reenable scrollstart listening like silentScroll would + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + cleanFrom = function(){ + $from + .removeClass( $.mobile.activePageClass + " out in reverse " + name ) + .height( "" ); + }, + startOut = function(){ + // if it's not sequential, call the doneOut transition to start the TO page animating in simultaneously + if( !sequential ){ + doneOut(); + } + else { + $from.animationComplete( doneOut ); + } + + // Set the from page's height and start it transitioning out + // Note: setting an explicit height helps eliminate tiling in the transitions + $from + .height( screenHeight + $(window ).scrollTop() ) + .addClass( name + " out" + reverseClass ); + }, + + doneOut = function() { + + if ( $from && sequential ) { + cleanFrom(); + } + + startIn(); + }, + + startIn = function(){ + + $to.addClass( $.mobile.activePageClass ); + + // Send focus to page as it is now display: block + $.mobile.focusPage( $to ); + + // Set to page height + $to.height( screenHeight + toScroll ); + + scrollPage(); + + if( !none ){ + $to.animationComplete( doneIn ); + } + + $to.addClass( name + " in" + reverseClass ); + + if( none ){ + doneIn(); + } + + }, + + doneIn = function() { + + if ( !sequential ) { + + if( $from ){ + cleanFrom(); + } + } + + $to + .removeClass( "out in reverse " + name ) + .height( "" ); + + toggleViewportClass(); + + // In some browsers (iOS5), 3D transitions block the ability to scroll to the desired location during transition + // This ensures we jump to that spot after the fact, if we aren't there already. + if( $( window ).scrollTop() !== toScroll ){ + scrollPage(); + } + + deferred.resolve( name, reverse, $to, $from, true ); + }; + + toggleViewportClass(); + + if ( $from && !none ) { + startOut(); + } + else { + doneOut(); + } + + return deferred.promise(); + }; +} + +// generate the handlers from the above +var sequentialHandler = createHandler(), + simultaneousHandler = createHandler( false ); + +// Make our transition handler the public default. +$.mobile.defaultTransitionHandler = sequentialHandler; + +//transition handler dictionary for 3rd party transitions +$.mobile.transitionHandlers = { + "default": $.mobile.defaultTransitionHandler, + "sequential": sequentialHandler, + "simultaneous": simultaneousHandler +}; + +$.mobile.transitionFallbacks = {}; + +})( jQuery, this ); + +( function( $, undefined ) { + + //define vars for interal use + var $window = $( window ), + $html = $( 'html' ), + $head = $( 'head' ), + + //url path helpers for use in relative url management + path = { + + // This scary looking regular expression parses an absolute URL or its relative + // variants (protocol, site, document, query, and hash), into the various + // components (protocol, host, path, query, fragment, etc that make up the + // URL as well as some other commonly used sub-parts. When used with RegExp.exec() + // or String.match, it parses the URL into a results array that looks like this: + // + // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content + // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread + // [2]: http://jblas:password@mycompany.com:8080/mail/inbox + // [3]: http://jblas:password@mycompany.com:8080 + // [4]: http: + // [5]: // + // [6]: jblas:password@mycompany.com:8080 + // [7]: jblas:password + // [8]: jblas + // [9]: password + // [10]: mycompany.com:8080 + // [11]: mycompany.com + // [12]: 8080 + // [13]: /mail/inbox + // [14]: /mail/ + // [15]: inbox + // [16]: ?msg=1234&type=unread + // [17]: #msg-content + // + urlParseRE: /^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/, + + //Parse a URL into a structure that allows easy access to + //all of the URL components by name. + parseUrl: function( url ) { + // If we're passed an object, we'll assume that it is + // a parsed url object and just return it back to the caller. + if ( $.type( url ) === "object" ) { + return url; + } + + var matches = path.urlParseRE.exec( url || "" ) || []; + + // Create an object that allows the caller to access the sub-matches + // by name. Note that IE returns an empty string instead of undefined, + // like all other browsers do, so we normalize everything so its consistent + // no matter what browser we're running on. + return { + href: matches[ 0 ] || "", + hrefNoHash: matches[ 1 ] || "", + hrefNoSearch: matches[ 2 ] || "", + domain: matches[ 3 ] || "", + protocol: matches[ 4 ] || "", + doubleSlash: matches[ 5 ] || "", + authority: matches[ 6 ] || "", + username: matches[ 8 ] || "", + password: matches[ 9 ] || "", + host: matches[ 10 ] || "", + hostname: matches[ 11 ] || "", + port: matches[ 12 ] || "", + pathname: matches[ 13 ] || "", + directory: matches[ 14 ] || "", + filename: matches[ 15 ] || "", + search: matches[ 16 ] || "", + hash: matches[ 17 ] || "" + }; + }, + + //Turn relPath into an asbolute path. absPath is + //an optional absolute path which describes what + //relPath is relative to. + makePathAbsolute: function( relPath, absPath ) { + if ( relPath && relPath.charAt( 0 ) === "/" ) { + return relPath; + } + + relPath = relPath || ""; + absPath = absPath ? absPath.replace( /^\/|(\/[^\/]*|[^\/]+)$/g, "" ) : ""; + + var absStack = absPath ? absPath.split( "/" ) : [], + relStack = relPath.split( "/" ); + for ( var i = 0; i < relStack.length; i++ ) { + var d = relStack[ i ]; + switch ( d ) { + case ".": + break; + case "..": + if ( absStack.length ) { + absStack.pop(); + } + break; + default: + absStack.push( d ); + break; + } + } + return "/" + absStack.join( "/" ); + }, + + //Returns true if both urls have the same domain. + isSameDomain: function( absUrl1, absUrl2 ) { + return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain; + }, + + //Returns true for any relative variant. + isRelativeUrl: function( url ) { + // All relative Url variants have one thing in common, no protocol. + return path.parseUrl( url ).protocol === ""; + }, + + //Returns true for an absolute url. + isAbsoluteUrl: function( url ) { + return path.parseUrl( url ).protocol !== ""; + }, + + //Turn the specified realtive URL into an absolute one. This function + //can handle all relative variants (protocol, site, document, query, fragment). + makeUrlAbsolute: function( relUrl, absUrl ) { + if ( !path.isRelativeUrl( relUrl ) ) { + return relUrl; + } + + var relObj = path.parseUrl( relUrl ), + absObj = path.parseUrl( absUrl ), + protocol = relObj.protocol || absObj.protocol, + doubleSlash = relObj.protocol ? relObj.doubleSlash : ( relObj.doubleSlash || absObj.doubleSlash ), + authority = relObj.authority || absObj.authority, + hasPath = relObj.pathname !== "", + pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ), + search = relObj.search || ( !hasPath && absObj.search ) || "", + hash = relObj.hash; + + return protocol + doubleSlash + authority + pathname + search + hash; + }, + + //Add search (aka query) params to the specified url. + addSearchParams: function( url, params ) { + var u = path.parseUrl( url ), + p = ( typeof params === "object" ) ? $.param( params ) : params, + s = u.search || "?"; + return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" ); + }, + + convertUrlToDataUrl: function( absUrl ) { + var u = path.parseUrl( absUrl ); + if ( path.isEmbeddedPage( u ) ) { + // For embedded pages, remove the dialog hash key as in getFilePath(), + // otherwise the Data Url won't match the id of the embedded Page. + return u.hash.split( dialogHashKey )[0].replace( /^#/, "" ); + } else if ( path.isSameDomain( u, documentBase ) ) { + return u.hrefNoHash.replace( documentBase.domain, "" ); + } + return absUrl; + }, + + //get path from current hash, or from a file path + get: function( newPath ) { + if( newPath === undefined ) { + newPath = location.hash; + } + return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' ); + }, + + //return the substring of a filepath before the sub-page key, for making a server request + getFilePath: function( path ) { + var splitkey = '&' + $.mobile.subPageUrlKey; + return path && path.split( splitkey )[0].split( dialogHashKey )[0]; + }, + + //set location hash to path + set: function( path ) { + location.hash = path; + }, + + //test if a given url (string) is a path + //NOTE might be exceptionally naive + isPath: function( url ) { + return ( /\// ).test( url ); + }, + + //return a url path with the window's location protocol/hostname/pathname removed + clean: function( url ) { + return url.replace( documentBase.domain, "" ); + }, + + //just return the url without an initial # + stripHash: function( url ) { + return url.replace( /^#/, "" ); + }, + + //remove the preceding hash, any query params, and dialog notations + cleanHash: function( hash ) { + return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) ); + }, + + //check whether a url is referencing the same domain, or an external domain or different protocol + //could be mailto, etc + isExternal: function( url ) { + var u = path.parseUrl( url ); + return u.protocol && u.domain !== documentUrl.domain ? true : false; + }, + + hasProtocol: function( url ) { + return ( /^(:?\w+:)/ ).test( url ); + }, + + //check if the specified url refers to the first page in the main application document. + isFirstPageUrl: function( url ) { + // We only deal with absolute paths. + var u = path.parseUrl( path.makeUrlAbsolute( url, documentBase ) ), + + // Does the url have the same path as the document? + samePath = u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ), + + // Get the first page element. + fp = $.mobile.firstPage, + + // Get the id of the first page element if it has one. + fpId = fp && fp[0] ? fp[0].id : undefined; + + // The url refers to the first page if the path matches the document and + // it either has no hash value, or the hash is exactly equal to the id of the + // first page element. + return samePath && ( !u.hash || u.hash === "#" || ( fpId && u.hash.replace( /^#/, "" ) === fpId ) ); + }, + + isEmbeddedPage: function( url ) { + var u = path.parseUrl( url ); + + //if the path is absolute, then we need to compare the url against + //both the documentUrl and the documentBase. The main reason for this + //is that links embedded within external documents will refer to the + //application document, whereas links embedded within the application + //document will be resolved against the document base. + if ( u.protocol !== "" ) { + return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) ); + } + return (/^#/).test( u.href ); + } + }, + + //will be defined when a link is clicked and given an active class + $activeClickedLink = null, + + //urlHistory is purely here to make guesses at whether the back or forward button was clicked + //and provide an appropriate transition + urlHistory = { + // Array of pages that are visited during a single page load. + // Each has a url and optional transition, title, and pageUrl (which represents the file path, in cases where URL is obscured, such as dialogs) + stack: [], + + //maintain an index number for the active page in the stack + activeIndex: 0, + + //get active + getActive: function() { + return urlHistory.stack[ urlHistory.activeIndex ]; + }, + + getPrev: function() { + return urlHistory.stack[ urlHistory.activeIndex - 1 ]; + }, + + getNext: function() { + return urlHistory.stack[ urlHistory.activeIndex + 1 ]; + }, + + // addNew is used whenever a new page is added + addNew: function( url, transition, title, pageUrl, role ) { + //if there's forward history, wipe it + if( urlHistory.getNext() ) { + urlHistory.clearForward(); + } + + urlHistory.stack.push( {url : url, transition: transition, title: title, pageUrl: pageUrl, role: role } ); + + urlHistory.activeIndex = urlHistory.stack.length - 1; + }, + + //wipe urls ahead of active index + clearForward: function() { + urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 ); + }, + + directHashChange: function( opts ) { + var back , forward, newActiveIndex, prev = this.getActive(); + + // check if url isp in history and if it's ahead or behind current page + $.each( urlHistory.stack, function( i, historyEntry ) { + + //if the url is in the stack, it's a forward or a back + if( opts.currentUrl === historyEntry.url ) { + //define back and forward by whether url is older or newer than current page + back = i < urlHistory.activeIndex; + forward = !back; + newActiveIndex = i; + } + }); + + // save new page index, null check to prevent falsey 0 result + this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex; + + if( back ) { + ( opts.either || opts.isBack )( true ); + } else if( forward ) { + ( opts.either || opts.isForward )( false ); + } + }, + + //disable hashchange event listener internally to ignore one change + //toggled internally when location.hash is updated to match the url of a successful page load + ignoreNextHashChange: false + }, + + //define first selector to receive focus when a page is shown + focusable = "[tabindex],a,button:visible,select:visible,input", + + //queue to hold simultanious page transitions + pageTransitionQueue = [], + + //indicates whether or not page is in process of transitioning + isPageTransitioning = false, + + //nonsense hash change key for dialogs, so they create a history entry + dialogHashKey = "&ui-state=dialog", + + //existing base tag? + $base = $head.children( "base" ), + + //tuck away the original document URL minus any fragment. + documentUrl = path.parseUrl( location.href ), + + //if the document has an embedded base tag, documentBase is set to its + //initial value. If a base tag does not exist, then we default to the documentUrl. + documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl, + + //cache the comparison once. + documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash ); + + //base element management, defined depending on dynamic base tag support + var base = $.support.dynamicBaseTag ? { + + //define base element, for use in routing asset urls that are referenced in Ajax-requested markup + element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ), + + //set the generated BASE element's href attribute to a new page's base path + set: function( href ) { + base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) ); + }, + + //set the generated BASE element's href attribute to a new page's base path + reset: function() { + base.element.attr( "href", documentBase.hrefNoHash ); + } + + } : undefined; + +/* + internal utility functions +--------------------------------------*/ + + + //direct focus to the page title, or otherwise first focusable element + $.mobile.focusPage = function ( page ) { + var autofocus = page.find("[autofocus]"), + pageTitle = page.find( ".ui-title:eq(0)" ); + + if( autofocus.length ) { + autofocus.focus(); + return; + } + + if( pageTitle.length ) { + pageTitle.focus(); + } + else{ + page.focus(); + } + } + + //remove active classes after page transition or error + function removeActiveLinkClass( forceRemoval ) { + if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) { + $activeClickedLink.removeClass( $.mobile.activeBtnClass ); + } + $activeClickedLink = null; + } + + function releasePageTransitionLock() { + isPageTransitioning = false; + if( pageTransitionQueue.length > 0 ) { + $.mobile.changePage.apply( null, pageTransitionQueue.pop() ); + } + } + + // Save the last scroll distance per page, before it is hidden + var setLastScrollEnabled = true, + setLastScroll, delayedSetLastScroll; + + setLastScroll = function() { + // this barrier prevents setting the scroll value based on the browser + // scrolling the window based on a hashchange + if( !setLastScrollEnabled ) { + return; + } + + var active = $.mobile.urlHistory.getActive(); + + if( active ) { + var lastScroll = $window.scrollTop(); + + // Set active page's lastScroll prop. + // If the location we're scrolling to is less than minScrollBack, let it go. + active.lastScroll = lastScroll < $.mobile.minScrollBack ? $.mobile.defaultHomeScroll : lastScroll; + } + }; + + // bind to scrollstop to gather scroll position. The delay allows for the hashchange + // event to fire and disable scroll recording in the case where the browser scrolls + // to the hash targets location (sometimes the top of the page). once pagechange fires + // getLastScroll is again permitted to operate + delayedSetLastScroll = function() { + setTimeout( setLastScroll, 100 ); + }; + + // disable an scroll setting when a hashchange has been fired, this only works + // because the recording of the scroll position is delayed for 100ms after + // the browser might have changed the position because of the hashchange + $window.bind( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = false; + }); + + // handle initial hashchange from chrome :( + $window.one( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = true; + }); + + // wait until the mobile page container has been determined to bind to pagechange + $window.one( "pagecontainercreate", function(){ + // once the page has changed, re-enable the scroll recording + $.mobile.pageContainer.bind( "pagechange", function() { + + setLastScrollEnabled = true; + + // remove any binding that previously existed on the get scroll + // which may or may not be different than the scroll element determined for + // this page previously + $window.unbind( "scrollstop", delayedSetLastScroll ); + + // determine and bind to the current scoll element which may be the window + // or in the case of touch overflow the element with touch overflow + $window.bind( "scrollstop", delayedSetLastScroll ); + }); + }); + + // bind to scrollstop for the first page as "pagechange" won't be fired in that case + $window.bind( "scrollstop", delayedSetLastScroll ); + + //function for transitioning between two existing pages + function transitionPages( toPage, fromPage, transition, reverse ) { + + if( fromPage ) { + //trigger before show/hide events + fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } ); + } + + toPage.data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } ); + + //clear page loader + $.mobile.hidePageLoadingMsg(); + + // If transition is defined, check if css 3D transforms are supported, and if not, if a fallback is specified + if( transition && !$.support.cssTransform3d && $.mobile.transitionFallbacks[ transition ] ){ + transition = $.mobile.transitionFallbacks[ transition ]; + } + + //find the transition handler for the specified transition. If there + //isn't one in our transitionHandlers dictionary, use the default one. + //call the handler immediately to kick-off the transition. + var th = $.mobile.transitionHandlers[ transition || "default" ] || $.mobile.defaultTransitionHandler, + promise = th( transition, reverse, toPage, fromPage ); + + promise.done(function() { + + //trigger show/hide events + if( fromPage ) { + fromPage.data( "page" )._trigger( "hide", null, { nextPage: toPage } ); + } + + //trigger pageshow, define prevPage as either fromPage or empty jQuery obj + toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } ); + }); + + return promise; + } + + //simply set the active page's minimum height to screen height, depending on orientation + function getScreenHeight(){ + // Native innerHeight returns more accurate value for this across platforms, + // jQuery version is here as a normalized fallback for platforms like Symbian + return window.innerHeight || $( window ).height(); + } + + $.mobile.getScreenHeight = getScreenHeight; + + //simply set the active page's minimum height to screen height, depending on orientation + function resetActivePageHeight(){ + var aPage = $( "." + $.mobile.activePageClass ), + aPagePadT = parseFloat( aPage.css( "padding-top" ) ), + aPagePadB = parseFloat( aPage.css( "padding-bottom" ) ); + + aPage.css( "min-height", getScreenHeight() - aPagePadT - aPagePadB ); + } + + //shared page enhancements + function enhancePage( $page, role ) { + // If a role was specified, make sure the data-role attribute + // on the page element is in sync. + if( role ) { + $page.attr( "data-" + $.mobile.ns + "role", role ); + } + + //run page plugin + $page.page(); + } + +/* exposed $.mobile methods */ + + //animation complete callback + $.fn.animationComplete = function( callback ) { + if( $.support.cssTransitions ) { + return $( this ).one( 'webkitAnimationEnd animationend', callback ); + } + else{ + // defer execution for consistency between webkit/non webkit + setTimeout( callback, 0 ); + return $( this ); + } + }; + + //expose path object on $.mobile + $.mobile.path = path; + + //expose base object on $.mobile + $.mobile.base = base; + + //history stack + $.mobile.urlHistory = urlHistory; + + $.mobile.dialogHashKey = dialogHashKey; + + + + //enable cross-domain page support + $.mobile.allowCrossDomainPages = false; + + //return the original document url + $.mobile.getDocumentUrl = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href; + }; + + //return the original document base url + $.mobile.getDocumentBase = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href; + }; + + $.mobile._bindPageRemove = function() { + var page = $(this); + + // when dom caching is not enabled or the page is embedded bind to remove the page on hide + if( !page.data("page").options.domCache + && page.is(":jqmData(external-page='true')") ) { + + page.bind( 'pagehide.remove', function() { + var $this = $( this ), + prEvent = new $.Event( "pageremove" ); + + $this.trigger( prEvent ); + + if( !prEvent.isDefaultPrevented() ){ + $this.removeWithDependents(); + } + }); + } + }; + + // Load a page into the DOM. + $.mobile.loadPage = function( url, options ) { + // This function uses deferred notifications to let callers + // know when the page is done loading, or if an error has occurred. + var deferred = $.Deferred(), + + // The default loadPage options with overrides specified by + // the caller. + settings = $.extend( {}, $.mobile.loadPage.defaults, options ), + + // The DOM element for the page after it has been loaded. + page = null, + + // If the reloadPage option is true, and the page is already + // in the DOM, dupCachedPage will be set to the page element + // so that it can be removed after the new version of the + // page is loaded off the network. + dupCachedPage = null, + + // determine the current base url + findBaseWithDefault = function(){ + var closestBase = ( $.mobile.activePage && getClosestBaseUrl( $.mobile.activePage ) ); + return closestBase || documentBase.hrefNoHash; + }, + + // The absolute version of the URL passed into the function. This + // version of the URL may contain dialog/subpage params in it. + absUrl = path.makeUrlAbsolute( url, findBaseWithDefault() ); + + + // If the caller provided data, and we're using "get" request, + // append the data to the URL. + if ( settings.data && settings.type === "get" ) { + absUrl = path.addSearchParams( absUrl, settings.data ); + settings.data = undefined; + } + + // If the caller is using a "post" request, reloadPage must be true + if( settings.data && settings.type === "post" ){ + settings.reloadPage = true; + } + + // The absolute version of the URL minus any dialog/subpage params. + // In otherwords the real URL of the page to be loaded. + var fileUrl = path.getFilePath( absUrl ), + + // The version of the Url actually stored in the data-url attribute of + // the page. For embedded pages, it is just the id of the page. For pages + // within the same domain as the document base, it is the site relative + // path. For cross-domain pages (Phone Gap only) the entire absolute Url + // used to load the page. + dataUrl = path.convertUrlToDataUrl( absUrl ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Check to see if the page already exists in the DOM. + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + + // If we failed to find the page, check to see if the url is a + // reference to an embedded page. If so, it may have been dynamically + // injected by a developer, in which case it would be lacking a data-url + // attribute and in need of enhancement. + if ( page.length === 0 && dataUrl && !path.isPath( dataUrl ) ) { + page = settings.pageContainer.children( "#" + dataUrl ) + .attr( "data-" + $.mobile.ns + "url", dataUrl ); + } + + // If we failed to find a page in the DOM, check the URL to see if it + // refers to the first page in the application. If it isn't a reference + // to the first page and refers to non-existent embedded page, error out. + if ( page.length === 0 ) { + if ( $.mobile.firstPage && path.isFirstPageUrl( fileUrl ) ) { + // Check to make sure our cached-first-page is actually + // in the DOM. Some user deployed apps are pruning the first + // page from the DOM for various reasons, we check for this + // case here because we don't want a first-page with an id + // falling through to the non-existent embedded page error + // case. If the first-page is not in the DOM, then we let + // things fall through to the ajax loading code below so + // that it gets reloaded. + if ( $.mobile.firstPage.parent().length ) { + page = $( $.mobile.firstPage ); + } + } else if ( path.isEmbeddedPage( fileUrl ) ) { + deferred.reject( absUrl, options ); + return deferred.promise(); + } + } + + // Reset base to the default document base. + if ( base ) { + base.reset(); + } + + // If the page we are interested in is already in the DOM, + // and the caller did not indicate that we should force a + // reload of the file, we are done. Otherwise, track the + // existing page as a duplicated. + if ( page.length ) { + if ( !settings.reloadPage ) { + enhancePage( page, settings.role ); + deferred.resolve( absUrl, options, page ); + return deferred.promise(); + } + dupCachedPage = page; + } + + var mpc = settings.pageContainer, + pblEvent = new $.Event( "pagebeforeload" ), + triggerData = { url: url, absUrl: absUrl, dataUrl: dataUrl, deferred: deferred, options: settings }; + + // Let listeners know we're about to load a page. + mpc.trigger( pblEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pblEvent.isDefaultPrevented() ){ + return deferred.promise(); + } + + if ( settings.showLoadMsg ) { + + // This configurable timeout allows cached pages a brief delay to load without showing a message + var loadMsgDelay = setTimeout(function(){ + $.mobile.showPageLoadingMsg(); + }, settings.loadMsgDelay ), + + // Shared logic for clearing timeout and removing message. + hideMsg = function(){ + + // Stop message show timer + clearTimeout( loadMsgDelay ); + + // Hide loading message + $.mobile.hidePageLoadingMsg(); + }; + } + + if ( !( $.mobile.allowCrossDomainPages || path.isSameDomain( documentUrl, absUrl ) ) ) { + deferred.reject( absUrl, options ); + } else { + // Load the new page. + $.ajax({ + url: fileUrl, + type: settings.type, + data: settings.data, + dataType: "html", + success: function( html, textStatus, xhr ) { + //pre-parse html to check for a data-url, + //use it as the new fileUrl, base path, etc + var all = $( "<div></div>" ), + + //page title regexp + newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1, + + // TODO handle dialogs again + pageElemRegex = new RegExp( "(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>)" ), + dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" ); + + + // data-url must be provided for the base tag so resource requests can be directed to the + // correct url. loading into a temprorary element makes these requests immediately + if( pageElemRegex.test( html ) + && RegExp.$1 + && dataUrlRegex.test( RegExp.$1 ) + && RegExp.$1 ) { + url = fileUrl = path.getFilePath( RegExp.$1 ); + } + + if ( base ) { + base.set( fileUrl ); + } + + //workaround to allow scripts to execute when included in page divs + all.get( 0 ).innerHTML = html; + page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first(); + + //if page elem couldn't be found, create one and insert the body element's contents + if( !page.length ){ + page = $( "<div data-" + $.mobile.ns + "role='page'>" + html.split( /<\/?body[^>]*>/gmi )[1] + "</div>" ); + } + + if ( newPageTitle && !page.jqmData( "title" ) ) { + if ( ~newPageTitle.indexOf( "&" ) ) { + newPageTitle = $( "<div>" + newPageTitle + "</div>" ).text(); + } + page.jqmData( "title", newPageTitle ); + } + + //rewrite src and href attrs to use a base url + if( !$.support.dynamicBaseTag ) { + var newPath = path.get( fileUrl ); + page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() { + var thisAttr = $( this ).is( '[href]' ) ? 'href' : + $(this).is('[src]') ? 'src' : 'action', + thisUrl = $( this ).attr( thisAttr ); + + // XXX_jblas: We need to fix this so that it removes the document + // base URL, and then prepends with the new page URL. + //if full path exists and is same, chop it - helps IE out + thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' ); + + if( !/^(\w+:|#|\/)/.test( thisUrl ) ) { + $( this ).attr( thisAttr, newPath + thisUrl ); + } + }); + } + + //append to page and enhance + // TODO taging a page with external to make sure that embedded pages aren't removed + // by the various page handling code is bad. Having page handling code in many + // places is bad. Solutions post 1.0 + page + .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) ) + .attr( "data-" + $.mobile.ns + "external-page", true ) + .appendTo( settings.pageContainer ); + + // wait for page creation to leverage options defined on widget + page.one( 'pagecreate', $.mobile._bindPageRemove ); + + enhancePage( page, settings.role ); + + // Enhancing the page may result in new dialogs/sub pages being inserted + // into the DOM. If the original absUrl refers to a sub-page, that is the + // real page we are interested in. + if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) { + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + } + + //bind pageHide to removePage after it's hidden, if the page options specify to do so + + // Remove loading message. + if ( settings.showLoadMsg ) { + hideMsg(); + } + + // Add the page reference and xhr to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.page = page; + + // Let listeners know the page loaded successfully. + settings.pageContainer.trigger( "pageload", triggerData ); + + deferred.resolve( absUrl, options, page, dupCachedPage ); + }, + error: function( xhr, textStatus, errorThrown ) { + //set base back to current path + if( base ) { + base.set( path.get() ); + } + + // Add error info to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.errorThrown = errorThrown; + + var plfEvent = new $.Event( "pageloadfailed" ); + + // Let listeners know the page load failed. + settings.pageContainer.trigger( plfEvent, triggerData ); + + // If the default behavior is prevented, stop here! + // Note that it is the responsibility of the listener/handler + // that called preventDefault(), to resolve/reject the + // deferred object within the triggerData. + if( plfEvent.isDefaultPrevented() ){ + return; + } + + // Remove loading message. + if ( settings.showLoadMsg ) { + + // Remove loading message. + hideMsg(); + + // show error message + $.mobile.showPageLoadingMsg( $.mobile.pageLoadErrorMessageTheme, $.mobile.pageLoadErrorMessage, true ); + + // hide after delay + setTimeout( $.mobile.hidePageLoadingMsg, 1500 ); + } + + deferred.reject( absUrl, options ); + } + }); + } + + return deferred.promise(); + }; + + $.mobile.loadPage.defaults = { + type: "get", + data: undefined, + reloadPage: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + showLoadMsg: false, + pageContainer: undefined, + loadMsgDelay: 50 // This delay allows loads that pull from browser cache to occur without showing the loading message. + }; + + // Show a specific page in the page container. + $.mobile.changePage = function( toPage, options ) { + // If we are in the midst of a transition, queue the current request. + // We'll call changePage() once we're done with the current transition to + // service the request. + if( isPageTransitioning ) { + pageTransitionQueue.unshift( arguments ); + return; + } + + var settings = $.extend( {}, $.mobile.changePage.defaults, options ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Make sure we have a fromPage. + settings.fromPage = settings.fromPage || $.mobile.activePage; + + var mpc = settings.pageContainer, + pbcEvent = new $.Event( "pagebeforechange" ), + triggerData = { toPage: toPage, options: settings }; + + // Let listeners know we're about to change the current page. + mpc.trigger( pbcEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pbcEvent.isDefaultPrevented() ){ + return; + } + + // We allow "pagebeforechange" observers to modify the toPage in the trigger + // data to allow for redirects. Make sure our toPage is updated. + + toPage = triggerData.toPage; + + // Set the isPageTransitioning flag to prevent any requests from + // entering this method while we are in the midst of loading a page + // or transitioning. + + isPageTransitioning = true; + + // If the caller passed us a url, call loadPage() + // to make sure it is loaded into the DOM. We'll listen + // to the promise object it returns so we know when + // it is done loading or if an error ocurred. + if ( typeof toPage == "string" ) { + $.mobile.loadPage( toPage, settings ) + .done(function( url, options, newPage, dupCachedPage ) { + isPageTransitioning = false; + options.duplicateCachedPage = dupCachedPage; + $.mobile.changePage( newPage, options ); + }) + .fail(function( url, options ) { + isPageTransitioning = false; + + //clear out the active button state + removeActiveLinkClass( true ); + + //release transition lock so navigation is free again + releasePageTransitionLock(); + settings.pageContainer.trigger( "pagechangefailed", triggerData ); + }); + return; + } + + // If we are going to the first-page of the application, we need to make + // sure settings.dataUrl is set to the application document url. This allows + // us to avoid generating a document url with an id hash in the case where the + // first-page of the document has an id attribute specified. + if ( toPage[ 0 ] === $.mobile.firstPage[ 0 ] && !settings.dataUrl ) { + settings.dataUrl = documentUrl.hrefNoHash; + } + + // The caller passed us a real page DOM element. Update our + // internal state and then trigger a transition to the page. + var fromPage = settings.fromPage, + url = ( settings.dataUrl && path.convertUrlToDataUrl( settings.dataUrl ) ) || toPage.jqmData( "url" ), + // The pageUrl var is usually the same as url, except when url is obscured as a dialog url. pageUrl always contains the file path + pageUrl = url, + fileUrl = path.getFilePath( url ), + active = urlHistory.getActive(), + activeIsInitialPage = urlHistory.activeIndex === 0, + historyDir = 0, + pageTitle = document.title, + isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog"; + + // By default, we prevent changePage requests when the fromPage and toPage + // are the same element, but folks that generate content manually/dynamically + // and reuse pages want to be able to transition to the same page. To allow + // this, they will need to change the default value of allowSamePageTransition + // to true, *OR*, pass it in as an option when they manually call changePage(). + // It should be noted that our default transition animations assume that the + // formPage and toPage are different elements, so they may behave unexpectedly. + // It is up to the developer that turns on the allowSamePageTransitiona option + // to either turn off transition animations, or make sure that an appropriate + // animation transition is used. + if( fromPage && fromPage[0] === toPage[0] && !settings.allowSamePageTransition ) { + isPageTransitioning = false; + mpc.trigger( "pagechange", triggerData ); + return; + } + + // We need to make sure the page we are given has already been enhanced. + enhancePage( toPage, settings.role ); + + // If the changePage request was sent from a hashChange event, check to see if the + // page is already within the urlHistory stack. If so, we'll assume the user hit + // the forward/back button and will try to match the transition accordingly. + if( settings.fromHashChange ) { + urlHistory.directHashChange({ + currentUrl: url, + isBack: function() { historyDir = -1; }, + isForward: function() { historyDir = 1; } + }); + } + + // Kill the keyboard. + // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead, + // we should be tracking focus with a delegate() handler so we already have + // the element in hand at this point. + // Wrap this in a try/catch block since IE9 throw "Unspecified error" if document.activeElement + // is undefined when we are in an IFrame. + try { + if(document.activeElement && document.activeElement.nodeName.toLowerCase() != 'body') { + $(document.activeElement).blur(); + } else { + $( "input:focus, textarea:focus, select:focus" ).blur(); + } + } catch(e) {} + + // If we're displaying the page as a dialog, we don't want the url + // for the dialog content to be used in the hash. Instead, we want + // to append the dialogHashKey to the url of the current page. + if ( isDialog && active ) { + // on the initial page load active.url is undefined and in that case should + // be an empty string. Moving the undefined -> empty string back into + // urlHistory.addNew seemed imprudent given undefined better represents + // the url state + url = ( active.url || "" ) + dialogHashKey; + } + + // Set the location hash. + if( settings.changeHash !== false && url ) { + //disable hash listening temporarily + urlHistory.ignoreNextHashChange = true; + //update hash and history + path.set( url ); + } + + // if title element wasn't found, try the page div data attr too + // If this is a deep-link or a reload ( active === undefined ) then just use pageTitle + var newPageTitle = ( !active )? pageTitle : toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).getEncodedText(); + if( !!newPageTitle && pageTitle == document.title ) { + pageTitle = newPageTitle; + } + if ( !toPage.jqmData( "title" ) ) { + toPage.jqmData( "title", pageTitle ); + } + + // Make sure we have a transition defined. + settings.transition = settings.transition + || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined ) + || ( isDialog ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition ); + + //add page to history stack if it's not back or forward + if( !historyDir ) { + urlHistory.addNew( url, settings.transition, pageTitle, pageUrl, settings.role ); + } + + //set page title + document.title = urlHistory.getActive().title; + + //set "toPage" as activePage + $.mobile.activePage = toPage; + + // If we're navigating back in the URL history, set reverse accordingly. + settings.reverse = settings.reverse || historyDir < 0; + + transitionPages( toPage, fromPage, settings.transition, settings.reverse ) + .done(function( name, reverse, $to, $from, alreadyFocused ) { + removeActiveLinkClass(); + + //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden + if ( settings.duplicateCachedPage ) { + settings.duplicateCachedPage.remove(); + } + + // Send focus to the newly shown page. Moved from promise .done binding in transitionPages + // itself to avoid ie bug that reports offsetWidth as > 0 (core check for visibility) + // despite visibility: hidden addresses issue #2965 + // https://github.com/jquery/jquery-mobile/issues/2965 + if( !alreadyFocused ){ + $.mobile.focusPage( toPage ); + } + + releasePageTransitionLock(); + + // Let listeners know we're all done changing the current page. + mpc.trigger( "pagechange", triggerData ); + }); + }; + + $.mobile.changePage.defaults = { + transition: undefined, + reverse: false, + changeHash: true, + fromHashChange: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + duplicateCachedPage: undefined, + pageContainer: undefined, + showLoadMsg: true, //loading message shows by default when pages are being fetched during changePage + dataUrl: undefined, + fromPage: undefined, + allowSamePageTransition: false + }; + +/* Event Bindings - hashchange, submit, and click */ + function findClosestLink( ele ) + { + while ( ele ) { + // Look for the closest element with a nodeName of "a". + // Note that we are checking if we have a valid nodeName + // before attempting to access it. This is because the + // node we get called with could have originated from within + // an embedded SVG document where some symbol instance elements + // don't have nodeName defined on them, or strings are of type + // SVGAnimatedString. + if ( ( typeof ele.nodeName === "string" ) && ele.nodeName.toLowerCase() == "a" ) { + break; + } + ele = ele.parentNode; + } + return ele; + } + + // The base URL for any given element depends on the page it resides in. + function getClosestBaseUrl( ele ) + { + // Find the closest page and extract out its url. + var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ), + base = documentBase.hrefNoHash; + + if ( !url || !path.isPath( url ) ) { + url = base; + } + + return path.makeUrlAbsolute( url, base); + } + + + //The following event bindings should be bound after mobileinit has been triggered + //the following function is called in the init file + $.mobile._registerInternalEvents = function(){ + + //bind to form submit events, handle with Ajax + $( document ).delegate( "form", "submit", function( event ) { + var $this = $( this ); + + if( !$.mobile.ajaxEnabled || + // test that the form is, itself, ajax false + $this.is(":jqmData(ajax='false')") || + // test that $.mobile.ignoreContentEnabled is set and + // the form or one of it's parents is ajax=false + !$this.jqmHijackable().length ) { + return; + } + + var type = $this.attr( "method" ), + target = $this.attr( "target" ), + url = $this.attr( "action" ); + + // If no action is specified, browsers default to using the + // URL of the document containing the form. Since we dynamically + // pull in pages from external documents, the form should submit + // to the URL for the source document of the page containing + // the form. + if ( !url ) { + // Get the @data-url for the page containing the form. + url = getClosestBaseUrl( $this ); + if ( url === documentBase.hrefNoHash ) { + // The url we got back matches the document base, + // which means the page must be an internal/embedded page, + // so default to using the actual document url as a browser + // would. + url = documentUrl.hrefNoSearch; + } + } + + url = path.makeUrlAbsolute( url, getClosestBaseUrl($this) ); + + //external submits use regular HTTP + if( path.isExternal( url ) || target ) { + return; + } + + $.mobile.changePage( + url, + { + type: type && type.length && type.toLowerCase() || "get", + data: $this.serialize(), + transition: $this.jqmData( "transition" ), + direction: $this.jqmData( "direction" ), + reloadPage: true + } + ); + event.preventDefault(); + }); + + //add active state on vclick + $( document ).bind( "vclick", function( event ) { + // if this isn't a left click we don't care. Its important to note + // that when the virtual event is generated it will create the which attr + if ( event.which > 1 || !$.mobile.linkBindingEnabled ) { + return; + } + + var link = findClosestLink( event.target ); + + // split from the previous return logic to avoid find closest where possible + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !$(link).jqmHijackable().length ) { + return; + } + + if ( link ) { + if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) { + removeActiveLinkClass( true ); + $activeClickedLink = $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ); + $activeClickedLink.addClass( $.mobile.activeBtnClass ); + $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur(); + + // By caching the href value to data and switching the href to a #, we can avoid address bar showing in iOS. The click handler resets the href during its initial steps if this data is present + $( link ) + .jqmData( "href", $( link ).attr( "href" ) ) + .attr( "href", "#" ); + } + } + }); + + // click routing - direct to HTTP or Ajax, accordingly + $( document ).bind( "click", function( event ) { + if( !$.mobile.linkBindingEnabled ){ + return; + } + + var link = findClosestLink( event.target ), $link = $( link ), httpCleanup; + + // If there is no link associated with the click or its not a left + // click we want to ignore the click + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !link || event.which > 1 || !$link.jqmHijackable().length ) { + return; + } + + //remove active link class if external (then it won't be there if you come back) + httpCleanup = function(){ + window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 ); + }; + + // If there's data cached for the real href value, set the link's href back to it again. This pairs with an address bar workaround from the vclick handler + if( $link.jqmData( "href" ) ){ + $link.attr( "href", $link.jqmData( "href" ) ); + } + + //if there's a data-rel=back attr, go back in history + if( $link.is( ":jqmData(rel='back')" ) ) { + window.history.back(); + return false; + } + + var baseUrl = getClosestBaseUrl( $link ), + + //get href, if defined, otherwise default to empty hash + href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl ); + + //if ajax is disabled, exit early + if( !$.mobile.ajaxEnabled && !path.isEmbeddedPage( href ) ){ + httpCleanup(); + //use default click handling + return; + } + + // XXX_jblas: Ideally links to application pages should be specified as + // an url to the application document with a hash that is either + // the site relative path or id to the page. But some of the + // internal code that dynamically generates sub-pages for nested + // lists and select dialogs, just write a hash in the link they + // create. This means the actual URL path is based on whatever + // the current value of the base tag is at the time this code + // is called. For now we are just assuming that any url with a + // hash in it is an application page reference. + if ( href.search( "#" ) != -1 ) { + href = href.replace( /[^#]*#/, "" ); + if ( !href ) { + //link was an empty hash meant purely + //for interaction, so we ignore it. + event.preventDefault(); + return; + } else if ( path.isPath( href ) ) { + //we have apath so make it the href we want to load. + href = path.makeUrlAbsolute( href, baseUrl ); + } else { + //we have a simple id so use the documentUrl as its base. + href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash ); + } + } + + // Should we handle this link, or let the browser deal with it? + var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ), + + // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR + // requests if the document doing the request was loaded via the file:// protocol. + // This is usually to allow the application to "phone home" and fetch app specific + // data. We normally let the browser handle external/cross-domain urls, but if the + // allowCrossDomainPages option is true, we will allow cross-domain http/https + // requests to go through our page loading logic. + isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ), + + //check for protocol or rel and its not an embedded page + //TODO overlap in logic from isExternal, rel=external check should be + // moved into more comprehensive isExternalLink + isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad ); + + if( isExternal ) { + httpCleanup(); + //use default click handling + return; + } + + //use ajax + var transition = $link.jqmData( "transition" ), + direction = $link.jqmData( "direction" ), + reverse = ( direction && direction === "reverse" ) || + // deprecated - remove by 1.0 + $link.jqmData( "back" ), + + //this may need to be more specific as we use data-rel more + role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined; + + $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } ); + event.preventDefault(); + }); + + //prefetch pages when anchors with data-prefetch are encountered + $( document ).delegate( ".ui-page", "pageshow.prefetch", function() { + var urls = []; + $( this ).find( "a:jqmData(prefetch)" ).each(function(){ + var $link = $(this), + url = $link.attr( "href" ); + + if ( url && $.inArray( url, urls ) === -1 ) { + urls.push( url ); + + $.mobile.loadPage( url, {role: $link.attr("data-" + $.mobile.ns + "rel")} ); + } + }); + }); + + $.mobile._handleHashChange = function( hash ) { + //find first page via hash + var to = path.stripHash( hash ), + //transition is false if it's the first page, undefined otherwise (and may be overridden by default) + transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined, + + // default options for the changPage calls made after examining the current state + // of the page and the hash + changePageOptions = { + transition: transition, + changeHash: false, + fromHashChange: true + }; + + //if listening is disabled (either globally or temporarily), or it's a dialog hash + if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) { + urlHistory.ignoreNextHashChange = false; + return; + } + + // special case for dialogs + if( urlHistory.stack.length > 1 && to.indexOf( dialogHashKey ) > -1 ) { + + // If current active page is not a dialog skip the dialog and continue + // in the same direction + if(!$.mobile.activePage.is( ".ui-dialog" )) { + //determine if we're heading forward or backward and continue accordingly past + //the current dialog + urlHistory.directHashChange({ + currentUrl: to, + isBack: function() { window.history.back(); }, + isForward: function() { window.history.forward(); } + }); + + // prevent changePage() + return; + } else { + // if the current active page is a dialog and we're navigating + // to a dialog use the dialog objected saved in the stack + urlHistory.directHashChange({ + currentUrl: to, + + // regardless of the direction of the history change + // do the following + either: function( isBack ) { + var active = $.mobile.urlHistory.getActive(); + + to = active.pageUrl; + + // make sure to set the role, transition and reversal + // as most of this is lost by the domCache cleaning + $.extend( changePageOptions, { + role: active.role, + transition: active.transition, + reverse: isBack + }); + } + }); + } + } + + //if to is defined, load it + if ( to ) { + // At this point, 'to' can be one of 3 things, a cached page element from + // a history stack entry, an id, or site-relative/absolute URL. If 'to' is + // an id, we need to resolve it against the documentBase, not the location.href, + // since the hashchange could've been the result of a forward/backward navigation + // that crosses from an external page/dialog to an internal page/dialog. + to = ( typeof to === "string" && !path.isPath( to ) ) ? ( path.makeUrlAbsolute( '#' + to, documentBase ) ) : to; + $.mobile.changePage( to, changePageOptions ); + } else { + //there's no hash, go to the first page in the dom + $.mobile.changePage( $.mobile.firstPage, changePageOptions ); + } + }; + + //hashchange event handler + $window.bind( "hashchange", function( e, triggered ) { + $.mobile._handleHashChange( location.hash ); + }); + + //set page min-heights to be device specific + $( document ).bind( "pageshow", resetActivePageHeight ); + $( window ).bind( "throttledresize", resetActivePageHeight ); + + };//_registerInternalEvents callback + +})( jQuery ); + +( function( $, window ) { + // For now, let's Monkeypatch this onto the end of $.mobile._registerInternalEvents + // Scope self to pushStateHandler so we can reference it sanely within the + // methods handed off as event handlers + var pushStateHandler = {}, + self = pushStateHandler, + $win = $( window ), + url = $.mobile.path.parseUrl( location.href ); + + $.extend( pushStateHandler, { + // TODO move to a path helper, this is rather common functionality + initialFilePath: (function() { + return url.pathname + url.search; + })(), + + initialHref: url.hrefNoHash, + + state: function() { + return { + hash: location.hash || "#" + self.initialFilePath, + title: document.title, + + // persist across refresh + initialHref: self.initialHref + }; + }, + + resetUIKeys: function( url ) { + var dialog = $.mobile.dialogHashKey, + subkey = "&" + $.mobile.subPageUrlKey, + dialogIndex = url.indexOf( dialog ); + + if( dialogIndex > -1 ) { + url = url.slice( 0, dialogIndex ) + "#" + url.slice( dialogIndex ); + } else if( url.indexOf( subkey ) > -1 ) { + url = url.split( subkey ).join( "#" + subkey ); + } + + return url; + }, + + hashValueAfterReset: function( url ) { + var resetUrl = self.resetUIKeys( url ); + return $.mobile.path.parseUrl( resetUrl ).hash; + }, + + // TODO sort out a single barrier to hashchange functionality + nextHashChangePrevented: function( value ) { + $.mobile.urlHistory.ignoreNextHashChange = value; + self.onHashChangeDisabled = value; + }, + + // on hash change we want to clean up the url + // NOTE this takes place *after* the vanilla navigation hash change + // handling has taken place and set the state of the DOM + onHashChange: function( e ) { + // disable this hash change + if( self.onHashChangeDisabled ){ + return; + } + + var href, state, + hash = location.hash, + isPath = $.mobile.path.isPath( hash ), + resolutionUrl = isPath ? location.href : $.mobile.getDocumentUrl(); + + hash = isPath ? hash.replace( "#", "" ) : hash; + + + // propulate the hash when its not available + state = self.state(); + + // make the hash abolute with the current href + href = $.mobile.path.makeUrlAbsolute( hash, resolutionUrl ); + + if ( isPath ) { + href = self.resetUIKeys( href ); + } + + // replace the current url with the new href and store the state + // Note that in some cases we might be replacing an url with the + // same url. We do this anyways because we need to make sure that + // all of our history entries have a state object associated with + // them. This allows us to work around the case where window.history.back() + // is called to transition from an external page to an embedded page. + // In that particular case, a hashchange event is *NOT* generated by the browser. + // Ensuring each history entry has a state object means that onPopState() + // will always trigger our hashchange callback even when a hashchange event + // is not fired. + history.replaceState( state, document.title, href ); + }, + + // on popstate (ie back or forward) we need to replace the hash that was there previously + // cleaned up by the additional hash handling + onPopState: function( e ) { + var poppedState = e.originalEvent.state, + timeout, fromHash, toHash, hashChanged; + + // if there's no state its not a popstate we care about, eg chrome's initial popstate + if( poppedState ) { + // the active url in the history stack will still be from the previous state + // so we can use it to verify if a hashchange will be fired from the popstate + fromHash = self.hashValueAfterReset( $.mobile.urlHistory.getActive().url ); + + // the hash stored in the state popped off the stack will be our currenturl or + // the url to which we wish to navigate + toHash = self.hashValueAfterReset( poppedState.hash.replace("#", "") ); + + // if the hashes of the urls are different we must assume that the browser + // will fire a hashchange + hashChanged = fromHash !== toHash; + + // unlock hash handling once the hashchange caused be the popstate has fired + if( hashChanged ) { + $win.one( "hashchange.pushstate", function() { + self.nextHashChangePrevented( false ); + }); + } + + // enable hash handling for the the _handleHashChange call + self.nextHashChangePrevented( false ); + + // change the page based on the hash + $.mobile._handleHashChange( poppedState.hash ); + + // only prevent another hash change handling if a hash change will be fired + // by the browser + if( hashChanged ) { + // disable hash handling until one of the above timers fires + self.nextHashChangePrevented( true ); + } + } + }, + + init: function() { + $win.bind( "hashchange", self.onHashChange ); + + // Handle popstate events the occur through history changes + $win.bind( "popstate", self.onPopState ); + + // if there's no hash, we need to replacestate for returning to home + if ( location.hash === "" ) { + history.replaceState( self.state(), document.title, location.href ); + } + } + }); + + $( function() { + if( $.mobile.pushStateEnabled && $.support.pushState ){ + pushStateHandler.init(); + } + }); +})( jQuery, this ); + +/* +* fallback transition for pop in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.pop = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slide in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +// Use the simultaneous transition handler for slide transitions +$.mobile.transitionHandlers.slide = $.mobile.transitionHandlers.simultaneous; + +// Set the slide transition's fallback to "fade" +$.mobile.transitionFallbacks.slide = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slidedown in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slidedown = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slideup in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slideup = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flip in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flip = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flow in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flow = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for turn in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.turn = "fade"; + +})( jQuery, this ); + +(function( $, undefined ) { + +$.mobile.page.prototype.options.degradeInputs = { + color: false, + date: false, + datetime: false, + "datetime-local": false, + email: false, + month: false, + number: false, + range: "number", + search: "text", + tel: false, + time: false, + url: false, + week: false +}; + + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + var page = $.mobile.closestPageData($(e.target)), options; + + if( !page ) { + return; + } + + options = page.options; + + // degrade inputs to avoid poorly implemented native functionality + $( e.target ).find( "input" ).not( page.keepNativeSelector() ).each(function() { + var $this = $( this ), + type = this.getAttribute( "type" ), + optType = options.degradeInputs[ type ] || "text"; + + if ( options.degradeInputs[ type ] ) { + var html = $( "<div>" ).html( $this.clone() ).html(), + // In IE browsers, the type sometimes doesn't exist in the cloned markup, so we replace the closing tag instead + hasType = html.indexOf( " type=" ) > -1, + findstr = hasType ? /\s+type=["']?\w+['"]?/ : /\/?>/, + repstr = " type=\"" + optType + "\" data-" + $.mobile.ns + "type=\"" + type + "\"" + ( hasType ? "" : ">" ); + + $this.replaceWith( html.replace( findstr, repstr ) ); + } + }); + +}); + +})( jQuery ); + +(function( $, window, undefined ) { + +$.widget( "mobile.dialog", $.mobile.widget, { + options: { + closeBtnText : "Close", + overlayTheme : "a", + initSelector : ":jqmData(role='dialog')" + }, + _create: function() { + var self = this, + $el = this.element, + headerCloseButton = $( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText + "</a>" ), + dialogWrap = $("<div/>", { + "role" : "dialog", + "class" : "ui-dialog-contain ui-corner-all ui-overlay-shadow" + }); + + $el.addClass( "ui-dialog ui-overlay-" + this.options.overlayTheme ); + + // Class the markup for dialog styling + // Set aria role + $el + .wrapInner( dialogWrap ) + .children() + .find( ":jqmData(role='header')" ) + .prepend( headerCloseButton ) + .end() + .children( ':first-child') + .addClass( "ui-corner-top" ) + .end() + .children( ":last-child" ) + .addClass( "ui-corner-bottom" ); + + // this must be an anonymous function so that select menu dialogs can replace + // the close method. This is a change from previously just defining data-rel=back + // on the button and letting nav handle it + // + // Use click rather than vclick in order to prevent the possibility of unintentionally + // reopening the dialog if the dialog opening item was directly under the close button. + headerCloseButton.bind( "click", function() { + self.close(); + }); + + /* bind events + - clicks and submits should use the closing transition that the dialog opened with + unless a data-transition is specified on the link/form + - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally + */ + $el.bind( "vclick submit", function( event ) { + var $target = $( event.target ).closest( event.type === "vclick" ? "a" : "form" ), + active; + + if ( $target.length && !$target.jqmData( "transition" ) ) { + + active = $.mobile.urlHistory.getActive() || {}; + + $target.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) ) + .attr( "data-" + $.mobile.ns + "direction", "reverse" ); + } + }) + .bind( "pagehide", function( e, ui ) { + $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass ); + }) + // Override the theme set by the page plugin on pageshow + .bind( "pagebeforeshow", function(){ + if( self.options.overlayTheme ){ + self.element + .page( "removeContainerBackground" ) + .page( "setContainerBackground", self.options.overlayTheme ); + } + }); + }, + + // Close method goes back in history + close: function() { + window.history.back(); + } +}); + +//auto self-init widgets +$( document ).delegate( $.mobile.dialog.prototype.options.initSelector, "pagecreate", function(){ + $.mobile.dialog.prototype.enhance( this ); +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.fn.fieldcontain = function( options ) { + return this.addClass( "ui-field-contain ui-body ui-br" ); +}; + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='fieldcontain')", e.target ).jqmEnhanceable().fieldcontain(); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.grid = function( options ) { + return this.each(function() { + + var $this = $( this ), + o = $.extend({ + grid: null + },options), + $kids = $this.children(), + gridCols = {solo:1, a:2, b:3, c:4, d:5}, + grid = o.grid, + iterator; + + if ( !grid ) { + if ( $kids.length <= 5 ) { + for ( var letter in gridCols ) { + if ( gridCols[ letter ] === $kids.length ) { + grid = letter; + } + } + } else { + grid = "a"; + } + } + iterator = gridCols[grid]; + + $this.addClass( "ui-grid-" + grid ); + + $kids.filter( ":nth-child(" + iterator + "n+1)" ).addClass( "ui-block-a" ); + + if ( iterator > 1 ) { + $kids.filter( ":nth-child(" + iterator + "n+2)" ).addClass( "ui-block-b" ); + } + if ( iterator > 2 ) { + $kids.filter( ":nth-child(3n+3)" ).addClass( "ui-block-c" ); + } + if ( iterator > 3 ) { + $kids.filter( ":nth-child(4n+4)" ).addClass( "ui-block-d" ); + } + if ( iterator > 4 ) { + $kids.filter( ":nth-child(5n+5)" ).addClass( "ui-block-e" ); + } + }); +}; +})( jQuery ); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='nojs')", e.target ).addClass( "ui-nojs" ); + +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.fn.buttonMarkup = function( options ) { + var $workingSet = this; + + // Enforce options to be of type string + options = ( options && ( $.type( options ) == "object" ) )? options : {}; + for ( var i = 0; i < $workingSet.length; i++ ) { + var el = $workingSet.eq( i ), + e = el[ 0 ], + o = $.extend( {}, $.fn.buttonMarkup.defaults, { + icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ), + iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ), + theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ), + inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ), + shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ), + corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ), + iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ), + mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" ) + }, options ), + + // Classes Defined + innerClass = "ui-btn-inner", + textClass = "ui-btn-text", + buttonClass, iconClass, + // Button inner markup + buttonInner, + buttonText, + buttonIcon, + buttonElements; + + $.each(o, function(key, value) { + e.setAttribute( "data-" + $.mobile.ns + key, value ); + el.jqmData(key, value); + }); + + // Check if this element is already enhanced + buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements"); + + if (buttonElements) { + e = buttonElements.outer; + el = $(e); + buttonInner = buttonElements.inner; + buttonText = buttonElements.text; + // We will recreate this icon below + $(buttonElements.icon).remove(); + buttonElements.icon = null; + } + else { + buttonInner = document.createElement( o.wrapperEls ); + buttonText = document.createElement( o.wrapperEls ); + } + buttonIcon = o.icon ? document.createElement( "span" ) : null; + + if ( attachEvents && !buttonElements) { + attachEvents(); + } + + // if not, try to find closest theme container + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( el, "c" ); + } + + buttonClass = "ui-btn ui-btn-up-" + o.theme; + buttonClass += o.inline ? " ui-btn-inline" : ""; + buttonClass += o.shadow ? " ui-shadow" : ""; + buttonClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.mini !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.mini ? " ui-mini" : " ui-fullsize"; + } + + if ( o.inline !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline"; + } + + + if ( o.icon ) { + o.icon = "ui-icon-" + o.icon; + o.iconpos = o.iconpos || "left"; + + iconClass = "ui-icon " + o.icon; + + if ( o.iconshadow ) { + iconClass += " ui-icon-shadow"; + } + } + + if ( o.iconpos ) { + buttonClass += " ui-btn-icon-" + o.iconpos; + + if ( o.iconpos == "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + } + + innerClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + + if ( buttonElements ) { + el.removeClass( buttonElements.bcls || "" ); + } + el.removeClass( "ui-link" ).addClass( buttonClass ); + + buttonInner.className = innerClass; + + buttonText.className = textClass; + if ( !buttonElements ) { + buttonInner.appendChild( buttonText ); + } + if ( buttonIcon ) { + buttonIcon.className = iconClass; + if ( !(buttonElements && buttonElements.icon) ) { + buttonIcon.appendChild( document.createTextNode("\u00a0") ); + buttonInner.appendChild( buttonIcon ); + } + } + + while ( e.firstChild && !buttonElements) { + buttonText.appendChild( e.firstChild ); + } + + if ( !buttonElements ) { + e.appendChild( buttonInner ); + } + + // Assign a structure containing the elements of this button to the elements of this button. This + // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup(). + buttonElements = { + bcls : buttonClass, + outer : e, + inner : buttonInner, + text : buttonText, + icon : buttonIcon + }; + + $.data(e, 'buttonElements', buttonElements); + $.data(buttonInner, 'buttonElements', buttonElements); + $.data(buttonText, 'buttonElements', buttonElements); + if (buttonIcon) { + $.data(buttonIcon, 'buttonElements', buttonElements); + } + } + + return this; +}; + +$.fn.buttonMarkup.defaults = { + corners: true, + shadow: true, + iconshadow: true, + wrapperEls: "span" +}; + +function closestEnabledButton( element ) { + var cname; + + while ( element ) { + // Note that we check for typeof className below because the element we + // handed could be in an SVG DOM where className on SVG elements is defined to + // be of a different type (SVGAnimatedString). We only operate on HTML DOM + // elements, so we look for plain "string". + cname = ( typeof element.className === 'string' ) && (element.className + ' '); + if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) { + break; + } + + element = element.parentNode; + } + + return element; +} + +var attachEvents = function() { + var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc; + + $( document ).bind( { + "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) { + var theme, + $btn = $( closestEnabledButton( event.target ) ), + evt = event.type; + + if ( $btn.length ) { + theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); + + if ( evt === "vmousedown" ) { + if ( $.support.touch ) { + hov = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + } + } else if ( evt === "vmousecancel" || evt === "vmouseup" ) { + $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + } else if ( evt === "vmouseover" || evt === "focus" ) { + if ( $.support.touch ) { + foc = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + } + } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) { + $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + if ( hov ) { + clearTimeout( hov ); + } + if ( foc ) { + clearTimeout( foc ); + } + } + } + }, + "focusin focus": function( event ){ + $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass ); + }, + "focusout blur": function( event ){ + $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass ); + } + }); + + attachEvents = null; +}; + +//links in bars, or those with data-role become buttons +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + $( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", e.target ) + .not( ".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')" ) + .buttonMarkup(); +}); + +})( jQuery ); + + +(function( $, undefined ) { + +$.mobile.page.prototype.options.backBtnText = "Back"; +$.mobile.page.prototype.options.addBackBtn = false; +$.mobile.page.prototype.options.backBtnTheme = null; +$.mobile.page.prototype.options.headerTheme = "a"; +$.mobile.page.prototype.options.footerTheme = "a"; +$.mobile.page.prototype.options.contentTheme = null; + +$( document ).delegate( ":jqmData(role='page'), :jqmData(role='dialog')", "pagecreate", function( e ) { + + var $page = $( this ), + o = $page.data( "page" ).options, + pageRole = $page.jqmData( "role" ), + pageTheme = o.theme; + + $( ":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", this ) + .jqmEnhanceable() + .each(function() { + + var $this = $( this ), + role = $this.jqmData( "role" ), + theme = $this.jqmData( "theme" ), + contentTheme = theme || o.contentTheme || ( pageRole === "dialog" && pageTheme ), + $headeranchors, + leftbtn, + rightbtn, + backBtn; + + $this.addClass( "ui-" + role ); + + //apply theming and markup modifications to page,header,content,footer + if ( role === "header" || role === "footer" ) { + + var thisTheme = theme || ( role === "header" ? o.headerTheme : o.footerTheme ) || pageTheme; + + $this + //add theme class + .addClass( "ui-bar-" + thisTheme ) + // Add ARIA role + .attr( "role", role === "header" ? "banner" : "contentinfo" ); + + if( role === "header") { + // Right,left buttons + $headeranchors = $this.children( "a" ); + leftbtn = $headeranchors.hasClass( "ui-btn-left" ); + rightbtn = $headeranchors.hasClass( "ui-btn-right" ); + + leftbtn = leftbtn || $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length; + + rightbtn = rightbtn || $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length; + } + + // Auto-add back btn on pages beyond first view + if ( o.addBackBtn && + role === "header" && + $( ".ui-page" ).length > 1 && + $page.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) && + !leftbtn ) { + + backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ) + // If theme is provided, override default inheritance + .attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme || thisTheme ) + .prependTo( $this ); + } + + // Page title + $this.children( "h1, h2, h3, h4, h5, h6" ) + .addClass( "ui-title" ) + // Regardless of h element number in src, it becomes h1 for the enhanced page + .attr({ + "role": "heading", + "aria-level": "1" + }); + + } else if ( role === "content" ) { + if ( contentTheme ) { + $this.addClass( "ui-body-" + ( contentTheme ) ); + } + + // Add ARIA role + $this.attr( "role", "main" ); + } + }); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsible", $.mobile.widget, { + options: { + expandCueText: " click to expand contents", + collapseCueText: " click to collapse contents", + collapsed: true, + heading: "h1,h2,h3,h4,h5,h6,legend", + theme: null, + contentTheme: null, + iconTheme: "d", + mini: false, + initSelector: ":jqmData(role='collapsible')" + }, + _create: function() { + + var $el = this.element, + o = this.options, + collapsible = $el.addClass( "ui-collapsible" ), + collapsibleHeading = $el.children( o.heading ).first(), + collapsibleContent = collapsible.wrapInner( "<div class='ui-collapsible-content'></div>" ).find( ".ui-collapsible-content" ), + collapsibleSet = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" ); + + // Replace collapsibleHeading if it's a legend + if ( collapsibleHeading.is( "legend" ) ) { + collapsibleHeading = $( "<div role='heading'>"+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading ); + collapsibleHeading.next().remove(); + } + + // If we are in a collapsible set + if ( collapsibleSet.length ) { + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = collapsibleSet.jqmData("theme") || $.mobile.getInheritedTheme( collapsibleSet, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = collapsibleSet.jqmData( "content-theme" ); + } + + // Gets the preference icon position in the set + if ( !o.iconPos ) { + o.iconPos = collapsibleSet.jqmData( "iconpos" ); + } + + if( !o.mini ) { + o.mini = collapsibleSet.jqmData( "mini" ); + } + } + collapsibleContent.addClass( ( o.contentTheme ) ? ( "ui-body-" + o.contentTheme ) : ""); + + collapsibleHeading + //drop heading in before content + .insertBefore( collapsibleContent ) + //modify markup & attributes + .addClass( "ui-collapsible-heading" ) + .append( "<span class='ui-collapsible-heading-status'></span>" ) + .wrapInner( "<a href='#' class='ui-collapsible-heading-toggle'></a>" ) + .find( "a" ) + .first() + .buttonMarkup({ + shadow: false, + corners: false, + iconpos: $el.jqmData( "iconpos" ) || o.iconPos || "left", + icon: "plus", + mini: o.mini, + theme: o.theme + }) + .add( ".ui-btn-inner", $el ) + .addClass( "ui-corner-top ui-corner-bottom" ); + + //events + collapsible + .bind( "expand collapse", function( event ) { + if ( !event.isDefaultPrevented() ) { + + event.preventDefault(); + + var $this = $( this ), + isCollapse = ( event.type === "collapse" ), + contentTheme = o.contentTheme; + + collapsibleHeading + .toggleClass( "ui-collapsible-heading-collapsed", isCollapse) + .find( ".ui-collapsible-heading-status" ) + .text( isCollapse ? o.expandCueText : o.collapseCueText ) + .end() + .find( ".ui-icon" ) + .toggleClass( "ui-icon-minus", !isCollapse ) + .toggleClass( "ui-icon-plus", isCollapse ); + + $this.toggleClass( "ui-collapsible-collapsed", isCollapse ); + collapsibleContent.toggleClass( "ui-collapsible-content-collapsed", isCollapse ).attr( "aria-hidden", isCollapse ); + + if ( contentTheme && ( !collapsibleSet.length || collapsible.jqmData( "collapsible-last" ) ) ) { + collapsibleHeading + .find( "a" ).first().add( collapsibleHeading.find( ".ui-btn-inner" ) ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsibleContent.toggleClass( "ui-corner-bottom", !isCollapse ); + } + collapsibleContent.trigger( "updatelayout" ); + } + }) + .trigger( o.collapsed ? "collapse" : "expand" ); + + collapsibleHeading + .bind( "click", function( event ) { + + var type = collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ? + "expand" : "collapse"; + + collapsible.trigger( type ); + + event.preventDefault(); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsible.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsibleset", $.mobile.widget, { + options: { + initSelector: ":jqmData(role='collapsible-set')" + }, + _create: function() { + var $el = this.element.addClass( "ui-collapsible-set" ), + o = this.options; + + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( $el, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = $el.jqmData( "content-theme" ); + } + + if ( !o.corners ) { + o.corners = $el.jqmData( "corners" ) === undefined ? true : false; + } + + // Initialize the collapsible set if it's not already initialized + if ( !$el.jqmData( "collapsiblebound" ) ) { + $el + .jqmData( "collapsiblebound", true ) + .bind( "expand collapse", function( event ) { + var isCollapse = ( event.type === "collapse" ), + collapsible = $( event.target ).closest( ".ui-collapsible" ), + widget = collapsible.data( "collapsible" ), + contentTheme = widget.options.contentTheme; + if ( contentTheme && collapsible.jqmData( "collapsible-last" ) ) { + collapsible.find( widget.options.heading ).first() + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsible.find( ".ui-collapsible-content" ).toggleClass( "ui-corner-bottom", !isCollapse ); + } + }) + .bind( "expand", function( event ) { + $( event.target ) + .closest( ".ui-collapsible" ) + .siblings( ".ui-collapsible" ) + .trigger( "collapse" ); + }); + } + }, + + _init: function() { + this.refresh(); + }, + + refresh: function() { + var $el = this.element, + o = this.options, + collapsiblesInSet = $el.children( ":jqmData(role='collapsible')" ); + + $.mobile.collapsible.prototype.enhance( collapsiblesInSet.not( ".ui-collapsible" ) ); + + // clean up borders + collapsiblesInSet.each( function() { + $( this ).find( $.mobile.collapsible.prototype.options.heading ) + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .removeClass( "ui-corner-top ui-corner-bottom" ); + }); + + collapsiblesInSet.first() + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-top" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-top" ); + + collapsiblesInSet.last() + .jqmData( "collapsible-last", true ) + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-bottom" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-bottom" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsibleset.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.navbar", $.mobile.widget, { + options: { + iconpos: "top", + grid: null, + initSelector: ":jqmData(role='navbar')" + }, + + _create: function(){ + + var $navbar = this.element, + $navbtns = $navbar.find( "a" ), + iconpos = $navbtns.filter( ":jqmData(icon)" ).length ? + this.options.iconpos : undefined; + + $navbar.addClass( "ui-navbar" ) + .attr( "role","navigation" ) + .find( "ul" ) + .jqmEnhanceable() + .grid({ grid: this.options.grid }); + + if ( !iconpos ) { + $navbar.addClass( "ui-navbar-noicons" ); + } + + $navbtns.buttonMarkup({ + corners: false, + shadow: false, + inline: true, + iconpos: iconpos + }); + + $navbar.delegate( "a", "vclick", function( event ) { + if( !$(event.target).hasClass("ui-disabled") ) { + $navbtns.removeClass( $.mobile.activeBtnClass ); + $( this ).addClass( $.mobile.activeBtnClass ); + } + }); + + // Buttons in the navbar with ui-state-persist class should regain their active state before page show + $navbar.closest( ".ui-page" ).bind( "pagebeforeshow", function() { + $navbtns.filter( ".ui-state-persist" ).addClass( $.mobile.activeBtnClass ); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.navbar.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +//Keeps track of the number of lists per page UID +//This allows support for multiple nested list in the same page +//https://github.com/jquery/jquery-mobile/issues/1617 +var listCountPerPage = {}; + +$.widget( "mobile.listview", $.mobile.widget, { + + options: { + theme: null, + countTheme: "c", + headerTheme: "b", + dividerTheme: "b", + splitIcon: "arrow-r", + splitTheme: "b", + mini: false, + inset: false, + initSelector: ":jqmData(role='listview')" + }, + + _create: function() { + var t = this, + listviewClasses = ""; + + listviewClasses += t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : ""; + listviewClasses += t.element.jqmData( "mini" ) || t.options.mini === true ? " ui-mini" : ""; + + // create listview markup + t.element.addClass(function( i, orig ) { + return orig + " ui-listview " + listviewClasses; + }); + + t.refresh( true ); + }, + + _removeCorners: function( li, which ) { + var top = "ui-corner-top ui-corner-tr ui-corner-tl", + bot = "ui-corner-bottom ui-corner-br ui-corner-bl"; + + li = li.add( li.find( ".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb" ) ); + + if ( which === "top" ) { + li.removeClass( top ); + } else if ( which === "bottom" ) { + li.removeClass( bot ); + } else { + li.removeClass( top + " " + bot ); + } + }, + + _refreshCorners: function( create ) { + var $li, + $visibleli, + $topli, + $bottomli; + + if ( this.options.inset ) { + $li = this.element.children( "li" ); + // at create time the li are not visible yet so we need to rely on .ui-screen-hidden + $visibleli = create?$li.not( ".ui-screen-hidden" ):$li.filter( ":visible" ); + + this._removeCorners( $li ); + + // Select the first visible li element + $topli = $visibleli.first() + .addClass( "ui-corner-top" ); + + $topli.add( $topli.find( ".ui-btn-inner" ) + .not( ".ui-li-link-alt span:first-child" ) ) + .addClass( "ui-corner-top" ) + .end() + .find( ".ui-li-link-alt, .ui-li-link-alt span:first-child" ) + .addClass( "ui-corner-tr" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-tl" ); + + // Select the last visible li element + $bottomli = $visibleli.last() + .addClass( "ui-corner-bottom" ); + + $bottomli.add( $bottomli.find( ".ui-btn-inner" ) ) + .find( ".ui-li-link-alt" ) + .addClass( "ui-corner-br" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-bl" ); + } + if ( !create ) { + this.element.trigger( "updatelayout" ); + } + }, + + // This is a generic utility method for finding the first + // node with a given nodeName. It uses basic DOM traversal + // to be fast and is meant to be a substitute for simple + // $.fn.closest() and $.fn.children() calls on a single + // element. Note that callers must pass both the lowerCase + // and upperCase version of the nodeName they are looking for. + // The main reason for this is that this function will be + // called many times and we want to avoid having to lowercase + // the nodeName from the element every time to ensure we have + // a match. Note that this function lives here for now, but may + // be moved into $.mobile if other components need a similar method. + _findFirstElementByTagName: function( ele, nextProp, lcName, ucName ) + { + var dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + return ele; + } + ele = ele[ nextProp ]; + } + return null; + }, + _getChildrenByTagName: function( ele, lcName, ucName ) + { + var results = [], + dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + ele = ele.firstChild; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + results.push( ele ); + } + ele = ele.nextSibling; + } + return $( results ); + }, + + _addThumbClasses: function( containers ) + { + var i, img, len = containers.length; + for ( i = 0; i < len; i++ ) { + img = $( this._findFirstElementByTagName( containers[ i ].firstChild, "nextSibling", "img", "IMG" ) ); + if ( img.length ) { + img.addClass( "ui-li-thumb" ); + $( this._findFirstElementByTagName( img[ 0 ].parentNode, "parentNode", "li", "LI" ) ).addClass( img.is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" ); + } + } + }, + + refresh: function( create ) { + this.parentPage = this.element.closest( ".ui-page" ); + this._createSubPages(); + + var o = this.options, + $list = this.element, + self = this, + dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme, + listsplittheme = $list.jqmData( "splittheme" ), + listspliticon = $list.jqmData( "spliticon" ), + li = this._getChildrenByTagName( $list[ 0 ], "li", "LI" ), + counter = $.support.cssPseudoElement || !$.nodeName( $list[ 0 ], "ol" ) ? 0 : 1, + itemClassDict = {}, + item, itemClass, itemTheme, + a, last, splittheme, countParent, icon, imgParents, img, linkIcon; + + if ( counter ) { + $list.find( ".ui-li-dec" ).remove(); + } + + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + for ( var pos = 0, numli = li.length; pos < numli; pos++ ) { + item = li.eq( pos ); + itemClass = "ui-li"; + + // If we're creating the element, we update it regardless + if ( create || !item.hasClass( "ui-li" ) ) { + itemTheme = item.jqmData("theme") || o.theme; + a = this._getChildrenByTagName( item[ 0 ], "a", "A" ); + + if ( a.length ) { + icon = item.jqmData("icon"); + + item.buttonMarkup({ + wrapperEls: "div", + shadow: false, + corners: false, + iconpos: "right", + icon: a.length > 1 || icon === false ? false : icon || "arrow-r", + theme: itemTheme + }); + + if ( ( icon != false ) && ( a.length == 1 ) ) { + item.addClass( "ui-li-has-arrow" ); + } + + a.first().removeClass( "ui-link" ).addClass( "ui-link-inherit" ); + + if ( a.length > 1 ) { + itemClass += " ui-li-has-alt"; + + last = a.last(); + splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme; + linkIcon = last.jqmData("icon"); + + last.appendTo(item) + .attr( "title", last.getEncodedText() ) + .addClass( "ui-li-link-alt" ) + .empty() + .buttonMarkup({ + shadow: false, + corners: false, + theme: itemTheme, + icon: false, + iconpos: false + }) + .find( ".ui-btn-inner" ) + .append( + $( document.createElement( "span" ) ).buttonMarkup({ + shadow: true, + corners: true, + theme: splittheme, + iconpos: "notext", + // link icon overrides list item icon overrides ul element overrides options + icon: linkIcon || icon || listspliticon || o.splitIcon + }) + ); + } + } else if ( item.jqmData( "role" ) === "list-divider" ) { + + itemClass += " ui-li-divider ui-bar-" + dividertheme; + item.attr( "role", "heading" ); + + //reset counter when a divider heading is encountered + if ( counter ) { + counter = 1; + } + + } else { + itemClass += " ui-li-static ui-body-" + itemTheme; + } + } + + if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) { + countParent = item.is( ".ui-li-static:first" ) ? item : item.find( ".ui-link-inherit" ); + + countParent.addClass( "ui-li-jsnumbering" ) + .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" ); + } + + // Instead of setting item class directly on the list item and its + // btn-inner at this point in time, push the item into a dictionary + // that tells us what class to set on it so we can do this after this + // processing loop is finished. + + if ( !itemClassDict[ itemClass ] ) { + itemClassDict[ itemClass ] = []; + } + + itemClassDict[ itemClass ].push( item[ 0 ] ); + } + + // Set the appropriate listview item classes on each list item + // and their btn-inner elements. The main reason we didn't do this + // in the for-loop above is because we can eliminate per-item function overhead + // by calling addClass() and children() once or twice afterwards. This + // can give us a significant boost on platforms like WP7.5. + + for ( itemClass in itemClassDict ) { + $( itemClassDict[ itemClass ] ).addClass( itemClass ).children( ".ui-btn-inner" ).addClass( itemClass ); + } + + $list.find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ) + .end() + + .find( "p, dl" ).addClass( "ui-li-desc" ) + .end() + + .find( ".ui-li-aside" ).each(function() { + var $this = $(this); + $this.prependTo( $this.parent() ); //shift aside to front for css float + }) + .end() + + .find( ".ui-li-count" ).each( function() { + $( this ).closest( "li" ).addClass( "ui-li-has-count" ); + }).addClass( "ui-btn-up-" + ( $list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ); + + // The idea here is to look at the first image in the list item + // itself, and any .ui-link-inherit element it may contain, so we + // can place the appropriate classes on the image and list item. + // Note that we used to use something like: + // + // li.find(">img:eq(0), .ui-link-inherit>img:eq(0)").each( ... ); + // + // But executing a find() like that on Windows Phone 7.5 took a + // really long time. Walking things manually with the code below + // allows the 400 listview item page to load in about 3 seconds as + // opposed to 30 seconds. + + this._addThumbClasses( li ); + this._addThumbClasses( $list.find( ".ui-link-inherit" ) ); + + this._refreshCorners( create ); + }, + + //create a string for ID/subpage url creation + _idStringEscape: function( str ) { + return str.replace(/[^a-zA-Z0-9]/g, '-'); + }, + + _createSubPages: function() { + var parentList = this.element, + parentPage = parentList.closest( ".ui-page" ), + parentUrl = parentPage.jqmData( "url" ), + parentId = parentUrl || parentPage[ 0 ][ $.expando ], + parentListId = parentList.attr( "id" ), + o = this.options, + dns = "data-" + $.mobile.ns, + self = this, + persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ), + hasSubPages; + + if ( typeof listCountPerPage[ parentId ] === "undefined" ) { + listCountPerPage[ parentId ] = -1; + } + + parentListId = parentListId || ++listCountPerPage[ parentId ]; + + $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) { + var self = this, + list = $( this ), + listId = list.attr( "id" ) || parentListId + "-" + i, + parent = list.parent(), + nodeEls = $( list.prevAll().toArray().reverse() ), + nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ), + title = nodeEls.first().getEncodedText(),//url limits to first 30 chars of text + id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId, + theme = list.jqmData( "theme" ) || o.theme, + countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme, + newPage, anchor; + + //define hasSubPages for use in later removal + hasSubPages = true; + + newPage = list.detach() + .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" ) + .parent() + .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" ) + .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" ) + .parent() + .appendTo( $.mobile.pageContainer ); + + newPage.page(); + + anchor = parent.find('a:first'); + + if ( !anchor.length ) { + anchor = $( "<a/>" ).html( nodeEls || title ).prependTo( parent.empty() ); + } + + anchor.attr( "href", "#" + id ); + + }).listview(); + + // on pagehide, remove any nested pages along with the parent page, as long as they aren't active + // and aren't embedded + if( hasSubPages && + parentPage.is( ":jqmData(external-page='true')" ) && + parentPage.data("page").options.domCache === false ) { + + var newRemove = function( e, ui ){ + var nextPage = ui.nextPage, npURL; + + if( ui.nextPage ){ + npURL = nextPage.jqmData( "url" ); + if( npURL.indexOf( parentUrl + "&" + $.mobile.subPageUrlKey ) !== 0 ){ + self.childPages().remove(); + parentPage.remove(); + } + } + }; + + // unbind the original page remove and replace with our specialized version + parentPage + .unbind( "pagehide.remove" ) + .bind( "pagehide.remove", newRemove); + } + }, + + // TODO sort out a better way to track sub pages of the listview this is brittle + childPages: function(){ + var parentUrl = this.parentPage.jqmData( "url" ); + + return $( ":jqmData(url^='"+ parentUrl + "&" + $.mobile.subPageUrlKey +"')"); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.listview.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +/* +* "checkboxradio" plugin +*/ + +(function( $, undefined ) { + +$.widget( "mobile.checkboxradio", $.mobile.widget, { + options: { + theme: null, + initSelector: "input[type='checkbox'],input[type='radio']" + }, + _create: function() { + var self = this, + input = this.element, + inheritAttr = function( input, dataAttr ) { + return input.jqmData( dataAttr ) || input.closest( "form,fieldset" ).jqmData( dataAttr ) + }, + // NOTE: Windows Phone could not find the label through a selector + // filter works though. + parentLabel = $( input ).closest( "label" ), + label = parentLabel.length ? parentLabel : $( input ).closest( "form,fieldset,:jqmData(role='page'),:jqmData(role='dialog')" ).find( "label" ).filter( "[for='" + input[0].id + "']" ), + inputtype = input[0].type, + mini = inheritAttr( input, "mini" ), + checkedState = inputtype + "-on", + uncheckedState = inputtype + "-off", + icon = input.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedState, + iconpos = inheritAttr( input, "iconpos" ), + activeBtn = icon ? "" : " " + $.mobile.activeBtnClass, + checkedClass = "ui-" + checkedState + activeBtn, + uncheckedClass = "ui-" + uncheckedState, + checkedicon = "ui-icon-" + checkedState, + uncheckedicon = "ui-icon-" + uncheckedState; + + if ( inputtype !== "checkbox" && inputtype !== "radio" ) { + return; + } + + // Expose for other methods + $.extend( this, { + label: label, + inputtype: inputtype, + checkedClass: checkedClass, + uncheckedClass: uncheckedClass, + checkedicon: checkedicon, + uncheckedicon: uncheckedicon + }); + + // If there's no selected theme check the data attr + if( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + label.buttonMarkup({ + theme: this.options.theme, + icon: icon, + shadow: false, + mini: mini, + iconpos: iconpos + }); + + // Wrap the input + label in a div + var wrapper = document.createElement('div'); + wrapper.className = 'ui-' + inputtype; + + input.add( label ).wrapAll( wrapper ); + + label.bind({ + vmouseover: function( event ) { + if ( $( this ).parent().is( ".ui-disabled" ) ) { + event.stopPropagation(); + } + }, + + vclick: function( event ) { + if ( input.is( ":disabled" ) ) { + event.preventDefault(); + return; + } + + self._cacheVals(); + + input.prop( "checked", inputtype === "radio" && true || !input.prop( "checked" ) ); + + // trigger click handler's bound directly to the input as a substitute for + // how label clicks behave normally in the browsers + // TODO: it would be nice to let the browser's handle the clicks and pass them + // through to the associate input. we can swallow that click at the parent + // wrapper element level + input.triggerHandler( 'click' ); + + // Input set for common radio buttons will contain all the radio + // buttons, but will not for checkboxes. clearing the checked status + // of other radios ensures the active button state is applied properly + self._getInputSet().not( input ).prop( "checked", false ); + + self._updateAll(); + return false; + } + }); + + input + .bind({ + vmousedown: function() { + self._cacheVals(); + }, + + vclick: function() { + var $this = $(this); + + // Adds checked attribute to checked input when keyboard is used + if ( $this.is( ":checked" ) ) { + + $this.prop( "checked", true); + self._getInputSet().not($this).prop( "checked", false ); + } else { + + $this.prop( "checked", false ); + } + + self._updateAll(); + }, + + focus: function() { + label.addClass( $.mobile.focusClass ); + }, + + blur: function() { + label.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + _cacheVals: function() { + this._getInputSet().each(function() { + $(this).jqmData( "cacheVal", this.checked ); + }); + }, + + //returns either a set of radios with the same name attribute, or a single checkbox + _getInputSet: function(){ + if(this.inputtype === "checkbox") { + return this.element; + } + + return this.element.closest( "form,fieldset,:jqmData(role='page')" ) + .find( "input[name='"+ this.element[0].name +"'][type='"+ this.inputtype +"']" ); + }, + + _updateAll: function() { + var self = this; + + this._getInputSet().each(function() { + var $this = $(this); + + if ( this.checked || self.inputtype === "checkbox" ) { + $this.trigger( "change" ); + } + }) + .checkboxradio( "refresh" ); + }, + + refresh: function() { + var input = this.element[0], + label = this.label, + icon = label.find( ".ui-icon" ); + + if ( input.checked ) { + label.addClass( this.checkedClass ).removeClass( this.uncheckedClass ); + icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon ); + } else { + label.removeClass( this.checkedClass ).addClass( this.uncheckedClass ); + icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon ); + } + + if ( input.disabled ) { + this.disable(); + } else { + this.enable(); + } + }, + + disable: function() { + this.element.prop( "disabled", true ).parent().addClass( "ui-disabled" ); + }, + + enable: function() { + this.element.prop( "disabled", false ).parent().removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.checkboxradio.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.button", $.mobile.widget, { + options: { + theme: null, + icon: null, + iconpos: null, + inline: false, + corners: true, + shadow: true, + iconshadow: true, + initSelector: "button, [type='button'], [type='submit'], [type='reset'], [type='image']", + mini: false + }, + _create: function() { + var $el = this.element, + $button, + o = this.options, + type, + name, + classes = "", + $buttonPlaceholder; + + // if this is a link, check if it's been enhanced and, if not, use the right function + if( $el[ 0 ].tagName === "A" ) { + !$el.hasClass( "ui-btn" ) && $el.buttonMarkup(); + return; + } + + // get the inherited theme + // TODO centralize for all widgets + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~$el[0].className.indexOf( "ui-btn-left" ) ) { + classes = "ui-btn-left"; + } + + if( !!~$el[0].className.indexOf( "ui-btn-right" ) ) { + classes = "ui-btn-right"; + } + + // Add ARIA role + this.button = $( "<div></div>" ) + .text( $el.text() || $el.val() ) + .insertBefore( $el ) + .buttonMarkup({ + theme: o.theme, + icon: o.icon, + iconpos: o.iconpos, + inline: o.inline, + corners: o.corners, + shadow: o.shadow, + iconshadow: o.iconshadow, + mini: o.mini + }) + .addClass( classes ) + .append( $el.addClass( "ui-btn-hidden" ) ); + + $button = this.button; + type = $el.attr( "type" ); + name = $el.attr( "name" ); + + // Add hidden input during submit if input type="submit" has a name. + if ( type !== "button" && type !== "reset" && name ) { + $el.bind( "vclick", function() { + // Add hidden input if it doesn’t already exist. + if( $buttonPlaceholder === undefined ) { + $buttonPlaceholder = $( "<input>", { + type: "hidden", + name: $el.attr( "name" ), + value: $el.attr( "value" ) + }).insertBefore( $el ); + + // Bind to doc to remove after submit handling + $( document ).one("submit", function(){ + $buttonPlaceholder.remove(); + + // reset the local var so that the hidden input + // will be re-added on subsequent clicks + $buttonPlaceholder = undefined; + }); + } + }); + } + + $el.bind({ + focus: function() { + $button.addClass( $.mobile.focusClass ); + }, + + blur: function() { + $button.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + }, + + refresh: function() { + var $el = this.element; + + if ( $el.prop("disabled") ) { + this.disable(); + } else { + this.enable(); + } + + // Grab the button's text element from its implementation-independent data item + $( this.button.data( 'buttonElements' ).text ).text( $el.text() || $el.val() ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.button.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.controlgroup = function( options ) { + function flipClasses( els, flCorners ) { + els.removeClass( "ui-btn-corner-all ui-shadow" ) + .eq( 0 ).addClass( flCorners[ 0 ] ) + .end() + .last().addClass( flCorners[ 1 ] ).addClass( "ui-controlgroup-last" ); + } + + return this.each(function() { + var $el = $( this ), + o = $.extend({ + direction: $el.jqmData( "type" ) || "vertical", + shadow: false, + excludeInvisible: true, + mini: $el.jqmData( "mini" ) + }, options ), + groupheading = $el.children( "legend" ), + flCorners = o.direction == "horizontal" ? [ "ui-corner-left", "ui-corner-right" ] : [ "ui-corner-top", "ui-corner-bottom" ], + type = $el.find( "input" ).first().attr( "type" ); + + // Replace legend with more stylable replacement div + if ( groupheading.length ) { + $el.wrapInner( "<div class='ui-controlgroup-controls'></div>" ); + $( "<div role='heading' class='ui-controlgroup-label'>" + groupheading.html() + "</div>" ).insertBefore( $el.children(0) ); + groupheading.remove(); + } + + $el.addClass( "ui-corner-all ui-controlgroup ui-controlgroup-" + o.direction ); + + flipClasses( $el.find( ".ui-btn" + ( o.excludeInvisible ? ":visible" : "" ) ).not('.ui-slider-handle'), flCorners ); + flipClasses( $el.find( ".ui-btn-inner" ), flCorners ); + + if ( o.shadow ) { + $el.addClass( "ui-shadow" ); + } + + if ( o.mini ) { + $el.addClass( "ui-mini" ); + } + + }); +}; + +// The pagecreate handler for controlgroup is in jquery.mobile.init because of the soft-dependency on the wrapped widgets + +})(jQuery); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + + //links within content areas, tests included with page + $( e.target ) + .find( "a" ) + .jqmEnhanceable() + .not( ".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')" ) + .addClass( "ui-link" ); + +}); + +})( jQuery ); + + +( function( $ ) { + var meta = $( "meta[name=viewport]" ), + initialContent = meta.attr( "content" ), + disabledZoom = initialContent + ",maximum-scale=1, user-scalable=no", + enabledZoom = initialContent + ",maximum-scale=10, user-scalable=yes", + disabledInitially = /(user-scalable[\s]*=[\s]*no)|(maximum-scale[\s]*=[\s]*1)[$,\s]/.test( initialContent ); + + $.mobile.zoom = $.extend( {}, { + enabled: !disabledInitially, + locked: false, + disable: function( lock ) { + if( !disabledInitially && !$.mobile.zoom.locked ){ + meta.attr( "content", disabledZoom ); + $.mobile.zoom.enabled = false; + $.mobile.zoom.locked = lock || false; + } + }, + enable: function( unlock ) { + if( !disabledInitially && ( !$.mobile.zoom.locked || unlock === true ) ){ + meta.attr( "content", enabledZoom ); + $.mobile.zoom.enabled = true; + $.mobile.zoom.locked = false; + } + }, + restore: function() { + if( !disabledInitially ){ + meta.attr( "content", initialContent ); + $.mobile.zoom.enabled = true; + } + } + }); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "mobile.textinput", $.mobile.widget, { + options: { + theme: null, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])", + clearSearchButtonText: "clear text" + }, + + _create: function() { + + var input = this.element, + o = this.options, + theme = o.theme || $.mobile.getInheritedTheme( this.element, "c" ), + themeclass = " ui-body-" + theme, + mini = input.jqmData("mini") == true, + miniclass = mini ? " ui-mini" : "", + focusedEl, clearbtn; + + $( "label[for='" + input.attr( "id" ) + "']" ).addClass( "ui-input-text" ); + + focusedEl = input.addClass("ui-input-text ui-body-"+ theme ); + + // XXX: Temporary workaround for issue 785 (Apple bug 8910589). + // Turn off autocorrect and autocomplete on non-iOS 5 devices + // since the popup they use can't be dismissed by the user. Note + // that we test for the presence of the feature by looking for + // the autocorrect property on the input element. We currently + // have no test for iOS 5 or newer so we're temporarily using + // the touchOverflow support flag for jQM 1.0. Yes, I feel dirty. - jblas + if ( typeof input[0].autocorrect !== "undefined" && !$.support.touchOverflow ) { + // Set the attribute instead of the property just in case there + // is code that attempts to make modifications via HTML. + input[0].setAttribute( "autocorrect", "off" ); + input[0].setAttribute( "autocomplete", "off" ); + } + + + //"search" input widget + if ( input.is( "[type='search'],:jqmData(type='search')" ) ) { + + focusedEl = input.wrap( "<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield" + themeclass + miniclass + "'></div>" ).parent(); + clearbtn = $( "<a href='#' class='ui-input-clear' title='" + o.clearSearchButtonText + "'>" + o.clearSearchButtonText + "</a>" ) + .bind('click', function( event ) { + input + .val( "" ) + .focus() + .trigger( "change" ); + clearbtn.addClass( "ui-input-clear-hidden" ); + event.preventDefault(); + }) + .appendTo( focusedEl ) + .buttonMarkup({ + icon: "delete", + iconpos: "notext", + corners: true, + shadow: true, + mini: mini + }); + + function toggleClear() { + setTimeout(function() { + clearbtn.toggleClass( "ui-input-clear-hidden", !input.val() ); + }, 0); + } + + toggleClear(); + + input.bind('paste cut keyup focus change blur', toggleClear); + + } else { + input.addClass( "ui-corner-all ui-shadow-inset" + themeclass + miniclass ); + } + + input.focus(function() { + focusedEl.addClass( $.mobile.focusClass ); + }) + .blur(function(){ + focusedEl.removeClass( $.mobile.focusClass ); + }) + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + .bind( "focus", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "blur", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + + // Autogrow + if ( input.is( "textarea" ) ) { + var extraLineHeight = 15, + keyupTimeoutBuffer = 100, + keyup = function() { + var scrollHeight = input[ 0 ].scrollHeight, + clientHeight = input[ 0 ].clientHeight; + + if ( clientHeight < scrollHeight ) { + input.height(scrollHeight + extraLineHeight); + } + }, + keyupTimeout; + + input.keyup(function() { + clearTimeout( keyupTimeout ); + keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer ); + }); + + // binding to pagechange here ensures that for pages loaded via + // ajax the height is recalculated without user input + $( document ).one( "pagechange", keyup ); + + // Issue 509: the browser is not providing scrollHeight properly until the styles load + if ( $.trim( input.val() ) ) { + // bind to the window load to make sure the height is calculated based on BOTH + // the DOM and CSS + $( window ).load( keyup ); + } + } + }, + + disable: function(){ + ( this.element.attr( "disabled", true ).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).addClass( "ui-disabled" ); + }, + + enable: function(){ + ( this.element.attr( "disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.textinput.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.mobile.listview.prototype.options.filter = false; +$.mobile.listview.prototype.options.filterPlaceholder = "Filter items..."; +$.mobile.listview.prototype.options.filterTheme = "c"; +$.mobile.listview.prototype.options.filterCallback = function( text, searchValue ){ + return text.toLowerCase().indexOf( searchValue ) === -1; +}; + +$( document ).delegate( ":jqmData(role='listview')", "listviewcreate", function() { + + var list = $( this ), + listview = list.data( "listview" ); + + if ( !listview.options.filter ) { + return; + } + + var wrapper = $( "<form>", { + "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, + "role": "search" + }), + search = $( "<input>", { + placeholder: listview.options.filterPlaceholder + }) + .attr( "data-" + $.mobile.ns + "type", "search" ) + .jqmData( "lastval", "" ) + .bind( "keyup change", function() { + + var $this = $(this), + val = this.value.toLowerCase(), + listItems = null, + lastval = $this.jqmData( "lastval" ) + "", + childItems = false, + itemtext = "", + item; + + // Change val as lastval for next execution + $this.jqmData( "lastval" , val ); + if ( val.length < lastval.length || val.indexOf(lastval) !== 0 ) { + + // Removed chars or pasted something totally different, check all items + listItems = list.children(); + } else { + + // Only chars added, not removed, only use visible subset + listItems = list.children( ":not(.ui-screen-hidden)" ); + } + + if ( val ) { + + // This handles hiding regular rows without the text we search for + // and any list dividers without regular rows shown under it + + for ( var i = listItems.length - 1; i >= 0; i-- ) { + item = $( listItems[ i ] ); + itemtext = item.jqmData( "filtertext" ) || item.text(); + + if ( item.is( "li:jqmData(role=list-divider)" ) ) { + + item.toggleClass( "ui-filter-hidequeue" , !childItems ); + + // New bucket! + childItems = false; + + } else if ( listview.options.filterCallback( itemtext, val ) ) { + + //mark to be hidden + item.toggleClass( "ui-filter-hidequeue" , true ); + } else { + + // There's a shown item in the bucket + childItems = true; + } + } + + // Show items, not marked to be hidden + listItems + .filter( ":not(.ui-filter-hidequeue)" ) + .toggleClass( "ui-screen-hidden", false ); + + // Hide items, marked to be hidden + listItems + .filter( ".ui-filter-hidequeue" ) + .toggleClass( "ui-screen-hidden", true ) + .toggleClass( "ui-filter-hidequeue", false ); + + } else { + + //filtervalue is empty => show all + listItems.toggleClass( "ui-screen-hidden", false ); + } + listview._refreshCorners(); + }) + .appendTo( wrapper ) + .textinput(); + + if ( listview.options.inset ) { + wrapper.addClass( "ui-listview-filter-inset" ); + } + + wrapper.bind( "submit", function() { + return false; + }) + .insertBefore( list ); +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.widget( "mobile.slider", $.mobile.widget, { + options: { + theme: null, + trackTheme: null, + disabled: false, + initSelector: "input[type='range'], :jqmData(type='range'), :jqmData(role='slider')", + mini: false + }, + + _create: function() { + + // TODO: Each of these should have comments explain what they're for + var self = this, + + control = this.element, + + parentTheme = $.mobile.getInheritedTheme( control, "c" ), + + theme = this.options.theme || parentTheme, + + trackTheme = this.options.trackTheme || parentTheme, + + cType = control[ 0 ].nodeName.toLowerCase(), + + selectClass = ( cType == "select" ) ? "ui-slider-switch" : "", + + controlID = control.attr( "id" ), + + labelID = controlID + "-label", + + label = $( "[for='"+ controlID +"']" ).attr( "id", labelID ), + + val = function() { + return cType == "input" ? parseFloat( control.val() ) : control[0].selectedIndex; + }, + + min = cType == "input" ? parseFloat( control.attr( "min" ) ) : 0, + + max = cType == "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length-1, + + step = window.parseFloat( control.attr( "step" ) || 1 ), + + inlineClass = ( this.options.inline || control.jqmData("inline") == true ) ? " ui-slider-inline" : "", + + miniClass = ( this.options.mini || control.jqmData("mini") ) ? " ui-slider-mini" : "", + + + domHandle = document.createElement('a'), + handle = $( domHandle ), + domSlider = document.createElement('div'), + slider = $( domSlider ), + + valuebg = control.jqmData("highlight") && cType != "select" ? (function() { + var bg = document.createElement('div'); + bg.className = 'ui-slider-bg ui-btn-active ui-btn-corner-all'; + return $( bg ).prependTo( slider ); + })() : false, + + options; + + domHandle.setAttribute( 'href', "#" ); + domSlider.setAttribute('role','application'); + domSlider.className = ['ui-slider ',selectClass," ui-btn-down-",trackTheme,' ui-btn-corner-all', inlineClass, miniClass].join(""); + domHandle.className = 'ui-slider-handle'; + domSlider.appendChild(domHandle); + + handle.buttonMarkup({ corners: true, theme: theme, shadow: true }) + .attr({ + "role": "slider", + "aria-valuemin": min, + "aria-valuemax": max, + "aria-valuenow": val(), + "aria-valuetext": val(), + "title": val(), + "aria-labelledby": labelID + }); + + $.extend( this, { + slider: slider, + handle: handle, + valuebg: valuebg, + dragging: false, + beforeStart: null, + userModified: false, + mouseMoved: false + }); + + if ( cType == "select" ) { + var wrapper = document.createElement('div'); + wrapper.className = 'ui-slider-inneroffset'; + + for(var j = 0,length = domSlider.childNodes.length;j < length;j++){ + wrapper.appendChild(domSlider.childNodes[j]); + } + + domSlider.appendChild(wrapper); + + // slider.wrapInner( "<div class='ui-slider-inneroffset'></div>" ); + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + options = control.find( "option" ); + + for(var i = 0, optionsCount = options.length; i < optionsCount; i++){ + var side = !i ? "b":"a", + sliderTheme = !i ? " ui-btn-down-" + trackTheme :( " " + $.mobile.activeBtnClass ), + sliderLabel = document.createElement('div'), + sliderImg = document.createElement('span'); + + sliderImg.className = ['ui-slider-label ui-slider-label-',side,sliderTheme," ui-btn-corner-all"].join(""); + sliderImg.setAttribute('role','img'); + sliderImg.appendChild(document.createTextNode(options[i].innerHTML)); + $(sliderImg).prependTo( slider ); + } + + self._labels = $( ".ui-slider-label", slider ); + + } + + label.addClass( "ui-slider" ); + + // monitor the input for updated values + control.addClass( cType === "input" ? "ui-slider-input" : "ui-slider-switch" ) + .change( function() { + // if the user dragged the handle, the "change" event was triggered from inside refresh(); don't call refresh() again + if (!self.mouseMoved) { + self.refresh( val(), true ); + } + }) + .keyup( function() { // necessary? + self.refresh( val(), true, true ); + }) + .blur( function() { + self.refresh( val(), true ); + }); + + // prevent screen drag when slider activated + $( document ).bind( "vmousemove", function( event ) { + if ( self.dragging ) { + // self.mouseMoved must be updated before refresh() because it will be used in the control "change" event + self.mouseMoved = true; + + if ( cType === "select" ) { + // make the handle move in sync with the mouse + handle.removeClass( "ui-slider-handle-snapping" ); + } + + self.refresh( event ); + + // only after refresh() you can calculate self.userModified + self.userModified = self.beforeStart !== control[0].selectedIndex; + return false; + } + }); + + slider.bind( "vmousedown", function( event ) { + self.dragging = true; + self.userModified = false; + self.mouseMoved = false; + + if ( cType === "select" ) { + self.beforeStart = control[0].selectedIndex; + } + + self.refresh( event ); + return false; + }) + .bind( "vclick", false ); + + slider.add( document ) + .bind( "vmouseup", function() { + if ( self.dragging ) { + + self.dragging = false; + + if ( cType === "select") { + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + if ( self.mouseMoved ) { + + // this is a drag, change the value only if user dragged enough + if ( self.userModified ) { + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + else { + self.refresh( self.beforeStart ); + } + + } + else { + // this is just a click, change the value + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + + } + + self.mouseMoved = false; + + return false; + } + }); + + slider.insertAfter( control ); + + // Only add focus class to toggle switch, sliders get it automatically from ui-btn + if( cType == 'select' ) { + this.handle.bind({ + focus: function() { + slider.addClass( $.mobile.focusClass ); + }, + + blur: function() { + slider.removeClass( $.mobile.focusClass ); + } + }); + } + + this.handle.bind({ + // NOTE force focus on handle + vmousedown: function() { + $( this ).focus(); + }, + + vclick: false, + + keydown: function( event ) { + var index = val(); + + if ( self.options.disabled ) { + return; + } + + // In all cases prevent the default and mark the handle as active + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + case $.mobile.keyCode.END: + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + event.preventDefault(); + + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + } + break; + } + + // move the slider according to the keypress + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + self.refresh( min ); + break; + case $.mobile.keyCode.END: + self.refresh( max ); + break; + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + self.refresh( index + step ); + break; + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + self.refresh( index - step ); + break; + } + }, // remove active mark + + keyup: function( event ) { + if ( self._keySliding ) { + self._keySliding = false; + $( this ).removeClass( "ui-state-active" ); + } + } + }); + + this.refresh(undefined, undefined, true); + }, + + refresh: function( val, isfromControl, preventInputUpdate ) { + + if ( this.options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + var control = this.element, percent, + cType = control[0].nodeName.toLowerCase(), + min = cType === "input" ? parseFloat( control.attr( "min" ) ) : 0, + max = cType === "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length - 1, + step = (cType === "input" && parseFloat( control.attr( "step" ) ) > 0) ? parseFloat(control.attr("step")) : 1; + + if ( typeof val === "object" ) { + var data = val, + // a slight tolerance helped get to the ends of the slider + tol = 8; + if ( !this.dragging || + data.pageX < this.slider.offset().left - tol || + data.pageX > this.slider.offset().left + this.slider.width() + tol ) { + return; + } + percent = Math.round( ( ( data.pageX - this.slider.offset().left ) / this.slider.width() ) * 100 ); + } else { + if ( val == null ) { + val = cType === "input" ? parseFloat( control.val() || 0 ) : control[0].selectedIndex; + } + percent = ( parseFloat( val ) - min ) / ( max - min ) * 100; + } + + if ( isNaN( percent ) ) { + return; + } + + if ( percent < 0 ) { + percent = 0; + } + + if ( percent > 100 ) { + percent = 100; + } + + var newval = ( percent / 100 ) * ( max - min ) + min; + + //from jQuery UI slider, the following source will round to the nearest step + var valModStep = ( newval - min ) % step; + var alignValue = newval - valModStep; + + if ( Math.abs( valModStep ) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see jQueryUI: #4124) + newval = parseFloat( alignValue.toFixed(5) ); + + if ( newval < min ) { + newval = min; + } + + if ( newval > max ) { + newval = max; + } + + this.handle.css( "left", percent + "%" ); + this.handle.attr( { + "aria-valuenow": cType === "input" ? newval : control.find( "option" ).eq( newval ).attr( "value" ), + "aria-valuetext": cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText(), + title: cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText() + }); + this.valuebg && this.valuebg.css( "width", percent + "%" ); + + // drag the label widths + if ( this._labels ) { + var handlePercent = this.handle.width() / this.slider.width() * 100, + aPercent = percent && handlePercent + ( 100 - handlePercent ) * percent / 100, + bPercent = percent === 100 ? 0 : Math.min( handlePercent + 100 - aPercent, 100 ); + + this._labels.each(function(){ + var ab = $(this).is( ".ui-slider-label-a" ); + $( this ).width( ( ab ? aPercent : bPercent ) + "%" ); + }); + } + + if ( !preventInputUpdate ) { + var valueChanged = false; + + // update control"s value + if ( cType === "input" ) { + valueChanged = control.val() !== newval; + control.val( newval ); + } else { + valueChanged = control[ 0 ].selectedIndex !== newval; + control[ 0 ].selectedIndex = newval; + } + if ( !isfromControl && valueChanged ) { + control.trigger( "change" ); + } + } + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.slider.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.slider.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + } + +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.slider.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.selectmenu", $.mobile.widget, { + options: { + theme: null, + disabled: false, + icon: "arrow-d", + iconpos: "right", + inline: false, + corners: true, + shadow: true, + iconshadow: true, + overlayTheme: "a", + hidePlaceholderMenuItems: true, + closeText: "Close", + nativeMenu: true, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "select:not(:jqmData(role='slider'))", + mini: false + }, + + _button: function(){ + return $( "<div/>" ); + }, + + _setDisabled: function( value ) { + this.element.attr( "disabled", value ); + this.button.attr( "aria-disabled", value ); + return this._setOption( "disabled", value ); + }, + + _focusButton : function() { + var self = this; + + setTimeout( function() { + self.button.focus(); + }, 40); + }, + + _selectOptions: function() { + return this.select.find( "option" ); + }, + + // setup items that are generally necessary for select menu extension + _preExtension: function(){ + var classes = ""; + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~this.element[0].className.indexOf( "ui-btn-left" ) ) { + classes = " ui-btn-left"; + } + + if( !!~this.element[0].className.indexOf( "ui-btn-right" ) ) { + classes = " ui-btn-right"; + } + + this.select = this.element.wrap( "<div class='ui-select" + classes + "'>" ); + this.selectID = this.select.attr( "id" ); + this.label = $( "label[for='"+ this.selectID +"']" ).addClass( "ui-select" ); + this.isMultiple = this.select[ 0 ].multiple; + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.select, "c" ); + } + }, + + _create: function() { + this._preExtension(); + + // Allows for extension of the native select for custom selects and other plugins + // see select.custom for example extension + // TODO explore plugin registration + this._trigger( "beforeCreate" ); + + this.button = this._button(); + + var self = this, + + options = this.options, + + // IE throws an exception at options.item() function when + // there is no selected item + // select first in this case + selectedIndex = this.select[ 0 ].selectedIndex == -1 ? 0 : this.select[ 0 ].selectedIndex, + + // TODO values buttonId and menuId are undefined here + button = this.button + .text( $( this.select[ 0 ].options.item( selectedIndex ) ).text() ) + .insertBefore( this.select ) + .buttonMarkup( { + theme: options.theme, + icon: options.icon, + iconpos: options.iconpos, + inline: options.inline, + corners: options.corners, + shadow: options.shadow, + iconshadow: options.iconshadow, + mini: options.mini + }); + + // Opera does not properly support opacity on select elements + // In Mini, it hides the element, but not its text + // On the desktop,it seems to do the opposite + // for these reasons, using the nativeMenu option results in a full native select in Opera + if ( options.nativeMenu && window.opera && window.opera.version ) { + this.select.addClass( "ui-select-nativeonly" ); + } + + // Add counter for multi selects + if ( this.isMultiple ) { + this.buttonCount = $( "<span>" ) + .addClass( "ui-li-count ui-btn-up-c ui-btn-corner-all" ) + .hide() + .appendTo( button.addClass('ui-li-has-count') ); + } + + // Disable if specified + if ( options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + // Events on native select + this.select.change( function() { + self.refresh(); + }); + + this.build(); + }, + + build: function() { + var self = this; + + this.select + .appendTo( self.button ) + .bind( "vmousedown", function() { + // Add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + }) + .bind( "focus", function() { + self.button.addClass( $.mobile.focusClass ); + }) + .bind( "blur", function() { + self.button.removeClass( $.mobile.focusClass ); + }) + .bind( "focus vmouseover", function() { + self.button.trigger( "vmouseover" ); + }) + .bind( "vmousemove", function() { + // Remove active class on scroll/touchmove + self.button.removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur vmouseout", function() { + self.button.trigger( "vmouseout" ) + .removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur", function() { + self.button.removeClass( "ui-btn-down-" + self.options.theme ); + }); + + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + self.button.bind( "vmousedown", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "mouseup", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + }, + + selected: function() { + return this._selectOptions().filter( ":selected" ); + }, + + selectedIndices: function() { + var self = this; + + return this.selected().map( function() { + return self._selectOptions().index( this ); + }).get(); + }, + + setButtonText: function() { + var self = this, selected = this.selected(); + + this.button.find( ".ui-btn-text" ).text( function() { + if ( !self.isMultiple ) { + return selected.text(); + } + + return selected.length ? selected.map( function() { + return $( this ).text(); + }).get().join( ", " ) : self.placeholder; + }); + }, + + setButtonCount: function() { + var selected = this.selected(); + + // multiple count inside button + if ( this.isMultiple ) { + this.buttonCount[ selected.length > 1 ? "show" : "hide" ]().text( selected.length ); + } + }, + + refresh: function() { + this.setButtonText(); + this.setButtonCount(); + }, + + // open and close preserved in native selects + // to simplify users code when looping over selects + open: $.noop, + close: $.noop, + + disable: function() { + this._setDisabled( true ); + this.button.addClass( "ui-disabled" ); + }, + + enable: function() { + this._setDisabled( false ); + this.button.removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.selectmenu.prototype.enhanceWithin( e.target, true ); +}); +})( jQuery ); + +/* +* custom "selectmenu" plugin +*/ + +(function( $, undefined ) { + var extendSelect = function( widget ){ + + var select = widget.select, + selectID = widget.selectID, + label = widget.label, + thisPage = widget.select.closest( ".ui-page" ), + screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"} ).appendTo( thisPage ), + selectOptions = widget._selectOptions(), + isMultiple = widget.isMultiple = widget.select[ 0 ].multiple, + buttonId = selectID + "-button", + menuId = selectID + "-menu", + menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ widget.options.theme +"' data-" +$.mobile.ns + "overlay-theme='"+ widget.options.overlayTheme +"'>" + + "<div data-" + $.mobile.ns + "role='header'>" + + "<div class='ui-title'>" + label.getEncodedText() + "</div>"+ + "</div>"+ + "<div data-" + $.mobile.ns + "role='content'></div>"+ + "</div>" ), + + listbox = $("<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-" + widget.options.overlayTheme + " " + $.mobile.defaultDialogTransition } ).insertAfter(screen), + + list = $( "<ul>", { + "class": "ui-selectmenu-list", + "id": menuId, + "role": "listbox", + "aria-labelledby": buttonId + }).attr( "data-" + $.mobile.ns + "theme", widget.options.theme ).appendTo( listbox ), + + header = $( "<div>", { + "class": "ui-header ui-bar-" + widget.options.theme + }).prependTo( listbox ), + + headerTitle = $( "<h1>", { + "class": "ui-title" + }).appendTo( header ), + + menuPageContent, + menuPageClose, + headerClose; + + if( widget.isMultiple ) { + headerClose = $( "<a>", { + "text": widget.options.closeText, + "href": "#", + "class": "ui-btn-left" + }).attr( "data-" + $.mobile.ns + "iconpos", "notext" ).attr( "data-" + $.mobile.ns + "icon", "delete" ).appendTo( header ).buttonMarkup(); + } + + $.extend( widget, { + select: widget.select, + selectID: selectID, + buttonId: buttonId, + menuId: menuId, + thisPage: thisPage, + menuPage: menuPage, + label: label, + screen: screen, + selectOptions: selectOptions, + isMultiple: isMultiple, + theme: widget.options.theme, + listbox: listbox, + list: list, + header: header, + headerTitle: headerTitle, + headerClose: headerClose, + menuPageContent: menuPageContent, + menuPageClose: menuPageClose, + placeholder: "", + + build: function() { + var self = this; + + // Create list from select, update state + self.refresh(); + + self.select.attr( "tabindex", "-1" ).focus(function() { + $( this ).blur(); + self.button.focus(); + }); + + // Button events + self.button.bind( "vclick keydown" , function( event ) { + if ( event.type == "vclick" || + event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || + event.keyCode === $.mobile.keyCode.SPACE ) ) { + + self.open(); + event.preventDefault(); + } + }); + + // Events for list items + self.list.attr( "role", "listbox" ) + .bind( "focusin", function( e ){ + $( e.target ) + .attr( "tabindex", "0" ) + .trigger( "vmouseover" ); + + }) + .bind( "focusout", function( e ){ + $( e.target ) + .attr( "tabindex", "-1" ) + .trigger( "vmouseout" ); + }) + .delegate( "li:not(.ui-disabled, .ui-li-divider)", "click", function( event ) { + + // index of option tag to be selected + var oldIndex = self.select[ 0 ].selectedIndex, + newIndex = self.list.find( "li:not(.ui-li-divider)" ).index( this ), + option = self._selectOptions().eq( newIndex )[ 0 ]; + + // toggle selected status on the tag for multi selects + option.selected = self.isMultiple ? !option.selected : true; + + // toggle checkbox class for multiple selects + if ( self.isMultiple ) { + $( this ).find( ".ui-icon" ) + .toggleClass( "ui-icon-checkbox-on", option.selected ) + .toggleClass( "ui-icon-checkbox-off", !option.selected ); + } + + // trigger change if value changed + if ( self.isMultiple || oldIndex !== newIndex ) { + self.select.trigger( "change" ); + } + + //hide custom select for single selects only + if ( !self.isMultiple ) { + self.close(); + } + + event.preventDefault(); + }) + .keydown(function( event ) { //keyboard events for menu items + var target = $( event.target ), + li = target.closest( "li" ), + prev, next; + + // switch logic based on which key was pressed + switch ( event.keyCode ) { + // up or left arrow keys + case 38: + prev = li.prev().not( ".ui-selectmenu-placeholder" ); + + if( prev.is( ".ui-li-divider" ) ) { + prev = prev.prev(); + } + + // if there's a previous option, focus it + if ( prev.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + prev.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // down or right arrow keys + case 40: + next = li.next(); + + if( next.is( ".ui-li-divider" ) ) { + next = next.next(); + } + + // if there's a next option, focus it + if ( next.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + next.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // If enter or space is pressed, trigger click + case 13: + case 32: + target.trigger( "click" ); + + return false; + break; + } + }); + + // button refocus ensures proper height calculation + // by removing the inline style and ensuring page inclusion + self.menuPage.bind( "pagehide", function() { + self.list.appendTo( self.listbox ); + self._focusButton(); + + // TODO centralize page removal binding / handling in the page plugin. + // Suggestion from @jblas to do refcounting + // + // TODO extremely confusing dependency on the open method where the pagehide.remove + // bindings are stripped to prevent the parent page from disappearing. The way + // we're keeping pages in the DOM right now sucks + // + // rebind the page remove that was unbound in the open function + // to allow for the parent page removal from actions other than the use + // of a dialog sized custom select + // + // doing this here provides for the back button on the custom select dialog + $.mobile._bindPageRemove.call( self.thisPage ); + }); + + // Events on "screen" overlay + self.screen.bind( "vclick", function( event ) { + self.close(); + }); + + // Close button on small overlays + if( self.isMultiple ){ + self.headerClose.click( function() { + if ( self.menuType == "overlay" ) { + self.close(); + return false; + } + }); + } + + // track this dependency so that when the parent page + // is removed on pagehide it will also remove the menupage + self.thisPage.addDependents( this.menuPage ); + }, + + _isRebuildRequired: function() { + var list = this.list.find( "li" ), + options = this._selectOptions(); + + // TODO exceedingly naive method to determine difference + // ignores value changes etc in favor of a forcedRebuild + // from the user in the refresh method + return options.text() !== list.text(); + }, + + refresh: function( forceRebuild , foo ){ + var self = this, + select = this.element, + isMultiple = this.isMultiple, + options = this._selectOptions(), + selected = this.selected(), + // return an array of all selected index's + indicies = this.selectedIndices(); + + if ( forceRebuild || this._isRebuildRequired() ) { + self._buildList(); + } + + self.setButtonText(); + self.setButtonCount(); + + self.list.find( "li:not(.ui-li-divider)" ) + .removeClass( $.mobile.activeBtnClass ) + .attr( "aria-selected", false ) + .each(function( i ) { + + if ( $.inArray( i, indicies ) > -1 ) { + var item = $( this ); + + // Aria selected attr + item.attr( "aria-selected", true ); + + // Multiple selects: add the "on" checkbox state to the icon + if ( self.isMultiple ) { + item.find( ".ui-icon" ).removeClass( "ui-icon-checkbox-off" ).addClass( "ui-icon-checkbox-on" ); + } else { + if( item.is( ".ui-selectmenu-placeholder" ) ) { + item.next().addClass( $.mobile.activeBtnClass ); + } else { + item.addClass( $.mobile.activeBtnClass ); + } + } + } + }); + }, + + close: function() { + if ( this.options.disabled || !this.isOpen ) { + return; + } + + var self = this; + + if ( self.menuType == "page" ) { + // doesn't solve the possible issue with calling change page + // where the objects don't define data urls which prevents dialog key + // stripping - changePage has incoming refactor + window.history.back(); + } else { + self.screen.addClass( "ui-screen-hidden" ); + self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass( "in" ); + self.list.appendTo( self.listbox ); + self._focusButton(); + } + + // allow the dialog to be closed again + self.isOpen = false; + }, + + open: function() { + if ( this.options.disabled ) { + return; + } + + var self = this, + $window = $( window ), + selfListParent = self.list.parent(), + menuHeight = selfListParent.outerHeight(), + menuWidth = selfListParent.outerWidth(), + activePage = $( ".ui-page-active" ), + tScrollElem = activePage, + scrollTop = $window.scrollTop(), + btnOffset = self.button.offset().top, + screenHeight = $window.height(), + screenWidth = $window.width(); + + //add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + + //remove after delay + setTimeout( function() { + self.button.removeClass( $.mobile.activeBtnClass ); + }, 300); + + function focusMenuItem() { + self.list.find( "." + $.mobile.activeBtnClass + " a" ).focus(); + } + + if ( menuHeight > screenHeight - 80 || !$.support.scrollTop ) { + + self.menuPage.appendTo( $.mobile.pageContainer ).page(); + self.menuPageContent = menuPage.find( ".ui-content" ); + self.menuPageClose = menuPage.find( ".ui-header a" ); + + // prevent the parent page from being removed from the DOM, + // otherwise the results of selecting a list item in the dialog + // fall into a black hole + self.thisPage.unbind( "pagehide.remove" ); + + //for WebOS/Opera Mini (set lastscroll using button offset) + if ( scrollTop == 0 && btnOffset > screenHeight ) { + self.thisPage.one( "pagehide", function() { + $( this ).jqmData( "lastScroll", btnOffset ); + }); + } + + self.menuPage.one( "pageshow", function() { + focusMenuItem(); + self.isOpen = true; + }); + + self.menuType = "page"; + self.menuPageContent.append( self.list ); + self.menuPage.find("div .ui-title").text(self.label.text()); + $.mobile.changePage( self.menuPage, { + transition: $.mobile.defaultDialogTransition + }); + } else { + self.menuType = "overlay"; + + self.screen.height( $(document).height() ) + .removeClass( "ui-screen-hidden" ); + + // Try and center the overlay over the button + var roomtop = btnOffset - scrollTop, + roombot = scrollTop + screenHeight - btnOffset, + halfheight = menuHeight / 2, + maxwidth = parseFloat( self.list.parent().css( "max-width" ) ), + newtop, newleft; + + if ( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ) { + newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight; + } else { + // 30px tolerance off the edges + newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30; + } + + // If the menuwidth is smaller than the screen center is + if ( menuWidth < maxwidth ) { + newleft = ( screenWidth - menuWidth ) / 2; + } else { + + //otherwise insure a >= 30px offset from the left + newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2; + + // 30px tolerance off the edges + if ( newleft < 30 ) { + newleft = 30; + } else if ( (newleft + menuWidth) > screenWidth ) { + newleft = screenWidth - menuWidth - 30; + } + } + + self.listbox.append( self.list ) + .removeClass( "ui-selectmenu-hidden" ) + .css({ + top: newtop, + left: newleft + }) + .addClass( "in" ); + + focusMenuItem(); + + // duplicate with value set in page show for dialog sized selects + self.isOpen = true; + } + }, + + _buildList: function() { + var self = this, + o = this.options, + placeholder = this.placeholder, + needPlaceholder = true, + optgroups = [], + lis = [], + dataIcon = self.isMultiple ? "checkbox-off" : "false"; + + self.list.empty().filter( ".ui-listview" ).listview( "destroy" ); + + var $options = self.select.find("option"), + numOptions = $options.length, + select = this.select[ 0 ], + dataPrefix = 'data-' + $.mobile.ns, + dataIndexAttr = dataPrefix + 'option-index', + dataIconAttr = dataPrefix + 'icon', + dataRoleAttr = dataPrefix + 'role', + fragment = document.createDocumentFragment(), + optGroup; + + for (var i = 0; i < numOptions;i++){ + var option = $options[i], + $option = $(option), + parent = option.parentNode, + text = $option.text(), + anchor = document.createElement('a'), + classes = []; + + anchor.setAttribute('href','#'); + anchor.appendChild(document.createTextNode(text)); + + // Are we inside an optgroup? + if (parent !== select && parent.nodeName.toLowerCase() === "optgroup"){ + var optLabel = parent.getAttribute('label'); + if ( optLabel != optGroup) { + var divider = document.createElement('li'); + divider.setAttribute(dataRoleAttr,'list-divider'); + divider.setAttribute('role','option'); + divider.setAttribute('tabindex','-1'); + divider.appendChild(document.createTextNode(optLabel)); + fragment.appendChild(divider); + optGroup = optLabel; + } + } + + if (needPlaceholder && (!option.getAttribute( "value" ) || text.length == 0 || $option.jqmData( "placeholder" ))) { + needPlaceholder = false; + if ( o.hidePlaceholderMenuItems ) { + classes.push( "ui-selectmenu-placeholder" ); + } + if (!placeholder) { + placeholder = self.placeholder = text; + } + } + + var item = document.createElement('li'); + if ( option.disabled ) { + classes.push( "ui-disabled" ); + item.setAttribute('aria-disabled',true); + } + item.setAttribute(dataIndexAttr,i); + item.setAttribute(dataIconAttr,dataIcon); + item.className = classes.join(" "); + item.setAttribute('role','option'); + anchor.setAttribute('tabindex','-1'); + item.appendChild(anchor); + fragment.appendChild(item); + } + + self.list[0].appendChild(fragment); + + // Hide header if it's not a multiselect and there's no placeholder + if ( !this.isMultiple && !placeholder.length ) { + this.header.hide(); + } else { + this.headerTitle.text( this.placeholder ); + } + + // Now populated, create listview + self.list.listview(); + }, + + _button: function(){ + return $( "<a>", { + "href": "#", + "role": "button", + // TODO value is undefined at creation + "id": this.buttonId, + "aria-haspopup": "true", + + // TODO value is undefined at creation + "aria-owns": this.menuId + }); + } + }); + }; + + // issue #3894 - core doesn't triggered events on disabled delegates + $( document ).bind( "selectmenubeforecreate", function( event ){ + var selectmenuWidget = $( event.target ).data( "selectmenu" ); + + if( !selectmenuWidget.options.nativeMenu ){ + extendSelect( selectmenuWidget ); + } + }); +})( jQuery ); + +(function( $, undefined ) { + + + $.widget( "mobile.fixedtoolbar", $.mobile.widget, { + options: { + visibleOnPageShow: true, + disablePageZoom: true, + transition: "slide", //can be none, fade, slide (slide maps to slideup or slidedown) + fullscreen: false, + tapToggle: true, + tapToggleBlacklist: "a, input, select, textarea, .ui-header-fixed, .ui-footer-fixed", + hideDuringFocus: "input, textarea, select", + updatePagePadding: true, + trackPersistentToolbars: true, + + // Browser detection! Weeee, here we go... + // Unfortunately, position:fixed is costly, not to mention probably impossible, to feature-detect accurately. + // Some tests exist, but they currently return false results in critical devices and browsers, which could lead to a broken experience. + // Testing fixed positioning is also pretty obtrusive to page load, requiring injected elements and scrolling the window + // The following function serves to rule out some popular browsers with known fixed-positioning issues + // This is a plugin option like any other, so feel free to improve or overwrite it + supportBlacklist: function(){ + var w = window, + ua = navigator.userAgent, + platform = navigator.platform, + // Rendering engine is Webkit, and capture major version + wkmatch = ua.match( /AppleWebKit\/([0-9]+)/ ), + wkversion = !!wkmatch && wkmatch[ 1 ], + ffmatch = ua.match( /Fennec\/([0-9]+)/ ), + ffversion = !!ffmatch && ffmatch[ 1 ], + operammobilematch = ua.match( /Opera Mobi\/([0-9]+)/ ), + omversion = !!operammobilematch && operammobilematch[ 1 ]; + + if( + // iOS 4.3 and older : Platform is iPhone/Pad/Touch and Webkit version is less than 534 (ios5) + ( ( platform.indexOf( "iPhone" ) > -1 || platform.indexOf( "iPad" ) > -1 || platform.indexOf( "iPod" ) > -1 ) && wkversion && wkversion < 534 ) + || + // Opera Mini + ( w.operamini && ({}).toString.call( w.operamini ) === "[object OperaMini]" ) + || + ( operammobilematch && omversion < 7458 ) + || + //Android lte 2.1: Platform is Android and Webkit version is less than 533 (Android 2.2) + ( ua.indexOf( "Android" ) > -1 && wkversion && wkversion < 533 ) + || + // Firefox Mobile before 6.0 - + ( ffversion && ffversion < 6 ) + || + // WebOS less than 3 + ( "palmGetResource" in window && wkversion && wkversion < 534 ) + || + // MeeGo + ( ua.indexOf( "MeeGo" ) > -1 && ua.indexOf( "NokiaBrowser/8.5.0" ) > -1 ) + ){ + return true; + } + + return false; + }, + initSelector: ":jqmData(position='fixed')" + }, + + _create: function() { + + var self = this, + o = self.options, + $el = self.element, + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer", + $page = $el.closest(".ui-page"); + + // Feature detecting support for + if( o.supportBlacklist() ){ + self.destroy(); + return; + } + + $el.addClass( "ui-"+ tbtype +"-fixed" ); + + // "fullscreen" overlay positioning + if( o.fullscreen ){ + $el.addClass( "ui-"+ tbtype +"-fullscreen" ); + $page.addClass( "ui-page-" + tbtype + "-fullscreen" ); + } + // If not fullscreen, add class to page to set top or bottom padding + else{ + $page.addClass( "ui-page-" + tbtype + "-fixed" ); + } + + self._addTransitionClass(); + self._bindPageEvents(); + self._bindToggleHandlers(); + }, + + _addTransitionClass: function(){ + var tclass = this.options.transition; + + if( tclass && tclass !== "none" ){ + // use appropriate slide for header or footer + if( tclass === "slide" ){ + tclass = this.element.is( ".ui-header" ) ? "slidedown" : "slideup"; + } + + this.element.addClass( tclass ); + } + }, + + _bindPageEvents: function(){ + var self = this, + o = self.options, + $el = self.element; + + //page event bindings + // Fixed toolbars require page zoom to be disabled, otherwise usability issues crop up + // This method is meant to disable zoom while a fixed-positioned toolbar page is visible + $el.closest( ".ui-page" ) + .bind( "pagebeforeshow", function(){ + if( o.disablePageZoom ){ + $.mobile.zoom.disable( true ); + } + if( !o.visibleOnPageShow ){ + self.hide( true ); + } + } ) + .bind( "webkitAnimationStart animationstart updatelayout", function(){ + if( o.updatePagePadding ){ + self.updatePagePadding(); + } + }) + .bind( "pageshow", function(){ + self.updatePagePadding(); + if( o.updatePagePadding ){ + $( window ).bind( "throttledresize." + self.widgetName, function(){ + self.updatePagePadding(); + }); + } + }) + .bind( "pagebeforehide", function( e, ui ){ + if( o.disablePageZoom ){ + $.mobile.zoom.enable( true ); + } + if( o.updatePagePadding ){ + $( window ).unbind( "throttledresize." + self.widgetName ); + } + + if( o.trackPersistentToolbars ){ + var thisFooter = $( ".ui-footer-fixed:jqmData(id)", this ), + thisHeader = $( ".ui-header-fixed:jqmData(id)", this ), + nextFooter = thisFooter.length && ui.nextPage && $( ".ui-footer-fixed:jqmData(id='" + thisFooter.jqmData( "id" ) + "')", ui.nextPage ), + nextHeader = thisHeader.length && ui.nextPage && $( ".ui-header-fixed:jqmData(id='" + thisHeader.jqmData( "id" ) + "')", ui.nextPage ); + + nextFooter = nextFooter || $(); + + if( nextFooter.length || nextHeader.length ){ + + nextFooter.add( nextHeader ).appendTo( $.mobile.pageContainer ); + + ui.nextPage.one( "pageshow", function(){ + nextFooter.add( nextHeader ).appendTo( this ); + }); + } + } + }); + }, + + _visible: true, + + // This will set the content element's top or bottom padding equal to the toolbar's height + updatePagePadding: function() { + var $el = this.element, + header = $el.is( ".ui-header" ); + + // This behavior only applies to "fixed", not "fullscreen" + if( this.options.fullscreen ){ return; } + + $el.closest( ".ui-page" ).css( "padding-" + ( header ? "top" : "bottom" ), $el.outerHeight() ); + }, + + _useTransition: function( notransition ){ + var $win = $( window ), + $el = this.element, + scroll = $win.scrollTop(), + elHeight = $el.height(), + pHeight = $el.closest( ".ui-page" ).height(), + viewportHeight = $.mobile.getScreenHeight(), + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer"; + + return !notransition && + ( this.options.transition && this.options.transition !== "none" && + ( + ( tbtype === "header" && !this.options.fullscreen && scroll > elHeight ) || + ( tbtype === "footer" && !this.options.fullscreen && scroll + viewportHeight < pHeight - elHeight ) + ) || this.options.fullscreen + ); + }, + + show: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element; + + if( this._useTransition( notransition ) ){ + $el + .removeClass( "out " + hideClass ) + .addClass( "in" ); + } + else { + $el.removeClass( hideClass ); + } + this._visible = true; + }, + + hide: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element, + // if it's a slide transition, our new transitions need the reverse class as well to slide outward + outclass = "out" + ( this.options.transition === "slide" ? " reverse" : "" ); + + if( this._useTransition( notransition ) ){ + $el + .addClass( outclass ) + .removeClass( "in" ) + .animationComplete( function(){ + $el.addClass( hideClass ).removeClass( outclass ); + }); + } + else { + $el.addClass( hideClass ).removeClass( outclass ); + } + this._visible = false; + }, + + toggle: function(){ + this[ this._visible ? "hide" : "show" ](); + }, + + _bindToggleHandlers: function(){ + var self = this, + o = self.options, + $el = self.element; + + // tap toggle + $el.closest( ".ui-page" ) + .bind( "vclick", function( e ){ + if( o.tapToggle && !$( e.target ).closest( o.tapToggleBlacklist ).length ){ + self.toggle(); + } + }) + .bind( "focusin focusout", function( e ){ + if( screen.width < 500 && $( e.target ).is( o.hideDuringFocus ) && !$( e.target ).closest( ".ui-header-fixed, .ui-footer-fixed" ).length ){ + self[ ( e.type === "focusin" && self._visible ) ? "hide" : "show" ](); + } + }); + }, + + destroy: function(){ + this.element.removeClass( "ui-header-fixed ui-footer-fixed ui-header-fullscreen ui-footer-fullscreen in out fade slidedown slideup ui-fixed-hidden" ); + this.element.closest( ".ui-page" ).removeClass( "ui-page-header-fixed ui-page-footer-fixed ui-page-header-fullscreen ui-page-footer-fullscreen" ); + } + + }); + + //auto self-init widgets + $( document ) + .bind( "pagecreate create", function( e ){ + + // DEPRECATED in 1.1: support for data-fullscreen=true|false on the page element. + // This line ensures it still works, but we recommend moving the attribute to the toolbars themselves. + if( $( e.target ).jqmData( "fullscreen" ) ){ + $( $.mobile.fixedtoolbar.prototype.options.initSelector, e.target ).not( ":jqmData(fullscreen)" ).jqmData( "fullscreen", true ); + } + + $.mobile.fixedtoolbar.prototype.enhanceWithin( e.target ); + }); + +})( jQuery ); + +( function( $, window ) { + + // This fix addresses an iOS bug, so return early if the UA claims it's something else. + if( !(/iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1 ) ){ + return; + } + + var zoom = $.mobile.zoom, + evt, x, y, z, aig; + + function checkTilt( e ){ + evt = e.originalEvent; + aig = evt.accelerationIncludingGravity; + + x = Math.abs( aig.x ); + y = Math.abs( aig.y ); + z = Math.abs( aig.z ); + + // If portrait orientation and in one of the danger zones + if( !window.orientation && ( x > 7 || ( ( z > 6 && y < 8 || z < 8 && y > 6 ) && x > 5 ) ) ){ + if( zoom.enabled ){ + zoom.disable(); + } + } + else if( !zoom.enabled ){ + zoom.enable(); + } + } + + $( window ) + .bind( "orientationchange.iosorientationfix", zoom.enable ) + .bind( "devicemotion.iosorientationfix", checkTilt ); + +}( jQuery, this )); + +( function( $, window, undefined ) { + var $html = $( "html" ), + $head = $( "head" ), + $window = $( window ); + + // trigger mobileinit event - useful hook for configuring $.mobile settings before they're used + $( window.document ).trigger( "mobileinit" ); + + // support conditions + // if device support condition(s) aren't met, leave things as they are -> a basic, usable experience, + // otherwise, proceed with the enhancements + if ( !$.mobile.gradeA() ) { + return; + } + + // override ajaxEnabled on platforms that have known conflicts with hash history updates + // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini) + if ( $.mobile.ajaxBlacklist ) { + $.mobile.ajaxEnabled = false; + } + + // Add mobile, initial load "rendering" classes to docEl + $html.addClass( "ui-mobile ui-mobile-rendering" ); + + // This is a fallback. If anything goes wrong (JS errors, etc), or events don't fire, + // this ensures the rendering class is removed after 5 seconds, so content is visible and accessible + setTimeout( hideRenderingClass, 5000 ); + + // loading div which appears during Ajax requests + // will not appear if $.mobile.loadingMessage is false + var loaderClass = "ui-loader", + $loader = $( "<div class='" + loaderClass + "'><span class='ui-icon ui-icon-loading'></span><h1></h1></div>" ); + + // For non-fixed supportin browsers. Position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top + function fakeFixLoader(){ + var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); + + $loader + .css({ + top: $.support.scrollTop && $window.scrollTop() + $window.height() / 2 || + activeBtn.length && activeBtn.offset().top || 100 + }); + } + + // check position of loader to see if it appears to be "fixed" to center + // if not, use abs positioning + function checkLoaderPosition(){ + var offset = $loader.offset(), + scrollTop = $window.scrollTop(), + screenHeight = $.mobile.getScreenHeight(); + + if( offset.top < scrollTop || (offset.top - scrollTop) > screenHeight ) { + $loader.addClass( "ui-loader-fakefix" ); + fakeFixLoader(); + $window + .unbind( "scroll", checkLoaderPosition ) + .bind( "scroll", fakeFixLoader ); + } + } + + //remove initial build class (only present on first pageshow) + function hideRenderingClass(){ + $html.removeClass( "ui-mobile-rendering" ); + } + + $.extend($.mobile, { + // turn on/off page loading message. + showPageLoadingMsg: function( theme, msgText, textonly ) { + $html.addClass( "ui-loading" ); + + if ( $.mobile.loadingMessage ) { + // text visibility from argument takes priority + var textVisible = textonly || $.mobile.loadingMessageTextVisible; + + theme = theme || $.mobile.loadingMessageTheme, + + $loader + .attr( "class", loaderClass + " ui-corner-all ui-body-" + ( theme || "a" ) + " ui-loader-" + ( textVisible ? "verbose" : "default" ) + ( textonly ? " ui-loader-textonly" : "" ) ) + .find( "h1" ) + .text( msgText || $.mobile.loadingMessage ) + .end() + .appendTo( $.mobile.pageContainer ); + + checkLoaderPosition(); + $window.bind( "scroll", checkLoaderPosition ); + } + }, + + hidePageLoadingMsg: function() { + $html.removeClass( "ui-loading" ); + + if( $.mobile.loadingMessage ){ + $loader.removeClass( "ui-loader-fakefix" ); + } + + $( window ).unbind( "scroll", fakeFixLoader ); + $( window ).unbind( "scroll", checkLoaderPosition ); + }, + + // find and enhance the pages in the dom and transition to the first page. + initializePage: function() { + // find present pages + var $pages = $( ":jqmData(role='page'), :jqmData(role='dialog')" ); + + // if no pages are found, create one with body's inner html + if ( !$pages.length ) { + $pages = $( "body" ).wrapInner( "<div data-" + $.mobile.ns + "role='page'></div>" ).children( 0 ); + } + + // add dialogs, set data-url attrs + $pages.each(function() { + var $this = $(this); + + // unless the data url is already set set it to the pathname + if ( !$this.jqmData("url") ) { + $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) || location.pathname + location.search ); + } + }); + + // define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback) + $.mobile.firstPage = $pages.first(); + + // define page container + $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" ); + + // alert listeners that the pagecontainer has been determined for binding + // to events triggered on it + $window.trigger( "pagecontainercreate" ); + + // cue page loading message + $.mobile.showPageLoadingMsg(); + + //remove initial build class (only present on first pageshow) + hideRenderingClass(); + + // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM + if ( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ) { + $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } ); + } + // otherwise, trigger a hashchange to load a deeplink + else { + $window.trigger( "hashchange", [ true ] ); + } + } + }); + + // initialize events now, after mobileinit has occurred + $.mobile._registerInternalEvents(); + + // check which scrollTop value should be used by scrolling to 1 immediately at domready + // then check what the scroll top is. Android will report 0... others 1 + // note that this initial scroll won't hide the address bar. It's just for the check. + $(function() { + window.scrollTo( 0, 1 ); + + // if defaultHomeScroll hasn't been set yet, see if scrollTop is 1 + // it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar) + // so if it's 1, use 0 from now on + $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1; + + + // TODO: Implement a proper registration mechanism with dependency handling in order to not have exceptions like the one below + //auto self-init widgets for those widgets that have a soft dependency on others + if ( $.fn.controlgroup ) { + $( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='controlgroup')", e.target ) + .jqmEnhanceable() + .controlgroup({ excludeInvisible: false }); + }); + } + + //dom-ready inits + if( $.mobile.autoInitializePage ){ + $.mobile.initializePage(); + } + + // window load event + // hide iOS browser chrome on load + $window.load( $.mobile.silentScroll ); + }); +}( jQuery, this )); + + +})); diff --git a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js deleted file mode 100644 index 78ae1d6..0000000 --- a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.14.custom.min.js +++ /dev/null @@ -1,141 +0,0 @@ -/*! - * jQuery UI 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); -b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, -"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", -function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, -outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); -return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= -0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); -;/*! - * jQuery UI Widget 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, -a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; -e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, -this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, -widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, -enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -;/*! - * jQuery UI Mouse 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ -this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== -false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& -!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Dialog 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= -1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), -height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); -b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a= -a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); -;/* - * jQuery UI Tabs 1.8.14 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& -a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); -;
\ No newline at end of file diff --git a/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js new file mode 100644 index 0000000..42413ed --- /dev/null +++ b/h-source/Public/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js @@ -0,0 +1,1937 @@ +/*! + * jQuery UI 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.21", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/*! + * jQuery UI Position 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); +/*! + * jQuery UI Dialog 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.21", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); |