diff options
Diffstat (limited to 'Js/jquery')
39 files changed, 12275 insertions, 0 deletions
diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png Binary files differnew file mode 100755 index 0000000..82524ab --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png Binary files differnew file mode 100755 index 0000000..6aed97a --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png Binary files differnew file mode 100755 index 0000000..f11ca67 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png Binary files differnew file mode 100755 index 0000000..68306d1 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png Binary files differnew file mode 100755 index 0000000..f567c28 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png Binary files differnew file mode 100755 index 0000000..29e9965 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png Binary files differnew file mode 100755 index 0000000..9a46d19 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png b/Js/jquery/dialog/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png Binary files differnew file mode 100755 index 0000000..f811f30 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-icons_0a82eb_256x240.png b/Js/jquery/dialog/css/excite-bike/images/ui-icons_0a82eb_256x240.png Binary files differnew file mode 100755 index 0000000..755fe99 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-icons_0a82eb_256x240.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-icons_0b54d5_256x240.png b/Js/jquery/dialog/css/excite-bike/images/ui-icons_0b54d5_256x240.png Binary files differnew file mode 100755 index 0000000..98705f9 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-icons_0b54d5_256x240.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-icons_5fa5e3_256x240.png b/Js/jquery/dialog/css/excite-bike/images/ui-icons_5fa5e3_256x240.png Binary files differnew file mode 100755 index 0000000..2179078 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-icons_5fa5e3_256x240.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-icons_fcdd4a_256x240.png b/Js/jquery/dialog/css/excite-bike/images/ui-icons_fcdd4a_256x240.png Binary files differnew file mode 100755 index 0000000..de76ce2 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-icons_fcdd4a_256x240.png diff --git a/Js/jquery/dialog/css/excite-bike/images/ui-icons_ffffff_256x240.png b/Js/jquery/dialog/css/excite-bike/images/ui-icons_ffffff_256x240.png Binary files differnew file mode 100755 index 0000000..42f8f99 --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/images/ui-icons_ffffff_256x240.png diff --git a/Js/jquery/dialog/css/excite-bike/jquery-ui-1.8.4.custom.css b/Js/jquery/dialog/css/excite-bike/jquery-ui-1.8.4.custom.css new file mode 100755 index 0000000..c4ed3ea --- /dev/null +++ b/Js/jquery/dialog/css/excite-bike/jquery-ui-1.8.4.custom.css @@ -0,0 +1,315 @@ +/* + * jQuery UI CSS Framework @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=segoe%20ui,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=3px&bgColorHeader=f9f9f9&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=cccccc&fcHeader=e69700&iconColorHeader=5fa5e3&bgColorContent=eeeeee&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=0a82eb&bgColorDefault=1484e6&bgTextureDefault=08_diagonals_thick.png&bgImgOpacityDefault=22&borderColorDefault=ffffff&fcDefault=ffffff&iconColorDefault=fcdd4a&bgColorHover=2293f7&bgTextureHover=08_diagonals_thick.png&bgImgOpacityHover=26&borderColorHover=2293f7&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=e69700&bgTextureActive=08_diagonals_thick.png&bgImgOpacityActive=20&borderColorActive=e69700&fcActive=ffffff&iconColorActive=ffffff&bgColorHighlight=c5ddfc&bgTextureHighlight=07_diagonals_small.png&bgImgOpacityHighlight=25&borderColorHighlight=ffffff&fcHighlight=333333&iconColorHighlight=0b54d5&bgColorError=e69700&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=20&borderColorError=e69700&fcError=ffffff&iconColorError=ffffff&bgColorOverlay=e6b900&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=e69700&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=20&thicknessShadow=0px&offsetTopShadow=6px&offsetLeftShadow=6px&cornerRadiusShadow=3px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: segoe ui, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: segoe ui, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #eeeeee url(images/ui-bg_inset-hard_100_eeeeee_1x100.png) 50% bottom repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #cccccc; background: #f9f9f9 url(images/ui-bg_highlight-soft_100_f9f9f9_1x100.png) 50% 50% repeat-x; color: #e69700; font-weight: bold; } +.ui-widget-header a { color: #e69700; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #ffffff; background: #1484e6 url(images/ui-bg_diagonals-thick_22_1484e6_40x40.png) 50% 50% repeat; font-weight: bold; color: #ffffff; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #ffffff; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #2293f7; background: #2293f7 url(images/ui-bg_diagonals-thick_26_2293f7_40x40.png) 50% 50% repeat; font-weight: bold; color: #ffffff; } +.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #e69700; background: #e69700 url(images/ui-bg_diagonals-thick_20_e69700_40x40.png) 50% 50% repeat; font-weight: bold; color: #ffffff; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #ffffff; background: #c5ddfc url(images/ui-bg_diagonals-small_25_c5ddfc_40x40.png) 50% 50% repeat; color: #333333; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #333333; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #e69700; background: #e69700 url(images/ui-bg_diagonals-thick_20_e69700_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_0a82eb_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_0a82eb_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_5fa5e3_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_fcdd4a_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_0b54d5_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; } +.ui-corner-tr { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; } +.ui-corner-br { -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-top { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-right { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; border-top-right-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } +.ui-corner-left { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; border-top-left-radius: 3px; -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; } +.ui-corner-all { -moz-border-radius: 3px; -webkit-border-radius: 3px; border-radius: 3px; } + +/* Overlays */ +.ui-widget-overlay { background: #e6b900 url(images/ui-bg_flat_0_e6b900_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: 6px 0 0 6px; padding: 0px; background: #e69700 url(images/ui-bg_flat_0_e69700_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 3px; -webkit-border-radius: 3px; border-radius: 3px; }/* + * jQuery UI Dialog @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/Js/jquery/dialog/js/jquery-ui-1.8.4.custom.min.js b/Js/jquery/dialog/js/jquery-ui-1.8.4.custom.min.js new file mode 100755 index 0000000..7469ef3 --- /dev/null +++ b/Js/jquery/dialog/js/jquery-ui-1.8.4.custom.min.js @@ -0,0 +1,87 @@ +/*! + * jQuery UI 1.8.4 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.4",plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a, +b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93, +CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable", +"off").css("MozUserSelect","")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none")},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, +"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"));if(!isNaN(b)&&b!=0)return b}a=a.parent()}}return 0}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-= +parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c.style(this,h,d(this,f)+"px")})};c.fn["outer"+ +b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c.style(this,h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"== +b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}})}})(jQuery); +;/*! + * jQuery UI Widget 1.8.4 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,j){var k=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return k.call(b(this),a,c)})};b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options); +b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.substring(0,1)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}): +this.each(function(){var g=b.data(this,a);if(g){d&&g.option(d);g._init()}else b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,b.metadata&&b.metadata.get(c)[this.widgetName],a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()}); +this._create();this._init()},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a,e=this;if(arguments.length===0)return b.extend({},e.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}b.each(d,function(f, +h){e._setOption(f,h)});return e},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a= +b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); +;/* + * jQuery UI Position 1.8.4 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var m=/left|center|right/,n=/top|center|bottom/,p=c.fn.position,q=c.fn.offset;c.fn.position=function(a){if(!a||!a.of)return p.apply(this,arguments);a=c.extend({},a);var b=c(a.of),d=(a.collision||"flip").split(" "),e=a.offset?a.offset.split(" "):[0,0],g,h,i;if(a.of.nodeType===9){g=b.width();h=b.height();i={top:0,left:0}}else if(a.of.scrollTo&&a.of.document){g=b.width();h=b.height();i={top:b.scrollTop(),left:b.scrollLeft()}}else if(a.of.preventDefault){a.at="left top";g=h= +0;i={top:a.of.pageY,left:a.of.pageX}}else{g=b.outerWidth();h=b.outerHeight();i=b.offset()}c.each(["my","at"],function(){var f=(a[this]||"").split(" ");if(f.length===1)f=m.test(f[0])?f.concat(["center"]):n.test(f[0])?["center"].concat(f):["center","center"];f[0]=m.test(f[0])?f[0]:"center";f[1]=n.test(f[1])?f[1]:"center";a[this]=f});if(d.length===1)d[1]=d[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(a.at[0]==="right")i.left+=g;else if(a.at[0]==="center")i.left+= +g/2;if(a.at[1]==="bottom")i.top+=h;else if(a.at[1]==="center")i.top+=h/2;i.left+=e[0];i.top+=e[1];return this.each(function(){var f=c(this),k=f.outerWidth(),l=f.outerHeight(),j=c.extend({},i);if(a.my[0]==="right")j.left-=k;else if(a.my[0]==="center")j.left-=k/2;if(a.my[1]==="bottom")j.top-=l;else if(a.my[1]==="center")j.top-=l/2;j.left=parseInt(j.left);j.top=parseInt(j.top);c.each(["left","top"],function(o,r){c.ui.position[d[o]]&&c.ui.position[d[o]][r](j,{targetWidth:g,targetHeight:h,elemWidth:k, +elemHeight:l,offset:e,my:a.my,at:a.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(j,{using:a.using}))})};c.ui.position={fit:{left:function(a,b){var d=c(window);b=a.left+b.elemWidth-d.width()-d.scrollLeft();a.left=b>0?a.left-b:Math.max(0,a.left)},top:function(a,b){var d=c(window);b=a.top+b.elemHeight-d.height()-d.scrollTop();a.top=b>0?a.top-b:Math.max(0,a.top)}},flip:{left:function(a,b){if(b.at[0]!=="center"){var d=c(window);d=a.left+b.elemWidth-d.width()-d.scrollLeft();var e=b.my[0]==="left"? +-b.elemWidth:b.my[0]==="right"?b.elemWidth:0,g=-2*b.offset[0];a.left+=a.left<0?e+b.targetWidth+g:d>0?e-b.targetWidth+g:0}},top:function(a,b){if(b.at[1]!=="center"){var d=c(window);d=a.top+b.elemHeight-d.height()-d.scrollTop();var e=b.my[1]==="top"?-b.elemHeight:b.my[1]==="bottom"?b.elemHeight:0,g=b.at[1]==="top"?b.targetHeight:-b.targetHeight,h=-2*b.offset[1];a.top+=a.top<0?e+b.targetHeight+h:d>0?e+g+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(a,b){if(/static/.test(c.curCSS(a,"position")))a.style.position= +"relative";var d=c(a),e=d.offset(),g=parseInt(c.curCSS(a,"top",true),10)||0,h=parseInt(c.curCSS(a,"left",true),10)||0;e={top:b.top-e.top+g,left:b.left-e.left+h};"using"in b?b.using.call(a,e):d.css(e)};c.fn.offset=function(a){var b=this[0];if(!b||!b.ownerDocument)return null;if(a)return this.each(function(){c.offset.setOffset(this,a)});return q.call(this)}}})(jQuery); +;/* + * jQuery UI Dialog 1.8.4 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,j){c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",of:window,collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title"); +if(typeof this.originalTitle!=="string")this.originalTitle="";var a=this,b=a.options,d=b.title||a.originalTitle||" ",f=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(i){a.moveToTop(false, +i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var e=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i); +return false}).appendTo(e);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",f).html(d).prependTo(e);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;e.find("*").add(e).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&& +g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog"); +b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0])d=Math.max(d,c(this).css("z-index"))});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,f=d.options;if(f.modal&&!a||!f.stack&&!f.modal)return d._trigger("focus",b);if(f.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ= +f.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;d.next().length&&d.appendTo("body");a._size();a._position(b.position);d.show(b.show); +a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(f){if(f.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),e=g.filter(":first");g=g.filter(":last");if(f.target===g[0]&&!f.shiftKey){e.focus(1);return false}else if(f.target===e[0]&&f.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._trigger("open");a._isOpen=true;return a}},_createButtons:function(a){var b=this,d=false, +f=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(f);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(e,h){e=c('<button type="button"></button>').text(e).click(function(){h.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&e.button()});f.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(e){return{position:e.position, +offset:e.offset}}var b=this,d=b.options,f=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(e,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",e,a(h))},drag:function(e,h){b._trigger("drag",e,a(h))},stop:function(e,h){d.position=[h.position.left-f.scrollLeft(),h.position.top-f.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g); +b._trigger("dragStop",e,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(e){return{originalPosition:e.originalPosition,originalSize:e.originalSize,position:e.position,size:e.size}}a=a===j?this.options.resizable:a;var d=this,f=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:d._minHeight(), +handles:a,start:function(e,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",e,b(h))},resize:function(e,h){d._trigger("resize",e,b(h))},stop:function(e,h){c(this).removeClass("ui-dialog-resizing");f.height=c(this).height();f.width=c(this).width();d._trigger("resizeStop",e,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight, +a.height)},_position:function(a){var b=[],d=[0,0],f;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,e){if(+b[g]===b[g]){d[g]=b[g];b[g]=e}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a); +f||this.uiDialog.hide()},_setOption:function(a,b){var d=this,f=d.uiDialog,g=f.is(":data(resizable)"),e=false;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);e=true;break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":f.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case "draggable":b? +d._makeDraggable():f.draggable("destroy");break;case "height":e=true;break;case "maxHeight":g&&f.resizable("option","maxHeight",b);e=true;break;case "maxWidth":g&&f.resizable("option","maxWidth",b);e=true;break;case "minHeight":g&&f.resizable("option","minHeight",b);e=true;break;case "minWidth":g&&f.resizable("option","minWidth",b);e=true;break;case "position":d._position(b);break;case "resizable":g&&!b&&f.resizable("destroy");g&&typeof b==="string"&&f.resizable("option","handles",b);!g&&b!==false&& +d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break;case "width":e=true;break}c.Widget.prototype._setOption.apply(d,arguments);e&&d._size()},_size:function(){var a=this.options,b;this.element.css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();this.element.css(a.height==="auto"?{minHeight:Math.max(a.minHeight-b,0),height:"auto"}:{minHeight:0,height:Math.max(a.height- +b,0)}).show();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.4",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){return c(d.target).zIndex()>=c.ui.dialog.overlay.maxZ})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){this.oldInstances.push(this.instances.splice(c.inArray(a,this.instances),1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var b=0;c.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances, +function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +;
\ No newline at end of file diff --git a/Js/jquery/images/ajax-loader.png b/Js/jquery/images/ajax-loader.png Binary files differnew file mode 100644 index 0000000..811a2cd --- /dev/null +++ b/Js/jquery/images/ajax-loader.png diff --git a/Js/jquery/images/icon-search-black.png b/Js/jquery/images/icon-search-black.png Binary files differnew file mode 100644 index 0000000..5721120 --- /dev/null +++ b/Js/jquery/images/icon-search-black.png diff --git a/Js/jquery/images/icons-18-black.png b/Js/jquery/images/icons-18-black.png Binary files differnew file mode 100644 index 0000000..1ecfd26 --- /dev/null +++ b/Js/jquery/images/icons-18-black.png diff --git a/Js/jquery/images/icons-18-white.png b/Js/jquery/images/icons-18-white.png Binary files differnew file mode 100644 index 0000000..0c70831 --- /dev/null +++ b/Js/jquery/images/icons-18-white.png diff --git a/Js/jquery/images/icons-36-black.png b/Js/jquery/images/icons-36-black.png Binary files differnew file mode 100644 index 0000000..4c72adf --- /dev/null +++ b/Js/jquery/images/icons-36-black.png diff --git a/Js/jquery/images/icons-36-white.png b/Js/jquery/images/icons-36-white.png Binary files differnew file mode 100644 index 0000000..84ea9fb --- /dev/null +++ b/Js/jquery/images/icons-36-white.png diff --git a/Js/jquery/jquery-1.7.1.min.js b/Js/jquery/jquery-1.7.1.min.js new file mode 100644 index 0000000..198b3ff --- /dev/null +++ b/Js/jquery/jquery-1.7.1.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.7.1 jquery.com | jquery.org/license */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!ck[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){cl||(cl=c.createElement("iframe"),cl.frameBorder=cl.width=cl.height=0),b.appendChild(cl);if(!cm||!cl.createElement)cm=(cl.contentWindow||cl.contentDocument).document,cm.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),cm.close();d=cm.createElement(a),cm.body.appendChild(d),e=f.css(d,"display"),b.removeChild(cl)}ck[a]=e}return ck[a]}function cu(a,b){var c={};f.each(cq.concat.apply([],cq.slice(0,b)),function(){c[this]=a});return c}function ct(){cr=b}function cs(){setTimeout(ct,0);return cr=f.now()}function cj(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ci(){try{return new a.XMLHttpRequest}catch(b){}}function cc(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function cb(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function ca(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bE.test(a)?d(a,e):ca(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)ca(a+"["+e+"]",b[e],c,d);else d(a,b)}function b_(a,c){var d,e,g=f.ajaxSettings.flatOptions||{};for(d in c)c[d]!==b&&((g[d]?a:e||(e={}))[d]=c[d]);e&&f.extend(!0,a,e)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bT,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bP),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bC(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bx:by,g=0,h=e.length;if(d>0){if(c!=="border")for(;g<h;g++)c||(d-=parseFloat(f.css(a,"padding"+e[g]))||0),c==="margin"?d+=parseFloat(f.css(a,c+e[g]))||0:d-=parseFloat(f.css(a,"border"+e[g]+"Width"))||0;return d+"px"}d=bz(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0;if(c)for(;g<h;g++)d+=parseFloat(f.css(a,"padding"+e[g]))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+e[g]+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+e[g]))||0);return d+"px"}function bp(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bo(a){var b=c.createElement("div");bh.appendChild(b),b.innerHTML=a.outerHTML;return b.firstChild}function bn(a){var b=(a.nodeName||"").toLowerCase();b==="input"?bm(a):b!=="script"&&typeof a.getElementsByTagName!="undefined"&&f.grep(a.getElementsByTagName("input"),bm)}function bm(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bl(a){return typeof a.getElementsByTagName!="undefined"?a.getElementsByTagName("*"):typeof a.querySelectorAll!="undefined"?a.querySelectorAll("*"):[]}function bk(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bj(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c,d,e,g=f._data(a),h=f._data(b,g),i=g.events;if(i){delete h.handle,h.events={};for(c in i)for(d=0,e=i[c].length;d<e;d++)f.event.add(b,c+(i[c][d].namespace?".":"")+i[c][d].namespace,i[c][d],i[c][d].data)}h.data&&(h.data=f.extend({},h.data))}}function bi(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function U(a){var b=V.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}function T(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(O.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?parseFloat(d):j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c<d;c++)b[a[c]]=!0;return b}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b,c){var d;if(b){if(H)return H.call(b,a,c);d=b.length,c=c?c<0?Math.max(0,d+c):c:0;for(;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g={};f.Callbacks=function(a){a=a?g[a]||h(a):{};var c=[],d=[],e,i,j,k,l,m=function(b){var d,e,g,h,i;for(d=0,e=b.length;d<e;d++)g=b[d],h=f.type(g),h==="array"?m(g):h==="function"&&(!a.unique||!o.has(g))&&c.push(g)},n=function(b,f){f=f||[],e=!a.memory||[b,f],i=!0,l=j||0,j=0,k=c.length;for(;c&&l<k;l++)if(c[l].apply(b,f)===!1&&a.stopOnFalse){e=!0;break}i=!1,c&&(a.once?e===!0?o.disable():c=[]:d&&d.length&&(e=d.shift(),o.fireWith(e[0],e[1])))},o={add:function(){if(c){var a=c.length;m(arguments),i?k=c.length:e&&e!==!0&&(j=a,n(e[0],e[1]))}return this},remove:function(){if(c){var b=arguments,d=0,e=b.length;for(;d<e;d++)for(var f=0;f<c.length;f++)if(b[d]===c[f]){i&&f<=k&&(k--,f<=l&&l--),c.splice(f--,1);if(a.unique)break}}return this},has:function(a){if(c){var b=0,d=c.length;for(;b<d;b++)if(a===c[b])return!0}return!1},empty:function(){c=[];return this},disable:function(){c=d=e=b;return this},disabled:function(){return!c},lock:function(){d=b,(!e||e===!0)&&o.disable();return this},locked:function(){return!d},fireWith:function(b,c){d&&(i?a.once||d.push([b,c]):(!a.once||!e)&&n(b,c));return this},fire:function(){o.fireWith(this,arguments);return this},fired:function(){return!!e}};return o};var i=[].slice;f.extend({Deferred:function(a){var b=f.Callbacks("once memory"),c=f.Callbacks("once memory"),d=f.Callbacks("memory"),e="pending",g={resolve:b,reject:c,notify:d},h={done:b.add,fail:c.add,progress:d.add,state:function(){return e},isResolved:b.fired,isRejected:c.fired,then:function(a,b,c){i.done(a).fail(b).progress(c);return this},always:function(){i.done.apply(i,arguments).fail.apply(i,arguments);return this},pipe:function(a,b,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[b,"reject"],progress:[c,"notify"]},function(a,b){var c=b[0],e=b[1],g;f.isFunction(c)?i[a](function(){g=c.apply(this,arguments),g&&f.isFunction(g.promise)?g.promise().then(d.resolve,d.reject,d.notify):d[e+"With"](this===i?d:this,[g])}):i[a](d[e])})}).promise()},promise:function(a){if(a==null)a=h;else for(var b in h)a[b]=h[b];return a}},i=h.promise({}),j;for(j in g)i[j]=g[j].fire,i[j+"With"]=g[j].fireWith;i.done(function(){e="resolved"},c.disable,d.lock).fail(function(){e="rejected"},b.disable,d.lock),a&&a.call(i,i);return i},when:function(a){function m(a){return function(b){e[a]=arguments.length>1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c<d;c++)b[c]&&b[c].promise&&f.isFunction(b[c].promise)?b[c].promise().then(l(c),j.reject,m(c)):--g;g||j.resolveWith(j,b)}else j!==a&&j.resolveWith(j,d?[a]:[]);return k}}),f.support=function(){var b,d,e,g,h,i,j,k,l,m,n,o,p,q=c.createElement("div"),r=c.documentElement;q.setAttribute("className","t"),q.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=q.getElementsByTagName("*"),e=q.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=q.getElementsByTagName("input")[0],b={leadingWhitespace:q.firstChild.nodeType===3,tbody:!q.getElementsByTagName("tbody").length,htmlSerialize:!!q.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:q.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav></:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete q.test}catch(s){b.deleteExpando=!1}!q.addEventListener&&q.attachEvent&&q.fireEvent&&(q.attachEvent("onclick",function(){b.noCloneEvent=!1}),q.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),q.appendChild(i),k=c.createDocumentFragment(),k.appendChild(q.lastChild),b.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,k.removeChild(i),k.appendChild(q),q.innerHTML="",a.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",q.style.width="2px",q.appendChild(j),b.reliableMarginRight=(parseInt((a.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0);if(q.attachEvent)for(o in{submit:1,change:1,focusin:1})n="on"+o,p=n in q,p||(q.setAttribute(n,"return;"),p=typeof q[n]=="function"),b[o+"Bubbles"]=p;k.removeChild(q),k=g=h=j=q=i=null,f(function(){var a,d,e,g,h,i,j,k,m,n,o,r=c.getElementsByTagName("body")[0];!r||(j=1,k="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;",m="visibility:hidden;border:0;",n="style='"+k+"border:5px solid #000;padding:0;'",o="<div "+n+"><div></div></div>"+"<table "+n+" cellpadding='0' cellspacing='0'>"+"<tr><td></td></tr></table>",a=c.createElement("div"),a.style.cssText=m+"width:0;height:0;position:static;top:0;margin-top:"+j+"px",r.insertBefore(a,r.firstChild),q=c.createElement("div"),a.appendChild(q),q.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",l=q.getElementsByTagName("td"),p=l[0].offsetHeight===0,l[0].style.display="",l[1].style.display="none",b.reliableHiddenOffsets=p&&l[0].offsetHeight===0,q.innerHTML="",q.style.width=q.style.paddingLeft="1px",f.boxModel=b.boxModel=q.offsetWidth===2,typeof q.style.zoom!="undefined"&&(q.style.display="inline",q.style.zoom=1,b.inlineBlockNeedsLayout=q.offsetWidth===2,q.style.display="",q.innerHTML="<div style='width:4px;'></div>",b.shrinkWrapBlocks=q.offsetWidth!==2),q.style.cssText=k+m,q.innerHTML=o,d=q.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,i={doesNotAddBorder:e.offsetTop!==5,doesAddBorderForTableAndCells:h.offsetTop===5},e.style.position="fixed",e.style.top="20px",i.fixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",i.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,i.doesNotIncludeMarginInBodyOffset=r.offsetTop!==j,r.removeChild(a),q=a=null,f.extend(b,i))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e<g;e++)delete d[b[e]];if(!(c?m:f.isEmptyObject)(d))return}}if(!c){delete j[k].data;if(!m(j[k]))return}f.support.deleteExpando||!j.setInterval?delete j[k]:j[k]=null,i&&(f.support.deleteExpando?delete a[h]:a.removeAttribute?a.removeAttribute(h):a[h]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d,e,g,h=null;if(typeof a=="undefined"){if(this.length){h=f.data(this[0]);if(this[0].nodeType===1&&!f._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var i=0,j=e.length;i<j;i++)g=e[i].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),l(this[0],g,h[g]));f._data(this[0],"parsedAttrs",!0)}}return h}if(typeof a=="object")return this.each(function(){f.data(this,a)});d=a.split("."),d[1]=d[1]?"."+d[1]:"";if(c===b){h=this.triggerHandler("getData"+d[1]+"!",[d[0]]),h===b&&this.length&&(h=f.data(this[0],a),h=l(this[0],a,h));return h===b&&d[1]?this.data(d[0]):h}return this.each(function(){var b=f(this),e=[d[0],c];b.triggerHandler("setData"+d[1]+"!",e),f.data(this,a,c),b.triggerHandler("changeData"+d[1]+"!",e)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,b){a&&(b=(b||"fx")+"mark",f._data(a,b,(f._data(a,b)||0)+1))},_unmark:function(a,b,c){a!==!0&&(c=b,b=a,a=!1);if(b){c=c||"fx";var d=c+"mark",e=a?0:(f._data(b,d)||1)-1;e?f._data(b,d,e):(f.removeData(b,d,!0),n(b,c,"mark"))}},queue:function(a,b,c){var d;if(a){b=(b||"fx")+"queue",d=f._data(a,b),c&&(!d||f.isArray(c)?d=f._data(a,b,f.makeArray(c)):d.push(c));return d||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e={};d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),f._data(a,b+".run",e),d.call(a,function(){f.dequeue(a,b)},e)),c.length||(f.removeData(a,b+"queue "+b+".run",!0),n(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f.Callbacks("once memory"),!0))h++,l.add(m);m();return d.promise()}});var o=/[\n\t\r]/g,p=/\s+/,q=/\r/g,r=/^(?:button|input)$/i,s=/^(?:button|input|object|select|textarea)$/i,t=/^a(?:rea)?$/i,u=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,v=f.support.getSetAttribute,w,x,y;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(p);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(p);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(o," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(p);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ",c=0,d=this.length;for(;c<d;c++)if(this[c].nodeType===1&&(" "+this[c].className+" ").replace(o," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.nodeName.toLowerCase()]||f.valHooks[g.type];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c<d;c++){e=i[c];if(e.selected&&(f.support.optDisabled?!e.disabled:e.getAttribute("disabled")===null)&&(!e.parentNode.disabled||!f.nodeName(e.parentNode,"optgroup"))){b=f(e).val();if(j)return b;h.push(b)}}if(j&&!h.length&&i.length)return f(i[g]).val();return h},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;h<g;h++)e=d[h],e&&(c=f.propFix[e]||e,f.attr(a,e,""),a.removeAttribute(v?e:c),u.test(e)&&c in a&&(a[c]=!1))}},attrHooks:{type:{set:function(a,b){if(r.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},value:{get:function(a,b){if(w&&f.nodeName(a,"button"))return w.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(w&&f.nodeName(a,"button"))return w.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e,g,h,i=a.nodeType;if(!!a&&i!==3&&i!==8&&i!==2){h=i!==1||!f.isXMLDoc(a),h&&(c=f.propFix[c]||c,g=f.propHooks[c]);return d!==b?g&&"set"in g&&(e=g.set(a,d,c))!==b?e:a[c]=d:g&&"get"in g&&(e=g.get(a,c))!==null?e:a[c]}},propHooks:{tabIndex:{get:function(a){var c=a.getAttributeNode("tabindex");return c&&c.specified?parseInt(c.value,10):s.test(a.nodeName)||t.test(a.nodeName)&&a.href?0:b}}}}),f.attrHooks.tabindex=f.propHooks.tabIndex,x={get:function(a,c){var d,e=f.prop(a,c);return e===!0||typeof e!="boolean"&&(d=a.getAttributeNode(c))&&d.nodeValue!==!1?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},v||(y={name:!0,id:!0},w=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&(y[c]?d.nodeValue!=="":d.specified)?d.nodeValue:b},set:function(a,b,d){var e=a.getAttributeNode(d);e||(e=c.createAttribute(d),a.setAttributeNode(e));return e.nodeValue=b+""}},f.attrHooks.tabindex.set=w.set,f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})}),f.attrHooks.contenteditable={get:w.get,set:function(a,b,c){b===""&&(b="false"),w.set(a,b,c)}}),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex);return null}})),f.support.enctype||(f.propFix.enctype="encoding"),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/\bhover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")}; +f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k<c.length;k++){l=A.exec(c[k])||[],m=l[1],n=(l[2]||"").split(".").sort(),s=f.event.special[m]||{},m=(g?s.delegateType:s.bindType)||m,s=f.event.special[m]||{},o=f.extend({type:m,origType:l[1],data:e,handler:d,guid:d.guid,selector:g,quick:G(g),namespace:n.join(".")},p),r=j[m];if(!r){r=j[m]=[],r.delegateCount=0;if(!s.setup||s.setup.call(a,e,n,i)===!1)a.addEventListener?a.addEventListener(m,i,!1):a.attachEvent&&a.attachEvent("on"+m,i)}s.add&&(s.add.call(a,o),o.handler.guid||(o.handler.guid=d.guid)),g?r.splice(r.delegateCount++,0,o):r.push(o),f.event.global[m]=!0}a=null}},global:{},remove:function(a,b,c,d,e){var g=f.hasData(a)&&f._data(a),h,i,j,k,l,m,n,o,p,q,r,s;if(!!g&&!!(o=g.events)){b=f.trim(I(b||"")).split(" ");for(h=0;h<b.length;h++){i=A.exec(b[h])||[],j=k=i[1],l=i[2];if(!j){for(j in o)f.event.remove(a,j+b[h],c,d,!0);continue}p=f.event.special[j]||{},j=(d?p.delegateType:p.bindType)||j,r=o[j]||[],m=r.length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(n=0;n<r.length;n++)s=r[n],(e||k===s.origType)&&(!c||c.guid===s.guid)&&(!l||l.test(s.namespace))&&(!d||d===s.selector||d==="**"&&s.selector)&&(r.splice(n--,1),s.selector&&r.delegateCount--,p.remove&&p.remove.call(a,s));r.length===0&&m!==r.length&&((!p.teardown||p.teardown.call(a,l)===!1)&&f.removeEvent(a,j,g.handle),delete o[j])}f.isEmptyObject(o)&&(q=g.handle,q&&(q.elem=null),f.removeData(a,["events","handle"],!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){if(!e||e.nodeType!==3&&e.nodeType!==8){var h=c.type||c,i=[],j,k,l,m,n,o,p,q,r,s;if(E.test(h+f.event.triggered))return;h.indexOf("!")>=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;l<r.length&&!c.isPropagationStopped();l++)m=r[l][0],c.type=r[l][1],q=(f._data(m,"events")||{})[c.type]&&f._data(m,"handle"),q&&q.apply(m,d),q=o&&m[o],q&&f.acceptData(m)&&q.apply(m,d)===!1&&c.preventDefault();c.type=h,!g&&!c.isDefaultPrevented()&&(!p._default||p._default.apply(e.ownerDocument,d)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)&&o&&e[h]&&(h!=="focus"&&h!=="blur"||c.target.offsetWidth!==0)&&!f.isWindow(e)&&(n=e[o],n&&(e[o]=null),f.event.triggered=h,e[h](),f.event.triggered=b,n&&(e[o]=n));return c.result}},dispatch:function(c){c=f.event.fix(c||a.event);var d=(f._data(this,"events")||{})[c.type]||[],e=d.delegateCount,g=[].slice.call(arguments,0),h=!c.exclusive&&!c.namespace,i=[],j,k,l,m,n,o,p,q,r,s,t;g[0]=c,c.delegateTarget=this;if(e&&!c.target.disabled&&(!c.button||c.type!=="click")){m=f(this),m.context=this.ownerDocument||this;for(l=c.target;l!=this;l=l.parentNode||this){o={},q=[],m[0]=l;for(j=0;j<e;j++)r=d[j],s=r.selector,o[s]===b&&(o[s]=r.quick?H(l,r.quick):m.is(s)),o[s]&&q.push(r);q.length&&i.push({elem:l,matches:q})}}d.length>e&&i.push({elem:this,matches:d.slice(e)});for(j=0;j<i.length&&!c.isPropagationStopped();j++){p=i[j],c.currentTarget=p.elem;for(k=0;k<p.matches.length&&!c.isImmediatePropagationStopped();k++){r=p.matches[k];if(h||!c.namespace&&!r.namespace||c.namespace_re&&c.namespace_re.test(r.namespace))c.data=r.data,c.handleObj=r,n=((f.event.special[r.origType]||{}).handle||r.handler).apply(p.elem,g),n!==b&&(c.result=n,n===!1&&(c.preventDefault(),c.stopPropagation()))}}return c.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){a.which==null&&(a.which=b.charCode!=null?b.charCode:b.keyCode);return a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,d){var e,f,g,h=d.button,i=d.fromElement;a.pageX==null&&d.clientX!=null&&(e=a.target.ownerDocument||c,f=e.documentElement,g=e.body,a.pageX=d.clientX+(f&&f.scrollLeft||g&&g.scrollLeft||0)-(f&&f.clientLeft||g&&g.clientLeft||0),a.pageY=d.clientY+(f&&f.scrollTop||g&&g.scrollTop||0)-(f&&f.clientTop||g&&g.clientTop||0)),!a.relatedTarget&&i&&(a.relatedTarget=i===a.target?d.toElement:i),!a.which&&h!==b&&(a.which=h&1?1:h&2?3:h&4?2:0);return a}},fix:function(a){if(a[f.expando])return a;var d,e,g=a,h=f.event.fixHooks[a.type]||{},i=h.props?this.props.concat(h.props):this.props;a=f.Event(g);for(d=i.length;d;)e=i[--d],a[e]=g[e];a.target||(a.target=g.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),a.metaKey===b&&(a.metaKey=a.ctrlKey);return h.filter?h.filter(a,g):a},special:{ready:{setup:f.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}},simulate:function(a,b,c,d){var e=f.extend(new f.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?f.event.trigger(e,null,b):f.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},f.event.handle=f.event.dispatch,f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!(this instanceof f.Event))return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?K:J):this.type=a,b&&f.extend(this,b),this.timeStamp=a&&a.timeStamp||f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:J,isPropagationStopped:J,isImmediatePropagationStopped:J},f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c=this,d=a.relatedTarget,e=a.handleObj,g=e.selector,h;if(!d||d!==c&&!f.contains(c,d))a.type=e.origType,h=e.handler.apply(this,arguments),a.type=b;return h}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(){if(f.nodeName(this,"form"))return!1;f.event.add(this,"click._submit keypress._submit",function(a){var c=a.target,d=f.nodeName(c,"input")||f.nodeName(c,"button")?c.form:b;d&&!d._submit_attached&&(f.event.add(d,"submit._submit",function(a){this.parentNode&&!a.isTrigger&&f.event.simulate("submit",this.parentNode,a,!0)}),d._submit_attached=!0)})},teardown:function(){if(f.nodeName(this,"form"))return!1;f.event.remove(this,"._submit")}}),f.support.changeBubbles||(f.event.special.change={setup:function(){if(z.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio")f.event.add(this,"propertychange._change",function(a){a.originalEvent.propertyName==="checked"&&(this._just_changed=!0)}),f.event.add(this,"click._change",function(a){this._just_changed&&!a.isTrigger&&(this._just_changed=!1,f.event.simulate("change",this,a,!0))});return!1}f.event.add(this,"beforeactivate._change",function(a){var b=a.target;z.test(b.nodeName)&&!b._change_attached&&(f.event.add(b,"change._change",function(a){this.parentNode&&!a.isSimulated&&!a.isTrigger&&f.event.simulate("change",this.parentNode,a,!0)}),b._change_attached=!0)})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||b.type!=="radio"&&b.type!=="checkbox")return a.handleObj.handler.apply(this,arguments)},teardown:function(){f.event.remove(this,"._change");return z.test(this.nodeName)}}),f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){var d=0,e=function(a){f.event.simulate(b,a.target,f.event.fix(a),!0)};f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.fn.extend({on:function(a,c,d,e,g){var h,i;if(typeof a=="object"){typeof c!="string"&&(d=c,c=b);for(i in a)this.on(i,c,d,a[i],g);return this}d==null&&e==null?(e=c,d=c=b):e==null&&(typeof c=="string"?(e=d,d=b):(e=d,d=c,c=b));if(e===!1)e=J;else if(!e)return this;g===1&&(h=e,e=function(a){f().off(a);return h.apply(this,arguments)},e.guid=h.guid||(h.guid=f.guid++));return this.each(function(){f.event.add(this,a,e,d,c)})},one:function(a,b,c,d){return this.on.call(this,a,b,c,d,1)},off:function(a,c,d){if(a&&a.preventDefault&&a.handleObj){var e=a.handleObj;f(a.delegateTarget).off(e.namespace?e.type+"."+e.namespace:e.type,e.selector,e.handler);return this}if(typeof a=="object"){for(var g in a)this.off(g,c,a[g]);return this}if(c===!1||typeof c=="function")d=c,c=b;d===!1&&(d=J);return this.each(function(){f.event.remove(this,a,d,c)})},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},live:function(a,b,c){f(this.context).on(a,this.selector,b,c);return this},die:function(a,b){f(this.context).off(a,this.selector||"**",b);return this},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return arguments.length==1?this.off(a,"**"):this.off(b,a,c)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f._data(this,"lastToggle"+a.guid)||0)%d;f._data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}if(j.nodeType===1){g||(j[d]=c,j.sizset=h);if(typeof b!="string"){if(j===b){k=!0;break}}else if(m.filter(b,[j]).length>0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h<i;h++){var j=e[h];if(j){var k=!1;j=j[a];while(j){if(j[d]===c){k=e[j.sizset];break}j.nodeType===1&&!g&&(j[d]=c,j.sizset=h);if(j.nodeName.toLowerCase()===b){k=j;break}j=j[a]}e[h]=k}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},m.matches=function(a,b){return m(a,null,null,b)},m.matchesSelector=function(a,b){return m(b,null,null,[a]).length>0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e<f;e++){h=o.order[e];if(g=o.leftMatch[h].exec(a)){i=g[1],g.splice(1,1);if(i.substr(i.length-1)!=="\\"){g[1]=(g[1]||"").replace(j,""),d=o.find[h](g,b,c);if(d!=null){a=a.replace(o.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},m.filter=function(a,c,d,e){var f,g,h,i,j,k,l,n,p,q=a,r=[],s=c,t=c&&c[0]&&m.isXML(c[0]);while(a&&c.length){for(h in o.filter)if((f=o.leftMatch[h].exec(a))!=null&&f[2]){k=o.filter[h],l=f[1],g=!1,f.splice(1,1);if(l.substr(l.length-1)==="\\")continue;s===r&&(r=[]);if(o.preFilter[h]){f=o.preFilter[h](f,s,d,r,e,t);if(!f)g=i=!0;else if(f===!0)continue}if(f)for(n=0;(j=s[n])!=null;n++)j&&(i=k(j,f,n,s),p=e^i,d&&i!=null?p?g=!0:s[n]=!1:p&&(r.push(j),g=!0));if(i!==b){d||(s=r),a=a.replace(o.match[h],"");if(!g)return[];break}}if(a===q)if(g==null)m.error(a);else break;q=a}return s},m.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)};var n=m.getText=function(a){var b,c,d=a.nodeType,e="";if(d){if(d===1||d===9){if(typeof a.textContent=="string")return a.textContent;if(typeof a.innerText=="string")return a.innerText.replace(k,"");for(a=a.firstChild;a;a=a.nextSibling)e+=n(a)}else if(d===3||d===4)return a.nodeValue}else for(b=0;c=a[b];b++)c.nodeType!==8&&(e+=n(c));return e},o=m.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!l.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&m.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&m.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=x;typeof b=="string"&&!l.test(b)&&(b=b.toLowerCase(),d=b,g=w),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(j,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}m.error(e)},CHILD:function(a,b){var c,e,f,g,h,i,j,k=b[1],l=a;switch(k){case"only":case"first":while(l=l.previousSibling)if(l.nodeType===1)return!1;if(k==="first")return!0;l=a;case"last":while(l=l.nextSibling)if(l.nodeType===1)return!1;return!0;case"nth":c=b[2],e=b[3];if(c===1&&e===0)return!0;f=b[0],g=a.parentNode;if(g&&(g[d]!==f||!a.nodeIndex)){i=0;for(l=g.firstChild;l;l=l.nextSibling)l.nodeType===1&&(l.nodeIndex=++i);g[d]=f}j=a.nodeIndex-e;return c===0?j===0:j%c===0&&j/c>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var u,v;c.documentElement.compareDocumentPosition?u=function(a,b){if(a===b){h=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(u=function(a,b){if(a===b){h=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],g=a.parentNode,i=b.parentNode,j=g;if(g===i)return v(a,b);if(!g)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return v(e[k],f[k]);return k===c?v(a,f[k],-1):v(e[k],b,1)},v=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h<i;h++)m(a,g[h],e,c);return m.filter(f,e)};m.attr=f.attr,m.selectors.attrMap={},f.find=m,f.expr=m.selectors,f.expr[":"]=f.expr.filters,f.unique=m.uniqueSort,f.text=m.getText,f.isXMLDoc=m.isXML,f.contains=m.contains}();var L=/Until$/,M=/^(?:parents|prevUntil|prevAll)/,N=/,/,O=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,Q=f.expr.match.POS,R={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(T(this,a,!1),"not",a)},filter:function(a){return this.pushStack(T(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?Q.test(a)?f(a,this.context).index(this[0])>=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d<a.length;d++)f(g).is(a[d])&&c.push({selector:a[d],elem:g,level:h});g=g.parentNode,h++}return c}var i=Q.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(i?i.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/<tbody/i,_=/<|&#?\w+;/,ba=/<(?:script|style)/i,bb=/<(?:script|object|embed|option|style)/i,bc=new RegExp("<(?:"+V+")","i"),bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function() +{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bi(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bp)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i,j=a[0];b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof j=="string"&&j.length<512&&i===c&&j.charAt(0)==="<"&&!bb.test(j)&&(f.support.checkClone||!bd.test(j))&&(f.support.html5Clone||!bc.test(j))&&(g=!0,h=f.fragments[j],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[j]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||!bc.test("<"+a.nodeName)?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1></$2>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");b===c?bh.appendChild(o):U(b).appendChild(o),o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bn(k[i]);else bn(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.event.special,g=f.support.deleteExpando;for(var h=0,i;(i=a[h])!=null;h++){if(i.nodeName&&f.noData[i.nodeName.toLowerCase()])continue;c=i[f.expando];if(c){b=d[c];if(b&&b.events){for(var j in b.events)e[j]?f.event.remove(i,j):f.removeEvent(i,j,b.handle);b.handle&&(b.handle.elem=null)}g?delete i[f.expando]:i.removeAttribute&&i.removeAttribute(f.expando),delete d[c]}}}});var bq=/alpha\([^)]*\)/i,br=/opacity=([^)]*)/,bs=/([A-Z]|^ms)/g,bt=/^-?\d+(?:px)?$/i,bu=/^-?\d/,bv=/^([\-+])=([\-+.\de]+)/,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d,h==="string"&&(g=bv.exec(d))&&(d=+(g[1]+1)*+g[2]+parseFloat(f.css(a,c)),h="number");if(d==null||h==="number"&&isNaN(d))return;h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bC(a,b,d);f.swap(a,bw,function(){e=bC(a,b,d)});return e}},set:function(a,b){if(!bt.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return br.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bq,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bq.test(g)?g.replace(bq,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,b){var c,d,e;b=b.replace(bs,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b)));return c}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f===null&&g&&(e=g[b])&&(f=e),!bt.test(f)&&bu.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f||0,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bD=/%20/g,bE=/\[\]$/,bF=/\r?\n/g,bG=/#.*$/,bH=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bI=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bJ=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bK=/^(?:GET|HEAD)$/,bL=/^\/\//,bM=/\?/,bN=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);var d,e,g=0,h=this.length;for(;g<h;g++)d=this[g],d.style&&(e=f.css(d,"display"),e!=="none"&&!f._data(d,"olddisplay")&&f._data(d,"olddisplay",e));for(g=0;g<h;g++)this[g].style&&(this[g].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){function g(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(!f.support.inlineBlockNeedsLayout||cv(this.nodeName)==="inline"?this.style.display="inline-block":this.style.zoom=1))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)j=new f.fx(this,b,i),h=a[i],cn.test(h)?(o=f._data(this,"toggle"+i)||(h==="toggle"?d?"show":"hide":0),o?(f._data(this,"toggle"+i,o==="show"?"hide":"show"),j[o]()):j[h]()):(k=co.exec(h),l=j.cur(),k?(m=parseFloat(k[2]),n=k[3]||(f.cssNumber[i]?"":"px"),n!=="px"&&(f.style(this,i,(m||1)+n),l=(m||1)/j.cur()*l,f.style(this,i,l+n)),k[1]&&(m=(k[1]==="-="?-1:1)*m+l),j.custom(l,m,n)):j.custom(l,h,""));return!0}var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return e.queue===!1?this.each(g):this.queue(e.queue,g)},stop:function(a,c,d){typeof a!="string"&&(d=c,c=a,a=b),c&&a!==!1&&this.queue(a||"fx",[]);return this.each(function(){function h(a,b,c){var e=b[c];f.removeData(a,c,!0),e.stop(d)}var b,c=!1,e=f.timers,g=f._data(this);d||f._unmark(!0,this);if(a==null)for(b in g)g[b]&&g[b].stop&&b.indexOf(".run")===b.length-4&&h(this,g,b);else g[b=a+".run"]&&g[b].stop&&h(this,g,b);for(b=e.length;b--;)e[b].elem===this&&(a==null||e[b].queue===a)&&(d?e[b](!0):e[b].saveState(),c=!0,e.splice(b,1));(!d||!c)&&f.dequeue(this,a)})}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default;if(d.queue==null||d.queue===!0)d.queue="fx";d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue?f.dequeue(this,d.queue):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,c,d){function h(a){return e.step(a)}var e=this,g=f.fx;this.startTime=cr||cs(),this.end=c,this.now=this.start=a,this.pos=this.state=0,this.unit=d||this.unit||(f.cssNumber[this.prop]?"":"px"),h.queue=this.options.queue,h.elem=this.elem,h.saveState=function(){e.options.hide&&f._data(e.elem,"fxshow"+e.prop)===b&&f._data(e.elem,"fxshow"+e.prop,e.start)},h()&&f.timers.push(h)&&!cp&&(cp=setInterval(g.tick,g.interval))},show:function(){var a=f._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=a||f.style(this.elem,this.prop),this.options.show=!0,a!==b?this.custom(this.cur(),a):this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f._data(this.elem,"fxshow"+this.prop)||f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b,c,d,e=cr||cs(),g=!0,h=this.elem,i=this.options;if(a||e>=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c<b.length;c++)a=b[c],!a()&&b[c]===a&&b.splice(c--,1);b.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cp),cp=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=a.now+a.unit:a.elem[a.prop]=a.now}}}),f.each(["width","height"],function(a,b){f.fx.step[b]=function(a){f.style(a.elem,b,Math.max(0,a.now)+a.unit)}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.support.fixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.support.doesNotAddBorder&&(!f.support.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.support.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.support.fixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.support.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
\ No newline at end of file diff --git a/Js/jquery/jquery.mobile-1.1.0.css b/Js/jquery/jquery.mobile-1.1.0.css new file mode 100644 index 0000000..06dbf8f --- /dev/null +++ b/Js/jquery/jquery.mobile-1.1.0.css @@ -0,0 +1,2053 @@ +/* +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 +* http://jquerymobile.com +* +* Copyright 2011 (c) jQuery Project +* Dual licensed under the MIT or GPL Version 2 licenses. +* http://jquery.org/license +* +*/ +/* Swatches */ +/* A +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-a { + border: 1px solid #333 /*{a-bar-border}*/; + background: #111111 /*{a-bar-background-color}*/; + color: #ffffff /*{a-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000000 /*{a-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #3c3c3c /*{a-bar-background-start}*/), to( #111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); +} +.ui-bar-a, +.ui-bar-a input, +.ui-bar-a select, +.ui-bar-a textarea, +.ui-bar-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-a .ui-link-inherit { + color: #fff /*{a-bar-color}*/; +} +.ui-bar-a .ui-link { + color: #7cc4e7 /*{a-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-a .ui-link:hover { + color: #2489CE /*{a-bar-link-hover}*/; +} +.ui-bar-a .ui-link:active { + color: #2489CE /*{a-bar-link-active}*/; +} +.ui-bar-a .ui-link:visited { + color: #2489CE /*{a-bar-link-visited}*/; +} +.ui-body-a, +.ui-overlay-a { + border: 1px solid #444 /*{a-body-border}*/; + background: #222 /*{a-body-background-color}*/; + color: #fff /*{a-body-color}*/; + text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 1px /*{a-body-shadow-radius}*/ #111 /*{a-body-shadow-color}*/; + font-weight: normal; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444 /*{a-body-background-start}*/), to( #222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); +} +.ui-overlay-a { + background-image: none; + border-width: 0; +} +.ui-body-a, +.ui-body-a input, +.ui-body-a select, +.ui-body-a textarea, +.ui-body-a button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-a .ui-link-inherit { + color: #fff /*{a-body-color}*/; +} +.ui-body-a .ui-link { + color: #2489CE /*{a-body-link-color}*/; + font-weight: bold; +} +.ui-body-a .ui-link:hover { + color: #2489CE /*{a-body-link-hover}*/; +} +.ui-body-a .ui-link:active { + color: #2489CE /*{a-body-link-active}*/; +} +.ui-body-a .ui-link:visited { + color: #2489CE /*{a-body-link-visited}*/; +} +.ui-btn-up-a { + border: 1px solid #111 /*{a-bup-border}*/; + background: #333 /*{a-bup-background-color}*/; + font-weight: bold; + color: #fff /*{a-bup-color}*/; + text-shadow: 0 /*{a-bup-shadow-x}*/ 1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #111 /*{a-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #444444 /*{a-bup-background-start}*/), to( #2d2d2d /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #444444 /*{a-bup-background-start}*/, #2d2d2d /*{a-bup-background-end}*/); +} +.ui-btn-up-a a.ui-link-inherit { + color: #fff /*{a-bup-color}*/; +} +.ui-btn-hover-a { + border: 1px solid #000 /*{a-bhover-border}*/; + background: #444444 /*{a-bhover-background-color}*/; + font-weight: bold; + color: #fff /*{a-bhover-color}*/; + text-shadow: 0 /*{a-bhover-shadow-x}*/ 1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #111 /*{a-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #555555 /*{a-bhover-background-start}*/), to( #383838 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #555555 /*{a-bhover-background-start}*/, #383838 /*{a-bhover-background-end}*/); +} +.ui-btn-hover-a a.ui-link-inherit { + color: #fff /*{a-bhover-color}*/; +} +.ui-btn-down-a { + border: 1px solid #000 /*{a-bdown-border}*/; + background: #222 /*{a-bdown-background-color}*/; + font-weight: bold; + color: #fff /*{a-bdown-color}*/; + text-shadow: 0 /*{a-bdown-shadow-x}*/ 1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #111 /*{a-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #202020 /*{a-bdown-background-start}*/), to( #2c2c2c /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #202020 /*{a-bdown-background-start}*/, #2c2c2c /*{a-bdown-background-end}*/); +} +.ui-btn-down-a a.ui-link-inherit { + color: #fff /*{a-bdown-color}*/; +} +.ui-btn-up-a, +.ui-btn-hover-a, +.ui-btn-down-a { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* B +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-b { + border: 1px solid #456f9a /*{b-bar-border}*/; + background: #5e87b0 /*{b-bar-background-color}*/; + color: #fff /*{b-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{b-bar-shadow-x}*/ 1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #3e6790 /*{b-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bar-background-start}*/), to( #497bae /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bar-background-start}*/, #497bae /*{b-bar-background-end}*/); +} +.ui-bar-b, +.ui-bar-b input, +.ui-bar-b select, +.ui-bar-b textarea, +.ui-bar-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-b .ui-link-inherit { + color: #fff /*{b-bar-color}*/; +} +.ui-bar-b .ui-link { + color: #ddf0f8 /*{b-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-b .ui-link:hover { + color: #ddf0f8 /*{b-bar-link-hover}*/; +} +.ui-bar-b .ui-link:active { + color: #ddf0f8 /*{b-bar-link-active}*/; +} +.ui-bar-b .ui-link:visited { + color: #ddf0f8 /*{b-bar-link-visited}*/; +} +.ui-body-b, +.ui-overlay-b { + border: 1px solid #999 /*{b-body-border}*/; + background: #f3f3f3 /*{b-body-background-color}*/; + color: #222222 /*{b-body-color}*/; + text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/; + font-weight: normal; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{b-body-background-start}*/), to( #ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); +} +.ui-overlay-b { + background-image: none; + border-width: 0; +} +.ui-body-b, +.ui-body-b input, +.ui-body-b select, +.ui-body-b textarea, +.ui-body-b button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-b .ui-link-inherit { + color: #333333 /*{b-body-color}*/; +} +.ui-body-b .ui-link { + color: #2489CE /*{b-body-link-color}*/; + font-weight: bold; +} +.ui-body-b .ui-link:hover { + color: #2489CE /*{b-body-link-hover}*/; +} +.ui-body-b .ui-link:active { + color: #2489CE /*{b-body-link-active}*/; +} +.ui-body-b .ui-link:visited { + color: #2489CE /*{b-body-link-visited}*/; +} +.ui-btn-up-b { + border: 1px solid #044062 /*{b-bup-border}*/; + background: #396b9e /*{b-bup-background-color}*/; + font-weight: bold; + color: #fff /*{b-bup-color}*/; + text-shadow: 0 /*{b-bup-shadow-x}*/ 1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #194b7e /*{b-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5f9cc5 /*{b-bup-background-start}*/), to( #396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); +} +.ui-btn-up-b a.ui-link-inherit { + color: #fff /*{b-bup-color}*/; +} +.ui-btn-hover-b { + border: 1px solid #00415e /*{b-bhover-border}*/; + background: #4b88b6 /*{b-bhover-background-color}*/; + font-weight: bold; + color: #fff /*{b-bhover-color}*/; + text-shadow: 0 /*{b-bhover-shadow-x}*/ 1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #194b7e /*{b-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #6facd5 /*{b-bhover-background-start}*/), to( #4272a4 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #6facd5 /*{b-bhover-background-start}*/, #4272a4 /*{b-bhover-background-end}*/); +} +.ui-btn-hover-b a.ui-link-inherit { + color: #fff /*{b-bhover-color}*/; +} +.ui-btn-down-b { + border: 1px solid #225377 /*{b-bdown-border}*/; + background: #4e89c5 /*{b-bdown-background-color}*/; + font-weight: bold; + color: #fff /*{b-bdown-color}*/; + text-shadow: 0 /*{b-bdown-shadow-x}*/ 1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #194b7e /*{b-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #295b8e /*{b-bdown-background-start}*/), to( #3e79b5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #295b8e /*{b-bdown-background-start}*/, #3e79b5 /*{b-bdown-background-end}*/); +} +.ui-btn-down-b a.ui-link-inherit { + color: #fff /*{b-bdown-color}*/; +} +.ui-btn-up-b, +.ui-btn-hover-b, +.ui-btn-down-b { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* C +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-c { + border: 1px solid #B3B3B3 /*{c-bar-border}*/; + background: #eeeeee /*{c-bar-background-color}*/; + color: #3E3E3E /*{c-bar-color}*/; + font-weight: bold; + text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f0f0f0 /*{c-bar-background-start}*/), to( #ddd /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f0f0f0 /*{c-bar-background-start}*/, #ddd /*{c-bar-background-end}*/); +} +.ui-bar-c .ui-link-inherit { + color: #3E3E3E /*{c-bar-color}*/; +} +.ui-bar-c .ui-link { + color: #7cc4e7 /*{c-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-c .ui-link:hover { + color: #2489CE /*{c-bar-link-hover}*/; +} +.ui-bar-c .ui-link:active { + color: #2489CE /*{c-bar-link-active}*/; +} +.ui-bar-c .ui-link:visited { + color: #2489CE /*{c-bar-link-visited}*/; +} +.ui-bar-c, +.ui-bar-c input, +.ui-bar-c select, +.ui-bar-c textarea, +.ui-bar-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c, +.ui-overlay-c { + border: 1px solid #aaa /*{c-body-border}*/; + color: #333333 /*{c-body-color}*/; + text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/; + background: #f9f9f9 /*{c-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f9f9f9 /*{c-body-background-start}*/), to( #eeeeee /*{c-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f9f9f9 /*{c-body-background-start}*/, #eeeeee /*{c-body-background-end}*/); +} +.ui-overlay-c { + background-image: none; + border-width: 0; +} +.ui-body-c, +.ui-body-c input, +.ui-body-c select, +.ui-body-c textarea, +.ui-body-c button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-c .ui-link-inherit { + color: #333333 /*{c-body-color}*/; +} +.ui-body-c .ui-link { + color: #2489CE /*{c-body-link-color}*/; + font-weight: bold; +} +.ui-body-c .ui-link:hover { + color: #2489CE /*{c-body-link-hover}*/; +} +.ui-body-c .ui-link:active { + color: #2489CE /*{c-body-link-active}*/; +} +.ui-body-c .ui-link:visited { + color: #2489CE /*{c-body-link-visited}*/; +} +.ui-btn-up-c { + border: 1px solid #ccc /*{c-bup-border}*/; + background: #eee /*{c-bup-background-color}*/; + font-weight: bold; + color: #222 /*{c-bup-color}*/; + text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 0 /*{c-bup-shadow-radius}*/ #ffffff /*{c-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffffff /*{c-bup-background-start}*/), to( #f1f1f1 /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffffff /*{c-bup-background-start}*/, #f1f1f1 /*{c-bup-background-end}*/); +} +.ui-btn-up-c a.ui-link-inherit { + color: #2F3E46 /*{c-bup-color}*/; +} +.ui-btn-hover-c { + border: 1px solid #bbb /*{c-bhover-border}*/; + background: #dfdfdf /*{c-bhover-background-color}*/; + font-weight: bold; + color: #222 /*{c-bhover-color}*/; + text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 0 /*{c-bhover-shadow-radius}*/ #ffffff /*{c-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f6f6f6 /*{c-bhover-background-start}*/), to( #e0e0e0 /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f9f9f9 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f6f6f6 /*{c-bhover-background-start}*/, #e0e0e0 /*{c-bhover-background-end}*/); +} +.ui-btn-hover-c a.ui-link-inherit { + color: #2F3E46 /*{c-bhover-color}*/; +} +.ui-btn-down-c { + border: 1px solid #bbb /*{c-bdown-border}*/; + background: #d6d6d6 /*{c-bdown-background-color}*/; + font-weight: bold; + color: #222 /*{c-bdown-color}*/; + text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 0 /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #d0d0d0 /*{c-bdown-background-start}*/), to( #dfdfdf /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #d0d0d0 /*{c-bdown-background-start}*/, #dfdfdf /*{c-bdown-background-end}*/); +} +.ui-btn-down-c a.ui-link-inherit { + color: #2F3E46 /*{c-bdown-color}*/; +} +.ui-btn-up-c, +.ui-btn-hover-c, +.ui-btn-down-c { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* D +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-d { + border: 1px solid #bbb /*{d-bar-border}*/; + background: #bbb /*{d-bar-background-color}*/; + color: #333 /*{d-bar-color}*/; + text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ddd /*{d-bar-background-start}*/), to( #bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); +} +.ui-bar-d, +.ui-bar-d input, +.ui-bar-d select, +.ui-bar-d textarea, +.ui-bar-d button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-d .ui-link-inherit { + color: #333333 /*{d-bar-color}*/; +} +.ui-bar-d .ui-link { + color: #2489CE /*{d-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-d .ui-link:hover { + color: #2489CE /*{d-bar-link-hover}*/; +} +.ui-bar-d .ui-link:active { + color: #2489CE /*{d-bar-link-active}*/; +} +.ui-bar-d .ui-link:visited { + color: #2489CE /*{d-bar-link-visited}*/; +} +.ui-body-d, +.ui-overlay-d { + border: 1px solid #bbb /*{d-body-border}*/; + color: #333333 /*{d-body-color}*/; + text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/; + background: #ffffff /*{d-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff), to( #fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); +} +.ui-overlay-d { + background-image: none; + border-width: 0; +} +.ui-body-d, +.ui-body-d input, +.ui-body-d select, +.ui-body-d textarea, +.ui-body-d button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-d .ui-link-inherit { + color: #333333 /*{d-body-color}*/; +} +.ui-body-d .ui-link { + color: #2489CE /*{d-body-link-color}*/; + font-weight: bold; +} +.ui-body-d .ui-link:hover { + color: #2489CE /*{d-body-link-hover}*/; +} +.ui-body-d .ui-link:active { + color: #2489CE /*{d-body-link-active}*/; +} +.ui-body-d .ui-link:visited { + color: #2489CE /*{d-body-link-visited}*/; +} +.ui-btn-up-d { + border: 1px solid #bbb /*{d-bup-border}*/; + background: #fff /*{d-bup-background-color}*/; + font-weight: bold; + color: #333 /*{d-bup-color}*/; + text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 0 /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fafafa), to( #f6f6f6 /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fafafa /*{d-bup-background-start}*/, #f6f6f6 /*{d-bup-background-end}*/); +} +.ui-btn-up-d a.ui-link-inherit { + color: #333 /*{d-bup-color}*/; +} +.ui-btn-hover-d { + border: 1px solid #aaa /*{d-bhover-border}*/; + background: #eeeeee /*{d-bhover-background-color}*/; + font-weight: bold; + color: #333 /*{d-bhover-color}*/; + cursor: pointer; + text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 0 /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #eee), to( #fff /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #eee /*{d-bhover-background-start}*/, #fff /*{d-bhover-background-end}*/); +} +.ui-btn-hover-d a.ui-link-inherit { + color: #333 /*{d-bhover-color}*/; +} +.ui-btn-down-d { + border: 1px solid #aaa /*{d-bdown-border}*/; + background: #eee /*{d-bdown-background-color}*/; + font-weight: bold; + color: #333 /*{d-bdown-color}*/; + text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 0 /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #e5e5e5 /*{d-bdown-background-start}*/), to( #f2f2f2 /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #e5e5e5 /*{d-bdown-background-start}*/, #f2f2f2 /*{d-bdown-background-end}*/); +} +.ui-btn-down-d a.ui-link-inherit { + color: #333 /*{d-bdown-color}*/; +} +.ui-btn-up-d, +.ui-btn-hover-d, +.ui-btn-down-d { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* E +-----------------------------------------------------------------------------------------------------------*/ +.ui-bar-e { + border: 1px solid #F7C942 /*{e-bar-border}*/; + background: #fadb4e /*{e-bar-background-color}*/; + color: #333 /*{e-bar-color}*/; + text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fceda7 /*{e-bar-background-start}*/), to( #fbef7e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fceda7 /*{e-bar-background-start}*/, #fbef7e /*{e-bar-background-end}*/); +} +.ui-bar-e, +.ui-bar-e input, +.ui-bar-e select, +.ui-bar-e textarea, +.ui-bar-e button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-bar-e .ui-link-inherit { + color: #333333 /*{e-bar-color}*/; +} +.ui-bar-e .ui-link { + color: #2489CE /*{e-bar-link-color}*/; + font-weight: bold; +} +.ui-bar-e .ui-link:hover { + color: #2489CE /*{e-bar-link-hover}*/; +} +.ui-bar-e .ui-link:active { + color: #2489CE /*{e-bar-link-active}*/; +} +.ui-bar-e .ui-link:visited { + color: #2489CE /*{e-bar-link-visited}*/; +} +.ui-body-e, +.ui-overlay-e { + border: 1px solid #F7C942 /*{e-body-border}*/; + color: #222222 /*{e-body-color}*/; + text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/; + background: #fff9df /*{e-body-background-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fffadf /*{e-body-background-start}*/), to( #fff3a5 /*{e-body-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fffadf /*{e-body-background-start}*/, #fff3a5 /*{e-body-background-end}*/); +} +.ui-overlay-e { + background-image: none; + border-width: 0; +} +.ui-body-e, +.ui-body-e input, +.ui-body-e select, +.ui-body-e textarea, +.ui-body-e button { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-body-e .ui-link-inherit { + color: #333333 /*{e-body-color}*/; +} +.ui-body-e .ui-link { + color: #2489CE /*{e-body-link-color}*/; + font-weight: bold; +} +.ui-body-e .ui-link:hover { + color: #2489CE /*{e-body-link-hover}*/; +} +.ui-body-e .ui-link:active { + color: #2489CE /*{e-body-link-active}*/; +} +.ui-body-e .ui-link:visited { + color: #2489CE /*{e-body-link-visited}*/; +} +.ui-btn-up-e { + border: 1px solid #F4C63f /*{e-bup-border}*/; + background: #fadb4e /*{e-bup-background-color}*/; + font-weight: bold; + color: #222 /*{e-bup-color}*/; + text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #ffefaa /*{e-bup-background-start}*/), to( #ffe155 /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #ffefaa /*{e-bup-background-start}*/, #ffe155 /*{e-bup-background-end}*/); +} +.ui-btn-up-e a.ui-link-inherit { + color: #222 /*{e-bup-color}*/; +} +.ui-btn-hover-e { + border: 1px solid #F2C43d /*{e-bhover-border}*/; + background: #fbe26f /*{e-bhover-background-color}*/; + font-weight: bold; + color: #111 /*{e-bhover-color}*/; + text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 0 /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #fff5ba /*{e-bhover-background-start}*/), to( #fbdd52 /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #fff5ba /*{e-bhover-background-start}*/, #fbdd52 /*{e-bhover-background-end}*/); +} +.ui-btn-hover-e a.ui-link-inherit { + color: #333 /*{e-bhover-color}*/; +} +.ui-btn-down-e { + border: 1px solid #F2C43d /*{e-bdown-border}*/; + background: #fceda7 /*{e-bdown-background-color}*/; + font-weight: bold; + color: #111 /*{e-bdown-color}*/; + text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 0 /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; + background-image: -webkit-gradient(linear, left top, left bottom, from( #f8d94c /*{e-bdown-background-start}*/), to( #fadb4e /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #f8d94c /*{e-bdown-background-start}*/, #fadb4e /*{e-bdown-background-end}*/); +} +.ui-btn-down-e a.ui-link-inherit { + color: #333 /*{e-bdown-color}*/; +} +.ui-btn-up-e, +.ui-btn-hover-e, +.ui-btn-down-e { + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; + text-decoration: none; +} +/* Structure */ +/* links within "buttons" +-----------------------------------------------------------------------------------------------------------*/ +a.ui-link-inherit { + text-decoration: none !important; +} +/* Active class used as the "on" state across all themes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-active { + border: 1px solid #2373a5 /*{global-active-border}*/; + background: #5393c5 /*{global-active-background-color}*/; + font-weight: bold; + color: #fff /*{global-active-color}*/; + cursor: pointer; + text-shadow: 0 /*{global-active-shadow-x}*/ 1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #3373a5 /*{global-active-shadow-color}*/; + text-decoration: none; + background-image: -webkit-gradient(linear, left top, left bottom, from( #5393c5 /*{global-active-background-start}*/), to( #6facd5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ + background-image: -webkit-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ + background-image: -moz-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* FF3.6 */ + background-image: -ms-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* IE10 */ + background-image: -o-linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); /* Opera 11.10+ */ + background-image: linear-gradient( #5393c5 /*{global-active-background-start}*/, #6facd5 /*{global-active-background-end}*/); + font-family: Helvetica, Arial, sans-serif /*{global-font-family}*/; +} +.ui-btn-active a.ui-link-inherit { + color: #fff /*{global-active-color}*/; +} +/* button inner top highlight +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-inner { + border-top: 1px solid #fff; + border-color: rgba(255,255,255,.3); +} +/* corner rounding classes +-----------------------------------------------------------------------------------------------------------*/ +.ui-corner-tl { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-tr { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bl { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-br { + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-top { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-bottom { + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + } +.ui-corner-right { + -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; + -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; + border-top-right-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; + border-bottom-right-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-left { + -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; + -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; + border-top-left-radius: .6em /*{global-radii-blocks}*/; + -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; + -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; + border-bottom-left-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-all { + -moz-border-radius: .6em /*{global-radii-blocks}*/; + -webkit-border-radius: .6em /*{global-radii-blocks}*/; + border-radius: .6em /*{global-radii-blocks}*/; +} +.ui-corner-none { + -moz-border-radius: 0; + -webkit-border-radius: 0; + border-radius: 0; +} +/* Form field separator +-----------------------------------------------------------------------------------------------------------*/ +.ui-br { + border-bottom: rgb(130,130,130); + border-bottom: rgba(130,130,130,.3); + border-bottom-width: 1px; + border-bottom-style: solid; +} +/* Interaction cues +-----------------------------------------------------------------------------------------------------------*/ +.ui-disabled { + opacity: .3; +} +.ui-disabled, +.ui-disabled a { + cursor: default !important; + pointer-events: none; +} +.ui-disabled .ui-btn-text { + -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(opacity=30)"; + filter: alpha(opacity=30); + zoom: 1; +} +/* Icons +-----------------------------------------------------------------------------------------------------------*/ +.ui-icon, +.ui-icon-searchfield:after { + background: #666 /*{global-icon-color}*/; + background: rgba(0,0,0,.4) /*{global-icon-disc}*/; + background-image: url(images/icons-18-white.png) /*{global-icon-set}*/; + background-repeat: no-repeat; + -moz-border-radius: 9px; + -webkit-border-radius: 9px; + border-radius: 9px; +} +/* Alt icon color +-----------------------------------------------------------------------------------------------------------*/ +.ui-icon-alt { + background: #fff; + background: rgba(255,255,255,.3); + background-image: url(images/icons-18-black.png); + background-repeat: no-repeat; +} +/* HD/"retina" sprite +-----------------------------------------------------------------------------------------------------------*/ +@media only screen and (-webkit-min-device-pixel-ratio: 1.5), + only screen and (min--moz-device-pixel-ratio: 1.5), + only screen and (min-resolution: 240dpi) { + + .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, + .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, + .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, + .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after, + .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { + background-image: url(images/icons-36-white.png); + -moz-background-size: 776px 18px; + -o-background-size: 776px 18px; + -webkit-background-size: 776px 18px; + background-size: 776px 18px; + } + .ui-icon-alt { + background-image: url(images/icons-36-black.png); + } +} +/* plus minus */ +.ui-icon-plus { + background-position: -0 50%; +} +.ui-icon-minus { + background-position: -36px 50%; +} +/* delete/close */ +.ui-icon-delete { + background-position: -72px 50%; +} +/* arrows */ +.ui-icon-arrow-r { + background-position: -108px 50%; +} +.ui-icon-arrow-l { + background-position: -144px 50%; +} +.ui-icon-arrow-u { + background-position: -180px 50%; +} +.ui-icon-arrow-d { + background-position: -216px 50%; +} +/* misc */ +.ui-icon-check { + background-position: -252px 50%; +} +.ui-icon-gear { + background-position: -288px 50%; +} +.ui-icon-refresh { + background-position: -324px 50%; +} +.ui-icon-forward { + background-position: -360px 50%; +} +.ui-icon-back { + background-position: -396px 50%; +} +.ui-icon-grid { + background-position: -432px 50%; +} +.ui-icon-star { + background-position: -468px 50%; +} +.ui-icon-alert { + background-position: -504px 50%; +} +.ui-icon-info { + background-position: -540px 50%; +} +.ui-icon-home { + background-position: -576px 50%; +} +.ui-icon-search, +.ui-icon-searchfield:after { + background-position: -612px 50%; +} +.ui-icon-checkbox-off { + background-position: -684px 50%; +} +.ui-icon-checkbox-on { + background-position: -648px 50%; +} +.ui-icon-radio-off { + background-position: -756px 50%; +} +.ui-icon-radio-on { + background-position: -720px 50%; +} +/* checks,radios */ +.ui-checkbox .ui-icon { + -moz-border-radius: 3px; + -webkit-border-radius: 3px; + border-radius: 3px; +} +.ui-icon-checkbox-off, +.ui-icon-radio-off { + background-color: transparent; +} +.ui-checkbox-on .ui-icon, +.ui-radio-on .ui-icon { + background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ +} +/* loading icon */ +.ui-icon-loading { + background: url(images/ajax-loader.gif); + background-size: 46px 46px; +} +/* Button corner classes +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn-corner-tl { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-tr { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bl { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-br { + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-top { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-bottom { + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-right { + -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; + -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; + border-top-right-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; + border-bottom-right-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-left { + -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; + -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; + border-top-left-radius: 1em /*{global-radii-buttons}*/; + -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; + -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; + border-bottom-left-radius: 1em /*{global-radii-buttons}*/; +} +.ui-btn-corner-all { + -moz-border-radius: 1em /*{global-radii-buttons}*/; + -webkit-border-radius: 1em /*{global-radii-buttons}*/; + border-radius: 1em /*{global-radii-buttons}*/; +} +/* radius clip workaround for cleaning up corner trapping */ +.ui-corner-tl, +.ui-corner-tr, +.ui-corner-bl, +.ui-corner-br, +.ui-corner-top, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-left, +.ui-corner-all, +.ui-btn-corner-tl, +.ui-btn-corner-tr, +.ui-btn-corner-bl, +.ui-btn-corner-br, +.ui-btn-corner-top, +.ui-btn-corner-bottom, +.ui-btn-corner-right, +.ui-btn-corner-left, +.ui-btn-corner-all { + -webkit-background-clip: padding-box; + -moz-background-clip: padding; + background-clip: padding-box; +} +/* Overlay / modal +-----------------------------------------------------------------------------------------------------------*/ +.ui-overlay { + background: #666; + opacity: .5; + filter: Alpha(Opacity=50); + position: absolute; + width: 100%; + height: 100%; +} +.ui-overlay-shadow { + -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); + box-shadow: 0px 0px 12px rgba(0,0,0,.6); +} +.ui-shadow { + -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; + box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; +} +.ui-bar-a .ui-shadow, +.ui-bar-b .ui-shadow , +.ui-bar-c .ui-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); + box-shadow: 0px 1px 0 rgba(255,255,255,.3); +} +.ui-shadow-inset { + -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); + box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); +} +.ui-icon-shadow { + -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; + box-shadow: 0px 1px 0 rgba(255,255,255,.4) /*{global-icon-shadow}*/; +} +/* Focus state - set here for specificity (note: these classes are added by JavaScript) +-----------------------------------------------------------------------------------------------------------*/ +.ui-btn:focus { + outline: 0; +} +.ui-focus, +.ui-btn:focus { + -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; + box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; +} +/* unset box shadow in browsers that don't do it right +-----------------------------------------------------------------------------------------------------------*/ +.ui-mobile-nosupport-boxshadow * { + -moz-box-shadow: none !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; +} +/* ...and bring back focus */ +.ui-mobile-nosupport-boxshadow .ui-focus, +.ui-mobile-nosupport-boxshadow .ui-btn:focus { + outline-width: 1px; + outline-style: dotted; +} +/* some unsets - more probably needed */ +.ui-mobile, .ui-mobile body { height: 99.9%; } +.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } +.ui-mobile a img, .ui-mobile fieldset { border-width: 0; } +/* responsive page widths */ +.ui-mobile-viewport { margin: 0; overflow-x: visible; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } +/* Issue #2066 */ +body.ui-mobile-viewport, +div.ui-mobile-viewport { overflow-x: hidden; } +/* "page" containers - full-screen views, one should always be in view post-pageload */ +.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } +.ui-mobile .ui-page-active { display: block; overflow: visible; } +/* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */ +.ui-page { outline: none; } +/*orientations from js are available */ +@media screen and (orientation: portrait){ +.ui-mobile, .ui-mobile .ui-page { min-height: 420px; } +} +@media screen and (orientation: landscape){ +.ui-mobile, .ui-mobile .ui-page { min-height: 300px; } +} +/* loading screen */ +.ui-loading .ui-loader { display: block; } +.ui-loader { display: none; z-index: 9999999; position: fixed; top: 50%; box-shadow: 0 1px 1px -1px #fff; left: 50%; border:0; } +.ui-loader-default { background: none; opacity: .18; width: 46px; height: 46px; margin-left: -23px; margin-top: -23px; } +.ui-loader-verbose { width: 200px; opacity: .88; height: auto; margin-left: -110px; margin-top: -43px; padding: 10px; } +.ui-loader-default h1 { font-size: 0; width: 0; height: 0; overflow: hidden; } +.ui-loader-verbose h1 { font-size: 16px; margin: 0; text-align: center; } +.ui-loader .ui-icon { background-color: #000; display: block; margin: 0; width: 44px; height: 44px; padding: 1px; -webkit-border-radius: 36px; -moz-border-radius: 36px; border-radius: 36px; } +.ui-loader-verbose .ui-icon { margin: 0 auto 10px; opacity: .75; } +.ui-loader-textonly { padding: 15px; margin-left: -115px; } +.ui-loader-textonly .ui-icon { display: none; } +.ui-loader-fakefix { position: absolute; } +/*fouc*/ +.ui-mobile-rendering > * { visibility: hidden; } +/*headers, content panels*/ +.ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } +.ui-bar { font-size: 16px; margin: 0; } +.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } +.ui-header, .ui-footer { position: relative; border-left-width: 0; border-right-width: 0; } +.ui-header .ui-btn-left, +.ui-header .ui-btn-right, +.ui-footer .ui-btn-left, +.ui-footer .ui-btn-right { position: absolute; top: 3px; } +.ui-header .ui-btn-left, +.ui-footer .ui-btn-left { left: 5px; } +.ui-header .ui-btn-right, +.ui-footer .ui-btn-right { right: 5px; } +.ui-footer .ui-btn-icon-notext, +.ui-header .ui-btn-icon-notext { top: 6px; } +.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 30% .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } +.ui-footer .ui-title { margin: .6em 15px .8em; } +/*content area*/ +.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } +/* icons sizing */ +.ui-icon { width: 18px; height: 18px; } +/* non-js content hiding */ +.ui-nojs { position: absolute; left: -9999px; } +/* accessible content hiding */ +.ui-hide-label label, +.ui-hidden-accessible { position: absolute !important; left: -9999px; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +/* Transitions originally inspired by those from jQtouch, nice work, folks */ +.ui-mobile-viewport-transitioning, +.ui-mobile-viewport-transitioning .ui-page { + width: 100%; + height: 100%; + overflow: hidden; +} +.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.out { + -webkit-animation-timing-function: ease-in; + -webkit-animation-duration: 225ms; + -moz-animation-timing-function: ease-in; + -moz-animation-duration: 225; +} +@-webkit-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-moz-keyframes fadein { + from { opacity: 0; } + to { opacity: 1; } +} +@-webkit-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +@-moz-keyframes fadeout { + from { opacity: 1; } + to { opacity: 0; } +} +.fade.out { + opacity: 0; + -webkit-animation-duration: 125ms; + -webkit-animation-name: fadeout; + -moz-animation-duration: 125ms; + -moz-animation-name: fadeout; +} +.fade.in { + opacity: 1; + -webkit-animation-duration: 225ms; + -webkit-animation-name: fadein; + -moz-animation-duration: 225ms; + -moz-animation-name: fadein; +} +.pop { + -webkit-transform-origin: 50% 50%; + -moz-transform-origin: 50% 50%; +} +.pop.in { + -webkit-transform: scale(1); + -moz-transform: scale(1); + opacity: 1; + -webkit-animation-name: popin; + -moz-animation-name: popin; + -webkit-animation-duration: 350ms; + -moz-animation-duration: 350ms; +} +.pop.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + opacity: 0; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.pop.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; +} +.pop.out.reverse { + -webkit-transform: scale(.8); + -moz-transform: scale(.8); + -webkit-animation-name: popout; + -moz-animation-name: popout; +} +@-webkit-keyframes popin { + from { + -webkit-transform: scale(.8); + opacity: 0; + } + to { + -webkit-transform: scale(1); + opacity: 1; + } +} +@-moz-keyframes popin { + from { + -moz-transform: scale(.8); + opacity: 0; + } + to { + -moz-transform: scale(1); + opacity: 1; + } +} +@-webkit-keyframes popout { + from { + -webkit-transform: scale(1); + opacity: 1; + } + to { + -webkit-transform: scale(.8); + opacity: 0; + } +} +@-moz-keyframes popout { + from { + -moz-transform: scale(1); + opacity: 1; + } + to { + -moz-transform: scale(.8); + opacity: 0; + } +} +/* keyframes for slidein from sides */ +@-webkit-keyframes slideinfromright { + from { -webkit-transform: translateX(100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromright { + from { -moz-transform: translateX(100%); } + to { -moz-transform: translateX(0); } +} +@-webkit-keyframes slideinfromleft { + from { -webkit-transform: translateX(-100%); } + to { -webkit-transform: translateX(0); } +} +@-moz-keyframes slideinfromleft { + from { -moz-transform: translateX(-100%); } + to { -moz-transform: translateX(0); } +} +/* keyframes for slideout to sides */ +@-webkit-keyframes slideouttoleft { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(-100%); } +} +@-moz-keyframes slideouttoleft { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(-100%); } +} +@-webkit-keyframes slideouttoright { + from { -webkit-transform: translateX(0); } + to { -webkit-transform: translateX(100%); } +} +@-moz-keyframes slideouttoright { + from { -moz-transform: translateX(0); } + to { -moz-transform: translateX(100%); } +} +.slide.out, .slide.in { + -webkit-animation-timing-function: ease-out; + -webkit-animation-duration: 350ms; + -moz-animation-timing-function: ease-out; + -moz-animation-duration: 350ms; +} +.slide.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; +} +.slide.in { + -webkit-transform: translateX(0); + -webkit-animation-name: slideinfromright; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromright; +} +.slide.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; +} +.slide.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: slideinfromleft; + -moz-transform: translateX(0); + -moz-animation-name: slideinfromleft; +} +.slidefade.out { + -webkit-transform: translateX(-100%); + -webkit-animation-name: slideouttoleft; + -moz-transform: translateX(-100%); + -moz-animation-name: slideouttoleft; + -webkit-animation-duration: 225ms; + -moz-animation-duration: 225ms; +} +.slidefade.in { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +.slidefade.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: slideouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: slideouttoright; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +.slidefade.in.reverse { + -webkit-transform: translateX(0); + -webkit-animation-name: fadein; + -moz-transform: translateX(0); + -moz-animation-name: fadein; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +/* slide down */ +.slidedown.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.slidedown.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfromtop; + -moz-transform: translateY(0); + -moz-animation-name: slideinfromtop; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slidedown.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slidedown.out.reverse { + -webkit-transform: translateY(-100%); + -moz-transform: translateY(-100%); + -webkit-animation-name: slideouttotop; + -moz-animation-name: slideouttotop; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfromtop { + from { -webkit-transform: translateY(-100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfromtop { + from { -moz-transform: translateY(-100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttotop { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(-100%); } +} +@-moz-keyframes slideouttotop { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(-100%); } +} +/* slide up */ +.slideup.out { + -webkit-animation-name: fadeout; + -moz-animation-name: fadeout; + -webkit-animation-duration: 100ms; + -moz-animation-duration: 100ms; +} +.slideup.in { + -webkit-transform: translateY(0); + -webkit-animation-name: slideinfrombottom; + -moz-transform: translateY(0); + -moz-animation-name: slideinfrombottom; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; +} +.slideup.in.reverse { + -webkit-animation-name: fadein; + -moz-animation-name: fadein; + -webkit-animation-duration: 150ms; + -moz-animation-duration: 150ms; +} +.slideup.out.reverse { + -webkit-transform: translateY(100%); + -moz-transform: translateY(100%); + -webkit-animation-name: slideouttobottom; + -moz-animation-name: slideouttobottom; + -webkit-animation-duration: 200ms; + -moz-animation-duration: 200ms; +} +@-webkit-keyframes slideinfrombottom { + from { -webkit-transform: translateY(100%); } + to { -webkit-transform: translateY(0); } +} +@-moz-keyframes slideinfrombottom { + from { -moz-transform: translateY(100%); } + to { -moz-transform: translateY(0); } +} +@-webkit-keyframes slideouttobottom { + from { -webkit-transform: translateY(0); } + to { -webkit-transform: translateY(100%); } +} +@-moz-keyframes slideouttobottom { + from { -moz-transform: translateY(0); } + to { -moz-transform: translateY(100%); } +} +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-flip { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.flip { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); +} +.flip.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -webkit-animation-duration: 175ms; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -moz-animation-duration: 175ms; +} +.flip.in { + -webkit-animation-name: flipintoright; + -webkit-animation-duration: 225ms; + -moz-animation-name: flipintoright; + -moz-animation-duration: 225ms; +} +.flip.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.flip.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* The properties in this rule are only necessary for the 'flip' transition. + * We need specify the perspective to create a projection matrix. This will add + * some depth as the element flips. The depth number represents the distance of + * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate + * value. + */ +.viewport-turn { + -webkit-perspective: 1000; + -moz-perspective: 1000; + position: absolute; +} +.turn { + -webkit-backface-visibility:hidden; + -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -webkit-transform-origin: 0; + + -moz-backface-visibility:hidden; + -moz-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ + -moz-transform-origin: 0; +} +.turn.out { + -webkit-transform: rotateY(-90deg) scale(.9); + -webkit-animation-name: flipouttoleft; + -moz-transform: rotateY(-90deg) scale(.9); + -moz-animation-name: flipouttoleft; + -webkit-animation-duration: 125ms; + -moz-animation-duration: 125ms; +} +.turn.in { + -webkit-animation-name: flipintoright; + -moz-animation-name: flipintoright; + -webkit-animation-duration: 250ms; + -moz-animation-duration: 250ms; + +} +.turn.out.reverse { + -webkit-transform: rotateY(90deg) scale(.9); + -webkit-animation-name: flipouttoright; + -moz-transform: rotateY(90deg) scale(.9); + -moz-animation-name: flipouttoright; +} +.turn.in.reverse { + -webkit-animation-name: flipintoleft; + -moz-animation-name: flipintoleft; +} +@-webkit-keyframes flipouttoleft { + from { -webkit-transform: rotateY(0); } + to { -webkit-transform: rotateY(-90deg) scale(.9); } +} +@-moz-keyframes flipouttoleft { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(-90deg) scale(.9); } +} +@-webkit-keyframes flipouttoright { + from { -webkit-transform: rotateY(0) ; } + to { -webkit-transform: rotateY(90deg) scale(.9); } +} +@-moz-keyframes flipouttoright { + from { -moz-transform: rotateY(0); } + to { -moz-transform: rotateY(90deg) scale(.9); } +} +@-webkit-keyframes flipintoleft { + from { -webkit-transform: rotateY(-90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoleft { + from { -moz-transform: rotateY(-90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +@-webkit-keyframes flipintoright { + from { -webkit-transform: rotateY(90deg) scale(.9); } + to { -webkit-transform: rotateY(0); } +} +@-moz-keyframes flipintoright { + from { -moz-transform: rotateY(90deg) scale(.9); } + to { -moz-transform: rotateY(0); } +} +/* flow transition */ +.flow { + -webkit-transform-origin: 50% 30%; + -moz-transform-origin: 50% 30%; + -webkit-box-shadow: 0 0 20px rgba(0,0,0,.4); + -moz-box-shadow: 0 0 20px rgba(0,0,0,.4); +} +.ui-dialog.flow { + -webkit-transform-origin: none; + -moz-transform-origin: none; + -webkit-box-shadow: none; + -moz-box-shadow: none; +} +.flow.out { + -webkit-transform: translateX(-100%) scale(.7); + -webkit-animation-name: flowouttoleft; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(-100%) scale(.7); + -moz-animation-name: flowouttoleft; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.in { + -webkit-transform: translateX(0) scale(1); + -webkit-animation-name: flowinfromright; + -webkit-animation-timing-function: ease; + -webkit-animation-duration: 350ms; + -moz-transform: translateX(0) scale(1); + -moz-animation-name: flowinfromright; + -moz-animation-timing-function: ease; + -moz-animation-duration: 350ms; +} +.flow.out.reverse { + -webkit-transform: translateX(100%); + -webkit-animation-name: flowouttoright; + -moz-transform: translateX(100%); + -moz-animation-name: flowouttoright; +} +.flow.in.reverse { + -webkit-animation-name: flowinfromleft; + -moz-animation-name: flowinfromleft; +} +@-webkit-keyframes flowouttoleft { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(-100%) scale(.7); } +} +@-moz-keyframes flowouttoleft { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(-100%) scale(.7); } +} +@-webkit-keyframes flowouttoright { + 0% { -webkit-transform: translateX(0) scale(1); } + 60%, 70% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(100%) scale(.7); } +} +@-moz-keyframes flowouttoright { + 0% { -moz-transform: translateX(0) scale(1); } + 60%, 70% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(100%) scale(.7); } +} +@-webkit-keyframes flowinfromleft { + 0% { -webkit-transform: translateX(-100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromleft { + 0% { -moz-transform: translateX(-100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +@-webkit-keyframes flowinfromright { + 0% { -webkit-transform: translateX(100%) scale(.7); } + 30%, 40% { -webkit-transform: translateX(0) scale(.7); } + 100% { -webkit-transform: translateX(0) scale(1); } +} +@-moz-keyframes flowinfromright { + 0% { -moz-transform: translateX(100%) scale(.7); } + 30%, 40% { -moz-transform: translateX(0) scale(.7); } + 100% { -moz-transform: translateX(0) scale(1); } +} +/* content configurations. */ +.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } +.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} +/* grid solo: 100 - single item fallback */ +.ui-grid-solo .ui-block-a { width: 100%; float: none; } +/* grid a: 50/50 */ +.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } +.ui-grid-a .ui-block-a { clear: left; } +/* grid b: 33/33/33 */ +.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } +.ui-grid-b .ui-block-a { clear: left; } +/* grid c: 25/25/25/25 */ +.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } +.ui-grid-c .ui-block-a { clear: left; } +/* grid d: 20/20/20/20/20 */ +.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } +.ui-grid-d .ui-block-a { clear: left; } +/* fixed page header & footer configuration */ +.ui-header-fixed, +.ui-footer-fixed { + left: 0; + right: 0; + width: 100%; + position: fixed; + z-index: 1000; +} +.ui-header-fixed { + top: 0; +} +.ui-footer-fixed { + bottom: 0; +} +.ui-header-fullscreen, +.ui-footer-fullscreen { + opacity: .9; +} +.ui-page-header-fixed { + padding-top: 2.5em; +} +.ui-page-footer-fixed { + padding-bottom: 3em; +} +.ui-page-header-fullscreen .ui-content, +.ui-page-footer-fullscreen .ui-content { + padding: 0; +} +.ui-fixed-hidden { + position: absolute; +} +.ui-page-header-fullscreen .ui-fixed-hidden, +.ui-page-footer-fullscreen .ui-fixed-hidden { + left: -99999em; +} +.ui-header-fixed .ui-btn, +.ui-footer-fixed .ui-btn { + z-index: 10; +} +.ui-navbar { overflow: hidden; } +.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} +.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } +.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } +.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } +.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; max-width: 100%; } +.ui-navbar li .ui-btn { margin-right: -1px; } +.ui-navbar li .ui-btn:last-child { margin-right: 0; } +.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, +.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; } +.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; } +.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; } +/*expanded page styles*/ +.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; } +.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; } +.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; } +.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; } +.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; } +.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; } +.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } +.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } +.ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } +.ui-mini { margin: .25em 5px; } +.ui-btn-inner { padding: .6em 20px; min-width: .75em; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } +.ui-btn input, .ui-btn button { z-index: 2; } +.ui-btn-left, .ui-btn-right, .ui-btn-inline { display: inline-block; } +.ui-btn-block { display: block; } +.ui-header .ui-btn, +.ui-footer .ui-btn { display: inline-block; margin: 0; } +.ui-header .ui-btn-inner, +.ui-footer .ui-btn-inner, +.ui-mini .ui-btn-inner { font-size: 12.5px; padding: .55em 11px .5em; } +.ui-header .ui-fullsize .ui-btn-inner, +.ui-footer .ui-fullsize .ui-btn-inner { font-size: 16px; padding: .6em 25px; } +.ui-btn-icon-notext { width: 24px; height: 24px; } +.ui-btn-icon-notext .ui-btn-inner { padding: 0; height: 100%; } +.ui-btn-icon-notext .ui-btn-inner .ui-icon { margin: 2px 1px 2px 3px; } +.ui-btn-text { position: relative; z-index: 1; width: 100%; } +.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -9999px; } +.ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-btn-icon-right .ui-btn-inner { padding-right: 40px; } +.ui-btn-icon-top .ui-btn-inner { padding-top: 40px; } +.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 40px; } +.ui-header .ui-btn-icon-left .ui-btn-inner, +.ui-footer .ui-btn-icon-left .ui-btn-inner, +.ui-mini .ui-btn-icon-left .ui-btn-inner { padding-left: 30px; } +.ui-header .ui-btn-icon-right .ui-btn-inner, +.ui-footer .ui-btn-icon-right .ui-btn-inner, +.ui-mini .ui-btn-icon-right .ui-btn-inner { padding-right: 30px; } +.ui-header .ui-btn-icon-top .ui-btn-inner, +.ui-footer .ui-btn-icon-top .ui-btn-inner, +.ui-mini .ui-btn-icon-top .ui-btn-inner { padding: 30px 3px .5em 3px; } +.ui-header .ui-btn-icon-bottom .ui-btn-inner, +.ui-footer .ui-btn-icon-bottom .ui-btn-inner, +.ui-mini .ui-btn-icon-bottom .ui-btn-inner { padding: .55em 3px 30px 3px; } +/*btn icon positioning*/ +.ui-btn-icon-notext .ui-icon { display: block; z-index: 0;} +.ui-btn-icon-left .ui-btn-inner .ui-icon, .ui-btn-icon-right .ui-btn-inner .ui-icon { position: absolute; top: 50%; margin-top: -9px; } +.ui-btn-icon-top .ui-btn-inner .ui-icon, .ui-btn-icon-bottom .ui-btn-inner .ui-icon { position: absolute; left: 50%; margin-left: -9px; } +.ui-btn-icon-left .ui-icon { left: 10px; } +.ui-btn-icon-right .ui-icon { right: 10px; } +.ui-btn-icon-top .ui-icon { top: 10px; } +.ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-header .ui-btn-icon-left .ui-icon, +.ui-footer .ui-btn-icon-left .ui-icon, +.ui-mini.ui-btn-icon-left .ui-icon, +.ui-mini .ui-btn-icon-left .ui-icon { left: 5px; } +.ui-header .ui-btn-icon-right .ui-icon, +.ui-footer .ui-btn-icon-right .ui-icon, +.ui-mini.ui-btn-icon-right .ui-icon, +.ui-mini .ui-btn-icon-right .ui-icon { right: 5px; } +.ui-header .ui-btn-icon-top .ui-icon, +.ui-footer .ui-btn-icon-top .ui-icon, +.ui-mini.ui-btn-icon-top .ui-icon, +.ui-mini .ui-btn-icon-top .ui-icon { top: 5px; } +.ui-header .ui-btn-icon-bottom .ui-icon, +.ui-footer .ui-btn-icon-bottom .ui-icon, +.ui-mini.ui-btn-icon-bottom .ui-icon, +.ui-mini .ui-btn-icon-bottom .ui-icon { bottom: 5px; } +/*hiding native button,inputs */ +.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: #fff; background: rgba(255,255,255,0); filter: Alpha(Opacity=.0001); font-size: 1px; border: none; text-indent: -9999px; } +.ui-collapsible { margin: .5em 0; } +.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } +.ui-collapsible-heading a { text-align: left; margin: 0; } +.ui-collapsible-heading .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-left .ui-btn-inner { padding-left: 40px; } +.ui-collapsible-heading .ui-btn-icon-right .ui-btn-inner { padding-left: 12px; padding-right: 40px; } +.ui-collapsible-heading .ui-btn-icon-top .ui-btn-inner, +.ui-collapsible-heading .ui-btn-icon-bottom .ui-btn-inner { padding-right: 40px; text-align: center; } +.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } +.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } +.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } +.ui-collapsible-heading-status { position: absolute; top: -9999px; left:0px; } +.ui-collapsible-content { + display: block; + margin: 0 -8px; + padding: 10px 16px; + border-top: none; /* Overrides ui-btn-up-* */ + background-image: none; /* Overrides ui-btn-up-* */ + font-weight: normal; /* Overrides ui-btn-up-* */ +} +.ui-collapsible-content-collapsed { display: none; } +.ui-collapsible-set { margin: .5em 0; } +.ui-collapsible-set .ui-collapsible { margin: -1px 0 0; } +.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: 0em 0 .5em; zoom: 1; } +.ui-bar .ui-controlgroup { margin: 0 .3em; } +.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .4em; } +.ui-controlgroup-controls { display: block; width: 100%;} +.ui-controlgroup li { list-style: none; } +.ui-controlgroup-vertical .ui-btn, +.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } +.ui-controlgroup-controls label.ui-select { position: absolute; left: -9999px; } +.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } +.ui-controlgroup-horizontal { padding: 0; } +.ui-controlgroup-horizontal .ui-btn-inner { text-align:center; } +.ui-controlgroup-horizontal .ui-btn, .ui-controlgroup-horizontal .ui-select { display: inline-block; margin: 0 -6px 0 0; } +.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; clear: none; margin: 0 -1px 0 0; } +.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, +.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } +.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } +.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } +/* conflicts with listview.. +.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } +.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } +*/ +@media all and (min-width: 450px){ + .ui-field-contain .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain .ui-controlgroup-controls { width: 60%; display: inline-block; } + .ui-field-contain .ui-controlgroup .ui-select { width: 100%; } + .ui-field-contain .ui-controlgroup-horizontal .ui-select { width: auto; } +} +.ui-dialog { + background: none !important; /* this is to ensure that dialog theming does not apply (by default at least) on the page div */ +} +.ui-dialog-contain { width: 92.5%; max-width: 500px; margin: 10% auto 15px auto; padding: 0; } +.ui-dialog .ui-header { + margin-top: 15%; + border: none; + overflow: hidden; +} +.ui-dialog .ui-header, +.ui-dialog .ui-content, +.ui-dialog .ui-footer { + display: block; + position: relative; + width: auto; +} +.ui-dialog .ui-header, +.ui-dialog .ui-footer { + z-index: 10; + padding: 0; +} +.ui-dialog .ui-footer { + padding: 0 15px; +} +.ui-dialog .ui-content { + padding: 15px; +} +.ui-dialog { + margin-top: -15px; +} +.ui-checkbox, .ui-radio { position: relative; clear: both; margin: .2em 0 .5em; z-index: 1; } +.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } +.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } +.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-mini.ui-btn-icon-left .ui-btn-inner { padding-left: 36px; } +.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-mini.ui-btn-icon-right .ui-btn-inner { padding-right: 36px; } +.ui-checkbox .ui-btn-icon-top .ui-btn-inner,.ui-radio .ui-btn-icon-top .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-btn-icon-bottom .ui-btn-inner, .ui-radio .ui-btn-icon-bottom .ui-btn-inner { padding-right: 0; padding-left: 0; text-align: center; } +.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } +.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon { left: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-left .ui-icon, .ui-radio .ui-mini.ui-btn-icon-left .ui-icon { left: 9px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +.ui-checkbox .ui-btn-icon-top .ui-icon, .ui-radio .ui-btn-icon-top .ui-icon { top: 10px; } +.ui-checkbox .ui-btn-icon-bottom .ui-icon, .ui-radio .ui-btn-icon-bottom .ui-icon { top: auto; bottom: 10px; } +.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-checkbox .ui-mini.ui-btn-icon-right .ui-icon, .ui-radio .ui-mini.ui-btn-icon-right .ui-icon { right: 9px; } +/* input, label positioning */ +.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; } +.ui-field-contain, fieldset.ui-field-contain { padding: .8em 0; margin: 0; border-width: 0 0 1px 0; overflow: visible; } +.ui-field-contain:first-child { border-top-width: 0; } +.ui-header .ui-field-contain-left, +.ui-header .ui-field-contain-right { + position: absolute; + top: 0; + width: 25%; +} +.ui-header .ui-field-contain-left { + left: 1em; +} +.ui-header .ui-field-contain-right { + right: 1em; +} +@media all and (min-width: 450px){ + .ui-field-contain, .ui-mobile fieldset.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } +} +.ui-select { display: block; position: relative; } +.ui-select select { position: absolute; left: -9999px; top: -9999px; } +.ui-select .ui-btn { overflow: hidden; opacity: 1; margin: 0; } +/* Fixes #2588 — When Windows Phone 7.5 (Mango) tries to calculate a numeric opacity for a select—including “inherit”—without explicitly specifying an opacity on the parent to give it context, a bug appears where clicking elsewhere on the page after opening the select will open the select again. */ +.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); z-index: 2; } +.ui-select .ui-disabled { opacity: .3; } +@-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} +.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } +.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } +.ui-select .ui-btn-icon-right .ui-icon { right: 15px; } +.ui-select .ui-mini.ui-btn-icon-right .ui-icon { right: 7px; } +/* labels */ +label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +/*listbox*/ +.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; overflow: hidden !important; +/* This !important is required for iPad Safari specifically. See https://github.com/jquery/jquery-mobile/issues/2647 */ } +.ui-select .ui-btn-text { text-overflow: ellipsis; } +.ui-selectmenu { position: absolute; padding: 0; z-index: 1100 !important; width: 80%; max-width: 350px; padding: 6px; } +.ui-selectmenu .ui-listview { margin: 0; } +.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } +.ui-selectmenu-hidden { top: -9999px; left: -9999px; } +.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; } +.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } +.ui-selectmenu-list .ui-li .ui-icon { display: block; } +.ui-li.ui-selectmenu-placeholder { display: none; } +.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain .ui-select { width: 60%; display: inline-block; } +} +/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ +.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; } +label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } +input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 97%; outline: 0; } +.ui-header input.ui-input-text, +.ui-footer input.ui-input-text { margin-left: 1.25%; padding: .4em 1%; width: 95.5% } /* Note that padding left/right on text inputs is factored into how the element is displayed in Firefox, but does not actually pad the text inside it. */ + input.ui-input-text { -webkit-appearance: none; } +textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } +.ui-input-search { padding: 0 30px; background-image: none; position: relative; } +.ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; } +.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } +.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -13px; } +.ui-mini .ui-input-clear { right: -3px; } +.ui-input-search .ui-input-clear-hidden { display: none; } +input.ui-mini, .ui-mini input, textarea.ui-mini { font-size: 14px; } +textarea.ui-mini { height: 45px; } +/* orientation adjustments - incomplete!*/ +@media all and (min-width: 450px){ + .ui-field-contain label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } + .ui-field-contain input.ui-input-text, + .ui-field-contain textarea.ui-input-text, + .ui-field-contain .ui-input-search { width: 60%; display: inline-block; } + .ui-field-contain .ui-input-search { width: 50%; } + .ui-hide-label input.ui-input-text, + .ui-hide-label textarea.ui-input-text, + .ui-hide-label .ui-input-search { padding: .4em; width: 97%; } + .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } +} +.ui-listview { margin: 0; counter-reset: listnumbering; } +.ui-content .ui-listview { margin: -15px; } +.ui-content .ui-listview-inset { margin: 1em 0; } +.ui-listview, .ui-li { list-style:none; padding:0; } +.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } +.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; } +.ui-li-divider { counter-reset: listnumbering; } +ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; } +ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ +.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } +.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; } +.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } +.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 15px .7em 15px; display: block; } +.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } +.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } +.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-count { padding-right: 45px; } +.ui-li-has-arrow .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow { padding-right: 30px; } +.ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow.ui-li-has-count { padding-right: 75px; } +.ui-li-has-count .ui-btn-text { padding-right: 15px; } +.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } +.ui-li-thumb, .ui-listview .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } +.ui-listview .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } +.ui-li-thumb, .ui-listview .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } +.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } +@media all and (min-width: 480px){ + .ui-li-aside { width: 45%; } +} +.ui-li-divider { cursor: default; } +.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } +.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 48px; } +.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } +.ui-li-has-alt .ui-li-count { right: 55px; } +.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; } +.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; z-index: -1;} +.ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;} +.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } +.ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; } +.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } +.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } +.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } +.ui-li.ui-screen-hidden{display:none;} +/* Odd iPad positioning issue. */ +@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { + .ui-li .ui-btn-text { overflow: visible; } +} +label.ui-slider { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } +input.ui-slider-input, +.ui-field-contain input.ui-slider-input { display: inline-block; width: 50px; } +select.ui-slider-switch { display: none; } +div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 65%; } +div.ui-slider-mini { height: 12px; margin-left: 10px; } +div.ui-slider-bg { border: none; height: 100%; padding-right: 8px; } +.ui-controlgroup a.ui-slider-handle, a.ui-slider-handle { position: absolute; z-index: 1; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; outline: 0; } +a.ui-slider-handle .ui-btn-inner { padding: 0; height: 100%; } +div.ui-slider-mini a.ui-slider-handle { height: 14px; width: 14px; margin: -8px 0 0 -7px; } +div.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: -9px 0 0 -9px; } +@media all and (min-width: 450px){ + .ui-field-contain label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } + .ui-field-contain div.ui-slider { width: 43%; } + .ui-field-contain div.ui-slider-switch { width: 5.5em; } +} +div.ui-slider-switch { height: 32px; margin-left: 0; width: 5.8em; } +a.ui-slider-handle-snapping { -webkit-transition: left 70ms linear; -moz-transition: left 70ms linear; } +div.ui-slider-switch .ui-slider-handle { margin-top: 1px; } +.ui-slider-inneroffset { margin: 0 16px; position: relative; z-index: 1; } +div.ui-slider-switch.ui-slider-mini { width: 5em; height: 29px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-inneroffset { margin: 0 15px 0 14px; } +div.ui-slider-switch.ui-slider-mini .ui-slider-handle { width: 25px; height: 25px; margin: 1px 0 0 -13px; } +div.ui-slider-switch.ui-slider-mini a.ui-slider-handle .ui-btn-inner { height: 30px; width: 30px; padding: 0; margin: 0; } +span.ui-slider-label { position: absolute; text-align: center; width: 100%; overflow: hidden; font-size: 16px; top: 0; line-height: 2; min-height: 100%; border-width: 0; white-space: nowrap; } +.ui-slider-mini span.ui-slider-label { font-size: 14px; } +span.ui-slider-label-a { z-index: 1; left: 0; text-indent: -1.5em; } +span.ui-slider-label-b { z-index: 0; right: 0; text-indent: 1.5em;} +.ui-slider-inline { width: 120px; display: inline-block; } diff --git a/Js/jquery/jquery.mobile-1.1.0.js b/Js/jquery/jquery.mobile-1.1.0.js new file mode 100644 index 0000000..c12426c --- /dev/null +++ b/Js/jquery/jquery.mobile-1.1.0.js @@ -0,0 +1,7551 @@ +/* +* jQuery Mobile Framework 1.1.0 db342b1f315c282692791aa870455901fdb46a55 +* http://jquerymobile.com +* +* Copyright 2011 (c) jQuery Project +* Dual licensed under the MIT or GPL Version 2 licenses. +* http://jquery.org/license +* +*/ +(function ( root, doc, factory ) { + if ( typeof define === "function" && define.amd ) { + // AMD. Register as an anonymous module. + define( [ "jquery" ], function ( $ ) { + factory( $, root, doc ); + return $.mobile; + }); + } else { + // Browser globals + factory( root.jQuery, root, doc ); + } +}( this, document, function ( $, window, document, undefined ) { + + +// This plugin is an experiment for abstracting away the touch and mouse +// events so that developers don't have to worry about which method of input +// the device their document is loaded on supports. +// +// The idea here is to allow the developer to register listeners for the +// basic mouse events, such as mousedown, mousemove, mouseup, and click, +// and the plugin will take care of registering the correct listeners +// behind the scenes to invoke the listener at the fastest possible time +// for that device, while still retaining the order of event firing in +// the traditional mouse environment, should multiple handlers be registered +// on the same element for different events. +// +// The current version exposes the following virtual events to jQuery bind methods: +// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" + +(function( $, window, document, undefined ) { + +var dataPropertyName = "virtualMouseBindings", + touchTargetPropertyName = "virtualTouchID", + virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), + touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), + mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], + mouseEventProps = $.event.props.concat( mouseHookProps ), + activeDocHandlers = {}, + resetTimerID = 0, + startX = 0, + startY = 0, + didScroll = false, + clickBlockList = [], + blockMouseTriggers = false, + blockTouchTriggers = false, + eventCaptureSupported = "addEventListener" in document, + $document = $( document ), + nextTouchID = 1, + lastTouchID = 0; + +$.vmouse = { + moveDistanceThreshold: 10, + clickDistanceThreshold: 10, + resetTimerDuration: 1500 +}; + +function getNativeEvent( event ) { + + while ( event && typeof event.originalEvent !== "undefined" ) { + event = event.originalEvent; + } + return event; +} + +function createVirtualEvent( event, eventType ) { + + var t = event.type, + oe, props, ne, prop, ct, touch, i, j; + + event = $.Event(event); + event.type = eventType; + + oe = event.originalEvent; + props = $.event.props; + + // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 + // https://github.com/jquery/jquery-mobile/issues/3280 + if ( t.search( /^(mouse|click)/ ) > -1 ) { + props = mouseEventProps; + } + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( oe ) { + for ( i = props.length, prop; i; ) { + prop = props[ --i ]; + event[ prop ] = oe[ prop ]; + } + } + + // make sure that if the mouse and click virtual events are generated + // without a .which one is defined + if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ){ + event.which = 1; + } + + if ( t.search(/^touch/) !== -1 ) { + ne = getNativeEvent( oe ); + t = ne.touches; + ct = ne.changedTouches; + touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined ); + + if ( touch ) { + for ( j = 0, len = touchEventProps.length; j < len; j++){ + prop = touchEventProps[ j ]; + event[ prop ] = touch[ prop ]; + } + } + } + + return event; +} + +function getVirtualBindingFlags( element ) { + + var flags = {}, + b, k; + + while ( element ) { + + b = $.data( element, dataPropertyName ); + + for ( k in b ) { + if ( b[ k ] ) { + flags[ k ] = flags.hasVirtualBinding = true; + } + } + element = element.parentNode; + } + return flags; +} + +function getClosestElementWithVirtualBinding( element, eventType ) { + var b; + while ( element ) { + + b = $.data( element, dataPropertyName ); + + if ( b && ( !eventType || b[ eventType ] ) ) { + return element; + } + element = element.parentNode; + } + return null; +} + +function enableTouchBindings() { + blockTouchTriggers = false; +} + +function disableTouchBindings() { + blockTouchTriggers = true; +} + +function enableMouseBindings() { + lastTouchID = 0; + clickBlockList.length = 0; + blockMouseTriggers = false; + + // When mouse bindings are enabled, our + // touch bindings are disabled. + disableTouchBindings(); +} + +function disableMouseBindings() { + // When mouse bindings are disabled, our + // touch bindings are enabled. + enableTouchBindings(); +} + +function startResetTimer() { + clearResetTimer(); + resetTimerID = setTimeout(function(){ + resetTimerID = 0; + enableMouseBindings(); + }, $.vmouse.resetTimerDuration ); +} + +function clearResetTimer() { + if ( resetTimerID ){ + clearTimeout( resetTimerID ); + resetTimerID = 0; + } +} + +function triggerVirtualEvent( eventType, event, flags ) { + var ve; + + if ( ( flags && flags[ eventType ] ) || + ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { + + ve = createVirtualEvent( event, eventType ); + + $( event.target).trigger( ve ); + } + + return ve; +} + +function mouseEventCallback( event ) { + var touchID = $.data(event.target, touchTargetPropertyName); + + if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){ + var ve = triggerVirtualEvent( "v" + event.type, event ); + if ( ve ) { + if ( ve.isDefaultPrevented() ) { + event.preventDefault(); + } + if ( ve.isPropagationStopped() ) { + event.stopPropagation(); + } + if ( ve.isImmediatePropagationStopped() ) { + event.stopImmediatePropagation(); + } + } + } +} + +function handleTouchStart( event ) { + + var touches = getNativeEvent( event ).touches, + target, flags; + + if ( touches && touches.length === 1 ) { + + target = event.target; + flags = getVirtualBindingFlags( target ); + + if ( flags.hasVirtualBinding ) { + + lastTouchID = nextTouchID++; + $.data( target, touchTargetPropertyName, lastTouchID ); + + clearResetTimer(); + + disableMouseBindings(); + didScroll = false; + + var t = getNativeEvent( event ).touches[ 0 ]; + startX = t.pageX; + startY = t.pageY; + + triggerVirtualEvent( "vmouseover", event, flags ); + triggerVirtualEvent( "vmousedown", event, flags ); + } + } +} + +function handleScroll( event ) { + if ( blockTouchTriggers ) { + return; + } + + if ( !didScroll ) { + triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); + } + + didScroll = true; + startResetTimer(); +} + +function handleTouchMove( event ) { + if ( blockTouchTriggers ) { + return; + } + + var t = getNativeEvent( event ).touches[ 0 ], + didCancel = didScroll, + moveThreshold = $.vmouse.moveDistanceThreshold; + didScroll = didScroll || + ( Math.abs(t.pageX - startX) > moveThreshold || + Math.abs(t.pageY - startY) > moveThreshold ), + flags = getVirtualBindingFlags( event.target ); + + if ( didScroll && !didCancel ) { + triggerVirtualEvent( "vmousecancel", event, flags ); + } + + triggerVirtualEvent( "vmousemove", event, flags ); + startResetTimer(); +} + +function handleTouchEnd( event ) { + if ( blockTouchTriggers ) { + return; + } + + disableTouchBindings(); + + var flags = getVirtualBindingFlags( event.target ), + t; + triggerVirtualEvent( "vmouseup", event, flags ); + + if ( !didScroll ) { + var ve = triggerVirtualEvent( "vclick", event, flags ); + if ( ve && ve.isDefaultPrevented() ) { + // The target of the mouse events that follow the touchend + // event don't necessarily match the target used during the + // touch. This means we need to rely on coordinates for blocking + // any click that is generated. + t = getNativeEvent( event ).changedTouches[ 0 ]; + clickBlockList.push({ + touchID: lastTouchID, + x: t.clientX, + y: t.clientY + }); + + // Prevent any mouse events that follow from triggering + // virtual event notifications. + blockMouseTriggers = true; + } + } + triggerVirtualEvent( "vmouseout", event, flags); + didScroll = false; + + startResetTimer(); +} + +function hasVirtualBindings( ele ) { + var bindings = $.data( ele, dataPropertyName ), + k; + + if ( bindings ) { + for ( k in bindings ) { + if ( bindings[ k ] ) { + return true; + } + } + } + return false; +} + +function dummyMouseHandler(){} + +function getSpecialEventObject( eventType ) { + var realType = eventType.substr( 1 ); + + return { + setup: function( data, namespace ) { + // If this is the first virtual mouse binding for this element, + // add a bindings object to its data. + + if ( !hasVirtualBindings( this ) ) { + $.data( this, dataPropertyName, {}); + } + + // If setup is called, we know it is the first binding for this + // eventType, so initialize the count for the eventType to zero. + var bindings = $.data( this, dataPropertyName ); + bindings[ eventType ] = true; + + // If this is the first virtual mouse event for this type, + // register a global handler on the document. + + activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; + + if ( activeDocHandlers[ eventType ] === 1 ) { + $document.bind( realType, mouseEventCallback ); + } + + // Some browsers, like Opera Mini, won't dispatch mouse/click events + // for elements unless they actually have handlers registered on them. + // To get around this, we register dummy handlers on the elements. + + $( this ).bind( realType, dummyMouseHandler ); + + // For now, if event capture is not supported, we rely on mouse handlers. + if ( eventCaptureSupported ) { + // If this is the first virtual mouse binding for the document, + // register our touchstart handler on the document. + + activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; + + if (activeDocHandlers[ "touchstart" ] === 1) { + $document.bind( "touchstart", handleTouchStart ) + .bind( "touchend", handleTouchEnd ) + + // On touch platforms, touching the screen and then dragging your finger + // causes the window content to scroll after some distance threshold is + // exceeded. On these platforms, a scroll prevents a click event from being + // dispatched, and on some platforms, even the touchend is suppressed. To + // mimic the suppression of the click event, we need to watch for a scroll + // event. Unfortunately, some platforms like iOS don't dispatch scroll + // events until *AFTER* the user lifts their finger (touchend). This means + // we need to watch both scroll and touchmove events to figure out whether + // or not a scroll happenens before the touchend event is fired. + + .bind( "touchmove", handleTouchMove ) + .bind( "scroll", handleScroll ); + } + } + }, + + teardown: function( data, namespace ) { + // If this is the last virtual binding for this eventType, + // remove its global handler from the document. + + --activeDocHandlers[ eventType ]; + + if ( !activeDocHandlers[ eventType ] ) { + $document.unbind( realType, mouseEventCallback ); + } + + if ( eventCaptureSupported ) { + // If this is the last virtual mouse binding in existence, + // remove our document touchstart listener. + + --activeDocHandlers[ "touchstart" ]; + + if ( !activeDocHandlers[ "touchstart" ] ) { + $document.unbind( "touchstart", handleTouchStart ) + .unbind( "touchmove", handleTouchMove ) + .unbind( "touchend", handleTouchEnd ) + .unbind( "scroll", handleScroll ); + } + } + + var $this = $( this ), + bindings = $.data( this, dataPropertyName ); + + // teardown may be called when an element was + // removed from the DOM. If this is the case, + // jQuery core may have already stripped the element + // of any data bindings so we need to check it before + // using it. + if ( bindings ) { + bindings[ eventType ] = false; + } + + // Unregister the dummy event handler. + + $this.unbind( realType, dummyMouseHandler ); + + // If this is the last virtual mouse binding on the + // element, remove the binding data from the element. + + if ( !hasVirtualBindings( this ) ) { + $this.removeData( dataPropertyName ); + } + } + }; +} + +// Expose our custom events to the jQuery bind/unbind mechanism. + +for ( var i = 0; i < virtualEventNames.length; i++ ){ + $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); +} + +// Add a capture click handler to block clicks. +// Note that we require event capture support for this so if the device +// doesn't support it, we punt for now and rely solely on mouse events. +if ( eventCaptureSupported ) { + document.addEventListener( "click", function( e ){ + var cnt = clickBlockList.length, + target = e.target, + x, y, ele, i, o, touchID; + + if ( cnt ) { + x = e.clientX; + y = e.clientY; + threshold = $.vmouse.clickDistanceThreshold; + + // The idea here is to run through the clickBlockList to see if + // the current click event is in the proximity of one of our + // vclick events that had preventDefault() called on it. If we find + // one, then we block the click. + // + // Why do we have to rely on proximity? + // + // Because the target of the touch event that triggered the vclick + // can be different from the target of the click event synthesized + // by the browser. The target of a mouse/click event that is syntehsized + // from a touch event seems to be implementation specific. For example, + // some browsers will fire mouse/click events for a link that is near + // a touch event, even though the target of the touchstart/touchend event + // says the user touched outside the link. Also, it seems that with most + // browsers, the target of the mouse/click event is not calculated until the + // time it is dispatched, so if you replace an element that you touched + // with another element, the target of the mouse/click will be the new + // element underneath that point. + // + // Aside from proximity, we also check to see if the target and any + // of its ancestors were the ones that blocked a click. This is necessary + // because of the strange mouse/click target calculation done in the + // Android 2.1 browser, where if you click on an element, and there is a + // mouse/click handler on one of its ancestors, the target will be the + // innermost child of the touched element, even if that child is no where + // near the point of touch. + + ele = target; + + while ( ele ) { + for ( i = 0; i < cnt; i++ ) { + o = clickBlockList[ i ]; + touchID = 0; + + if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || + $.data( ele, touchTargetPropertyName ) === o.touchID ) { + // XXX: We may want to consider removing matches from the block list + // instead of waiting for the reset timer to fire. + e.preventDefault(); + e.stopPropagation(); + return; + } + } + ele = ele.parentNode; + } + } + }, true); +} +})( jQuery, window, document ); + + + +// Script: jQuery hashchange event +// +// *Version: 1.3, Last updated: 7/21/2010* +// +// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ +// GitHub - http://github.com/cowboy/jquery-hashchange/ +// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js +// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ +// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, +// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. +// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ +// +// About: Known issues +// +// While this jQuery hashchange event implementation is quite stable and +// robust, there are a few unfortunate browser bugs surrounding expected +// hashchange event-based behaviors, independent of any JavaScript +// window.onhashchange abstraction. See the following examples for more +// information: +// +// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ +// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ +// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ +// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ +// +// Also note that should a browser natively support the window.onhashchange +// event, but not report that it does, the fallback polling loop will be used. +// +// About: Release History +// +// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more +// "removable" for mobile-only development. Added IE6/7 document.title +// support. Attempted to make Iframe as hidden as possible by using +// techniques from http://www.paciellogroup.com/blog/?p=604. Added +// support for the "shortcut" format $(window).hashchange( fn ) and +// $(window).hashchange() like jQuery provides for built-in events. +// Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and +// lowered its default value to 50. Added <jQuery.fn.hashchange.domain> +// and <jQuery.fn.hashchange.src> properties plus document-domain.html +// file to address access denied issues when setting document.domain in +// IE6/7. +// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin +// from a page on another domain would cause an error in Safari 4. Also, +// IE6/7 Iframe is now inserted after the body (this actually works), +// which prevents the page from scrolling when the event is first bound. +// Event can also now be bound before DOM ready, but it won't be usable +// before then in IE6/7. +// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug +// where browser version is incorrectly reported as 8.0, despite +// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. +// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special +// window.onhashchange functionality into a separate plugin for users +// who want just the basic event & back button support, without all the +// extra awesomeness that BBQ provides. This plugin will be included as +// part of jQuery BBQ, but also be available separately. + +(function($,window,undefined){ + // Reused string. + var str_hashchange = 'hashchange', + + // Method / object references. + doc = document, + fake_onhashchange, + special = $.event.special, + + // Does the browser support window.onhashchange? Note that IE8 running in + // IE7 compatibility mode reports true for 'onhashchange' in window, even + // though the event isn't supported, so also test document.documentMode. + doc_mode = doc.documentMode, + supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); + + // Get location.hash (or what you'd expect location.hash to be) sans any + // leading #. Thanks for making this necessary, Firefox! + function get_fragment( url ) { + url = url || location.href; + return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); + }; + + // Method: jQuery.fn.hashchange + // + // Bind a handler to the window.onhashchange event or trigger all bound + // window.onhashchange event handlers. This behavior is consistent with + // jQuery's built-in event handlers. + // + // Usage: + // + // > jQuery(window).hashchange( [ handler ] ); + // + // Arguments: + // + // handler - (Function) Optional handler to be bound to the hashchange + // event. This is a "shortcut" for the more verbose form: + // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, + // all bound window.onhashchange event handlers will be triggered. This + // is a shortcut for the more verbose + // jQuery(window).trigger( 'hashchange' ). These forms are described in + // the <hashchange event> section. + // + // Returns: + // + // (jQuery) The initial jQuery collection of elements. + + // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and + // $(elem).hashchange() for triggering, like jQuery does for built-in events. + $.fn[ str_hashchange ] = function( fn ) { + return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); + }; + + // Property: jQuery.fn.hashchange.delay + // + // The numeric interval (in milliseconds) at which the <hashchange event> + // polling loop executes. Defaults to 50. + + // Property: jQuery.fn.hashchange.domain + // + // If you're setting document.domain in your JavaScript, and you want hash + // history to work in IE6/7, not only must this property be set, but you must + // also set document.domain BEFORE jQuery is loaded into the page. This + // property is only applicable if you are supporting IE6/7 (or IE8 operating + // in "IE7 compatibility" mode). + // + // In addition, the <jQuery.fn.hashchange.src> property must be set to the + // path of the included "document-domain.html" file, which can be renamed or + // modified if necessary (note that the document.domain specified must be the + // same in both your main JavaScript as well as in this file). + // + // Usage: + // + // jQuery.fn.hashchange.domain = document.domain; + + // Property: jQuery.fn.hashchange.src + // + // If, for some reason, you need to specify an Iframe src file (for example, + // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can + // do so using this property. Note that when using this property, history + // won't be recorded in IE6/7 until the Iframe src file loads. This property + // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 + // compatibility" mode). + // + // Usage: + // + // jQuery.fn.hashchange.src = 'path/to/file.html'; + + $.fn[ str_hashchange ].delay = 50; + /* + $.fn[ str_hashchange ].domain = null; + $.fn[ str_hashchange ].src = null; + */ + + // Event: hashchange event + // + // Fired when location.hash changes. In browsers that support it, the native + // HTML5 window.onhashchange event is used, otherwise a polling loop is + // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to + // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 + // compatibility" mode), a hidden Iframe is created to allow the back button + // and hash-based history to work. + // + // Usage as described in <jQuery.fn.hashchange>: + // + // > // Bind an event handler. + // > jQuery(window).hashchange( function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).hashchange(); + // + // A more verbose usage that allows for event namespacing: + // + // > // Bind an event handler. + // > jQuery(window).bind( 'hashchange', function(e) { + // > var hash = location.hash; + // > ... + // > }); + // > + // > // Manually trigger the event handler. + // > jQuery(window).trigger( 'hashchange' ); + // + // Additional Notes: + // + // * The polling loop and Iframe are not created until at least one handler + // is actually bound to the 'hashchange' event. + // * If you need the bound handler(s) to execute immediately, in cases where + // a location.hash exists on page load, via bookmark or page refresh for + // example, use jQuery(window).hashchange() or the more verbose + // jQuery(window).trigger( 'hashchange' ). + // * The event can be bound before DOM ready, but since it won't be usable + // before then in IE6/7 (due to the necessary Iframe), recommended usage is + // to bind it inside a DOM ready handler. + + // Override existing $.event.special.hashchange methods (allowing this plugin + // to be defined after jQuery BBQ in BBQ's source code). + special[ str_hashchange ] = $.extend( special[ str_hashchange ], { + + // Called only when the first 'hashchange' event is bound to window. + setup: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to create our own. And we don't want to call this + // until the user binds to the event, just in case they never do, since it + // will create a polling loop and possibly even a hidden Iframe. + $( fake_onhashchange.start ); + }, + + // Called only when the last 'hashchange' event is unbound from window. + teardown: function() { + // If window.onhashchange is supported natively, there's nothing to do.. + if ( supports_onhashchange ) { return false; } + + // Otherwise, we need to stop ours (if possible). + $( fake_onhashchange.stop ); + } + + }); + + // fake_onhashchange does all the work of triggering the window.onhashchange + // event for browsers that don't natively support it, including creating a + // polling loop to watch for hash changes and in IE 6/7 creating a hidden + // Iframe to enable back and forward. + fake_onhashchange = (function(){ + var self = {}, + timeout_id, + + // Remember the initial hash so it doesn't get triggered immediately. + last_hash = get_fragment(), + + fn_retval = function(val){ return val; }, + history_set = fn_retval, + history_get = fn_retval; + + // Start the polling loop. + self.start = function() { + timeout_id || poll(); + }; + + // Stop the polling loop. + self.stop = function() { + timeout_id && clearTimeout( timeout_id ); + timeout_id = undefined; + }; + + // This polling loop checks every $.fn.hashchange.delay milliseconds to see + // if location.hash has changed, and triggers the 'hashchange' event on + // window when necessary. + function poll() { + var hash = get_fragment(), + history_hash = history_get( last_hash ); + + if ( hash !== last_hash ) { + history_set( last_hash = hash, history_hash ); + + $(window).trigger( str_hashchange ); + + } else if ( history_hash !== last_hash ) { + location.href = location.href.replace( /#.*/, '' ) + history_hash; + } + + timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); + }; + + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv + // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv + $.browser.msie && !supports_onhashchange && (function(){ + // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 + // when running in "IE7 compatibility" mode. + + var iframe, + iframe_src; + + // When the event is bound and polling starts in IE 6/7, create a hidden + // Iframe for history handling. + self.start = function(){ + if ( !iframe ) { + iframe_src = $.fn[ str_hashchange ].src; + iframe_src = iframe_src && iframe_src + get_fragment(); + + // Create hidden Iframe. Attempt to make Iframe as hidden as possible + // by using techniques from http://www.paciellogroup.com/blog/?p=604. + iframe = $('<iframe tabindex="-1" title="empty"/>').hide() + + // When Iframe has completely loaded, initialize the history and + // start polling. + .one( 'load', function(){ + iframe_src || history_set( get_fragment() ); + poll(); + }) + + // Load Iframe src if specified, otherwise nothing. + .attr( 'src', iframe_src || 'javascript:0' ) + + // Append Iframe after the end of the body to prevent unnecessary + // initial page scrolling (yes, this works). + .insertAfter( 'body' )[0].contentWindow; + + // Whenever `document.title` changes, update the Iframe's title to + // prettify the back/next history menu entries. Since IE sometimes + // errors with "Unspecified error" the very first time this is set + // (yes, very useful) wrap this with a try/catch block. + doc.onpropertychange = function(){ + try { + if ( event.propertyName === 'title' ) { + iframe.document.title = doc.title; + } + } catch(e) {} + }; + + } + }; + + // Override the "stop" method since an IE6/7 Iframe was created. Even + // if there are no longer any bound event handlers, the polling loop + // is still necessary for back/next to work at all! + self.stop = fn_retval; + + // Get history by looking at the hidden Iframe's location.hash. + history_get = function() { + return get_fragment( iframe.location.href ); + }; + + // Set a new history item by opening and then closing the Iframe + // document, *then* setting its location.hash. If document.domain has + // been set, update that as well. + history_set = function( hash, history_hash ) { + var iframe_doc = iframe.document, + domain = $.fn[ str_hashchange ].domain; + + if ( hash !== history_hash ) { + // Update Iframe with any initial `document.title` that might be set. + iframe_doc.title = doc.title; + + // Opening the Iframe's document after it has been closed is what + // actually adds a history entry. + iframe_doc.open(); + + // Set document.domain for the Iframe document as well, if necessary. + domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' ); + + iframe_doc.close(); + + // Update the Iframe's hash, for great justice. + iframe.location.hash = hash; + } + }; + + })(); + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^ + // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + + return self; + })(); + +})(jQuery,this); + +/*! + * jQuery UI Widget @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ + +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ); + if ( !instance ) { + throw "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'"; + } + if ( !$.isFunction( instance[options] ) ) { + throw "no such method '" + options + "' for " + name + " widget instance"; + } + var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + var options = {}; + if ( $.metadata ) { + options = $.metadata.get( element )[ this.widgetName ]; + } + return options; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.widget", { + // decorate the parent _createWidget to trigger `widgetinit` for users + // who wish to do post post `widgetcreate` alterations/additions + // + // TODO create a pull request for jquery ui to trigger this event + // in the original _createWidget + _createWidget: function() { + $.Widget.prototype._createWidget.apply( this, arguments ); + this._trigger( 'init' ); + }, + + _getCreateOptions: function() { + + var elem = this.element, + options = {}; + + $.each( this.options, function( option ) { + + var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { + return "-" + c.toLowerCase(); + }) + ); + + if ( value !== undefined ) { + options[ option ] = value; + } + }); + + return options; + }, + + enhanceWithin: function( target, useKeepNative ) { + this.enhance( $( this.options.initSelector, $( target )), useKeepNative ); + }, + + enhance: function( targets, useKeepNative ) { + var page, keepNative, $widgetElements = $( targets ), self = this; + + // if ignoreContentEnabled is set to true the framework should + // only enhance the selected elements when they do NOT have a + // parent with the data-namespace-ignore attribute + $widgetElements = $.mobile.enhanceable( $widgetElements ); + + if ( useKeepNative && $widgetElements.length ) { + // TODO remove dependency on the page widget for the keepNative. + // Currently the keepNative value is defined on the page prototype so + // the method is as well + page = $.mobile.closestPageData( $widgetElements ); + keepNative = (page && page.keepNativeSelector()) || ""; + + $widgetElements = $widgetElements.not( keepNative ); + } + + $widgetElements[ this.widgetName ](); + }, + + raise: function( msg ) { + throw "Widget [" + this.widgetName + "]: " + msg; + } +}); + +})( jQuery ); + +(function( $, window, undefined ) { + + var nsNormalizeDict = {}; + + // jQuery.mobile configurable options + $.mobile = $.extend( {}, { + + // Version of the jQuery Mobile Framework + version: "1.1.0", + + // Namespace used framework-wide for data-attrs. Default is no namespace + ns: "", + + // Define the url parameter used for referencing widget-generated sub-pages. + // Translates to to example.html&ui-page=subpageIdentifier + // hash segment before &ui-page= is used to make Ajax request + subPageUrlKey: "ui-page", + + // Class assigned to page currently in view, and during transitions + activePageClass: "ui-page-active", + + // Class used for "active" button state, from CSS framework + activeBtnClass: "ui-btn-active", + + // Class used for "focus" form element state, from CSS framework + focusClass: "ui-focus", + + // Automatically handle clicks and form submissions through Ajax, when same-domain + ajaxEnabled: true, + + // Automatically load and show pages based on location.hash + hashListeningEnabled: true, + + // disable to prevent jquery from bothering with links + linkBindingEnabled: true, + + // Set default page transition - 'none' for no transitions + defaultPageTransition: "fade", + + // Set maximum window width for transitions to apply - 'false' for no limit + maxTransitionWidth: false, + + // Minimum scroll distance that will be remembered when returning to a page + minScrollBack: 250, + + // DEPRECATED: the following property is no longer in use, but defined until 2.0 to prevent conflicts + touchOverflowEnabled: false, + + // Set default dialog transition - 'none' for no transitions + defaultDialogTransition: "pop", + + // Show loading message during Ajax requests + // if false, message will not appear, but loading classes will still be toggled on html el + loadingMessage: "loading", + + // Error response message - appears when an Ajax page request fails + pageLoadErrorMessage: "Error Loading Page", + + // Should the text be visble in the loading message? + loadingMessageTextVisible: false, + + // When the text is visible, what theme does the loading box use? + loadingMessageTheme: "a", + + // For error messages, which theme does the box uses? + pageLoadErrorMessageTheme: "e", + + //automatically initialize the DOM when it's ready + autoInitializePage: true, + + pushStateEnabled: true, + + // allows users to opt in to ignoring content by marking a parent element as + // data-ignored + ignoreContentEnabled: false, + + // turn of binding to the native orientationchange due to android orientation behavior + orientationChangeEnabled: true, + + buttonMarkup: { + hoverDelay: 200 + }, + + // TODO might be useful upstream in jquery itself ? + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + }, + + // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value + silentScroll: function( ypos ) { + if ( $.type( ypos ) !== "number" ) { + ypos = $.mobile.defaultHomeScroll; + } + + // prevent scrollstart and scrollstop events + $.event.special.scrollstart.enabled = false; + + setTimeout(function() { + window.scrollTo( 0, ypos ); + $( document ).trigger( "silentscroll", { x: 0, y: ypos }); + }, 20 ); + + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + + // Expose our cache for testing purposes. + nsNormalizeDict: nsNormalizeDict, + + // Take a data attribute property, prepend the namespace + // and then camel case the attribute string. Add the result + // to our nsNormalizeDict so we don't have to do this again. + nsNormalize: function( prop ) { + if ( !prop ) { + return; + } + + return nsNormalizeDict[ prop ] || ( nsNormalizeDict[ prop ] = $.camelCase( $.mobile.ns + prop ) ); + }, + + getInheritedTheme: function( el, defaultTheme ) { + + // Find the closest parent with a theme class on it. Note that + // we are not using $.fn.closest() on purpose here because this + // method gets called quite a bit and we need it to be as fast + // as possible. + + var e = el[ 0 ], + ltr = "", + re = /ui-(bar|body|overlay)-([a-z])\b/, + c, m; + + while ( e ) { + var c = e.className || ""; + if ( ( m = re.exec( c ) ) && ( ltr = m[ 2 ] ) ) { + // We found a parent with a theme class + // on it so bail from this loop. + break; + } + e = e.parentNode; + } + + // Return the theme letter we found, if none, return the + // specified default. + + return ltr || defaultTheme || "a"; + }, + + // TODO the following $ and $.fn extensions can/probably should be moved into jquery.mobile.core.helpers + // + // Find the closest javascript page element to gather settings data jsperf test + // http://jsperf.com/single-complex-selector-vs-many-complex-selectors/edit + // possibly naive, but it shows that the parsing overhead for *just* the page selector vs + // the page and dialog selector is negligable. This could probably be speed up by + // doing a similar parent node traversal to the one found in the inherited theme code above + closestPageData: function( $target ) { + return $target + .closest(':jqmData(role="page"), :jqmData(role="dialog")') + .data("page"); + }, + + enhanceable: function( $set ) { + return this.haveParents( $set, "enhance" ); + }, + + hijackable: function( $set ) { + return this.haveParents( $set, "ajax" ); + }, + + haveParents: function( $set, attr ) { + if( !$.mobile.ignoreContentEnabled ){ + return $set; + } + + var count = $set.length, + $newSet = $(), + e, $element, excluded; + + for ( var i = 0; i < count; i++ ) { + $element = $set.eq( i ); + excluded = false; + e = $set[ i ]; + + while ( e ) { + var c = e.getAttribute ? e.getAttribute( "data-" + $.mobile.ns + attr ) : ""; + + if ( c === "false" ) { + excluded = true; + break; + } + + e = e.parentNode; + } + + if ( !excluded ) { + $newSet = $newSet.add( $element ); + } + } + + return $newSet; + } + }, $.mobile ); + + // Mobile version of data and removeData and hasData methods + // ensures all data is set and retrieved using jQuery Mobile's data namespace + $.fn.jqmData = function( prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + if ( prop ) { + prop = $.mobile.nsNormalize( prop ); + } + result = this.data.apply( this, arguments.length < 2 ? [ prop ] : [ prop, value ] ); + } + return result; + }; + + $.jqmData = function( elem, prop, value ) { + var result; + if ( typeof prop != "undefined" ) { + result = $.data( elem, prop ? $.mobile.nsNormalize( prop ) : prop, value ); + } + return result; + }; + + $.fn.jqmRemoveData = function( prop ) { + return this.removeData( $.mobile.nsNormalize( prop ) ); + }; + + $.jqmRemoveData = function( elem, prop ) { + return $.removeData( elem, $.mobile.nsNormalize( prop ) ); + }; + + $.fn.removeWithDependents = function() { + $.removeWithDependents( this ); + }; + + $.removeWithDependents = function( elem ) { + var $elem = $( elem ); + + ( $elem.jqmData('dependents') || $() ).remove(); + $elem.remove(); + }; + + $.fn.addDependents = function( newDependents ) { + $.addDependents( $(this), newDependents ); + }; + + $.addDependents = function( elem, newDependents ) { + var dependents = $(elem).jqmData( 'dependents' ) || $(); + + $(elem).jqmData( 'dependents', $.merge(dependents, newDependents) ); + }; + + // note that this helper doesn't attempt to handle the callback + // or setting of an html elements text, its only purpose is + // to return the html encoded version of the text in all cases. (thus the name) + $.fn.getEncodedText = function() { + return $( "<div/>" ).text( $(this).text() ).html(); + }; + + // fluent helper function for the mobile namespaced equivalent + $.fn.jqmEnhanceable = function() { + return $.mobile.enhanceable( this ); + }; + + $.fn.jqmHijackable = function() { + return $.mobile.hijackable( this ); + }; + + // Monkey-patching Sizzle to filter the :jqmData selector + var oldFind = $.find, + jqmDataRE = /:jqmData\(([^)]*)\)/g; + + $.find = function( selector, context, ret, extra ) { + selector = selector.replace( jqmDataRE, "[data-" + ( $.mobile.ns || "" ) + "$1]" ); + + return oldFind.call( this, selector, context, ret, extra ); + }; + + $.extend( $.find, oldFind ); + + $.find.matches = function( expr, set ) { + return $.find( expr, null, null, set ); + }; + + $.find.matchesSelector = function( node, expr ) { + return $.find( expr, null, null, [ node ] ).length > 0; + }; +})( jQuery, this ); + + +(function( $, undefined ) { + +var $window = $( window ), + $html = $( "html" ); + +/* $.mobile.media method: pass a CSS media type or query and get a bool return + note: this feature relies on actual media query support for media queries, though types will work most anywhere + examples: + $.mobile.media('screen') // tests for screen media type + $.mobile.media('screen and (min-width: 480px)') // tests for screen media type with window width > 480px + $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') // tests for webkit 2x pixel ratio (iPhone 4) +*/ +$.mobile.media = (function() { + // TODO: use window.matchMedia once at least one UA implements it + var cache = {}, + testDiv = $( "<div id='jquery-mediatest'>" ), + fakeBody = $( "<body>" ).append( testDiv ); + + return function( query ) { + if ( !( query in cache ) ) { + var styleBlock = document.createElement( "style" ), + cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; + + //must set type for IE! + styleBlock.type = "text/css"; + + if ( styleBlock.styleSheet ){ + styleBlock.styleSheet.cssText = cssrule; + } else { + styleBlock.appendChild( document.createTextNode(cssrule) ); + } + + $html.prepend( fakeBody ).prepend( styleBlock ); + cache[ query ] = testDiv.css( "position" ) === "absolute"; + fakeBody.add( styleBlock ).remove(); + } + return cache[ query ]; + }; +})(); + +})(jQuery); + +(function( $, undefined ) { + +var fakeBody = $( "<body>" ).prependTo( "html" ), + fbCSS = fakeBody[ 0 ].style, + vendors = [ "Webkit", "Moz", "O" ], + webos = "palmGetResource" in window, //only used to rule out scrollTop + operamini = window.operamini && ({}).toString.call( window.operamini ) === "[object OperaMini]", + bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB + +// thx Modernizr +function propExists( prop ) { + var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), + props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); + + for ( var v in props ){ + if ( fbCSS[ props[ v ] ] !== undefined ) { + return true; + } + } +} + +function validStyle( prop, value, check_vend ) { + var div = document.createElement('div'), + uc = function( txt ) { + return txt.charAt( 0 ).toUpperCase() + txt.substr( 1 ) + }, + vend_pref = function( vend ) { + return "-" + vend.charAt( 0 ).toLowerCase() + vend.substr( 1 ) + "-"; + }, + check_style = function( vend ) { + var vend_prop = vend_pref( vend ) + prop + ": " + value + ";", + uc_vend = uc( vend ), + propStyle = uc_vend + uc( prop ); + + div.setAttribute( "style", vend_prop ); + + if( !!div.style[ propStyle ] ) { + ret = true; + } + }, + check_vends = check_vend ? [ check_vend ] : vendors, + ret; + + for( i = 0; i < check_vends.length; i++ ) { + check_style( check_vends[i] ); + } + return !!ret; +} + +// Thanks to Modernizr src for this test idea. `perspective` check is limited to Moz to prevent a false positive for 3D transforms on Android. +function transform3dTest() { + var prop = "transform-3d"; + return validStyle( 'perspective', '10px', 'moz' ) || $.mobile.media( "(-" + vendors.join( "-" + prop + "),(-" ) + "-" + prop + "),(" + prop + ")" ); +} + +// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) +function baseTagTest() { + var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", + base = $( "head base" ), + fauxEle = null, + href = "", + link, rebase; + + if ( !base.length ) { + base = fauxEle = $( "<base>", { "href": fauxBase }).appendTo( "head" ); + } else { + href = base.attr( "href" ); + } + + link = $( "<a href='testurl' />" ).prependTo( fakeBody ); + rebase = link[ 0 ].href; + base[ 0 ].href = href || location.pathname; + + if ( fauxEle ) { + fauxEle.remove(); + } + return rebase.indexOf( fauxBase ) === 0; +} + + +// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 +// allows for inclusion of IE 6+, including Windows Mobile 7 +$.extend( $.mobile, { browser: {} } ); +$.mobile.browser.ie = (function() { + var v = 3, + div = document.createElement( "div" ), + a = div.all || []; + + // added {} to silence closure compiler warnings. registering my dislike of all things + // overly clever here for future reference + while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ){}; + + return v > 4 ? v : !v; +})(); + + +$.extend( $.support, { + orientation: "orientation" in window && "onorientationchange" in window, + touch: "ontouchend" in document, + cssTransitions: "WebKitTransitionEvent" in window || validStyle( 'transition', 'height 100ms linear' ), + pushState: "pushState" in history && "replaceState" in history, + mediaquery: $.mobile.media( "only all" ), + cssPseudoElement: !!propExists( "content" ), + touchOverflow: !!propExists( "overflowScrolling" ), + cssTransform3d: transform3dTest(), + boxShadow: !!propExists( "boxShadow" ) && !bb, + scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos && !operamini, + dynamicBaseTag: baseTagTest() +}); + +fakeBody.remove(); + + +// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) +// or that generally work better browsing in regular http for full page refreshes (Opera Mini) +// Note: This detection below is used as a last resort. +// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible +var nokiaLTE7_3 = (function(){ + + var ua = window.navigator.userAgent; + + //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older + return ua.indexOf( "Nokia" ) > -1 && + ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && + ua.indexOf( "AppleWebKit" ) > -1 && + ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); +})(); + +// Support conditions that must be met in order to proceed +// default enhanced qualifications are media query support OR IE 7+ +$.mobile.gradeA = function(){ + return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7; +}; + +$.mobile.ajaxBlacklist = + // BlackBerry browsers, pre-webkit + window.blackberry && !window.WebKitPoint || + // Opera Mini + operamini || + // Symbian webkits pre 7.3 + nokiaLTE7_3; + +// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices +// to render the stylesheets when they're referenced before this script, as we'd recommend doing. +// This simply reappends the CSS in place, which for some reason makes it apply +if ( nokiaLTE7_3 ) { + $(function() { + $( "head link[rel='stylesheet']" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); + }); +} + +// For ruling out shadows via css +if ( !$.support.boxShadow ) { + $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); +} + +})( jQuery ); + +(function( $, window, undefined ) { + +// add new event shortcuts +$.each( ( "touchstart touchmove touchend orientationchange throttledresize " + + "tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) { + + $.fn[ name ] = function( fn ) { + return fn ? this.bind( name, fn ) : this.trigger( name ); + }; + + $.attrFn[ name ] = true; +}); + +var supportTouch = $.support.touch, + scrollEvent = "touchmove scroll", + touchStartEvent = supportTouch ? "touchstart" : "mousedown", + touchStopEvent = supportTouch ? "touchend" : "mouseup", + touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; + +function triggerCustomEvent( obj, eventType, event ) { + var originalType = event.type; + event.type = eventType; + $.event.handle.call( obj, event ); + event.type = originalType; +} + +// also handles scrollstop +$.event.special.scrollstart = { + + enabled: true, + + setup: function() { + + var thisObject = this, + $this = $( thisObject ), + scrolling, + timer; + + function trigger( event, state ) { + scrolling = state; + triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); + } + + // iPhone triggers scroll after a small delay; use touchmove instead + $this.bind( scrollEvent, function( event ) { + + if ( !$.event.special.scrollstart.enabled ) { + return; + } + + if ( !scrolling ) { + trigger( event, true ); + } + + clearTimeout( timer ); + timer = setTimeout(function() { + trigger( event, false ); + }, 50 ); + }); + } +}; + +// also handles taphold +$.event.special.tap = { + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( "vmousedown", function( event ) { + + if ( event.which && event.which !== 1 ) { + return false; + } + + var origTarget = event.target, + origEvent = event.originalEvent, + timer; + + function clearTapTimer() { + clearTimeout( timer ); + } + + function clearTapHandlers() { + clearTapTimer(); + + $this.unbind( "vclick", clickHandler ) + .unbind( "vmouseup", clearTapTimer ); + $( document ).unbind( "vmousecancel", clearTapHandlers ); + } + + function clickHandler(event) { + clearTapHandlers(); + + // ONLY trigger a 'tap' event if the start target is + // the same as the stop target. + if ( origTarget == event.target ) { + triggerCustomEvent( thisObject, "tap", event ); + } + } + + $this.bind( "vmouseup", clearTapTimer ) + .bind( "vclick", clickHandler ); + $( document ).bind( "vmousecancel", clearTapHandlers ); + + timer = setTimeout(function() { + triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); + }, 750 ); + }); + } +}; + +// also handles swipeleft, swiperight +$.event.special.swipe = { + scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling. + + durationThreshold: 1000, // More time than this, and it isn't a swipe. + + horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. + + verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. + + setup: function() { + var thisObject = this, + $this = $( thisObject ); + + $this.bind( touchStartEvent, function( event ) { + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event, + start = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ], + origin: $( event.target ) + }, + stop; + + function moveHandler( event ) { + + if ( !start ) { + return; + } + + var data = event.originalEvent.touches ? + event.originalEvent.touches[ 0 ] : event; + + stop = { + time: ( new Date() ).getTime(), + coords: [ data.pageX, data.pageY ] + }; + + // prevent scrolling + if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { + event.preventDefault(); + } + } + + $this.bind( touchMoveEvent, moveHandler ) + .one( touchStopEvent, function( event ) { + $this.unbind( touchMoveEvent, moveHandler ); + + if ( start && stop ) { + if ( stop.time - start.time < $.event.special.swipe.durationThreshold && + Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && + Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { + + start.origin.trigger( "swipe" ) + .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); + } + } + start = stop = undefined; + }); + }); + } +}; + +(function( $, window ) { + // "Cowboy" Ben Alman + + var win = $( window ), + special_event, + get_orientation, + last_orientation, + initial_orientation_is_landscape, + initial_orientation_is_default, + portrait_map = { "0": true, "180": true }; + + // It seems that some device/browser vendors use window.orientation values 0 and 180 to + // denote the "default" orientation. For iOS devices, and most other smart-phones tested, + // the default orientation is always "portrait", but in some Android and RIM based tablets, + // the default orientation is "landscape". The following code attempts to use the window + // dimensions to figure out what the current orientation is, and then makes adjustments + // to the to the portrait_map if necessary, so that we can properly decode the + // window.orientation value whenever get_orientation() is called. + // + // Note that we used to use a media query to figure out what the orientation the browser + // thinks it is in: + // + // initial_orientation_is_landscape = $.mobile.media("all and (orientation: landscape)"); + // + // but there was an iPhone/iPod Touch bug beginning with iOS 4.2, up through iOS 5.1, + // where the browser *ALWAYS* applied the landscape media query. This bug does not + // happen on iPad. + + if ( $.support.orientation ) { + + // Check the window width and height to figure out what the current orientation + // of the device is at this moment. Note that we've initialized the portrait map + // values to 0 and 180, *AND* we purposely check for landscape so that if we guess + // wrong, , we default to the assumption that portrait is the default orientation. + // We use a threshold check below because on some platforms like iOS, the iPhone + // form-factor can report a larger width than height if the user turns on the + // developer console. The actual threshold value is somewhat arbitrary, we just + // need to make sure it is large enough to exclude the developer console case. + + var ww = window.innerWidth || $( window ).width(), + wh = window.innerHeight || $( window ).height(), + landscape_threshold = 50; + + initial_orientation_is_landscape = ww > wh && ( ww - wh ) > landscape_threshold; + + + // Now check to see if the current window.orientation is 0 or 180. + initial_orientation_is_default = portrait_map[ window.orientation ]; + + // If the initial orientation is landscape, but window.orientation reports 0 or 180, *OR* + // if the initial orientation is portrait, but window.orientation reports 90 or -90, we + // need to flip our portrait_map values because landscape is the default orientation for + // this device/browser. + if ( ( initial_orientation_is_landscape && initial_orientation_is_default ) || ( !initial_orientation_is_landscape && !initial_orientation_is_default ) ) { + portrait_map = { "-90": true, "90": true }; + } + } + + $.event.special.orientationchange = special_event = { + setup: function() { + // If the event is supported natively, return false so that jQuery + // will bind to the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Get the current orientation to avoid initial double-triggering. + last_orientation = get_orientation(); + + // Because the orientationchange event doesn't exist, simulate the + // event by testing window dimensions on resize. + win.bind( "throttledresize", handler ); + }, + teardown: function(){ + // If the event is not supported natively, return false so that + // jQuery will unbind the event using DOM methods. + if ( $.support.orientation && $.mobile.orientationChangeEnabled ) { + return false; + } + + // Because the orientationchange event doesn't exist, unbind the + // resize event handler. + win.unbind( "throttledresize", handler ); + }, + add: function( handleObj ) { + // Save a reference to the bound event handler. + var old_handler = handleObj.handler; + + + handleObj.handler = function( event ) { + // Modify event object, adding the .orientation property. + event.orientation = get_orientation(); + + // Call the originally-bound event handler and return its result. + return old_handler.apply( this, arguments ); + }; + } + }; + + // If the event is not supported natively, this handler will be bound to + // the window resize event to simulate the orientationchange event. + function handler() { + // Get the current orientation. + var orientation = get_orientation(); + + if ( orientation !== last_orientation ) { + // The orientation has changed, so trigger the orientationchange event. + last_orientation = orientation; + win.trigger( "orientationchange" ); + } + } + + // Get the current page orientation. This method is exposed publicly, should it + // be needed, as jQuery.event.special.orientationchange.orientation() + $.event.special.orientationchange.orientation = get_orientation = function() { + var isPortrait = true, elem = document.documentElement; + + // prefer window orientation to the calculation based on screensize as + // the actual screen resize takes place before or after the orientation change event + // has been fired depending on implementation (eg android 2.3 is before, iphone after). + // More testing is required to determine if a more reliable method of determining the new screensize + // is possible when orientationchange is fired. (eg, use media queries + element + opacity) + if ( $.support.orientation ) { + // if the window orientation registers as 0 or 180 degrees report + // portrait, otherwise landscape + isPortrait = portrait_map[ window.orientation ]; + } else { + isPortrait = elem && elem.clientWidth / elem.clientHeight < 1.1; + } + + return isPortrait ? "portrait" : "landscape"; + }; + +})( jQuery, window ); + + +// throttled resize event +(function() { + + $.event.special.throttledresize = { + setup: function() { + $( this ).bind( "resize", handler ); + }, + teardown: function(){ + $( this ).unbind( "resize", handler ); + } + }; + + var throttle = 250, + handler = function() { + curr = ( new Date() ).getTime(); + diff = curr - lastCall; + + if ( diff >= throttle ) { + + lastCall = curr; + $( this ).trigger( "throttledresize" ); + + } else { + + if ( heldCall ) { + clearTimeout( heldCall ); + } + + // Promise a held call will still execute + heldCall = setTimeout( handler, throttle - diff ); + } + }, + lastCall = 0, + heldCall, + curr, + diff; +})(); + + +$.each({ + scrollstop: "scrollstart", + taphold: "tap", + swipeleft: "swipe", + swiperight: "swipe" +}, function( event, sourceEvent ) { + + $.event.special[ event ] = { + setup: function() { + $( this ).bind( sourceEvent, $.noop ); + } + }; +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.widget( "mobile.page", $.mobile.widget, { + options: { + theme: "c", + domCache: false, + keepNativeDefault: ":jqmData(role='none'), :jqmData(role='nojs')" + }, + + _create: function() { + + var self = this; + + // if false is returned by the callbacks do not create the page + if( self._trigger( "beforecreate" ) === false ){ + return false; + } + + self.element + .attr( "tabindex", "0" ) + .addClass( "ui-page ui-body-" + self.options.theme ) + .bind( "pagebeforehide", function(){ + self.removeContainerBackground(); + } ) + .bind( "pagebeforeshow", function(){ + self.setContainerBackground(); + } ); + + }, + + removeContainerBackground: function(){ + $.mobile.pageContainer.removeClass( "ui-overlay-" + $.mobile.getInheritedTheme( this.element.parent() ) ); + }, + + // set the page container background to the page theme + setContainerBackground: function( theme ){ + if( this.options.theme ){ + $.mobile.pageContainer.addClass( "ui-overlay-" + ( theme || this.options.theme ) ); + } + }, + + keepNativeSelector: function() { + var options = this.options, + keepNativeDefined = options.keepNative && $.trim(options.keepNative); + + if( keepNativeDefined && options.keepNative !== options.keepNativeDefault ){ + return [options.keepNative, options.keepNativeDefault].join(", "); + } + + return options.keepNativeDefault; + } +}); +})( jQuery ); + + +(function( $, window, undefined ) { + +var createHandler = function( sequential ){ + + // Default to sequential + if( sequential === undefined ){ + sequential = true; + } + + return function( name, reverse, $to, $from ) { + + var deferred = new $.Deferred(), + reverseClass = reverse ? " reverse" : "", + active = $.mobile.urlHistory.getActive(), + toScroll = active.lastScroll || $.mobile.defaultHomeScroll, + screenHeight = $.mobile.getScreenHeight(), + maxTransitionOverride = $.mobile.maxTransitionWidth !== false && $( window ).width() > $.mobile.maxTransitionWidth, + none = !$.support.cssTransitions || maxTransitionOverride || !name || name === "none", + toggleViewportClass = function(){ + $.mobile.pageContainer.toggleClass( "ui-mobile-viewport-transitioning viewport-" + name ); + }, + scrollPage = function(){ + // By using scrollTo instead of silentScroll, we can keep things better in order + // Just to be precautios, disable scrollstart listening like silentScroll would + $.event.special.scrollstart.enabled = false; + + window.scrollTo( 0, toScroll ); + + // reenable scrollstart listening like silentScroll would + setTimeout(function() { + $.event.special.scrollstart.enabled = true; + }, 150 ); + }, + cleanFrom = function(){ + $from + .removeClass( $.mobile.activePageClass + " out in reverse " + name ) + .height( "" ); + }, + startOut = function(){ + // if it's not sequential, call the doneOut transition to start the TO page animating in simultaneously + if( !sequential ){ + doneOut(); + } + else { + $from.animationComplete( doneOut ); + } + + // Set the from page's height and start it transitioning out + // Note: setting an explicit height helps eliminate tiling in the transitions + $from + .height( screenHeight + $(window ).scrollTop() ) + .addClass( name + " out" + reverseClass ); + }, + + doneOut = function() { + + if ( $from && sequential ) { + cleanFrom(); + } + + startIn(); + }, + + startIn = function(){ + + $to.addClass( $.mobile.activePageClass ); + + // Send focus to page as it is now display: block + $.mobile.focusPage( $to ); + + // Set to page height + $to.height( screenHeight + toScroll ); + + scrollPage(); + + if( !none ){ + $to.animationComplete( doneIn ); + } + + $to.addClass( name + " in" + reverseClass ); + + if( none ){ + doneIn(); + } + + }, + + doneIn = function() { + + if ( !sequential ) { + + if( $from ){ + cleanFrom(); + } + } + + $to + .removeClass( "out in reverse " + name ) + .height( "" ); + + toggleViewportClass(); + + // In some browsers (iOS5), 3D transitions block the ability to scroll to the desired location during transition + // This ensures we jump to that spot after the fact, if we aren't there already. + if( $( window ).scrollTop() !== toScroll ){ + scrollPage(); + } + + deferred.resolve( name, reverse, $to, $from, true ); + }; + + toggleViewportClass(); + + if ( $from && !none ) { + startOut(); + } + else { + doneOut(); + } + + return deferred.promise(); + }; +} + +// generate the handlers from the above +var sequentialHandler = createHandler(), + simultaneousHandler = createHandler( false ); + +// Make our transition handler the public default. +$.mobile.defaultTransitionHandler = sequentialHandler; + +//transition handler dictionary for 3rd party transitions +$.mobile.transitionHandlers = { + "default": $.mobile.defaultTransitionHandler, + "sequential": sequentialHandler, + "simultaneous": simultaneousHandler +}; + +$.mobile.transitionFallbacks = {}; + +})( jQuery, this ); + +( function( $, undefined ) { + + //define vars for interal use + var $window = $( window ), + $html = $( 'html' ), + $head = $( 'head' ), + + //url path helpers for use in relative url management + path = { + + // This scary looking regular expression parses an absolute URL or its relative + // variants (protocol, site, document, query, and hash), into the various + // components (protocol, host, path, query, fragment, etc that make up the + // URL as well as some other commonly used sub-parts. When used with RegExp.exec() + // or String.match, it parses the URL into a results array that looks like this: + // + // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content + // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread + // [2]: http://jblas:password@mycompany.com:8080/mail/inbox + // [3]: http://jblas:password@mycompany.com:8080 + // [4]: http: + // [5]: // + // [6]: jblas:password@mycompany.com:8080 + // [7]: jblas:password + // [8]: jblas + // [9]: password + // [10]: mycompany.com:8080 + // [11]: mycompany.com + // [12]: 8080 + // [13]: /mail/inbox + // [14]: /mail/ + // [15]: inbox + // [16]: ?msg=1234&type=unread + // [17]: #msg-content + // + urlParseRE: /^(((([^:\/#\?]+:)?(?:(\/\/)((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?\]\[]+|\[[^\/\]@#?]+\])(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/, + + //Parse a URL into a structure that allows easy access to + //all of the URL components by name. + parseUrl: function( url ) { + // If we're passed an object, we'll assume that it is + // a parsed url object and just return it back to the caller. + if ( $.type( url ) === "object" ) { + return url; + } + + var matches = path.urlParseRE.exec( url || "" ) || []; + + // Create an object that allows the caller to access the sub-matches + // by name. Note that IE returns an empty string instead of undefined, + // like all other browsers do, so we normalize everything so its consistent + // no matter what browser we're running on. + return { + href: matches[ 0 ] || "", + hrefNoHash: matches[ 1 ] || "", + hrefNoSearch: matches[ 2 ] || "", + domain: matches[ 3 ] || "", + protocol: matches[ 4 ] || "", + doubleSlash: matches[ 5 ] || "", + authority: matches[ 6 ] || "", + username: matches[ 8 ] || "", + password: matches[ 9 ] || "", + host: matches[ 10 ] || "", + hostname: matches[ 11 ] || "", + port: matches[ 12 ] || "", + pathname: matches[ 13 ] || "", + directory: matches[ 14 ] || "", + filename: matches[ 15 ] || "", + search: matches[ 16 ] || "", + hash: matches[ 17 ] || "" + }; + }, + + //Turn relPath into an asbolute path. absPath is + //an optional absolute path which describes what + //relPath is relative to. + makePathAbsolute: function( relPath, absPath ) { + if ( relPath && relPath.charAt( 0 ) === "/" ) { + return relPath; + } + + relPath = relPath || ""; + absPath = absPath ? absPath.replace( /^\/|(\/[^\/]*|[^\/]+)$/g, "" ) : ""; + + var absStack = absPath ? absPath.split( "/" ) : [], + relStack = relPath.split( "/" ); + for ( var i = 0; i < relStack.length; i++ ) { + var d = relStack[ i ]; + switch ( d ) { + case ".": + break; + case "..": + if ( absStack.length ) { + absStack.pop(); + } + break; + default: + absStack.push( d ); + break; + } + } + return "/" + absStack.join( "/" ); + }, + + //Returns true if both urls have the same domain. + isSameDomain: function( absUrl1, absUrl2 ) { + return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain; + }, + + //Returns true for any relative variant. + isRelativeUrl: function( url ) { + // All relative Url variants have one thing in common, no protocol. + return path.parseUrl( url ).protocol === ""; + }, + + //Returns true for an absolute url. + isAbsoluteUrl: function( url ) { + return path.parseUrl( url ).protocol !== ""; + }, + + //Turn the specified realtive URL into an absolute one. This function + //can handle all relative variants (protocol, site, document, query, fragment). + makeUrlAbsolute: function( relUrl, absUrl ) { + if ( !path.isRelativeUrl( relUrl ) ) { + return relUrl; + } + + var relObj = path.parseUrl( relUrl ), + absObj = path.parseUrl( absUrl ), + protocol = relObj.protocol || absObj.protocol, + doubleSlash = relObj.protocol ? relObj.doubleSlash : ( relObj.doubleSlash || absObj.doubleSlash ), + authority = relObj.authority || absObj.authority, + hasPath = relObj.pathname !== "", + pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ), + search = relObj.search || ( !hasPath && absObj.search ) || "", + hash = relObj.hash; + + return protocol + doubleSlash + authority + pathname + search + hash; + }, + + //Add search (aka query) params to the specified url. + addSearchParams: function( url, params ) { + var u = path.parseUrl( url ), + p = ( typeof params === "object" ) ? $.param( params ) : params, + s = u.search || "?"; + return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" ); + }, + + convertUrlToDataUrl: function( absUrl ) { + var u = path.parseUrl( absUrl ); + if ( path.isEmbeddedPage( u ) ) { + // For embedded pages, remove the dialog hash key as in getFilePath(), + // otherwise the Data Url won't match the id of the embedded Page. + return u.hash.split( dialogHashKey )[0].replace( /^#/, "" ); + } else if ( path.isSameDomain( u, documentBase ) ) { + return u.hrefNoHash.replace( documentBase.domain, "" ); + } + return absUrl; + }, + + //get path from current hash, or from a file path + get: function( newPath ) { + if( newPath === undefined ) { + newPath = location.hash; + } + return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' ); + }, + + //return the substring of a filepath before the sub-page key, for making a server request + getFilePath: function( path ) { + var splitkey = '&' + $.mobile.subPageUrlKey; + return path && path.split( splitkey )[0].split( dialogHashKey )[0]; + }, + + //set location hash to path + set: function( path ) { + location.hash = path; + }, + + //test if a given url (string) is a path + //NOTE might be exceptionally naive + isPath: function( url ) { + return ( /\// ).test( url ); + }, + + //return a url path with the window's location protocol/hostname/pathname removed + clean: function( url ) { + return url.replace( documentBase.domain, "" ); + }, + + //just return the url without an initial # + stripHash: function( url ) { + return url.replace( /^#/, "" ); + }, + + //remove the preceding hash, any query params, and dialog notations + cleanHash: function( hash ) { + return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) ); + }, + + //check whether a url is referencing the same domain, or an external domain or different protocol + //could be mailto, etc + isExternal: function( url ) { + var u = path.parseUrl( url ); + return u.protocol && u.domain !== documentUrl.domain ? true : false; + }, + + hasProtocol: function( url ) { + return ( /^(:?\w+:)/ ).test( url ); + }, + + //check if the specified url refers to the first page in the main application document. + isFirstPageUrl: function( url ) { + // We only deal with absolute paths. + var u = path.parseUrl( path.makeUrlAbsolute( url, documentBase ) ), + + // Does the url have the same path as the document? + samePath = u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ), + + // Get the first page element. + fp = $.mobile.firstPage, + + // Get the id of the first page element if it has one. + fpId = fp && fp[0] ? fp[0].id : undefined; + + // The url refers to the first page if the path matches the document and + // it either has no hash value, or the hash is exactly equal to the id of the + // first page element. + return samePath && ( !u.hash || u.hash === "#" || ( fpId && u.hash.replace( /^#/, "" ) === fpId ) ); + }, + + isEmbeddedPage: function( url ) { + var u = path.parseUrl( url ); + + //if the path is absolute, then we need to compare the url against + //both the documentUrl and the documentBase. The main reason for this + //is that links embedded within external documents will refer to the + //application document, whereas links embedded within the application + //document will be resolved against the document base. + if ( u.protocol !== "" ) { + return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) ); + } + return (/^#/).test( u.href ); + } + }, + + //will be defined when a link is clicked and given an active class + $activeClickedLink = null, + + //urlHistory is purely here to make guesses at whether the back or forward button was clicked + //and provide an appropriate transition + urlHistory = { + // Array of pages that are visited during a single page load. + // Each has a url and optional transition, title, and pageUrl (which represents the file path, in cases where URL is obscured, such as dialogs) + stack: [], + + //maintain an index number for the active page in the stack + activeIndex: 0, + + //get active + getActive: function() { + return urlHistory.stack[ urlHistory.activeIndex ]; + }, + + getPrev: function() { + return urlHistory.stack[ urlHistory.activeIndex - 1 ]; + }, + + getNext: function() { + return urlHistory.stack[ urlHistory.activeIndex + 1 ]; + }, + + // addNew is used whenever a new page is added + addNew: function( url, transition, title, pageUrl, role ) { + //if there's forward history, wipe it + if( urlHistory.getNext() ) { + urlHistory.clearForward(); + } + + urlHistory.stack.push( {url : url, transition: transition, title: title, pageUrl: pageUrl, role: role } ); + + urlHistory.activeIndex = urlHistory.stack.length - 1; + }, + + //wipe urls ahead of active index + clearForward: function() { + urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 ); + }, + + directHashChange: function( opts ) { + var back , forward, newActiveIndex, prev = this.getActive(); + + // check if url isp in history and if it's ahead or behind current page + $.each( urlHistory.stack, function( i, historyEntry ) { + + //if the url is in the stack, it's a forward or a back + if( opts.currentUrl === historyEntry.url ) { + //define back and forward by whether url is older or newer than current page + back = i < urlHistory.activeIndex; + forward = !back; + newActiveIndex = i; + } + }); + + // save new page index, null check to prevent falsey 0 result + this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex; + + if( back ) { + ( opts.either || opts.isBack )( true ); + } else if( forward ) { + ( opts.either || opts.isForward )( false ); + } + }, + + //disable hashchange event listener internally to ignore one change + //toggled internally when location.hash is updated to match the url of a successful page load + ignoreNextHashChange: false + }, + + //define first selector to receive focus when a page is shown + focusable = "[tabindex],a,button:visible,select:visible,input", + + //queue to hold simultanious page transitions + pageTransitionQueue = [], + + //indicates whether or not page is in process of transitioning + isPageTransitioning = false, + + //nonsense hash change key for dialogs, so they create a history entry + dialogHashKey = "&ui-state=dialog", + + //existing base tag? + $base = $head.children( "base" ), + + //tuck away the original document URL minus any fragment. + documentUrl = path.parseUrl( location.href ), + + //if the document has an embedded base tag, documentBase is set to its + //initial value. If a base tag does not exist, then we default to the documentUrl. + documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl, + + //cache the comparison once. + documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash ); + + //base element management, defined depending on dynamic base tag support + var base = $.support.dynamicBaseTag ? { + + //define base element, for use in routing asset urls that are referenced in Ajax-requested markup + element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ), + + //set the generated BASE element's href attribute to a new page's base path + set: function( href ) { + base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) ); + }, + + //set the generated BASE element's href attribute to a new page's base path + reset: function() { + base.element.attr( "href", documentBase.hrefNoHash ); + } + + } : undefined; + +/* + internal utility functions +--------------------------------------*/ + + + //direct focus to the page title, or otherwise first focusable element + $.mobile.focusPage = function ( page ) { + var autofocus = page.find("[autofocus]"), + pageTitle = page.find( ".ui-title:eq(0)" ); + + if( autofocus.length ) { + autofocus.focus(); + return; + } + + if( pageTitle.length ) { + pageTitle.focus(); + } + else{ + page.focus(); + } + } + + //remove active classes after page transition or error + function removeActiveLinkClass( forceRemoval ) { + if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) { + $activeClickedLink.removeClass( $.mobile.activeBtnClass ); + } + $activeClickedLink = null; + } + + function releasePageTransitionLock() { + isPageTransitioning = false; + if( pageTransitionQueue.length > 0 ) { + $.mobile.changePage.apply( null, pageTransitionQueue.pop() ); + } + } + + // Save the last scroll distance per page, before it is hidden + var setLastScrollEnabled = true, + setLastScroll, delayedSetLastScroll; + + setLastScroll = function() { + // this barrier prevents setting the scroll value based on the browser + // scrolling the window based on a hashchange + if( !setLastScrollEnabled ) { + return; + } + + var active = $.mobile.urlHistory.getActive(); + + if( active ) { + var lastScroll = $window.scrollTop(); + + // Set active page's lastScroll prop. + // If the location we're scrolling to is less than minScrollBack, let it go. + active.lastScroll = lastScroll < $.mobile.minScrollBack ? $.mobile.defaultHomeScroll : lastScroll; + } + }; + + // bind to scrollstop to gather scroll position. The delay allows for the hashchange + // event to fire and disable scroll recording in the case where the browser scrolls + // to the hash targets location (sometimes the top of the page). once pagechange fires + // getLastScroll is again permitted to operate + delayedSetLastScroll = function() { + setTimeout( setLastScroll, 100 ); + }; + + // disable an scroll setting when a hashchange has been fired, this only works + // because the recording of the scroll position is delayed for 100ms after + // the browser might have changed the position because of the hashchange + $window.bind( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = false; + }); + + // handle initial hashchange from chrome :( + $window.one( $.support.pushState ? "popstate" : "hashchange", function() { + setLastScrollEnabled = true; + }); + + // wait until the mobile page container has been determined to bind to pagechange + $window.one( "pagecontainercreate", function(){ + // once the page has changed, re-enable the scroll recording + $.mobile.pageContainer.bind( "pagechange", function() { + + setLastScrollEnabled = true; + + // remove any binding that previously existed on the get scroll + // which may or may not be different than the scroll element determined for + // this page previously + $window.unbind( "scrollstop", delayedSetLastScroll ); + + // determine and bind to the current scoll element which may be the window + // or in the case of touch overflow the element with touch overflow + $window.bind( "scrollstop", delayedSetLastScroll ); + }); + }); + + // bind to scrollstop for the first page as "pagechange" won't be fired in that case + $window.bind( "scrollstop", delayedSetLastScroll ); + + //function for transitioning between two existing pages + function transitionPages( toPage, fromPage, transition, reverse ) { + + if( fromPage ) { + //trigger before show/hide events + fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } ); + } + + toPage.data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } ); + + //clear page loader + $.mobile.hidePageLoadingMsg(); + + // If transition is defined, check if css 3D transforms are supported, and if not, if a fallback is specified + if( transition && !$.support.cssTransform3d && $.mobile.transitionFallbacks[ transition ] ){ + transition = $.mobile.transitionFallbacks[ transition ]; + } + + //find the transition handler for the specified transition. If there + //isn't one in our transitionHandlers dictionary, use the default one. + //call the handler immediately to kick-off the transition. + var th = $.mobile.transitionHandlers[ transition || "default" ] || $.mobile.defaultTransitionHandler, + promise = th( transition, reverse, toPage, fromPage ); + + promise.done(function() { + + //trigger show/hide events + if( fromPage ) { + fromPage.data( "page" )._trigger( "hide", null, { nextPage: toPage } ); + } + + //trigger pageshow, define prevPage as either fromPage or empty jQuery obj + toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } ); + }); + + return promise; + } + + //simply set the active page's minimum height to screen height, depending on orientation + function getScreenHeight(){ + // Native innerHeight returns more accurate value for this across platforms, + // jQuery version is here as a normalized fallback for platforms like Symbian + return window.innerHeight || $( window ).height(); + } + + $.mobile.getScreenHeight = getScreenHeight; + + //simply set the active page's minimum height to screen height, depending on orientation + function resetActivePageHeight(){ + var aPage = $( "." + $.mobile.activePageClass ), + aPagePadT = parseFloat( aPage.css( "padding-top" ) ), + aPagePadB = parseFloat( aPage.css( "padding-bottom" ) ); + + aPage.css( "min-height", getScreenHeight() - aPagePadT - aPagePadB ); + } + + //shared page enhancements + function enhancePage( $page, role ) { + // If a role was specified, make sure the data-role attribute + // on the page element is in sync. + if( role ) { + $page.attr( "data-" + $.mobile.ns + "role", role ); + } + + //run page plugin + $page.page(); + } + +/* exposed $.mobile methods */ + + //animation complete callback + $.fn.animationComplete = function( callback ) { + if( $.support.cssTransitions ) { + return $( this ).one( 'webkitAnimationEnd animationend', callback ); + } + else{ + // defer execution for consistency between webkit/non webkit + setTimeout( callback, 0 ); + return $( this ); + } + }; + + //expose path object on $.mobile + $.mobile.path = path; + + //expose base object on $.mobile + $.mobile.base = base; + + //history stack + $.mobile.urlHistory = urlHistory; + + $.mobile.dialogHashKey = dialogHashKey; + + + + //enable cross-domain page support + $.mobile.allowCrossDomainPages = false; + + //return the original document url + $.mobile.getDocumentUrl = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href; + }; + + //return the original document base url + $.mobile.getDocumentBase = function(asParsedObject) { + return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href; + }; + + $.mobile._bindPageRemove = function() { + var page = $(this); + + // when dom caching is not enabled or the page is embedded bind to remove the page on hide + if( !page.data("page").options.domCache + && page.is(":jqmData(external-page='true')") ) { + + page.bind( 'pagehide.remove', function() { + var $this = $( this ), + prEvent = new $.Event( "pageremove" ); + + $this.trigger( prEvent ); + + if( !prEvent.isDefaultPrevented() ){ + $this.removeWithDependents(); + } + }); + } + }; + + // Load a page into the DOM. + $.mobile.loadPage = function( url, options ) { + // This function uses deferred notifications to let callers + // know when the page is done loading, or if an error has occurred. + var deferred = $.Deferred(), + + // The default loadPage options with overrides specified by + // the caller. + settings = $.extend( {}, $.mobile.loadPage.defaults, options ), + + // The DOM element for the page after it has been loaded. + page = null, + + // If the reloadPage option is true, and the page is already + // in the DOM, dupCachedPage will be set to the page element + // so that it can be removed after the new version of the + // page is loaded off the network. + dupCachedPage = null, + + // determine the current base url + findBaseWithDefault = function(){ + var closestBase = ( $.mobile.activePage && getClosestBaseUrl( $.mobile.activePage ) ); + return closestBase || documentBase.hrefNoHash; + }, + + // The absolute version of the URL passed into the function. This + // version of the URL may contain dialog/subpage params in it. + absUrl = path.makeUrlAbsolute( url, findBaseWithDefault() ); + + + // If the caller provided data, and we're using "get" request, + // append the data to the URL. + if ( settings.data && settings.type === "get" ) { + absUrl = path.addSearchParams( absUrl, settings.data ); + settings.data = undefined; + } + + // If the caller is using a "post" request, reloadPage must be true + if( settings.data && settings.type === "post" ){ + settings.reloadPage = true; + } + + // The absolute version of the URL minus any dialog/subpage params. + // In otherwords the real URL of the page to be loaded. + var fileUrl = path.getFilePath( absUrl ), + + // The version of the Url actually stored in the data-url attribute of + // the page. For embedded pages, it is just the id of the page. For pages + // within the same domain as the document base, it is the site relative + // path. For cross-domain pages (Phone Gap only) the entire absolute Url + // used to load the page. + dataUrl = path.convertUrlToDataUrl( absUrl ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Check to see if the page already exists in the DOM. + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + + // If we failed to find the page, check to see if the url is a + // reference to an embedded page. If so, it may have been dynamically + // injected by a developer, in which case it would be lacking a data-url + // attribute and in need of enhancement. + if ( page.length === 0 && dataUrl && !path.isPath( dataUrl ) ) { + page = settings.pageContainer.children( "#" + dataUrl ) + .attr( "data-" + $.mobile.ns + "url", dataUrl ); + } + + // If we failed to find a page in the DOM, check the URL to see if it + // refers to the first page in the application. If it isn't a reference + // to the first page and refers to non-existent embedded page, error out. + if ( page.length === 0 ) { + if ( $.mobile.firstPage && path.isFirstPageUrl( fileUrl ) ) { + // Check to make sure our cached-first-page is actually + // in the DOM. Some user deployed apps are pruning the first + // page from the DOM for various reasons, we check for this + // case here because we don't want a first-page with an id + // falling through to the non-existent embedded page error + // case. If the first-page is not in the DOM, then we let + // things fall through to the ajax loading code below so + // that it gets reloaded. + if ( $.mobile.firstPage.parent().length ) { + page = $( $.mobile.firstPage ); + } + } else if ( path.isEmbeddedPage( fileUrl ) ) { + deferred.reject( absUrl, options ); + return deferred.promise(); + } + } + + // Reset base to the default document base. + if ( base ) { + base.reset(); + } + + // If the page we are interested in is already in the DOM, + // and the caller did not indicate that we should force a + // reload of the file, we are done. Otherwise, track the + // existing page as a duplicated. + if ( page.length ) { + if ( !settings.reloadPage ) { + enhancePage( page, settings.role ); + deferred.resolve( absUrl, options, page ); + return deferred.promise(); + } + dupCachedPage = page; + } + + var mpc = settings.pageContainer, + pblEvent = new $.Event( "pagebeforeload" ), + triggerData = { url: url, absUrl: absUrl, dataUrl: dataUrl, deferred: deferred, options: settings }; + + // Let listeners know we're about to load a page. + mpc.trigger( pblEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pblEvent.isDefaultPrevented() ){ + return deferred.promise(); + } + + if ( settings.showLoadMsg ) { + + // This configurable timeout allows cached pages a brief delay to load without showing a message + var loadMsgDelay = setTimeout(function(){ + $.mobile.showPageLoadingMsg(); + }, settings.loadMsgDelay ), + + // Shared logic for clearing timeout and removing message. + hideMsg = function(){ + + // Stop message show timer + clearTimeout( loadMsgDelay ); + + // Hide loading message + $.mobile.hidePageLoadingMsg(); + }; + } + + if ( !( $.mobile.allowCrossDomainPages || path.isSameDomain( documentUrl, absUrl ) ) ) { + deferred.reject( absUrl, options ); + } else { + // Load the new page. + $.ajax({ + url: fileUrl, + type: settings.type, + data: settings.data, + dataType: "html", + success: function( html, textStatus, xhr ) { + //pre-parse html to check for a data-url, + //use it as the new fileUrl, base path, etc + var all = $( "<div></div>" ), + + //page title regexp + newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1, + + // TODO handle dialogs again + pageElemRegex = new RegExp( "(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>)" ), + dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" ); + + + // data-url must be provided for the base tag so resource requests can be directed to the + // correct url. loading into a temprorary element makes these requests immediately + if( pageElemRegex.test( html ) + && RegExp.$1 + && dataUrlRegex.test( RegExp.$1 ) + && RegExp.$1 ) { + url = fileUrl = path.getFilePath( RegExp.$1 ); + } + + if ( base ) { + base.set( fileUrl ); + } + + //workaround to allow scripts to execute when included in page divs + all.get( 0 ).innerHTML = html; + page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first(); + + //if page elem couldn't be found, create one and insert the body element's contents + if( !page.length ){ + page = $( "<div data-" + $.mobile.ns + "role='page'>" + html.split( /<\/?body[^>]*>/gmi )[1] + "</div>" ); + } + + if ( newPageTitle && !page.jqmData( "title" ) ) { + if ( ~newPageTitle.indexOf( "&" ) ) { + newPageTitle = $( "<div>" + newPageTitle + "</div>" ).text(); + } + page.jqmData( "title", newPageTitle ); + } + + //rewrite src and href attrs to use a base url + if( !$.support.dynamicBaseTag ) { + var newPath = path.get( fileUrl ); + page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() { + var thisAttr = $( this ).is( '[href]' ) ? 'href' : + $(this).is('[src]') ? 'src' : 'action', + thisUrl = $( this ).attr( thisAttr ); + + // XXX_jblas: We need to fix this so that it removes the document + // base URL, and then prepends with the new page URL. + //if full path exists and is same, chop it - helps IE out + thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' ); + + if( !/^(\w+:|#|\/)/.test( thisUrl ) ) { + $( this ).attr( thisAttr, newPath + thisUrl ); + } + }); + } + + //append to page and enhance + // TODO taging a page with external to make sure that embedded pages aren't removed + // by the various page handling code is bad. Having page handling code in many + // places is bad. Solutions post 1.0 + page + .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) ) + .attr( "data-" + $.mobile.ns + "external-page", true ) + .appendTo( settings.pageContainer ); + + // wait for page creation to leverage options defined on widget + page.one( 'pagecreate', $.mobile._bindPageRemove ); + + enhancePage( page, settings.role ); + + // Enhancing the page may result in new dialogs/sub pages being inserted + // into the DOM. If the original absUrl refers to a sub-page, that is the + // real page we are interested in. + if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) { + page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); + } + + //bind pageHide to removePage after it's hidden, if the page options specify to do so + + // Remove loading message. + if ( settings.showLoadMsg ) { + hideMsg(); + } + + // Add the page reference and xhr to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.page = page; + + // Let listeners know the page loaded successfully. + settings.pageContainer.trigger( "pageload", triggerData ); + + deferred.resolve( absUrl, options, page, dupCachedPage ); + }, + error: function( xhr, textStatus, errorThrown ) { + //set base back to current path + if( base ) { + base.set( path.get() ); + } + + // Add error info to our triggerData. + triggerData.xhr = xhr; + triggerData.textStatus = textStatus; + triggerData.errorThrown = errorThrown; + + var plfEvent = new $.Event( "pageloadfailed" ); + + // Let listeners know the page load failed. + settings.pageContainer.trigger( plfEvent, triggerData ); + + // If the default behavior is prevented, stop here! + // Note that it is the responsibility of the listener/handler + // that called preventDefault(), to resolve/reject the + // deferred object within the triggerData. + if( plfEvent.isDefaultPrevented() ){ + return; + } + + // Remove loading message. + if ( settings.showLoadMsg ) { + + // Remove loading message. + hideMsg(); + + // show error message + $.mobile.showPageLoadingMsg( $.mobile.pageLoadErrorMessageTheme, $.mobile.pageLoadErrorMessage, true ); + + // hide after delay + setTimeout( $.mobile.hidePageLoadingMsg, 1500 ); + } + + deferred.reject( absUrl, options ); + } + }); + } + + return deferred.promise(); + }; + + $.mobile.loadPage.defaults = { + type: "get", + data: undefined, + reloadPage: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + showLoadMsg: false, + pageContainer: undefined, + loadMsgDelay: 50 // This delay allows loads that pull from browser cache to occur without showing the loading message. + }; + + // Show a specific page in the page container. + $.mobile.changePage = function( toPage, options ) { + // If we are in the midst of a transition, queue the current request. + // We'll call changePage() once we're done with the current transition to + // service the request. + if( isPageTransitioning ) { + pageTransitionQueue.unshift( arguments ); + return; + } + + var settings = $.extend( {}, $.mobile.changePage.defaults, options ); + + // Make sure we have a pageContainer to work with. + settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; + + // Make sure we have a fromPage. + settings.fromPage = settings.fromPage || $.mobile.activePage; + + var mpc = settings.pageContainer, + pbcEvent = new $.Event( "pagebeforechange" ), + triggerData = { toPage: toPage, options: settings }; + + // Let listeners know we're about to change the current page. + mpc.trigger( pbcEvent, triggerData ); + + // If the default behavior is prevented, stop here! + if( pbcEvent.isDefaultPrevented() ){ + return; + } + + // We allow "pagebeforechange" observers to modify the toPage in the trigger + // data to allow for redirects. Make sure our toPage is updated. + + toPage = triggerData.toPage; + + // Set the isPageTransitioning flag to prevent any requests from + // entering this method while we are in the midst of loading a page + // or transitioning. + + isPageTransitioning = true; + + // If the caller passed us a url, call loadPage() + // to make sure it is loaded into the DOM. We'll listen + // to the promise object it returns so we know when + // it is done loading or if an error ocurred. + if ( typeof toPage == "string" ) { + $.mobile.loadPage( toPage, settings ) + .done(function( url, options, newPage, dupCachedPage ) { + isPageTransitioning = false; + options.duplicateCachedPage = dupCachedPage; + $.mobile.changePage( newPage, options ); + }) + .fail(function( url, options ) { + isPageTransitioning = false; + + //clear out the active button state + removeActiveLinkClass( true ); + + //release transition lock so navigation is free again + releasePageTransitionLock(); + settings.pageContainer.trigger( "pagechangefailed", triggerData ); + }); + return; + } + + // If we are going to the first-page of the application, we need to make + // sure settings.dataUrl is set to the application document url. This allows + // us to avoid generating a document url with an id hash in the case where the + // first-page of the document has an id attribute specified. + if ( toPage[ 0 ] === $.mobile.firstPage[ 0 ] && !settings.dataUrl ) { + settings.dataUrl = documentUrl.hrefNoHash; + } + + // The caller passed us a real page DOM element. Update our + // internal state and then trigger a transition to the page. + var fromPage = settings.fromPage, + url = ( settings.dataUrl && path.convertUrlToDataUrl( settings.dataUrl ) ) || toPage.jqmData( "url" ), + // The pageUrl var is usually the same as url, except when url is obscured as a dialog url. pageUrl always contains the file path + pageUrl = url, + fileUrl = path.getFilePath( url ), + active = urlHistory.getActive(), + activeIsInitialPage = urlHistory.activeIndex === 0, + historyDir = 0, + pageTitle = document.title, + isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog"; + + // By default, we prevent changePage requests when the fromPage and toPage + // are the same element, but folks that generate content manually/dynamically + // and reuse pages want to be able to transition to the same page. To allow + // this, they will need to change the default value of allowSamePageTransition + // to true, *OR*, pass it in as an option when they manually call changePage(). + // It should be noted that our default transition animations assume that the + // formPage and toPage are different elements, so they may behave unexpectedly. + // It is up to the developer that turns on the allowSamePageTransitiona option + // to either turn off transition animations, or make sure that an appropriate + // animation transition is used. + if( fromPage && fromPage[0] === toPage[0] && !settings.allowSamePageTransition ) { + isPageTransitioning = false; + mpc.trigger( "pagechange", triggerData ); + return; + } + + // We need to make sure the page we are given has already been enhanced. + enhancePage( toPage, settings.role ); + + // If the changePage request was sent from a hashChange event, check to see if the + // page is already within the urlHistory stack. If so, we'll assume the user hit + // the forward/back button and will try to match the transition accordingly. + if( settings.fromHashChange ) { + urlHistory.directHashChange({ + currentUrl: url, + isBack: function() { historyDir = -1; }, + isForward: function() { historyDir = 1; } + }); + } + + // Kill the keyboard. + // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead, + // we should be tracking focus with a delegate() handler so we already have + // the element in hand at this point. + // Wrap this in a try/catch block since IE9 throw "Unspecified error" if document.activeElement + // is undefined when we are in an IFrame. + try { + if(document.activeElement && document.activeElement.nodeName.toLowerCase() != 'body') { + $(document.activeElement).blur(); + } else { + $( "input:focus, textarea:focus, select:focus" ).blur(); + } + } catch(e) {} + + // If we're displaying the page as a dialog, we don't want the url + // for the dialog content to be used in the hash. Instead, we want + // to append the dialogHashKey to the url of the current page. + if ( isDialog && active ) { + // on the initial page load active.url is undefined and in that case should + // be an empty string. Moving the undefined -> empty string back into + // urlHistory.addNew seemed imprudent given undefined better represents + // the url state + url = ( active.url || "" ) + dialogHashKey; + } + + // Set the location hash. + if( settings.changeHash !== false && url ) { + //disable hash listening temporarily + urlHistory.ignoreNextHashChange = true; + //update hash and history + path.set( url ); + } + + // if title element wasn't found, try the page div data attr too + // If this is a deep-link or a reload ( active === undefined ) then just use pageTitle + var newPageTitle = ( !active )? pageTitle : toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).getEncodedText(); + if( !!newPageTitle && pageTitle == document.title ) { + pageTitle = newPageTitle; + } + if ( !toPage.jqmData( "title" ) ) { + toPage.jqmData( "title", pageTitle ); + } + + // Make sure we have a transition defined. + settings.transition = settings.transition + || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined ) + || ( isDialog ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition ); + + //add page to history stack if it's not back or forward + if( !historyDir ) { + urlHistory.addNew( url, settings.transition, pageTitle, pageUrl, settings.role ); + } + + //set page title + document.title = urlHistory.getActive().title; + + //set "toPage" as activePage + $.mobile.activePage = toPage; + + // If we're navigating back in the URL history, set reverse accordingly. + settings.reverse = settings.reverse || historyDir < 0; + + transitionPages( toPage, fromPage, settings.transition, settings.reverse ) + .done(function( name, reverse, $to, $from, alreadyFocused ) { + removeActiveLinkClass(); + + //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden + if ( settings.duplicateCachedPage ) { + settings.duplicateCachedPage.remove(); + } + + // Send focus to the newly shown page. Moved from promise .done binding in transitionPages + // itself to avoid ie bug that reports offsetWidth as > 0 (core check for visibility) + // despite visibility: hidden addresses issue #2965 + // https://github.com/jquery/jquery-mobile/issues/2965 + if( !alreadyFocused ){ + $.mobile.focusPage( toPage ); + } + + releasePageTransitionLock(); + + // Let listeners know we're all done changing the current page. + mpc.trigger( "pagechange", triggerData ); + }); + }; + + $.mobile.changePage.defaults = { + transition: undefined, + reverse: false, + changeHash: true, + fromHashChange: false, + role: undefined, // By default we rely on the role defined by the @data-role attribute. + duplicateCachedPage: undefined, + pageContainer: undefined, + showLoadMsg: true, //loading message shows by default when pages are being fetched during changePage + dataUrl: undefined, + fromPage: undefined, + allowSamePageTransition: false + }; + +/* Event Bindings - hashchange, submit, and click */ + function findClosestLink( ele ) + { + while ( ele ) { + // Look for the closest element with a nodeName of "a". + // Note that we are checking if we have a valid nodeName + // before attempting to access it. This is because the + // node we get called with could have originated from within + // an embedded SVG document where some symbol instance elements + // don't have nodeName defined on them, or strings are of type + // SVGAnimatedString. + if ( ( typeof ele.nodeName === "string" ) && ele.nodeName.toLowerCase() == "a" ) { + break; + } + ele = ele.parentNode; + } + return ele; + } + + // The base URL for any given element depends on the page it resides in. + function getClosestBaseUrl( ele ) + { + // Find the closest page and extract out its url. + var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ), + base = documentBase.hrefNoHash; + + if ( !url || !path.isPath( url ) ) { + url = base; + } + + return path.makeUrlAbsolute( url, base); + } + + + //The following event bindings should be bound after mobileinit has been triggered + //the following function is called in the init file + $.mobile._registerInternalEvents = function(){ + + //bind to form submit events, handle with Ajax + $( document ).delegate( "form", "submit", function( event ) { + var $this = $( this ); + + if( !$.mobile.ajaxEnabled || + // test that the form is, itself, ajax false + $this.is(":jqmData(ajax='false')") || + // test that $.mobile.ignoreContentEnabled is set and + // the form or one of it's parents is ajax=false + !$this.jqmHijackable().length ) { + return; + } + + var type = $this.attr( "method" ), + target = $this.attr( "target" ), + url = $this.attr( "action" ); + + // If no action is specified, browsers default to using the + // URL of the document containing the form. Since we dynamically + // pull in pages from external documents, the form should submit + // to the URL for the source document of the page containing + // the form. + if ( !url ) { + // Get the @data-url for the page containing the form. + url = getClosestBaseUrl( $this ); + if ( url === documentBase.hrefNoHash ) { + // The url we got back matches the document base, + // which means the page must be an internal/embedded page, + // so default to using the actual document url as a browser + // would. + url = documentUrl.hrefNoSearch; + } + } + + url = path.makeUrlAbsolute( url, getClosestBaseUrl($this) ); + + //external submits use regular HTTP + if( path.isExternal( url ) || target ) { + return; + } + + $.mobile.changePage( + url, + { + type: type && type.length && type.toLowerCase() || "get", + data: $this.serialize(), + transition: $this.jqmData( "transition" ), + direction: $this.jqmData( "direction" ), + reloadPage: true + } + ); + event.preventDefault(); + }); + + //add active state on vclick + $( document ).bind( "vclick", function( event ) { + // if this isn't a left click we don't care. Its important to note + // that when the virtual event is generated it will create the which attr + if ( event.which > 1 || !$.mobile.linkBindingEnabled ) { + return; + } + + var link = findClosestLink( event.target ); + + // split from the previous return logic to avoid find closest where possible + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !$(link).jqmHijackable().length ) { + return; + } + + if ( link ) { + if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) { + removeActiveLinkClass( true ); + $activeClickedLink = $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ); + $activeClickedLink.addClass( $.mobile.activeBtnClass ); + $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur(); + + // By caching the href value to data and switching the href to a #, we can avoid address bar showing in iOS. The click handler resets the href during its initial steps if this data is present + $( link ) + .jqmData( "href", $( link ).attr( "href" ) ) + .attr( "href", "#" ); + } + } + }); + + // click routing - direct to HTTP or Ajax, accordingly + $( document ).bind( "click", function( event ) { + if( !$.mobile.linkBindingEnabled ){ + return; + } + + var link = findClosestLink( event.target ), $link = $( link ), httpCleanup; + + // If there is no link associated with the click or its not a left + // click we want to ignore the click + // TODO teach $.mobile.hijackable to operate on raw dom elements so the link wrapping + // can be avoided + if ( !link || event.which > 1 || !$link.jqmHijackable().length ) { + return; + } + + //remove active link class if external (then it won't be there if you come back) + httpCleanup = function(){ + window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 ); + }; + + // If there's data cached for the real href value, set the link's href back to it again. This pairs with an address bar workaround from the vclick handler + if( $link.jqmData( "href" ) ){ + $link.attr( "href", $link.jqmData( "href" ) ); + } + + //if there's a data-rel=back attr, go back in history + if( $link.is( ":jqmData(rel='back')" ) ) { + window.history.back(); + return false; + } + + var baseUrl = getClosestBaseUrl( $link ), + + //get href, if defined, otherwise default to empty hash + href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl ); + + //if ajax is disabled, exit early + if( !$.mobile.ajaxEnabled && !path.isEmbeddedPage( href ) ){ + httpCleanup(); + //use default click handling + return; + } + + // XXX_jblas: Ideally links to application pages should be specified as + // an url to the application document with a hash that is either + // the site relative path or id to the page. But some of the + // internal code that dynamically generates sub-pages for nested + // lists and select dialogs, just write a hash in the link they + // create. This means the actual URL path is based on whatever + // the current value of the base tag is at the time this code + // is called. For now we are just assuming that any url with a + // hash in it is an application page reference. + if ( href.search( "#" ) != -1 ) { + href = href.replace( /[^#]*#/, "" ); + if ( !href ) { + //link was an empty hash meant purely + //for interaction, so we ignore it. + event.preventDefault(); + return; + } else if ( path.isPath( href ) ) { + //we have apath so make it the href we want to load. + href = path.makeUrlAbsolute( href, baseUrl ); + } else { + //we have a simple id so use the documentUrl as its base. + href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash ); + } + } + + // Should we handle this link, or let the browser deal with it? + var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ), + + // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR + // requests if the document doing the request was loaded via the file:// protocol. + // This is usually to allow the application to "phone home" and fetch app specific + // data. We normally let the browser handle external/cross-domain urls, but if the + // allowCrossDomainPages option is true, we will allow cross-domain http/https + // requests to go through our page loading logic. + isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ), + + //check for protocol or rel and its not an embedded page + //TODO overlap in logic from isExternal, rel=external check should be + // moved into more comprehensive isExternalLink + isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad ); + + if( isExternal ) { + httpCleanup(); + //use default click handling + return; + } + + //use ajax + var transition = $link.jqmData( "transition" ), + direction = $link.jqmData( "direction" ), + reverse = ( direction && direction === "reverse" ) || + // deprecated - remove by 1.0 + $link.jqmData( "back" ), + + //this may need to be more specific as we use data-rel more + role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined; + + $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } ); + event.preventDefault(); + }); + + //prefetch pages when anchors with data-prefetch are encountered + $( document ).delegate( ".ui-page", "pageshow.prefetch", function() { + var urls = []; + $( this ).find( "a:jqmData(prefetch)" ).each(function(){ + var $link = $(this), + url = $link.attr( "href" ); + + if ( url && $.inArray( url, urls ) === -1 ) { + urls.push( url ); + + $.mobile.loadPage( url, {role: $link.attr("data-" + $.mobile.ns + "rel")} ); + } + }); + }); + + $.mobile._handleHashChange = function( hash ) { + //find first page via hash + var to = path.stripHash( hash ), + //transition is false if it's the first page, undefined otherwise (and may be overridden by default) + transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined, + + // default options for the changPage calls made after examining the current state + // of the page and the hash + changePageOptions = { + transition: transition, + changeHash: false, + fromHashChange: true + }; + + //if listening is disabled (either globally or temporarily), or it's a dialog hash + if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) { + urlHistory.ignoreNextHashChange = false; + return; + } + + // special case for dialogs + if( urlHistory.stack.length > 1 && to.indexOf( dialogHashKey ) > -1 ) { + + // If current active page is not a dialog skip the dialog and continue + // in the same direction + if(!$.mobile.activePage.is( ".ui-dialog" )) { + //determine if we're heading forward or backward and continue accordingly past + //the current dialog + urlHistory.directHashChange({ + currentUrl: to, + isBack: function() { window.history.back(); }, + isForward: function() { window.history.forward(); } + }); + + // prevent changePage() + return; + } else { + // if the current active page is a dialog and we're navigating + // to a dialog use the dialog objected saved in the stack + urlHistory.directHashChange({ + currentUrl: to, + + // regardless of the direction of the history change + // do the following + either: function( isBack ) { + var active = $.mobile.urlHistory.getActive(); + + to = active.pageUrl; + + // make sure to set the role, transition and reversal + // as most of this is lost by the domCache cleaning + $.extend( changePageOptions, { + role: active.role, + transition: active.transition, + reverse: isBack + }); + } + }); + } + } + + //if to is defined, load it + if ( to ) { + // At this point, 'to' can be one of 3 things, a cached page element from + // a history stack entry, an id, or site-relative/absolute URL. If 'to' is + // an id, we need to resolve it against the documentBase, not the location.href, + // since the hashchange could've been the result of a forward/backward navigation + // that crosses from an external page/dialog to an internal page/dialog. + to = ( typeof to === "string" && !path.isPath( to ) ) ? ( path.makeUrlAbsolute( '#' + to, documentBase ) ) : to; + $.mobile.changePage( to, changePageOptions ); + } else { + //there's no hash, go to the first page in the dom + $.mobile.changePage( $.mobile.firstPage, changePageOptions ); + } + }; + + //hashchange event handler + $window.bind( "hashchange", function( e, triggered ) { + $.mobile._handleHashChange( location.hash ); + }); + + //set page min-heights to be device specific + $( document ).bind( "pageshow", resetActivePageHeight ); + $( window ).bind( "throttledresize", resetActivePageHeight ); + + };//_registerInternalEvents callback + +})( jQuery ); + +( function( $, window ) { + // For now, let's Monkeypatch this onto the end of $.mobile._registerInternalEvents + // Scope self to pushStateHandler so we can reference it sanely within the + // methods handed off as event handlers + var pushStateHandler = {}, + self = pushStateHandler, + $win = $( window ), + url = $.mobile.path.parseUrl( location.href ); + + $.extend( pushStateHandler, { + // TODO move to a path helper, this is rather common functionality + initialFilePath: (function() { + return url.pathname + url.search; + })(), + + initialHref: url.hrefNoHash, + + state: function() { + return { + hash: location.hash || "#" + self.initialFilePath, + title: document.title, + + // persist across refresh + initialHref: self.initialHref + }; + }, + + resetUIKeys: function( url ) { + var dialog = $.mobile.dialogHashKey, + subkey = "&" + $.mobile.subPageUrlKey, + dialogIndex = url.indexOf( dialog ); + + if( dialogIndex > -1 ) { + url = url.slice( 0, dialogIndex ) + "#" + url.slice( dialogIndex ); + } else if( url.indexOf( subkey ) > -1 ) { + url = url.split( subkey ).join( "#" + subkey ); + } + + return url; + }, + + hashValueAfterReset: function( url ) { + var resetUrl = self.resetUIKeys( url ); + return $.mobile.path.parseUrl( resetUrl ).hash; + }, + + // TODO sort out a single barrier to hashchange functionality + nextHashChangePrevented: function( value ) { + $.mobile.urlHistory.ignoreNextHashChange = value; + self.onHashChangeDisabled = value; + }, + + // on hash change we want to clean up the url + // NOTE this takes place *after* the vanilla navigation hash change + // handling has taken place and set the state of the DOM + onHashChange: function( e ) { + // disable this hash change + if( self.onHashChangeDisabled ){ + return; + } + + var href, state, + hash = location.hash, + isPath = $.mobile.path.isPath( hash ), + resolutionUrl = isPath ? location.href : $.mobile.getDocumentUrl(); + + hash = isPath ? hash.replace( "#", "" ) : hash; + + + // propulate the hash when its not available + state = self.state(); + + // make the hash abolute with the current href + href = $.mobile.path.makeUrlAbsolute( hash, resolutionUrl ); + + if ( isPath ) { + href = self.resetUIKeys( href ); + } + + // replace the current url with the new href and store the state + // Note that in some cases we might be replacing an url with the + // same url. We do this anyways because we need to make sure that + // all of our history entries have a state object associated with + // them. This allows us to work around the case where window.history.back() + // is called to transition from an external page to an embedded page. + // In that particular case, a hashchange event is *NOT* generated by the browser. + // Ensuring each history entry has a state object means that onPopState() + // will always trigger our hashchange callback even when a hashchange event + // is not fired. + history.replaceState( state, document.title, href ); + }, + + // on popstate (ie back or forward) we need to replace the hash that was there previously + // cleaned up by the additional hash handling + onPopState: function( e ) { + var poppedState = e.originalEvent.state, + timeout, fromHash, toHash, hashChanged; + + // if there's no state its not a popstate we care about, eg chrome's initial popstate + if( poppedState ) { + // the active url in the history stack will still be from the previous state + // so we can use it to verify if a hashchange will be fired from the popstate + fromHash = self.hashValueAfterReset( $.mobile.urlHistory.getActive().url ); + + // the hash stored in the state popped off the stack will be our currenturl or + // the url to which we wish to navigate + toHash = self.hashValueAfterReset( poppedState.hash.replace("#", "") ); + + // if the hashes of the urls are different we must assume that the browser + // will fire a hashchange + hashChanged = fromHash !== toHash; + + // unlock hash handling once the hashchange caused be the popstate has fired + if( hashChanged ) { + $win.one( "hashchange.pushstate", function() { + self.nextHashChangePrevented( false ); + }); + } + + // enable hash handling for the the _handleHashChange call + self.nextHashChangePrevented( false ); + + // change the page based on the hash + $.mobile._handleHashChange( poppedState.hash ); + + // only prevent another hash change handling if a hash change will be fired + // by the browser + if( hashChanged ) { + // disable hash handling until one of the above timers fires + self.nextHashChangePrevented( true ); + } + } + }, + + init: function() { + $win.bind( "hashchange", self.onHashChange ); + + // Handle popstate events the occur through history changes + $win.bind( "popstate", self.onPopState ); + + // if there's no hash, we need to replacestate for returning to home + if ( location.hash === "" ) { + history.replaceState( self.state(), document.title, location.href ); + } + } + }); + + $( function() { + if( $.mobile.pushStateEnabled && $.support.pushState ){ + pushStateHandler.init(); + } + }); +})( jQuery, this ); + +/* +* fallback transition for pop in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.pop = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slide in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +// Use the simultaneous transition handler for slide transitions +$.mobile.transitionHandlers.slide = $.mobile.transitionHandlers.simultaneous; + +// Set the slide transition's fallback to "fade" +$.mobile.transitionFallbacks.slide = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slidedown in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slidedown = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for slideup in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.slideup = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flip in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flip = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for flow in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.flow = "fade"; + +})( jQuery, this ); + +/* +* fallback transition for turn in non-3D supporting browsers (which tend to handle complex transitions poorly in general +*/ + +(function( $, window, undefined ) { + +$.mobile.transitionFallbacks.turn = "fade"; + +})( jQuery, this ); + +(function( $, undefined ) { + +$.mobile.page.prototype.options.degradeInputs = { + color: false, + date: false, + datetime: false, + "datetime-local": false, + email: false, + month: false, + number: false, + range: "number", + search: "text", + tel: false, + time: false, + url: false, + week: false +}; + + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + var page = $.mobile.closestPageData($(e.target)), options; + + if( !page ) { + return; + } + + options = page.options; + + // degrade inputs to avoid poorly implemented native functionality + $( e.target ).find( "input" ).not( page.keepNativeSelector() ).each(function() { + var $this = $( this ), + type = this.getAttribute( "type" ), + optType = options.degradeInputs[ type ] || "text"; + + if ( options.degradeInputs[ type ] ) { + var html = $( "<div>" ).html( $this.clone() ).html(), + // In IE browsers, the type sometimes doesn't exist in the cloned markup, so we replace the closing tag instead + hasType = html.indexOf( " type=" ) > -1, + findstr = hasType ? /\s+type=["']?\w+['"]?/ : /\/?>/, + repstr = " type=\"" + optType + "\" data-" + $.mobile.ns + "type=\"" + type + "\"" + ( hasType ? "" : ">" ); + + $this.replaceWith( html.replace( findstr, repstr ) ); + } + }); + +}); + +})( jQuery ); + +(function( $, window, undefined ) { + +$.widget( "mobile.dialog", $.mobile.widget, { + options: { + closeBtnText : "Close", + overlayTheme : "a", + initSelector : ":jqmData(role='dialog')" + }, + _create: function() { + var self = this, + $el = this.element, + headerCloseButton = $( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText + "</a>" ), + dialogWrap = $("<div/>", { + "role" : "dialog", + "class" : "ui-dialog-contain ui-corner-all ui-overlay-shadow" + }); + + $el.addClass( "ui-dialog ui-overlay-" + this.options.overlayTheme ); + + // Class the markup for dialog styling + // Set aria role + $el + .wrapInner( dialogWrap ) + .children() + .find( ":jqmData(role='header')" ) + .prepend( headerCloseButton ) + .end() + .children( ':first-child') + .addClass( "ui-corner-top" ) + .end() + .children( ":last-child" ) + .addClass( "ui-corner-bottom" ); + + // this must be an anonymous function so that select menu dialogs can replace + // the close method. This is a change from previously just defining data-rel=back + // on the button and letting nav handle it + // + // Use click rather than vclick in order to prevent the possibility of unintentionally + // reopening the dialog if the dialog opening item was directly under the close button. + headerCloseButton.bind( "click", function() { + self.close(); + }); + + /* bind events + - clicks and submits should use the closing transition that the dialog opened with + unless a data-transition is specified on the link/form + - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally + */ + $el.bind( "vclick submit", function( event ) { + var $target = $( event.target ).closest( event.type === "vclick" ? "a" : "form" ), + active; + + if ( $target.length && !$target.jqmData( "transition" ) ) { + + active = $.mobile.urlHistory.getActive() || {}; + + $target.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) ) + .attr( "data-" + $.mobile.ns + "direction", "reverse" ); + } + }) + .bind( "pagehide", function( e, ui ) { + $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass ); + }) + // Override the theme set by the page plugin on pageshow + .bind( "pagebeforeshow", function(){ + if( self.options.overlayTheme ){ + self.element + .page( "removeContainerBackground" ) + .page( "setContainerBackground", self.options.overlayTheme ); + } + }); + }, + + // Close method goes back in history + close: function() { + window.history.back(); + } +}); + +//auto self-init widgets +$( document ).delegate( $.mobile.dialog.prototype.options.initSelector, "pagecreate", function(){ + $.mobile.dialog.prototype.enhance( this ); +}); + +})( jQuery, this ); + +(function( $, undefined ) { + +$.fn.fieldcontain = function( options ) { + return this.addClass( "ui-field-contain ui-body ui-br" ); +}; + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='fieldcontain')", e.target ).jqmEnhanceable().fieldcontain(); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.grid = function( options ) { + return this.each(function() { + + var $this = $( this ), + o = $.extend({ + grid: null + },options), + $kids = $this.children(), + gridCols = {solo:1, a:2, b:3, c:4, d:5}, + grid = o.grid, + iterator; + + if ( !grid ) { + if ( $kids.length <= 5 ) { + for ( var letter in gridCols ) { + if ( gridCols[ letter ] === $kids.length ) { + grid = letter; + } + } + } else { + grid = "a"; + } + } + iterator = gridCols[grid]; + + $this.addClass( "ui-grid-" + grid ); + + $kids.filter( ":nth-child(" + iterator + "n+1)" ).addClass( "ui-block-a" ); + + if ( iterator > 1 ) { + $kids.filter( ":nth-child(" + iterator + "n+2)" ).addClass( "ui-block-b" ); + } + if ( iterator > 2 ) { + $kids.filter( ":nth-child(3n+3)" ).addClass( "ui-block-c" ); + } + if ( iterator > 3 ) { + $kids.filter( ":nth-child(4n+4)" ).addClass( "ui-block-d" ); + } + if ( iterator > 4 ) { + $kids.filter( ":nth-child(5n+5)" ).addClass( "ui-block-e" ); + } + }); +}; +})( jQuery ); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='nojs')", e.target ).addClass( "ui-nojs" ); + +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.fn.buttonMarkup = function( options ) { + var $workingSet = this; + + // Enforce options to be of type string + options = ( options && ( $.type( options ) == "object" ) )? options : {}; + for ( var i = 0; i < $workingSet.length; i++ ) { + var el = $workingSet.eq( i ), + e = el[ 0 ], + o = $.extend( {}, $.fn.buttonMarkup.defaults, { + icon: options.icon !== undefined ? options.icon : el.jqmData( "icon" ), + iconpos: options.iconpos !== undefined ? options.iconpos : el.jqmData( "iconpos" ), + theme: options.theme !== undefined ? options.theme : el.jqmData( "theme" ) || $.mobile.getInheritedTheme( el, "c" ), + inline: options.inline !== undefined ? options.inline : el.jqmData( "inline" ), + shadow: options.shadow !== undefined ? options.shadow : el.jqmData( "shadow" ), + corners: options.corners !== undefined ? options.corners : el.jqmData( "corners" ), + iconshadow: options.iconshadow !== undefined ? options.iconshadow : el.jqmData( "iconshadow" ), + mini: options.mini !== undefined ? options.mini : el.jqmData( "mini" ) + }, options ), + + // Classes Defined + innerClass = "ui-btn-inner", + textClass = "ui-btn-text", + buttonClass, iconClass, + // Button inner markup + buttonInner, + buttonText, + buttonIcon, + buttonElements; + + $.each(o, function(key, value) { + e.setAttribute( "data-" + $.mobile.ns + key, value ); + el.jqmData(key, value); + }); + + // Check if this element is already enhanced + buttonElements = $.data(((e.tagName === "INPUT" || e.tagName === "BUTTON") ? e.parentNode : e), "buttonElements"); + + if (buttonElements) { + e = buttonElements.outer; + el = $(e); + buttonInner = buttonElements.inner; + buttonText = buttonElements.text; + // We will recreate this icon below + $(buttonElements.icon).remove(); + buttonElements.icon = null; + } + else { + buttonInner = document.createElement( o.wrapperEls ); + buttonText = document.createElement( o.wrapperEls ); + } + buttonIcon = o.icon ? document.createElement( "span" ) : null; + + if ( attachEvents && !buttonElements) { + attachEvents(); + } + + // if not, try to find closest theme container + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( el, "c" ); + } + + buttonClass = "ui-btn ui-btn-up-" + o.theme; + buttonClass += o.inline ? " ui-btn-inline" : ""; + buttonClass += o.shadow ? " ui-shadow" : ""; + buttonClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.mini !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.mini ? " ui-mini" : " ui-fullsize"; + } + + if ( o.inline !== undefined ) { + // Used to control styling in headers/footers, where buttons default to `mini` style. + buttonClass += o.inline === false ? " ui-btn-block" : " ui-btn-inline"; + } + + + if ( o.icon ) { + o.icon = "ui-icon-" + o.icon; + o.iconpos = o.iconpos || "left"; + + iconClass = "ui-icon " + o.icon; + + if ( o.iconshadow ) { + iconClass += " ui-icon-shadow"; + } + } + + if ( o.iconpos ) { + buttonClass += " ui-btn-icon-" + o.iconpos; + + if ( o.iconpos == "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + } + + innerClass += o.corners ? " ui-btn-corner-all" : ""; + + if ( o.iconpos && o.iconpos === "notext" && !el.attr( "title" ) ) { + el.attr( "title", el.getEncodedText() ); + } + + if ( buttonElements ) { + el.removeClass( buttonElements.bcls || "" ); + } + el.removeClass( "ui-link" ).addClass( buttonClass ); + + buttonInner.className = innerClass; + + buttonText.className = textClass; + if ( !buttonElements ) { + buttonInner.appendChild( buttonText ); + } + if ( buttonIcon ) { + buttonIcon.className = iconClass; + if ( !(buttonElements && buttonElements.icon) ) { + buttonIcon.appendChild( document.createTextNode("\u00a0") ); + buttonInner.appendChild( buttonIcon ); + } + } + + while ( e.firstChild && !buttonElements) { + buttonText.appendChild( e.firstChild ); + } + + if ( !buttonElements ) { + e.appendChild( buttonInner ); + } + + // Assign a structure containing the elements of this button to the elements of this button. This + // will allow us to recognize this as an already-enhanced button in future calls to buttonMarkup(). + buttonElements = { + bcls : buttonClass, + outer : e, + inner : buttonInner, + text : buttonText, + icon : buttonIcon + }; + + $.data(e, 'buttonElements', buttonElements); + $.data(buttonInner, 'buttonElements', buttonElements); + $.data(buttonText, 'buttonElements', buttonElements); + if (buttonIcon) { + $.data(buttonIcon, 'buttonElements', buttonElements); + } + } + + return this; +}; + +$.fn.buttonMarkup.defaults = { + corners: true, + shadow: true, + iconshadow: true, + wrapperEls: "span" +}; + +function closestEnabledButton( element ) { + var cname; + + while ( element ) { + // Note that we check for typeof className below because the element we + // handed could be in an SVG DOM where className on SVG elements is defined to + // be of a different type (SVGAnimatedString). We only operate on HTML DOM + // elements, so we look for plain "string". + cname = ( typeof element.className === 'string' ) && (element.className + ' '); + if ( cname && cname.indexOf("ui-btn ") > -1 && cname.indexOf("ui-disabled ") < 0 ) { + break; + } + + element = element.parentNode; + } + + return element; +} + +var attachEvents = function() { + var hoverDelay = $.mobile.buttonMarkup.hoverDelay, hov, foc; + + $( document ).bind( { + "vmousedown vmousecancel vmouseup vmouseover vmouseout focus blur scrollstart": function( event ) { + var theme, + $btn = $( closestEnabledButton( event.target ) ), + evt = event.type; + + if ( $btn.length ) { + theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); + + if ( evt === "vmousedown" ) { + if ( $.support.touch ) { + hov = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); + } + } else if ( evt === "vmousecancel" || evt === "vmouseup" ) { + $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + } else if ( evt === "vmouseover" || evt === "focus" ) { + if ( $.support.touch ) { + foc = setTimeout(function() { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + }, hoverDelay ); + } else { + $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); + } + } else if ( evt === "vmouseout" || evt === "blur" || evt === "scrollstart" ) { + $btn.removeClass( "ui-btn-hover-" + theme + " ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); + if ( hov ) { + clearTimeout( hov ); + } + if ( foc ) { + clearTimeout( foc ); + } + } + } + }, + "focusin focus": function( event ){ + $( closestEnabledButton( event.target ) ).addClass( $.mobile.focusClass ); + }, + "focusout blur": function( event ){ + $( closestEnabledButton( event.target ) ).removeClass( $.mobile.focusClass ); + } + }); + + attachEvents = null; +}; + +//links in bars, or those with data-role become buttons +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + + $( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", e.target ) + .not( ".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')" ) + .buttonMarkup(); +}); + +})( jQuery ); + + +(function( $, undefined ) { + +$.mobile.page.prototype.options.backBtnText = "Back"; +$.mobile.page.prototype.options.addBackBtn = false; +$.mobile.page.prototype.options.backBtnTheme = null; +$.mobile.page.prototype.options.headerTheme = "a"; +$.mobile.page.prototype.options.footerTheme = "a"; +$.mobile.page.prototype.options.contentTheme = null; + +$( document ).delegate( ":jqmData(role='page'), :jqmData(role='dialog')", "pagecreate", function( e ) { + + var $page = $( this ), + o = $page.data( "page" ).options, + pageRole = $page.jqmData( "role" ), + pageTheme = o.theme; + + $( ":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", this ) + .jqmEnhanceable() + .each(function() { + + var $this = $( this ), + role = $this.jqmData( "role" ), + theme = $this.jqmData( "theme" ), + contentTheme = theme || o.contentTheme || ( pageRole === "dialog" && pageTheme ), + $headeranchors, + leftbtn, + rightbtn, + backBtn; + + $this.addClass( "ui-" + role ); + + //apply theming and markup modifications to page,header,content,footer + if ( role === "header" || role === "footer" ) { + + var thisTheme = theme || ( role === "header" ? o.headerTheme : o.footerTheme ) || pageTheme; + + $this + //add theme class + .addClass( "ui-bar-" + thisTheme ) + // Add ARIA role + .attr( "role", role === "header" ? "banner" : "contentinfo" ); + + if( role === "header") { + // Right,left buttons + $headeranchors = $this.children( "a" ); + leftbtn = $headeranchors.hasClass( "ui-btn-left" ); + rightbtn = $headeranchors.hasClass( "ui-btn-right" ); + + leftbtn = leftbtn || $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length; + + rightbtn = rightbtn || $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length; + } + + // Auto-add back btn on pages beyond first view + if ( o.addBackBtn && + role === "header" && + $( ".ui-page" ).length > 1 && + $page.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) && + !leftbtn ) { + + backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ) + // If theme is provided, override default inheritance + .attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme || thisTheme ) + .prependTo( $this ); + } + + // Page title + $this.children( "h1, h2, h3, h4, h5, h6" ) + .addClass( "ui-title" ) + // Regardless of h element number in src, it becomes h1 for the enhanced page + .attr({ + "role": "heading", + "aria-level": "1" + }); + + } else if ( role === "content" ) { + if ( contentTheme ) { + $this.addClass( "ui-body-" + ( contentTheme ) ); + } + + // Add ARIA role + $this.attr( "role", "main" ); + } + }); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsible", $.mobile.widget, { + options: { + expandCueText: " click to expand contents", + collapseCueText: " click to collapse contents", + collapsed: true, + heading: "h1,h2,h3,h4,h5,h6,legend", + theme: null, + contentTheme: null, + iconTheme: "d", + mini: false, + initSelector: ":jqmData(role='collapsible')" + }, + _create: function() { + + var $el = this.element, + o = this.options, + collapsible = $el.addClass( "ui-collapsible" ), + collapsibleHeading = $el.children( o.heading ).first(), + collapsibleContent = collapsible.wrapInner( "<div class='ui-collapsible-content'></div>" ).find( ".ui-collapsible-content" ), + collapsibleSet = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" ); + + // Replace collapsibleHeading if it's a legend + if ( collapsibleHeading.is( "legend" ) ) { + collapsibleHeading = $( "<div role='heading'>"+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading ); + collapsibleHeading.next().remove(); + } + + // If we are in a collapsible set + if ( collapsibleSet.length ) { + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = collapsibleSet.jqmData("theme") || $.mobile.getInheritedTheme( collapsibleSet, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = collapsibleSet.jqmData( "content-theme" ); + } + + // Gets the preference icon position in the set + if ( !o.iconPos ) { + o.iconPos = collapsibleSet.jqmData( "iconpos" ); + } + + if( !o.mini ) { + o.mini = collapsibleSet.jqmData( "mini" ); + } + } + collapsibleContent.addClass( ( o.contentTheme ) ? ( "ui-body-" + o.contentTheme ) : ""); + + collapsibleHeading + //drop heading in before content + .insertBefore( collapsibleContent ) + //modify markup & attributes + .addClass( "ui-collapsible-heading" ) + .append( "<span class='ui-collapsible-heading-status'></span>" ) + .wrapInner( "<a href='#' class='ui-collapsible-heading-toggle'></a>" ) + .find( "a" ) + .first() + .buttonMarkup({ + shadow: false, + corners: false, + iconpos: $el.jqmData( "iconpos" ) || o.iconPos || "left", + icon: "plus", + mini: o.mini, + theme: o.theme + }) + .add( ".ui-btn-inner", $el ) + .addClass( "ui-corner-top ui-corner-bottom" ); + + //events + collapsible + .bind( "expand collapse", function( event ) { + if ( !event.isDefaultPrevented() ) { + + event.preventDefault(); + + var $this = $( this ), + isCollapse = ( event.type === "collapse" ), + contentTheme = o.contentTheme; + + collapsibleHeading + .toggleClass( "ui-collapsible-heading-collapsed", isCollapse) + .find( ".ui-collapsible-heading-status" ) + .text( isCollapse ? o.expandCueText : o.collapseCueText ) + .end() + .find( ".ui-icon" ) + .toggleClass( "ui-icon-minus", !isCollapse ) + .toggleClass( "ui-icon-plus", isCollapse ); + + $this.toggleClass( "ui-collapsible-collapsed", isCollapse ); + collapsibleContent.toggleClass( "ui-collapsible-content-collapsed", isCollapse ).attr( "aria-hidden", isCollapse ); + + if ( contentTheme && ( !collapsibleSet.length || collapsible.jqmData( "collapsible-last" ) ) ) { + collapsibleHeading + .find( "a" ).first().add( collapsibleHeading.find( ".ui-btn-inner" ) ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsibleContent.toggleClass( "ui-corner-bottom", !isCollapse ); + } + collapsibleContent.trigger( "updatelayout" ); + } + }) + .trigger( o.collapsed ? "collapse" : "expand" ); + + collapsibleHeading + .bind( "click", function( event ) { + + var type = collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ? + "expand" : "collapse"; + + collapsible.trigger( type ); + + event.preventDefault(); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsible.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.collapsibleset", $.mobile.widget, { + options: { + initSelector: ":jqmData(role='collapsible-set')" + }, + _create: function() { + var $el = this.element.addClass( "ui-collapsible-set" ), + o = this.options; + + // Inherit the theme from collapsible-set + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( $el, "c" ); + } + // Inherit the content-theme from collapsible-set + if ( !o.contentTheme ) { + o.contentTheme = $el.jqmData( "content-theme" ); + } + + if ( !o.corners ) { + o.corners = $el.jqmData( "corners" ) === undefined ? true : false; + } + + // Initialize the collapsible set if it's not already initialized + if ( !$el.jqmData( "collapsiblebound" ) ) { + $el + .jqmData( "collapsiblebound", true ) + .bind( "expand collapse", function( event ) { + var isCollapse = ( event.type === "collapse" ), + collapsible = $( event.target ).closest( ".ui-collapsible" ), + widget = collapsible.data( "collapsible" ), + contentTheme = widget.options.contentTheme; + if ( contentTheme && collapsible.jqmData( "collapsible-last" ) ) { + collapsible.find( widget.options.heading ).first() + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .toggleClass( "ui-corner-bottom", isCollapse ); + collapsible.find( ".ui-collapsible-content" ).toggleClass( "ui-corner-bottom", !isCollapse ); + } + }) + .bind( "expand", function( event ) { + $( event.target ) + .closest( ".ui-collapsible" ) + .siblings( ".ui-collapsible" ) + .trigger( "collapse" ); + }); + } + }, + + _init: function() { + this.refresh(); + }, + + refresh: function() { + var $el = this.element, + o = this.options, + collapsiblesInSet = $el.children( ":jqmData(role='collapsible')" ); + + $.mobile.collapsible.prototype.enhance( collapsiblesInSet.not( ".ui-collapsible" ) ); + + // clean up borders + collapsiblesInSet.each( function() { + $( this ).find( $.mobile.collapsible.prototype.options.heading ) + .find( "a" ).first() + .add( ".ui-btn-inner" ) + .removeClass( "ui-corner-top ui-corner-bottom" ); + }); + + collapsiblesInSet.first() + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-top" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-top" ); + + collapsiblesInSet.last() + .jqmData( "collapsible-last", true ) + .find( "a" ) + .first() + .addClass( o.corners ? "ui-corner-bottom" : "" ) + .find( ".ui-btn-inner" ) + .addClass( "ui-corner-bottom" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.collapsibleset.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.navbar", $.mobile.widget, { + options: { + iconpos: "top", + grid: null, + initSelector: ":jqmData(role='navbar')" + }, + + _create: function(){ + + var $navbar = this.element, + $navbtns = $navbar.find( "a" ), + iconpos = $navbtns.filter( ":jqmData(icon)" ).length ? + this.options.iconpos : undefined; + + $navbar.addClass( "ui-navbar" ) + .attr( "role","navigation" ) + .find( "ul" ) + .jqmEnhanceable() + .grid({ grid: this.options.grid }); + + if ( !iconpos ) { + $navbar.addClass( "ui-navbar-noicons" ); + } + + $navbtns.buttonMarkup({ + corners: false, + shadow: false, + inline: true, + iconpos: iconpos + }); + + $navbar.delegate( "a", "vclick", function( event ) { + if( !$(event.target).hasClass("ui-disabled") ) { + $navbtns.removeClass( $.mobile.activeBtnClass ); + $( this ).addClass( $.mobile.activeBtnClass ); + } + }); + + // Buttons in the navbar with ui-state-persist class should regain their active state before page show + $navbar.closest( ".ui-page" ).bind( "pagebeforeshow", function() { + $navbtns.filter( ".ui-state-persist" ).addClass( $.mobile.activeBtnClass ); + }); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.navbar.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +//Keeps track of the number of lists per page UID +//This allows support for multiple nested list in the same page +//https://github.com/jquery/jquery-mobile/issues/1617 +var listCountPerPage = {}; + +$.widget( "mobile.listview", $.mobile.widget, { + + options: { + theme: null, + countTheme: "c", + headerTheme: "b", + dividerTheme: "b", + splitIcon: "arrow-r", + splitTheme: "b", + mini: false, + inset: false, + initSelector: ":jqmData(role='listview')" + }, + + _create: function() { + var t = this, + listviewClasses = ""; + + listviewClasses += t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : ""; + listviewClasses += t.element.jqmData( "mini" ) || t.options.mini === true ? " ui-mini" : ""; + + // create listview markup + t.element.addClass(function( i, orig ) { + return orig + " ui-listview " + listviewClasses; + }); + + t.refresh( true ); + }, + + _removeCorners: function( li, which ) { + var top = "ui-corner-top ui-corner-tr ui-corner-tl", + bot = "ui-corner-bottom ui-corner-br ui-corner-bl"; + + li = li.add( li.find( ".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb" ) ); + + if ( which === "top" ) { + li.removeClass( top ); + } else if ( which === "bottom" ) { + li.removeClass( bot ); + } else { + li.removeClass( top + " " + bot ); + } + }, + + _refreshCorners: function( create ) { + var $li, + $visibleli, + $topli, + $bottomli; + + if ( this.options.inset ) { + $li = this.element.children( "li" ); + // at create time the li are not visible yet so we need to rely on .ui-screen-hidden + $visibleli = create?$li.not( ".ui-screen-hidden" ):$li.filter( ":visible" ); + + this._removeCorners( $li ); + + // Select the first visible li element + $topli = $visibleli.first() + .addClass( "ui-corner-top" ); + + $topli.add( $topli.find( ".ui-btn-inner" ) + .not( ".ui-li-link-alt span:first-child" ) ) + .addClass( "ui-corner-top" ) + .end() + .find( ".ui-li-link-alt, .ui-li-link-alt span:first-child" ) + .addClass( "ui-corner-tr" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-tl" ); + + // Select the last visible li element + $bottomli = $visibleli.last() + .addClass( "ui-corner-bottom" ); + + $bottomli.add( $bottomli.find( ".ui-btn-inner" ) ) + .find( ".ui-li-link-alt" ) + .addClass( "ui-corner-br" ) + .end() + .find( ".ui-li-thumb" ) + .not(".ui-li-icon") + .addClass( "ui-corner-bl" ); + } + if ( !create ) { + this.element.trigger( "updatelayout" ); + } + }, + + // This is a generic utility method for finding the first + // node with a given nodeName. It uses basic DOM traversal + // to be fast and is meant to be a substitute for simple + // $.fn.closest() and $.fn.children() calls on a single + // element. Note that callers must pass both the lowerCase + // and upperCase version of the nodeName they are looking for. + // The main reason for this is that this function will be + // called many times and we want to avoid having to lowercase + // the nodeName from the element every time to ensure we have + // a match. Note that this function lives here for now, but may + // be moved into $.mobile if other components need a similar method. + _findFirstElementByTagName: function( ele, nextProp, lcName, ucName ) + { + var dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + return ele; + } + ele = ele[ nextProp ]; + } + return null; + }, + _getChildrenByTagName: function( ele, lcName, ucName ) + { + var results = [], + dict = {}; + dict[ lcName ] = dict[ ucName ] = true; + ele = ele.firstChild; + while ( ele ) { + if ( dict[ ele.nodeName ] ) { + results.push( ele ); + } + ele = ele.nextSibling; + } + return $( results ); + }, + + _addThumbClasses: function( containers ) + { + var i, img, len = containers.length; + for ( i = 0; i < len; i++ ) { + img = $( this._findFirstElementByTagName( containers[ i ].firstChild, "nextSibling", "img", "IMG" ) ); + if ( img.length ) { + img.addClass( "ui-li-thumb" ); + $( this._findFirstElementByTagName( img[ 0 ].parentNode, "parentNode", "li", "LI" ) ).addClass( img.is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" ); + } + } + }, + + refresh: function( create ) { + this.parentPage = this.element.closest( ".ui-page" ); + this._createSubPages(); + + var o = this.options, + $list = this.element, + self = this, + dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme, + listsplittheme = $list.jqmData( "splittheme" ), + listspliticon = $list.jqmData( "spliticon" ), + li = this._getChildrenByTagName( $list[ 0 ], "li", "LI" ), + counter = $.support.cssPseudoElement || !$.nodeName( $list[ 0 ], "ol" ) ? 0 : 1, + itemClassDict = {}, + item, itemClass, itemTheme, + a, last, splittheme, countParent, icon, imgParents, img, linkIcon; + + if ( counter ) { + $list.find( ".ui-li-dec" ).remove(); + } + + if ( !o.theme ) { + o.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + for ( var pos = 0, numli = li.length; pos < numli; pos++ ) { + item = li.eq( pos ); + itemClass = "ui-li"; + + // If we're creating the element, we update it regardless + if ( create || !item.hasClass( "ui-li" ) ) { + itemTheme = item.jqmData("theme") || o.theme; + a = this._getChildrenByTagName( item[ 0 ], "a", "A" ); + + if ( a.length ) { + icon = item.jqmData("icon"); + + item.buttonMarkup({ + wrapperEls: "div", + shadow: false, + corners: false, + iconpos: "right", + icon: a.length > 1 || icon === false ? false : icon || "arrow-r", + theme: itemTheme + }); + + if ( ( icon != false ) && ( a.length == 1 ) ) { + item.addClass( "ui-li-has-arrow" ); + } + + a.first().removeClass( "ui-link" ).addClass( "ui-link-inherit" ); + + if ( a.length > 1 ) { + itemClass += " ui-li-has-alt"; + + last = a.last(); + splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme; + linkIcon = last.jqmData("icon"); + + last.appendTo(item) + .attr( "title", last.getEncodedText() ) + .addClass( "ui-li-link-alt" ) + .empty() + .buttonMarkup({ + shadow: false, + corners: false, + theme: itemTheme, + icon: false, + iconpos: false + }) + .find( ".ui-btn-inner" ) + .append( + $( document.createElement( "span" ) ).buttonMarkup({ + shadow: true, + corners: true, + theme: splittheme, + iconpos: "notext", + // link icon overrides list item icon overrides ul element overrides options + icon: linkIcon || icon || listspliticon || o.splitIcon + }) + ); + } + } else if ( item.jqmData( "role" ) === "list-divider" ) { + + itemClass += " ui-li-divider ui-bar-" + dividertheme; + item.attr( "role", "heading" ); + + //reset counter when a divider heading is encountered + if ( counter ) { + counter = 1; + } + + } else { + itemClass += " ui-li-static ui-body-" + itemTheme; + } + } + + if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) { + countParent = item.is( ".ui-li-static:first" ) ? item : item.find( ".ui-link-inherit" ); + + countParent.addClass( "ui-li-jsnumbering" ) + .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" ); + } + + // Instead of setting item class directly on the list item and its + // btn-inner at this point in time, push the item into a dictionary + // that tells us what class to set on it so we can do this after this + // processing loop is finished. + + if ( !itemClassDict[ itemClass ] ) { + itemClassDict[ itemClass ] = []; + } + + itemClassDict[ itemClass ].push( item[ 0 ] ); + } + + // Set the appropriate listview item classes on each list item + // and their btn-inner elements. The main reason we didn't do this + // in the for-loop above is because we can eliminate per-item function overhead + // by calling addClass() and children() once or twice afterwards. This + // can give us a significant boost on platforms like WP7.5. + + for ( itemClass in itemClassDict ) { + $( itemClassDict[ itemClass ] ).addClass( itemClass ).children( ".ui-btn-inner" ).addClass( itemClass ); + } + + $list.find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ) + .end() + + .find( "p, dl" ).addClass( "ui-li-desc" ) + .end() + + .find( ".ui-li-aside" ).each(function() { + var $this = $(this); + $this.prependTo( $this.parent() ); //shift aside to front for css float + }) + .end() + + .find( ".ui-li-count" ).each( function() { + $( this ).closest( "li" ).addClass( "ui-li-has-count" ); + }).addClass( "ui-btn-up-" + ( $list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ); + + // The idea here is to look at the first image in the list item + // itself, and any .ui-link-inherit element it may contain, so we + // can place the appropriate classes on the image and list item. + // Note that we used to use something like: + // + // li.find(">img:eq(0), .ui-link-inherit>img:eq(0)").each( ... ); + // + // But executing a find() like that on Windows Phone 7.5 took a + // really long time. Walking things manually with the code below + // allows the 400 listview item page to load in about 3 seconds as + // opposed to 30 seconds. + + this._addThumbClasses( li ); + this._addThumbClasses( $list.find( ".ui-link-inherit" ) ); + + this._refreshCorners( create ); + }, + + //create a string for ID/subpage url creation + _idStringEscape: function( str ) { + return str.replace(/[^a-zA-Z0-9]/g, '-'); + }, + + _createSubPages: function() { + var parentList = this.element, + parentPage = parentList.closest( ".ui-page" ), + parentUrl = parentPage.jqmData( "url" ), + parentId = parentUrl || parentPage[ 0 ][ $.expando ], + parentListId = parentList.attr( "id" ), + o = this.options, + dns = "data-" + $.mobile.ns, + self = this, + persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ), + hasSubPages; + + if ( typeof listCountPerPage[ parentId ] === "undefined" ) { + listCountPerPage[ parentId ] = -1; + } + + parentListId = parentListId || ++listCountPerPage[ parentId ]; + + $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) { + var self = this, + list = $( this ), + listId = list.attr( "id" ) || parentListId + "-" + i, + parent = list.parent(), + nodeEls = $( list.prevAll().toArray().reverse() ), + nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ), + title = nodeEls.first().getEncodedText(),//url limits to first 30 chars of text + id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId, + theme = list.jqmData( "theme" ) || o.theme, + countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme, + newPage, anchor; + + //define hasSubPages for use in later removal + hasSubPages = true; + + newPage = list.detach() + .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" ) + .parent() + .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" ) + .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" ) + .parent() + .appendTo( $.mobile.pageContainer ); + + newPage.page(); + + anchor = parent.find('a:first'); + + if ( !anchor.length ) { + anchor = $( "<a/>" ).html( nodeEls || title ).prependTo( parent.empty() ); + } + + anchor.attr( "href", "#" + id ); + + }).listview(); + + // on pagehide, remove any nested pages along with the parent page, as long as they aren't active + // and aren't embedded + if( hasSubPages && + parentPage.is( ":jqmData(external-page='true')" ) && + parentPage.data("page").options.domCache === false ) { + + var newRemove = function( e, ui ){ + var nextPage = ui.nextPage, npURL; + + if( ui.nextPage ){ + npURL = nextPage.jqmData( "url" ); + if( npURL.indexOf( parentUrl + "&" + $.mobile.subPageUrlKey ) !== 0 ){ + self.childPages().remove(); + parentPage.remove(); + } + } + }; + + // unbind the original page remove and replace with our specialized version + parentPage + .unbind( "pagehide.remove" ) + .bind( "pagehide.remove", newRemove); + } + }, + + // TODO sort out a better way to track sub pages of the listview this is brittle + childPages: function(){ + var parentUrl = this.parentPage.jqmData( "url" ); + + return $( ":jqmData(url^='"+ parentUrl + "&" + $.mobile.subPageUrlKey +"')"); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.listview.prototype.enhanceWithin( e.target ); +}); + +})( jQuery ); + +/* +* "checkboxradio" plugin +*/ + +(function( $, undefined ) { + +$.widget( "mobile.checkboxradio", $.mobile.widget, { + options: { + theme: null, + initSelector: "input[type='checkbox'],input[type='radio']" + }, + _create: function() { + var self = this, + input = this.element, + inheritAttr = function( input, dataAttr ) { + return input.jqmData( dataAttr ) || input.closest( "form,fieldset" ).jqmData( dataAttr ) + }, + // NOTE: Windows Phone could not find the label through a selector + // filter works though. + parentLabel = $( input ).closest( "label" ), + label = parentLabel.length ? parentLabel : $( input ).closest( "form,fieldset,:jqmData(role='page'),:jqmData(role='dialog')" ).find( "label" ).filter( "[for='" + input[0].id + "']" ), + inputtype = input[0].type, + mini = inheritAttr( input, "mini" ), + checkedState = inputtype + "-on", + uncheckedState = inputtype + "-off", + icon = input.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedState, + iconpos = inheritAttr( input, "iconpos" ), + activeBtn = icon ? "" : " " + $.mobile.activeBtnClass, + checkedClass = "ui-" + checkedState + activeBtn, + uncheckedClass = "ui-" + uncheckedState, + checkedicon = "ui-icon-" + checkedState, + uncheckedicon = "ui-icon-" + uncheckedState; + + if ( inputtype !== "checkbox" && inputtype !== "radio" ) { + return; + } + + // Expose for other methods + $.extend( this, { + label: label, + inputtype: inputtype, + checkedClass: checkedClass, + uncheckedClass: uncheckedClass, + checkedicon: checkedicon, + uncheckedicon: uncheckedicon + }); + + // If there's no selected theme check the data attr + if( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + label.buttonMarkup({ + theme: this.options.theme, + icon: icon, + shadow: false, + mini: mini, + iconpos: iconpos + }); + + // Wrap the input + label in a div + var wrapper = document.createElement('div'); + wrapper.className = 'ui-' + inputtype; + + input.add( label ).wrapAll( wrapper ); + + label.bind({ + vmouseover: function( event ) { + if ( $( this ).parent().is( ".ui-disabled" ) ) { + event.stopPropagation(); + } + }, + + vclick: function( event ) { + if ( input.is( ":disabled" ) ) { + event.preventDefault(); + return; + } + + self._cacheVals(); + + input.prop( "checked", inputtype === "radio" && true || !input.prop( "checked" ) ); + + // trigger click handler's bound directly to the input as a substitute for + // how label clicks behave normally in the browsers + // TODO: it would be nice to let the browser's handle the clicks and pass them + // through to the associate input. we can swallow that click at the parent + // wrapper element level + input.triggerHandler( 'click' ); + + // Input set for common radio buttons will contain all the radio + // buttons, but will not for checkboxes. clearing the checked status + // of other radios ensures the active button state is applied properly + self._getInputSet().not( input ).prop( "checked", false ); + + self._updateAll(); + return false; + } + }); + + input + .bind({ + vmousedown: function() { + self._cacheVals(); + }, + + vclick: function() { + var $this = $(this); + + // Adds checked attribute to checked input when keyboard is used + if ( $this.is( ":checked" ) ) { + + $this.prop( "checked", true); + self._getInputSet().not($this).prop( "checked", false ); + } else { + + $this.prop( "checked", false ); + } + + self._updateAll(); + }, + + focus: function() { + label.addClass( $.mobile.focusClass ); + }, + + blur: function() { + label.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + _cacheVals: function() { + this._getInputSet().each(function() { + $(this).jqmData( "cacheVal", this.checked ); + }); + }, + + //returns either a set of radios with the same name attribute, or a single checkbox + _getInputSet: function(){ + if(this.inputtype === "checkbox") { + return this.element; + } + + return this.element.closest( "form,fieldset,:jqmData(role='page')" ) + .find( "input[name='"+ this.element[0].name +"'][type='"+ this.inputtype +"']" ); + }, + + _updateAll: function() { + var self = this; + + this._getInputSet().each(function() { + var $this = $(this); + + if ( this.checked || self.inputtype === "checkbox" ) { + $this.trigger( "change" ); + } + }) + .checkboxradio( "refresh" ); + }, + + refresh: function() { + var input = this.element[0], + label = this.label, + icon = label.find( ".ui-icon" ); + + if ( input.checked ) { + label.addClass( this.checkedClass ).removeClass( this.uncheckedClass ); + icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon ); + } else { + label.removeClass( this.checkedClass ).addClass( this.uncheckedClass ); + icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon ); + } + + if ( input.disabled ) { + this.disable(); + } else { + this.enable(); + } + }, + + disable: function() { + this.element.prop( "disabled", true ).parent().addClass( "ui-disabled" ); + }, + + enable: function() { + this.element.prop( "disabled", false ).parent().removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.checkboxradio.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.button", $.mobile.widget, { + options: { + theme: null, + icon: null, + iconpos: null, + inline: false, + corners: true, + shadow: true, + iconshadow: true, + initSelector: "button, [type='button'], [type='submit'], [type='reset'], [type='image']", + mini: false + }, + _create: function() { + var $el = this.element, + $button, + o = this.options, + type, + name, + classes = "", + $buttonPlaceholder; + + // if this is a link, check if it's been enhanced and, if not, use the right function + if( $el[ 0 ].tagName === "A" ) { + !$el.hasClass( "ui-btn" ) && $el.buttonMarkup(); + return; + } + + // get the inherited theme + // TODO centralize for all widgets + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.element, "c" ); + } + + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~$el[0].className.indexOf( "ui-btn-left" ) ) { + classes = "ui-btn-left"; + } + + if( !!~$el[0].className.indexOf( "ui-btn-right" ) ) { + classes = "ui-btn-right"; + } + + // Add ARIA role + this.button = $( "<div></div>" ) + .text( $el.text() || $el.val() ) + .insertBefore( $el ) + .buttonMarkup({ + theme: o.theme, + icon: o.icon, + iconpos: o.iconpos, + inline: o.inline, + corners: o.corners, + shadow: o.shadow, + iconshadow: o.iconshadow, + mini: o.mini + }) + .addClass( classes ) + .append( $el.addClass( "ui-btn-hidden" ) ); + + $button = this.button; + type = $el.attr( "type" ); + name = $el.attr( "name" ); + + // Add hidden input during submit if input type="submit" has a name. + if ( type !== "button" && type !== "reset" && name ) { + $el.bind( "vclick", function() { + // Add hidden input if it doesn’t already exist. + if( $buttonPlaceholder === undefined ) { + $buttonPlaceholder = $( "<input>", { + type: "hidden", + name: $el.attr( "name" ), + value: $el.attr( "value" ) + }).insertBefore( $el ); + + // Bind to doc to remove after submit handling + $( document ).one("submit", function(){ + $buttonPlaceholder.remove(); + + // reset the local var so that the hidden input + // will be re-added on subsequent clicks + $buttonPlaceholder = undefined; + }); + } + }); + } + + $el.bind({ + focus: function() { + $button.addClass( $.mobile.focusClass ); + }, + + blur: function() { + $button.removeClass( $.mobile.focusClass ); + } + }); + + this.refresh(); + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + }, + + refresh: function() { + var $el = this.element; + + if ( $el.prop("disabled") ) { + this.disable(); + } else { + this.enable(); + } + + // Grab the button's text element from its implementation-independent data item + $( this.button.data( 'buttonElements' ).text ).text( $el.text() || $el.val() ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.button.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.fn.controlgroup = function( options ) { + function flipClasses( els, flCorners ) { + els.removeClass( "ui-btn-corner-all ui-shadow" ) + .eq( 0 ).addClass( flCorners[ 0 ] ) + .end() + .last().addClass( flCorners[ 1 ] ).addClass( "ui-controlgroup-last" ); + } + + return this.each(function() { + var $el = $( this ), + o = $.extend({ + direction: $el.jqmData( "type" ) || "vertical", + shadow: false, + excludeInvisible: true, + mini: $el.jqmData( "mini" ) + }, options ), + groupheading = $el.children( "legend" ), + flCorners = o.direction == "horizontal" ? [ "ui-corner-left", "ui-corner-right" ] : [ "ui-corner-top", "ui-corner-bottom" ], + type = $el.find( "input" ).first().attr( "type" ); + + // Replace legend with more stylable replacement div + if ( groupheading.length ) { + $el.wrapInner( "<div class='ui-controlgroup-controls'></div>" ); + $( "<div role='heading' class='ui-controlgroup-label'>" + groupheading.html() + "</div>" ).insertBefore( $el.children(0) ); + groupheading.remove(); + } + + $el.addClass( "ui-corner-all ui-controlgroup ui-controlgroup-" + o.direction ); + + flipClasses( $el.find( ".ui-btn" + ( o.excludeInvisible ? ":visible" : "" ) ).not('.ui-slider-handle'), flCorners ); + flipClasses( $el.find( ".ui-btn-inner" ), flCorners ); + + if ( o.shadow ) { + $el.addClass( "ui-shadow" ); + } + + if ( o.mini ) { + $el.addClass( "ui-mini" ); + } + + }); +}; + +// The pagecreate handler for controlgroup is in jquery.mobile.init because of the soft-dependency on the wrapped widgets + +})(jQuery); + +(function( $, undefined ) { + +$( document ).bind( "pagecreate create", function( e ){ + + //links within content areas, tests included with page + $( e.target ) + .find( "a" ) + .jqmEnhanceable() + .not( ".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')" ) + .addClass( "ui-link" ); + +}); + +})( jQuery ); + + +( function( $ ) { + var meta = $( "meta[name=viewport]" ), + initialContent = meta.attr( "content" ), + disabledZoom = initialContent + ",maximum-scale=1, user-scalable=no", + enabledZoom = initialContent + ",maximum-scale=10, user-scalable=yes", + disabledInitially = /(user-scalable[\s]*=[\s]*no)|(maximum-scale[\s]*=[\s]*1)[$,\s]/.test( initialContent ); + + $.mobile.zoom = $.extend( {}, { + enabled: !disabledInitially, + locked: false, + disable: function( lock ) { + if( !disabledInitially && !$.mobile.zoom.locked ){ + meta.attr( "content", disabledZoom ); + $.mobile.zoom.enabled = false; + $.mobile.zoom.locked = lock || false; + } + }, + enable: function( unlock ) { + if( !disabledInitially && ( !$.mobile.zoom.locked || unlock === true ) ){ + meta.attr( "content", enabledZoom ); + $.mobile.zoom.enabled = true; + $.mobile.zoom.locked = false; + } + }, + restore: function() { + if( !disabledInitially ){ + meta.attr( "content", initialContent ); + $.mobile.zoom.enabled = true; + } + } + }); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "mobile.textinput", $.mobile.widget, { + options: { + theme: null, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea, input[type='time'], input[type='date'], input[type='month'], input[type='week'], input[type='datetime'], input[type='datetime-local'], input[type='color'], input:not([type])", + clearSearchButtonText: "clear text" + }, + + _create: function() { + + var input = this.element, + o = this.options, + theme = o.theme || $.mobile.getInheritedTheme( this.element, "c" ), + themeclass = " ui-body-" + theme, + mini = input.jqmData("mini") == true, + miniclass = mini ? " ui-mini" : "", + focusedEl, clearbtn; + + $( "label[for='" + input.attr( "id" ) + "']" ).addClass( "ui-input-text" ); + + focusedEl = input.addClass("ui-input-text ui-body-"+ theme ); + + // XXX: Temporary workaround for issue 785 (Apple bug 8910589). + // Turn off autocorrect and autocomplete on non-iOS 5 devices + // since the popup they use can't be dismissed by the user. Note + // that we test for the presence of the feature by looking for + // the autocorrect property on the input element. We currently + // have no test for iOS 5 or newer so we're temporarily using + // the touchOverflow support flag for jQM 1.0. Yes, I feel dirty. - jblas + if ( typeof input[0].autocorrect !== "undefined" && !$.support.touchOverflow ) { + // Set the attribute instead of the property just in case there + // is code that attempts to make modifications via HTML. + input[0].setAttribute( "autocorrect", "off" ); + input[0].setAttribute( "autocomplete", "off" ); + } + + + //"search" input widget + if ( input.is( "[type='search'],:jqmData(type='search')" ) ) { + + focusedEl = input.wrap( "<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield" + themeclass + miniclass + "'></div>" ).parent(); + clearbtn = $( "<a href='#' class='ui-input-clear' title='" + o.clearSearchButtonText + "'>" + o.clearSearchButtonText + "</a>" ) + .bind('click', function( event ) { + input + .val( "" ) + .focus() + .trigger( "change" ); + clearbtn.addClass( "ui-input-clear-hidden" ); + event.preventDefault(); + }) + .appendTo( focusedEl ) + .buttonMarkup({ + icon: "delete", + iconpos: "notext", + corners: true, + shadow: true, + mini: mini + }); + + function toggleClear() { + setTimeout(function() { + clearbtn.toggleClass( "ui-input-clear-hidden", !input.val() ); + }, 0); + } + + toggleClear(); + + input.bind('paste cut keyup focus change blur', toggleClear); + + } else { + input.addClass( "ui-corner-all ui-shadow-inset" + themeclass + miniclass ); + } + + input.focus(function() { + focusedEl.addClass( $.mobile.focusClass ); + }) + .blur(function(){ + focusedEl.removeClass( $.mobile.focusClass ); + }) + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + .bind( "focus", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "blur", function() { + if( o.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + + // Autogrow + if ( input.is( "textarea" ) ) { + var extraLineHeight = 15, + keyupTimeoutBuffer = 100, + keyup = function() { + var scrollHeight = input[ 0 ].scrollHeight, + clientHeight = input[ 0 ].clientHeight; + + if ( clientHeight < scrollHeight ) { + input.height(scrollHeight + extraLineHeight); + } + }, + keyupTimeout; + + input.keyup(function() { + clearTimeout( keyupTimeout ); + keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer ); + }); + + // binding to pagechange here ensures that for pages loaded via + // ajax the height is recalculated without user input + $( document ).one( "pagechange", keyup ); + + // Issue 509: the browser is not providing scrollHeight properly until the styles load + if ( $.trim( input.val() ) ) { + // bind to the window load to make sure the height is calculated based on BOTH + // the DOM and CSS + $( window ).load( keyup ); + } + } + }, + + disable: function(){ + ( this.element.attr( "disabled", true ).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).addClass( "ui-disabled" ); + }, + + enable: function(){ + ( this.element.attr( "disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? + this.element.parent() : this.element ).removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.textinput.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.mobile.listview.prototype.options.filter = false; +$.mobile.listview.prototype.options.filterPlaceholder = "Filter items..."; +$.mobile.listview.prototype.options.filterTheme = "c"; +$.mobile.listview.prototype.options.filterCallback = function( text, searchValue ){ + return text.toLowerCase().indexOf( searchValue ) === -1; +}; + +$( document ).delegate( ":jqmData(role='listview')", "listviewcreate", function() { + + var list = $( this ), + listview = list.data( "listview" ); + + if ( !listview.options.filter ) { + return; + } + + var wrapper = $( "<form>", { + "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, + "role": "search" + }), + search = $( "<input>", { + placeholder: listview.options.filterPlaceholder + }) + .attr( "data-" + $.mobile.ns + "type", "search" ) + .jqmData( "lastval", "" ) + .bind( "keyup change", function() { + + var $this = $(this), + val = this.value.toLowerCase(), + listItems = null, + lastval = $this.jqmData( "lastval" ) + "", + childItems = false, + itemtext = "", + item; + + // Change val as lastval for next execution + $this.jqmData( "lastval" , val ); + if ( val.length < lastval.length || val.indexOf(lastval) !== 0 ) { + + // Removed chars or pasted something totally different, check all items + listItems = list.children(); + } else { + + // Only chars added, not removed, only use visible subset + listItems = list.children( ":not(.ui-screen-hidden)" ); + } + + if ( val ) { + + // This handles hiding regular rows without the text we search for + // and any list dividers without regular rows shown under it + + for ( var i = listItems.length - 1; i >= 0; i-- ) { + item = $( listItems[ i ] ); + itemtext = item.jqmData( "filtertext" ) || item.text(); + + if ( item.is( "li:jqmData(role=list-divider)" ) ) { + + item.toggleClass( "ui-filter-hidequeue" , !childItems ); + + // New bucket! + childItems = false; + + } else if ( listview.options.filterCallback( itemtext, val ) ) { + + //mark to be hidden + item.toggleClass( "ui-filter-hidequeue" , true ); + } else { + + // There's a shown item in the bucket + childItems = true; + } + } + + // Show items, not marked to be hidden + listItems + .filter( ":not(.ui-filter-hidequeue)" ) + .toggleClass( "ui-screen-hidden", false ); + + // Hide items, marked to be hidden + listItems + .filter( ".ui-filter-hidequeue" ) + .toggleClass( "ui-screen-hidden", true ) + .toggleClass( "ui-filter-hidequeue", false ); + + } else { + + //filtervalue is empty => show all + listItems.toggleClass( "ui-screen-hidden", false ); + } + listview._refreshCorners(); + }) + .appendTo( wrapper ) + .textinput(); + + if ( listview.options.inset ) { + wrapper.addClass( "ui-listview-filter-inset" ); + } + + wrapper.bind( "submit", function() { + return false; + }) + .insertBefore( list ); +}); + +})( jQuery ); + +( function( $, undefined ) { + +$.widget( "mobile.slider", $.mobile.widget, { + options: { + theme: null, + trackTheme: null, + disabled: false, + initSelector: "input[type='range'], :jqmData(type='range'), :jqmData(role='slider')", + mini: false + }, + + _create: function() { + + // TODO: Each of these should have comments explain what they're for + var self = this, + + control = this.element, + + parentTheme = $.mobile.getInheritedTheme( control, "c" ), + + theme = this.options.theme || parentTheme, + + trackTheme = this.options.trackTheme || parentTheme, + + cType = control[ 0 ].nodeName.toLowerCase(), + + selectClass = ( cType == "select" ) ? "ui-slider-switch" : "", + + controlID = control.attr( "id" ), + + labelID = controlID + "-label", + + label = $( "[for='"+ controlID +"']" ).attr( "id", labelID ), + + val = function() { + return cType == "input" ? parseFloat( control.val() ) : control[0].selectedIndex; + }, + + min = cType == "input" ? parseFloat( control.attr( "min" ) ) : 0, + + max = cType == "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length-1, + + step = window.parseFloat( control.attr( "step" ) || 1 ), + + inlineClass = ( this.options.inline || control.jqmData("inline") == true ) ? " ui-slider-inline" : "", + + miniClass = ( this.options.mini || control.jqmData("mini") ) ? " ui-slider-mini" : "", + + + domHandle = document.createElement('a'), + handle = $( domHandle ), + domSlider = document.createElement('div'), + slider = $( domSlider ), + + valuebg = control.jqmData("highlight") && cType != "select" ? (function() { + var bg = document.createElement('div'); + bg.className = 'ui-slider-bg ui-btn-active ui-btn-corner-all'; + return $( bg ).prependTo( slider ); + })() : false, + + options; + + domHandle.setAttribute( 'href', "#" ); + domSlider.setAttribute('role','application'); + domSlider.className = ['ui-slider ',selectClass," ui-btn-down-",trackTheme,' ui-btn-corner-all', inlineClass, miniClass].join(""); + domHandle.className = 'ui-slider-handle'; + domSlider.appendChild(domHandle); + + handle.buttonMarkup({ corners: true, theme: theme, shadow: true }) + .attr({ + "role": "slider", + "aria-valuemin": min, + "aria-valuemax": max, + "aria-valuenow": val(), + "aria-valuetext": val(), + "title": val(), + "aria-labelledby": labelID + }); + + $.extend( this, { + slider: slider, + handle: handle, + valuebg: valuebg, + dragging: false, + beforeStart: null, + userModified: false, + mouseMoved: false + }); + + if ( cType == "select" ) { + var wrapper = document.createElement('div'); + wrapper.className = 'ui-slider-inneroffset'; + + for(var j = 0,length = domSlider.childNodes.length;j < length;j++){ + wrapper.appendChild(domSlider.childNodes[j]); + } + + domSlider.appendChild(wrapper); + + // slider.wrapInner( "<div class='ui-slider-inneroffset'></div>" ); + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + options = control.find( "option" ); + + for(var i = 0, optionsCount = options.length; i < optionsCount; i++){ + var side = !i ? "b":"a", + sliderTheme = !i ? " ui-btn-down-" + trackTheme :( " " + $.mobile.activeBtnClass ), + sliderLabel = document.createElement('div'), + sliderImg = document.createElement('span'); + + sliderImg.className = ['ui-slider-label ui-slider-label-',side,sliderTheme," ui-btn-corner-all"].join(""); + sliderImg.setAttribute('role','img'); + sliderImg.appendChild(document.createTextNode(options[i].innerHTML)); + $(sliderImg).prependTo( slider ); + } + + self._labels = $( ".ui-slider-label", slider ); + + } + + label.addClass( "ui-slider" ); + + // monitor the input for updated values + control.addClass( cType === "input" ? "ui-slider-input" : "ui-slider-switch" ) + .change( function() { + // if the user dragged the handle, the "change" event was triggered from inside refresh(); don't call refresh() again + if (!self.mouseMoved) { + self.refresh( val(), true ); + } + }) + .keyup( function() { // necessary? + self.refresh( val(), true, true ); + }) + .blur( function() { + self.refresh( val(), true ); + }); + + // prevent screen drag when slider activated + $( document ).bind( "vmousemove", function( event ) { + if ( self.dragging ) { + // self.mouseMoved must be updated before refresh() because it will be used in the control "change" event + self.mouseMoved = true; + + if ( cType === "select" ) { + // make the handle move in sync with the mouse + handle.removeClass( "ui-slider-handle-snapping" ); + } + + self.refresh( event ); + + // only after refresh() you can calculate self.userModified + self.userModified = self.beforeStart !== control[0].selectedIndex; + return false; + } + }); + + slider.bind( "vmousedown", function( event ) { + self.dragging = true; + self.userModified = false; + self.mouseMoved = false; + + if ( cType === "select" ) { + self.beforeStart = control[0].selectedIndex; + } + + self.refresh( event ); + return false; + }) + .bind( "vclick", false ); + + slider.add( document ) + .bind( "vmouseup", function() { + if ( self.dragging ) { + + self.dragging = false; + + if ( cType === "select") { + + // make the handle move with a smooth transition + handle.addClass( "ui-slider-handle-snapping" ); + + if ( self.mouseMoved ) { + + // this is a drag, change the value only if user dragged enough + if ( self.userModified ) { + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + else { + self.refresh( self.beforeStart ); + } + + } + else { + // this is just a click, change the value + self.refresh( self.beforeStart == 0 ? 1 : 0 ); + } + + } + + self.mouseMoved = false; + + return false; + } + }); + + slider.insertAfter( control ); + + // Only add focus class to toggle switch, sliders get it automatically from ui-btn + if( cType == 'select' ) { + this.handle.bind({ + focus: function() { + slider.addClass( $.mobile.focusClass ); + }, + + blur: function() { + slider.removeClass( $.mobile.focusClass ); + } + }); + } + + this.handle.bind({ + // NOTE force focus on handle + vmousedown: function() { + $( this ).focus(); + }, + + vclick: false, + + keydown: function( event ) { + var index = val(); + + if ( self.options.disabled ) { + return; + } + + // In all cases prevent the default and mark the handle as active + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + case $.mobile.keyCode.END: + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + event.preventDefault(); + + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + } + break; + } + + // move the slider according to the keypress + switch ( event.keyCode ) { + case $.mobile.keyCode.HOME: + self.refresh( min ); + break; + case $.mobile.keyCode.END: + self.refresh( max ); + break; + case $.mobile.keyCode.PAGE_UP: + case $.mobile.keyCode.UP: + case $.mobile.keyCode.RIGHT: + self.refresh( index + step ); + break; + case $.mobile.keyCode.PAGE_DOWN: + case $.mobile.keyCode.DOWN: + case $.mobile.keyCode.LEFT: + self.refresh( index - step ); + break; + } + }, // remove active mark + + keyup: function( event ) { + if ( self._keySliding ) { + self._keySliding = false; + $( this ).removeClass( "ui-state-active" ); + } + } + }); + + this.refresh(undefined, undefined, true); + }, + + refresh: function( val, isfromControl, preventInputUpdate ) { + + if ( this.options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + var control = this.element, percent, + cType = control[0].nodeName.toLowerCase(), + min = cType === "input" ? parseFloat( control.attr( "min" ) ) : 0, + max = cType === "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length - 1, + step = (cType === "input" && parseFloat( control.attr( "step" ) ) > 0) ? parseFloat(control.attr("step")) : 1; + + if ( typeof val === "object" ) { + var data = val, + // a slight tolerance helped get to the ends of the slider + tol = 8; + if ( !this.dragging || + data.pageX < this.slider.offset().left - tol || + data.pageX > this.slider.offset().left + this.slider.width() + tol ) { + return; + } + percent = Math.round( ( ( data.pageX - this.slider.offset().left ) / this.slider.width() ) * 100 ); + } else { + if ( val == null ) { + val = cType === "input" ? parseFloat( control.val() || 0 ) : control[0].selectedIndex; + } + percent = ( parseFloat( val ) - min ) / ( max - min ) * 100; + } + + if ( isNaN( percent ) ) { + return; + } + + if ( percent < 0 ) { + percent = 0; + } + + if ( percent > 100 ) { + percent = 100; + } + + var newval = ( percent / 100 ) * ( max - min ) + min; + + //from jQuery UI slider, the following source will round to the nearest step + var valModStep = ( newval - min ) % step; + var alignValue = newval - valModStep; + + if ( Math.abs( valModStep ) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see jQueryUI: #4124) + newval = parseFloat( alignValue.toFixed(5) ); + + if ( newval < min ) { + newval = min; + } + + if ( newval > max ) { + newval = max; + } + + this.handle.css( "left", percent + "%" ); + this.handle.attr( { + "aria-valuenow": cType === "input" ? newval : control.find( "option" ).eq( newval ).attr( "value" ), + "aria-valuetext": cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText(), + title: cType === "input" ? newval : control.find( "option" ).eq( newval ).getEncodedText() + }); + this.valuebg && this.valuebg.css( "width", percent + "%" ); + + // drag the label widths + if ( this._labels ) { + var handlePercent = this.handle.width() / this.slider.width() * 100, + aPercent = percent && handlePercent + ( 100 - handlePercent ) * percent / 100, + bPercent = percent === 100 ? 0 : Math.min( handlePercent + 100 - aPercent, 100 ); + + this._labels.each(function(){ + var ab = $(this).is( ".ui-slider-label-a" ); + $( this ).width( ( ab ? aPercent : bPercent ) + "%" ); + }); + } + + if ( !preventInputUpdate ) { + var valueChanged = false; + + // update control"s value + if ( cType === "input" ) { + valueChanged = control.val() !== newval; + control.val( newval ); + } else { + valueChanged = control[ 0 ].selectedIndex !== newval; + control[ 0 ].selectedIndex = newval; + } + if ( !isfromControl && valueChanged ) { + control.trigger( "change" ); + } + } + }, + + enable: function() { + this.element.attr( "disabled", false ); + this.slider.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); + return this._setOption( "disabled", false ); + }, + + disable: function() { + this.element.attr( "disabled", true ); + this.slider.addClass( "ui-disabled" ).attr( "aria-disabled", true ); + return this._setOption( "disabled", true ); + } + +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.slider.prototype.enhanceWithin( e.target, true ); +}); + +})( jQuery ); + +(function( $, undefined ) { + +$.widget( "mobile.selectmenu", $.mobile.widget, { + options: { + theme: null, + disabled: false, + icon: "arrow-d", + iconpos: "right", + inline: false, + corners: true, + shadow: true, + iconshadow: true, + overlayTheme: "a", + hidePlaceholderMenuItems: true, + closeText: "Close", + nativeMenu: true, + // This option defaults to true on iOS devices. + preventFocusZoom: /iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1, + initSelector: "select:not(:jqmData(role='slider'))", + mini: false + }, + + _button: function(){ + return $( "<div/>" ); + }, + + _setDisabled: function( value ) { + this.element.attr( "disabled", value ); + this.button.attr( "aria-disabled", value ); + return this._setOption( "disabled", value ); + }, + + _focusButton : function() { + var self = this; + + setTimeout( function() { + self.button.focus(); + }, 40); + }, + + _selectOptions: function() { + return this.select.find( "option" ); + }, + + // setup items that are generally necessary for select menu extension + _preExtension: function(){ + var classes = ""; + // TODO: Post 1.1--once we have time to test thoroughly--any classes manually applied to the original element should be carried over to the enhanced element, with an `-enhanced` suffix. See https://github.com/jquery/jquery-mobile/issues/3577 + /* if( $el[0].className.length ) { + classes = $el[0].className; + } */ + if( !!~this.element[0].className.indexOf( "ui-btn-left" ) ) { + classes = " ui-btn-left"; + } + + if( !!~this.element[0].className.indexOf( "ui-btn-right" ) ) { + classes = " ui-btn-right"; + } + + this.select = this.element.wrap( "<div class='ui-select" + classes + "'>" ); + this.selectID = this.select.attr( "id" ); + this.label = $( "label[for='"+ this.selectID +"']" ).addClass( "ui-select" ); + this.isMultiple = this.select[ 0 ].multiple; + if ( !this.options.theme ) { + this.options.theme = $.mobile.getInheritedTheme( this.select, "c" ); + } + }, + + _create: function() { + this._preExtension(); + + // Allows for extension of the native select for custom selects and other plugins + // see select.custom for example extension + // TODO explore plugin registration + this._trigger( "beforeCreate" ); + + this.button = this._button(); + + var self = this, + + options = this.options, + + // IE throws an exception at options.item() function when + // there is no selected item + // select first in this case + selectedIndex = this.select[ 0 ].selectedIndex == -1 ? 0 : this.select[ 0 ].selectedIndex, + + // TODO values buttonId and menuId are undefined here + button = this.button + .text( $( this.select[ 0 ].options.item( selectedIndex ) ).text() ) + .insertBefore( this.select ) + .buttonMarkup( { + theme: options.theme, + icon: options.icon, + iconpos: options.iconpos, + inline: options.inline, + corners: options.corners, + shadow: options.shadow, + iconshadow: options.iconshadow, + mini: options.mini + }); + + // Opera does not properly support opacity on select elements + // In Mini, it hides the element, but not its text + // On the desktop,it seems to do the opposite + // for these reasons, using the nativeMenu option results in a full native select in Opera + if ( options.nativeMenu && window.opera && window.opera.version ) { + this.select.addClass( "ui-select-nativeonly" ); + } + + // Add counter for multi selects + if ( this.isMultiple ) { + this.buttonCount = $( "<span>" ) + .addClass( "ui-li-count ui-btn-up-c ui-btn-corner-all" ) + .hide() + .appendTo( button.addClass('ui-li-has-count') ); + } + + // Disable if specified + if ( options.disabled || this.element.attr('disabled')) { + this.disable(); + } + + // Events on native select + this.select.change( function() { + self.refresh(); + }); + + this.build(); + }, + + build: function() { + var self = this; + + this.select + .appendTo( self.button ) + .bind( "vmousedown", function() { + // Add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + }) + .bind( "focus", function() { + self.button.addClass( $.mobile.focusClass ); + }) + .bind( "blur", function() { + self.button.removeClass( $.mobile.focusClass ); + }) + .bind( "focus vmouseover", function() { + self.button.trigger( "vmouseover" ); + }) + .bind( "vmousemove", function() { + // Remove active class on scroll/touchmove + self.button.removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur vmouseout", function() { + self.button.trigger( "vmouseout" ) + .removeClass( $.mobile.activeBtnClass ); + }) + .bind( "change blur", function() { + self.button.removeClass( "ui-btn-down-" + self.options.theme ); + }); + + // In many situations, iOS will zoom into the select upon tap, this prevents that from happening + self.button.bind( "vmousedown", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.disable( true ); + } + }) + .bind( "mouseup", function() { + if( self.options.preventFocusZoom ){ + $.mobile.zoom.enable( true ); + } + }); + }, + + selected: function() { + return this._selectOptions().filter( ":selected" ); + }, + + selectedIndices: function() { + var self = this; + + return this.selected().map( function() { + return self._selectOptions().index( this ); + }).get(); + }, + + setButtonText: function() { + var self = this, selected = this.selected(); + + this.button.find( ".ui-btn-text" ).text( function() { + if ( !self.isMultiple ) { + return selected.text(); + } + + return selected.length ? selected.map( function() { + return $( this ).text(); + }).get().join( ", " ) : self.placeholder; + }); + }, + + setButtonCount: function() { + var selected = this.selected(); + + // multiple count inside button + if ( this.isMultiple ) { + this.buttonCount[ selected.length > 1 ? "show" : "hide" ]().text( selected.length ); + } + }, + + refresh: function() { + this.setButtonText(); + this.setButtonCount(); + }, + + // open and close preserved in native selects + // to simplify users code when looping over selects + open: $.noop, + close: $.noop, + + disable: function() { + this._setDisabled( true ); + this.button.addClass( "ui-disabled" ); + }, + + enable: function() { + this._setDisabled( false ); + this.button.removeClass( "ui-disabled" ); + } +}); + +//auto self-init widgets +$( document ).bind( "pagecreate create", function( e ){ + $.mobile.selectmenu.prototype.enhanceWithin( e.target, true ); +}); +})( jQuery ); + +/* +* custom "selectmenu" plugin +*/ + +(function( $, undefined ) { + var extendSelect = function( widget ){ + + var select = widget.select, + selectID = widget.selectID, + label = widget.label, + thisPage = widget.select.closest( ".ui-page" ), + screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"} ).appendTo( thisPage ), + selectOptions = widget._selectOptions(), + isMultiple = widget.isMultiple = widget.select[ 0 ].multiple, + buttonId = selectID + "-button", + menuId = selectID + "-menu", + menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ widget.options.theme +"' data-" +$.mobile.ns + "overlay-theme='"+ widget.options.overlayTheme +"'>" + + "<div data-" + $.mobile.ns + "role='header'>" + + "<div class='ui-title'>" + label.getEncodedText() + "</div>"+ + "</div>"+ + "<div data-" + $.mobile.ns + "role='content'></div>"+ + "</div>" ), + + listbox = $("<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-" + widget.options.overlayTheme + " " + $.mobile.defaultDialogTransition } ).insertAfter(screen), + + list = $( "<ul>", { + "class": "ui-selectmenu-list", + "id": menuId, + "role": "listbox", + "aria-labelledby": buttonId + }).attr( "data-" + $.mobile.ns + "theme", widget.options.theme ).appendTo( listbox ), + + header = $( "<div>", { + "class": "ui-header ui-bar-" + widget.options.theme + }).prependTo( listbox ), + + headerTitle = $( "<h1>", { + "class": "ui-title" + }).appendTo( header ), + + menuPageContent, + menuPageClose, + headerClose; + + if( widget.isMultiple ) { + headerClose = $( "<a>", { + "text": widget.options.closeText, + "href": "#", + "class": "ui-btn-left" + }).attr( "data-" + $.mobile.ns + "iconpos", "notext" ).attr( "data-" + $.mobile.ns + "icon", "delete" ).appendTo( header ).buttonMarkup(); + } + + $.extend( widget, { + select: widget.select, + selectID: selectID, + buttonId: buttonId, + menuId: menuId, + thisPage: thisPage, + menuPage: menuPage, + label: label, + screen: screen, + selectOptions: selectOptions, + isMultiple: isMultiple, + theme: widget.options.theme, + listbox: listbox, + list: list, + header: header, + headerTitle: headerTitle, + headerClose: headerClose, + menuPageContent: menuPageContent, + menuPageClose: menuPageClose, + placeholder: "", + + build: function() { + var self = this; + + // Create list from select, update state + self.refresh(); + + self.select.attr( "tabindex", "-1" ).focus(function() { + $( this ).blur(); + self.button.focus(); + }); + + // Button events + self.button.bind( "vclick keydown" , function( event ) { + if ( event.type == "vclick" || + event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || + event.keyCode === $.mobile.keyCode.SPACE ) ) { + + self.open(); + event.preventDefault(); + } + }); + + // Events for list items + self.list.attr( "role", "listbox" ) + .bind( "focusin", function( e ){ + $( e.target ) + .attr( "tabindex", "0" ) + .trigger( "vmouseover" ); + + }) + .bind( "focusout", function( e ){ + $( e.target ) + .attr( "tabindex", "-1" ) + .trigger( "vmouseout" ); + }) + .delegate( "li:not(.ui-disabled, .ui-li-divider)", "click", function( event ) { + + // index of option tag to be selected + var oldIndex = self.select[ 0 ].selectedIndex, + newIndex = self.list.find( "li:not(.ui-li-divider)" ).index( this ), + option = self._selectOptions().eq( newIndex )[ 0 ]; + + // toggle selected status on the tag for multi selects + option.selected = self.isMultiple ? !option.selected : true; + + // toggle checkbox class for multiple selects + if ( self.isMultiple ) { + $( this ).find( ".ui-icon" ) + .toggleClass( "ui-icon-checkbox-on", option.selected ) + .toggleClass( "ui-icon-checkbox-off", !option.selected ); + } + + // trigger change if value changed + if ( self.isMultiple || oldIndex !== newIndex ) { + self.select.trigger( "change" ); + } + + //hide custom select for single selects only + if ( !self.isMultiple ) { + self.close(); + } + + event.preventDefault(); + }) + .keydown(function( event ) { //keyboard events for menu items + var target = $( event.target ), + li = target.closest( "li" ), + prev, next; + + // switch logic based on which key was pressed + switch ( event.keyCode ) { + // up or left arrow keys + case 38: + prev = li.prev().not( ".ui-selectmenu-placeholder" ); + + if( prev.is( ".ui-li-divider" ) ) { + prev = prev.prev(); + } + + // if there's a previous option, focus it + if ( prev.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + prev.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // down or right arrow keys + case 40: + next = li.next(); + + if( next.is( ".ui-li-divider" ) ) { + next = next.next(); + } + + // if there's a next option, focus it + if ( next.length ) { + target + .blur() + .attr( "tabindex", "-1" ); + + next.addClass( "ui-btn-down-" + widget.options.theme ).find( "a" ).first().focus(); + } + + return false; + break; + + // If enter or space is pressed, trigger click + case 13: + case 32: + target.trigger( "click" ); + + return false; + break; + } + }); + + // button refocus ensures proper height calculation + // by removing the inline style and ensuring page inclusion + self.menuPage.bind( "pagehide", function() { + self.list.appendTo( self.listbox ); + self._focusButton(); + + // TODO centralize page removal binding / handling in the page plugin. + // Suggestion from @jblas to do refcounting + // + // TODO extremely confusing dependency on the open method where the pagehide.remove + // bindings are stripped to prevent the parent page from disappearing. The way + // we're keeping pages in the DOM right now sucks + // + // rebind the page remove that was unbound in the open function + // to allow for the parent page removal from actions other than the use + // of a dialog sized custom select + // + // doing this here provides for the back button on the custom select dialog + $.mobile._bindPageRemove.call( self.thisPage ); + }); + + // Events on "screen" overlay + self.screen.bind( "vclick", function( event ) { + self.close(); + }); + + // Close button on small overlays + if( self.isMultiple ){ + self.headerClose.click( function() { + if ( self.menuType == "overlay" ) { + self.close(); + return false; + } + }); + } + + // track this dependency so that when the parent page + // is removed on pagehide it will also remove the menupage + self.thisPage.addDependents( this.menuPage ); + }, + + _isRebuildRequired: function() { + var list = this.list.find( "li" ), + options = this._selectOptions(); + + // TODO exceedingly naive method to determine difference + // ignores value changes etc in favor of a forcedRebuild + // from the user in the refresh method + return options.text() !== list.text(); + }, + + refresh: function( forceRebuild , foo ){ + var self = this, + select = this.element, + isMultiple = this.isMultiple, + options = this._selectOptions(), + selected = this.selected(), + // return an array of all selected index's + indicies = this.selectedIndices(); + + if ( forceRebuild || this._isRebuildRequired() ) { + self._buildList(); + } + + self.setButtonText(); + self.setButtonCount(); + + self.list.find( "li:not(.ui-li-divider)" ) + .removeClass( $.mobile.activeBtnClass ) + .attr( "aria-selected", false ) + .each(function( i ) { + + if ( $.inArray( i, indicies ) > -1 ) { + var item = $( this ); + + // Aria selected attr + item.attr( "aria-selected", true ); + + // Multiple selects: add the "on" checkbox state to the icon + if ( self.isMultiple ) { + item.find( ".ui-icon" ).removeClass( "ui-icon-checkbox-off" ).addClass( "ui-icon-checkbox-on" ); + } else { + if( item.is( ".ui-selectmenu-placeholder" ) ) { + item.next().addClass( $.mobile.activeBtnClass ); + } else { + item.addClass( $.mobile.activeBtnClass ); + } + } + } + }); + }, + + close: function() { + if ( this.options.disabled || !this.isOpen ) { + return; + } + + var self = this; + + if ( self.menuType == "page" ) { + // doesn't solve the possible issue with calling change page + // where the objects don't define data urls which prevents dialog key + // stripping - changePage has incoming refactor + window.history.back(); + } else { + self.screen.addClass( "ui-screen-hidden" ); + self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass( "in" ); + self.list.appendTo( self.listbox ); + self._focusButton(); + } + + // allow the dialog to be closed again + self.isOpen = false; + }, + + open: function() { + if ( this.options.disabled ) { + return; + } + + var self = this, + $window = $( window ), + selfListParent = self.list.parent(), + menuHeight = selfListParent.outerHeight(), + menuWidth = selfListParent.outerWidth(), + activePage = $( ".ui-page-active" ), + tScrollElem = activePage, + scrollTop = $window.scrollTop(), + btnOffset = self.button.offset().top, + screenHeight = $window.height(), + screenWidth = $window.width(); + + //add active class to button + self.button.addClass( $.mobile.activeBtnClass ); + + //remove after delay + setTimeout( function() { + self.button.removeClass( $.mobile.activeBtnClass ); + }, 300); + + function focusMenuItem() { + self.list.find( "." + $.mobile.activeBtnClass + " a" ).focus(); + } + + if ( menuHeight > screenHeight - 80 || !$.support.scrollTop ) { + + self.menuPage.appendTo( $.mobile.pageContainer ).page(); + self.menuPageContent = menuPage.find( ".ui-content" ); + self.menuPageClose = menuPage.find( ".ui-header a" ); + + // prevent the parent page from being removed from the DOM, + // otherwise the results of selecting a list item in the dialog + // fall into a black hole + self.thisPage.unbind( "pagehide.remove" ); + + //for WebOS/Opera Mini (set lastscroll using button offset) + if ( scrollTop == 0 && btnOffset > screenHeight ) { + self.thisPage.one( "pagehide", function() { + $( this ).jqmData( "lastScroll", btnOffset ); + }); + } + + self.menuPage.one( "pageshow", function() { + focusMenuItem(); + self.isOpen = true; + }); + + self.menuType = "page"; + self.menuPageContent.append( self.list ); + self.menuPage.find("div .ui-title").text(self.label.text()); + $.mobile.changePage( self.menuPage, { + transition: $.mobile.defaultDialogTransition + }); + } else { + self.menuType = "overlay"; + + self.screen.height( $(document).height() ) + .removeClass( "ui-screen-hidden" ); + + // Try and center the overlay over the button + var roomtop = btnOffset - scrollTop, + roombot = scrollTop + screenHeight - btnOffset, + halfheight = menuHeight / 2, + maxwidth = parseFloat( self.list.parent().css( "max-width" ) ), + newtop, newleft; + + if ( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ) { + newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight; + } else { + // 30px tolerance off the edges + newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30; + } + + // If the menuwidth is smaller than the screen center is + if ( menuWidth < maxwidth ) { + newleft = ( screenWidth - menuWidth ) / 2; + } else { + + //otherwise insure a >= 30px offset from the left + newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2; + + // 30px tolerance off the edges + if ( newleft < 30 ) { + newleft = 30; + } else if ( (newleft + menuWidth) > screenWidth ) { + newleft = screenWidth - menuWidth - 30; + } + } + + self.listbox.append( self.list ) + .removeClass( "ui-selectmenu-hidden" ) + .css({ + top: newtop, + left: newleft + }) + .addClass( "in" ); + + focusMenuItem(); + + // duplicate with value set in page show for dialog sized selects + self.isOpen = true; + } + }, + + _buildList: function() { + var self = this, + o = this.options, + placeholder = this.placeholder, + needPlaceholder = true, + optgroups = [], + lis = [], + dataIcon = self.isMultiple ? "checkbox-off" : "false"; + + self.list.empty().filter( ".ui-listview" ).listview( "destroy" ); + + var $options = self.select.find("option"), + numOptions = $options.length, + select = this.select[ 0 ], + dataPrefix = 'data-' + $.mobile.ns, + dataIndexAttr = dataPrefix + 'option-index', + dataIconAttr = dataPrefix + 'icon', + dataRoleAttr = dataPrefix + 'role', + fragment = document.createDocumentFragment(), + optGroup; + + for (var i = 0; i < numOptions;i++){ + var option = $options[i], + $option = $(option), + parent = option.parentNode, + text = $option.text(), + anchor = document.createElement('a'), + classes = []; + + anchor.setAttribute('href','#'); + anchor.appendChild(document.createTextNode(text)); + + // Are we inside an optgroup? + if (parent !== select && parent.nodeName.toLowerCase() === "optgroup"){ + var optLabel = parent.getAttribute('label'); + if ( optLabel != optGroup) { + var divider = document.createElement('li'); + divider.setAttribute(dataRoleAttr,'list-divider'); + divider.setAttribute('role','option'); + divider.setAttribute('tabindex','-1'); + divider.appendChild(document.createTextNode(optLabel)); + fragment.appendChild(divider); + optGroup = optLabel; + } + } + + if (needPlaceholder && (!option.getAttribute( "value" ) || text.length == 0 || $option.jqmData( "placeholder" ))) { + needPlaceholder = false; + if ( o.hidePlaceholderMenuItems ) { + classes.push( "ui-selectmenu-placeholder" ); + } + if (!placeholder) { + placeholder = self.placeholder = text; + } + } + + var item = document.createElement('li'); + if ( option.disabled ) { + classes.push( "ui-disabled" ); + item.setAttribute('aria-disabled',true); + } + item.setAttribute(dataIndexAttr,i); + item.setAttribute(dataIconAttr,dataIcon); + item.className = classes.join(" "); + item.setAttribute('role','option'); + anchor.setAttribute('tabindex','-1'); + item.appendChild(anchor); + fragment.appendChild(item); + } + + self.list[0].appendChild(fragment); + + // Hide header if it's not a multiselect and there's no placeholder + if ( !this.isMultiple && !placeholder.length ) { + this.header.hide(); + } else { + this.headerTitle.text( this.placeholder ); + } + + // Now populated, create listview + self.list.listview(); + }, + + _button: function(){ + return $( "<a>", { + "href": "#", + "role": "button", + // TODO value is undefined at creation + "id": this.buttonId, + "aria-haspopup": "true", + + // TODO value is undefined at creation + "aria-owns": this.menuId + }); + } + }); + }; + + // issue #3894 - core doesn't triggered events on disabled delegates + $( document ).bind( "selectmenubeforecreate", function( event ){ + var selectmenuWidget = $( event.target ).data( "selectmenu" ); + + if( !selectmenuWidget.options.nativeMenu ){ + extendSelect( selectmenuWidget ); + } + }); +})( jQuery ); + +(function( $, undefined ) { + + + $.widget( "mobile.fixedtoolbar", $.mobile.widget, { + options: { + visibleOnPageShow: true, + disablePageZoom: true, + transition: "slide", //can be none, fade, slide (slide maps to slideup or slidedown) + fullscreen: false, + tapToggle: true, + tapToggleBlacklist: "a, input, select, textarea, .ui-header-fixed, .ui-footer-fixed", + hideDuringFocus: "input, textarea, select", + updatePagePadding: true, + trackPersistentToolbars: true, + + // Browser detection! Weeee, here we go... + // Unfortunately, position:fixed is costly, not to mention probably impossible, to feature-detect accurately. + // Some tests exist, but they currently return false results in critical devices and browsers, which could lead to a broken experience. + // Testing fixed positioning is also pretty obtrusive to page load, requiring injected elements and scrolling the window + // The following function serves to rule out some popular browsers with known fixed-positioning issues + // This is a plugin option like any other, so feel free to improve or overwrite it + supportBlacklist: function(){ + var w = window, + ua = navigator.userAgent, + platform = navigator.platform, + // Rendering engine is Webkit, and capture major version + wkmatch = ua.match( /AppleWebKit\/([0-9]+)/ ), + wkversion = !!wkmatch && wkmatch[ 1 ], + ffmatch = ua.match( /Fennec\/([0-9]+)/ ), + ffversion = !!ffmatch && ffmatch[ 1 ], + operammobilematch = ua.match( /Opera Mobi\/([0-9]+)/ ), + omversion = !!operammobilematch && operammobilematch[ 1 ]; + + if( + // iOS 4.3 and older : Platform is iPhone/Pad/Touch and Webkit version is less than 534 (ios5) + ( ( platform.indexOf( "iPhone" ) > -1 || platform.indexOf( "iPad" ) > -1 || platform.indexOf( "iPod" ) > -1 ) && wkversion && wkversion < 534 ) + || + // Opera Mini + ( w.operamini && ({}).toString.call( w.operamini ) === "[object OperaMini]" ) + || + ( operammobilematch && omversion < 7458 ) + || + //Android lte 2.1: Platform is Android and Webkit version is less than 533 (Android 2.2) + ( ua.indexOf( "Android" ) > -1 && wkversion && wkversion < 533 ) + || + // Firefox Mobile before 6.0 - + ( ffversion && ffversion < 6 ) + || + // WebOS less than 3 + ( "palmGetResource" in window && wkversion && wkversion < 534 ) + || + // MeeGo + ( ua.indexOf( "MeeGo" ) > -1 && ua.indexOf( "NokiaBrowser/8.5.0" ) > -1 ) + ){ + return true; + } + + return false; + }, + initSelector: ":jqmData(position='fixed')" + }, + + _create: function() { + + var self = this, + o = self.options, + $el = self.element, + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer", + $page = $el.closest(".ui-page"); + + // Feature detecting support for + if( o.supportBlacklist() ){ + self.destroy(); + return; + } + + $el.addClass( "ui-"+ tbtype +"-fixed" ); + + // "fullscreen" overlay positioning + if( o.fullscreen ){ + $el.addClass( "ui-"+ tbtype +"-fullscreen" ); + $page.addClass( "ui-page-" + tbtype + "-fullscreen" ); + } + // If not fullscreen, add class to page to set top or bottom padding + else{ + $page.addClass( "ui-page-" + tbtype + "-fixed" ); + } + + self._addTransitionClass(); + self._bindPageEvents(); + self._bindToggleHandlers(); + }, + + _addTransitionClass: function(){ + var tclass = this.options.transition; + + if( tclass && tclass !== "none" ){ + // use appropriate slide for header or footer + if( tclass === "slide" ){ + tclass = this.element.is( ".ui-header" ) ? "slidedown" : "slideup"; + } + + this.element.addClass( tclass ); + } + }, + + _bindPageEvents: function(){ + var self = this, + o = self.options, + $el = self.element; + + //page event bindings + // Fixed toolbars require page zoom to be disabled, otherwise usability issues crop up + // This method is meant to disable zoom while a fixed-positioned toolbar page is visible + $el.closest( ".ui-page" ) + .bind( "pagebeforeshow", function(){ + if( o.disablePageZoom ){ + $.mobile.zoom.disable( true ); + } + if( !o.visibleOnPageShow ){ + self.hide( true ); + } + } ) + .bind( "webkitAnimationStart animationstart updatelayout", function(){ + if( o.updatePagePadding ){ + self.updatePagePadding(); + } + }) + .bind( "pageshow", function(){ + self.updatePagePadding(); + if( o.updatePagePadding ){ + $( window ).bind( "throttledresize." + self.widgetName, function(){ + self.updatePagePadding(); + }); + } + }) + .bind( "pagebeforehide", function( e, ui ){ + if( o.disablePageZoom ){ + $.mobile.zoom.enable( true ); + } + if( o.updatePagePadding ){ + $( window ).unbind( "throttledresize." + self.widgetName ); + } + + if( o.trackPersistentToolbars ){ + var thisFooter = $( ".ui-footer-fixed:jqmData(id)", this ), + thisHeader = $( ".ui-header-fixed:jqmData(id)", this ), + nextFooter = thisFooter.length && ui.nextPage && $( ".ui-footer-fixed:jqmData(id='" + thisFooter.jqmData( "id" ) + "')", ui.nextPage ), + nextHeader = thisHeader.length && ui.nextPage && $( ".ui-header-fixed:jqmData(id='" + thisHeader.jqmData( "id" ) + "')", ui.nextPage ); + + nextFooter = nextFooter || $(); + + if( nextFooter.length || nextHeader.length ){ + + nextFooter.add( nextHeader ).appendTo( $.mobile.pageContainer ); + + ui.nextPage.one( "pageshow", function(){ + nextFooter.add( nextHeader ).appendTo( this ); + }); + } + } + }); + }, + + _visible: true, + + // This will set the content element's top or bottom padding equal to the toolbar's height + updatePagePadding: function() { + var $el = this.element, + header = $el.is( ".ui-header" ); + + // This behavior only applies to "fixed", not "fullscreen" + if( this.options.fullscreen ){ return; } + + $el.closest( ".ui-page" ).css( "padding-" + ( header ? "top" : "bottom" ), $el.outerHeight() ); + }, + + _useTransition: function( notransition ){ + var $win = $( window ), + $el = this.element, + scroll = $win.scrollTop(), + elHeight = $el.height(), + pHeight = $el.closest( ".ui-page" ).height(), + viewportHeight = $.mobile.getScreenHeight(), + tbtype = $el.is( ":jqmData(role='header')" ) ? "header" : "footer"; + + return !notransition && + ( this.options.transition && this.options.transition !== "none" && + ( + ( tbtype === "header" && !this.options.fullscreen && scroll > elHeight ) || + ( tbtype === "footer" && !this.options.fullscreen && scroll + viewportHeight < pHeight - elHeight ) + ) || this.options.fullscreen + ); + }, + + show: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element; + + if( this._useTransition( notransition ) ){ + $el + .removeClass( "out " + hideClass ) + .addClass( "in" ); + } + else { + $el.removeClass( hideClass ); + } + this._visible = true; + }, + + hide: function( notransition ){ + var hideClass = "ui-fixed-hidden", + $el = this.element, + // if it's a slide transition, our new transitions need the reverse class as well to slide outward + outclass = "out" + ( this.options.transition === "slide" ? " reverse" : "" ); + + if( this._useTransition( notransition ) ){ + $el + .addClass( outclass ) + .removeClass( "in" ) + .animationComplete( function(){ + $el.addClass( hideClass ).removeClass( outclass ); + }); + } + else { + $el.addClass( hideClass ).removeClass( outclass ); + } + this._visible = false; + }, + + toggle: function(){ + this[ this._visible ? "hide" : "show" ](); + }, + + _bindToggleHandlers: function(){ + var self = this, + o = self.options, + $el = self.element; + + // tap toggle + $el.closest( ".ui-page" ) + .bind( "vclick", function( e ){ + if( o.tapToggle && !$( e.target ).closest( o.tapToggleBlacklist ).length ){ + self.toggle(); + } + }) + .bind( "focusin focusout", function( e ){ + if( screen.width < 500 && $( e.target ).is( o.hideDuringFocus ) && !$( e.target ).closest( ".ui-header-fixed, .ui-footer-fixed" ).length ){ + self[ ( e.type === "focusin" && self._visible ) ? "hide" : "show" ](); + } + }); + }, + + destroy: function(){ + this.element.removeClass( "ui-header-fixed ui-footer-fixed ui-header-fullscreen ui-footer-fullscreen in out fade slidedown slideup ui-fixed-hidden" ); + this.element.closest( ".ui-page" ).removeClass( "ui-page-header-fixed ui-page-footer-fixed ui-page-header-fullscreen ui-page-footer-fullscreen" ); + } + + }); + + //auto self-init widgets + $( document ) + .bind( "pagecreate create", function( e ){ + + // DEPRECATED in 1.1: support for data-fullscreen=true|false on the page element. + // This line ensures it still works, but we recommend moving the attribute to the toolbars themselves. + if( $( e.target ).jqmData( "fullscreen" ) ){ + $( $.mobile.fixedtoolbar.prototype.options.initSelector, e.target ).not( ":jqmData(fullscreen)" ).jqmData( "fullscreen", true ); + } + + $.mobile.fixedtoolbar.prototype.enhanceWithin( e.target ); + }); + +})( jQuery ); + +( function( $, window ) { + + // This fix addresses an iOS bug, so return early if the UA claims it's something else. + if( !(/iPhone|iPad|iPod/.test( navigator.platform ) && navigator.userAgent.indexOf( "AppleWebKit" ) > -1 ) ){ + return; + } + + var zoom = $.mobile.zoom, + evt, x, y, z, aig; + + function checkTilt( e ){ + evt = e.originalEvent; + aig = evt.accelerationIncludingGravity; + + x = Math.abs( aig.x ); + y = Math.abs( aig.y ); + z = Math.abs( aig.z ); + + // If portrait orientation and in one of the danger zones + if( !window.orientation && ( x > 7 || ( ( z > 6 && y < 8 || z < 8 && y > 6 ) && x > 5 ) ) ){ + if( zoom.enabled ){ + zoom.disable(); + } + } + else if( !zoom.enabled ){ + zoom.enable(); + } + } + + $( window ) + .bind( "orientationchange.iosorientationfix", zoom.enable ) + .bind( "devicemotion.iosorientationfix", checkTilt ); + +}( jQuery, this )); + +( function( $, window, undefined ) { + var $html = $( "html" ), + $head = $( "head" ), + $window = $( window ); + + // trigger mobileinit event - useful hook for configuring $.mobile settings before they're used + $( window.document ).trigger( "mobileinit" ); + + // support conditions + // if device support condition(s) aren't met, leave things as they are -> a basic, usable experience, + // otherwise, proceed with the enhancements + if ( !$.mobile.gradeA() ) { + return; + } + + // override ajaxEnabled on platforms that have known conflicts with hash history updates + // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini) + if ( $.mobile.ajaxBlacklist ) { + $.mobile.ajaxEnabled = false; + } + + // Add mobile, initial load "rendering" classes to docEl + $html.addClass( "ui-mobile ui-mobile-rendering" ); + + // This is a fallback. If anything goes wrong (JS errors, etc), or events don't fire, + // this ensures the rendering class is removed after 5 seconds, so content is visible and accessible + setTimeout( hideRenderingClass, 5000 ); + + // loading div which appears during Ajax requests + // will not appear if $.mobile.loadingMessage is false + var loaderClass = "ui-loader", + $loader = $( "<div class='" + loaderClass + "'><span class='ui-icon ui-icon-loading'></span><h1></h1></div>" ); + + // For non-fixed supportin browsers. Position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top + function fakeFixLoader(){ + var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); + + $loader + .css({ + top: $.support.scrollTop && $window.scrollTop() + $window.height() / 2 || + activeBtn.length && activeBtn.offset().top || 100 + }); + } + + // check position of loader to see if it appears to be "fixed" to center + // if not, use abs positioning + function checkLoaderPosition(){ + var offset = $loader.offset(), + scrollTop = $window.scrollTop(), + screenHeight = $.mobile.getScreenHeight(); + + if( offset.top < scrollTop || (offset.top - scrollTop) > screenHeight ) { + $loader.addClass( "ui-loader-fakefix" ); + fakeFixLoader(); + $window + .unbind( "scroll", checkLoaderPosition ) + .bind( "scroll", fakeFixLoader ); + } + } + + //remove initial build class (only present on first pageshow) + function hideRenderingClass(){ + $html.removeClass( "ui-mobile-rendering" ); + } + + $.extend($.mobile, { + // turn on/off page loading message. + showPageLoadingMsg: function( theme, msgText, textonly ) { + $html.addClass( "ui-loading" ); + + if ( $.mobile.loadingMessage ) { + // text visibility from argument takes priority + var textVisible = textonly || $.mobile.loadingMessageTextVisible; + + theme = theme || $.mobile.loadingMessageTheme, + + $loader + .attr( "class", loaderClass + " ui-corner-all ui-body-" + ( theme || "a" ) + " ui-loader-" + ( textVisible ? "verbose" : "default" ) + ( textonly ? " ui-loader-textonly" : "" ) ) + .find( "h1" ) + .text( msgText || $.mobile.loadingMessage ) + .end() + .appendTo( $.mobile.pageContainer ); + + checkLoaderPosition(); + $window.bind( "scroll", checkLoaderPosition ); + } + }, + + hidePageLoadingMsg: function() { + $html.removeClass( "ui-loading" ); + + if( $.mobile.loadingMessage ){ + $loader.removeClass( "ui-loader-fakefix" ); + } + + $( window ).unbind( "scroll", fakeFixLoader ); + $( window ).unbind( "scroll", checkLoaderPosition ); + }, + + // find and enhance the pages in the dom and transition to the first page. + initializePage: function() { + // find present pages + var $pages = $( ":jqmData(role='page'), :jqmData(role='dialog')" ); + + // if no pages are found, create one with body's inner html + if ( !$pages.length ) { + $pages = $( "body" ).wrapInner( "<div data-" + $.mobile.ns + "role='page'></div>" ).children( 0 ); + } + + // add dialogs, set data-url attrs + $pages.each(function() { + var $this = $(this); + + // unless the data url is already set set it to the pathname + if ( !$this.jqmData("url") ) { + $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) || location.pathname + location.search ); + } + }); + + // define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback) + $.mobile.firstPage = $pages.first(); + + // define page container + $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" ); + + // alert listeners that the pagecontainer has been determined for binding + // to events triggered on it + $window.trigger( "pagecontainercreate" ); + + // cue page loading message + $.mobile.showPageLoadingMsg(); + + //remove initial build class (only present on first pageshow) + hideRenderingClass(); + + // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM + if ( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ) { + $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } ); + } + // otherwise, trigger a hashchange to load a deeplink + else { + $window.trigger( "hashchange", [ true ] ); + } + } + }); + + // initialize events now, after mobileinit has occurred + $.mobile._registerInternalEvents(); + + // check which scrollTop value should be used by scrolling to 1 immediately at domready + // then check what the scroll top is. Android will report 0... others 1 + // note that this initial scroll won't hide the address bar. It's just for the check. + $(function() { + window.scrollTo( 0, 1 ); + + // if defaultHomeScroll hasn't been set yet, see if scrollTop is 1 + // it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar) + // so if it's 1, use 0 from now on + $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1; + + + // TODO: Implement a proper registration mechanism with dependency handling in order to not have exceptions like the one below + //auto self-init widgets for those widgets that have a soft dependency on others + if ( $.fn.controlgroup ) { + $( document ).bind( "pagecreate create", function( e ){ + $( ":jqmData(role='controlgroup')", e.target ) + .jqmEnhanceable() + .controlgroup({ excludeInvisible: false }); + }); + } + + //dom-ready inits + if( $.mobile.autoInitializePage ){ + $.mobile.initializePage(); + } + + // window load event + // hide iOS browser chrome on load + $window.load( $.mobile.silentScroll ); + }); +}( jQuery, this )); + + +})); diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png Binary files differnew file mode 100755 index 0000000..82524ab --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-small_25_c5ddfc_40x40.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png Binary files differnew file mode 100755 index 0000000..6aed97a --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_20_e69700_40x40.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png Binary files differnew file mode 100755 index 0000000..f11ca67 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_22_1484e6_40x40.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png Binary files differnew file mode 100755 index 0000000..68306d1 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_diagonals-thick_26_2293f7_40x40.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png Binary files differnew file mode 100755 index 0000000..f567c28 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e69700_40x100.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png Binary files differnew file mode 100755 index 0000000..29e9965 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_flat_0_e6b900_40x100.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png Binary files differnew file mode 100755 index 0000000..9a46d19 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_highlight-soft_100_f9f9f9_1x100.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png b/Js/jquery/ui/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png Binary files differnew file mode 100755 index 0000000..f811f30 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-bg_inset-hard_100_eeeeee_1x100.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-icons_0a82eb_256x240.png b/Js/jquery/ui/css/excite-bike/images/ui-icons_0a82eb_256x240.png Binary files differnew file mode 100755 index 0000000..755fe99 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-icons_0a82eb_256x240.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-icons_0b54d5_256x240.png b/Js/jquery/ui/css/excite-bike/images/ui-icons_0b54d5_256x240.png Binary files differnew file mode 100755 index 0000000..98705f9 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-icons_0b54d5_256x240.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-icons_5fa5e3_256x240.png b/Js/jquery/ui/css/excite-bike/images/ui-icons_5fa5e3_256x240.png Binary files differnew file mode 100755 index 0000000..2179078 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-icons_5fa5e3_256x240.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-icons_fcdd4a_256x240.png b/Js/jquery/ui/css/excite-bike/images/ui-icons_fcdd4a_256x240.png Binary files differnew file mode 100755 index 0000000..de76ce2 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-icons_fcdd4a_256x240.png diff --git a/Js/jquery/ui/css/excite-bike/images/ui-icons_ffffff_256x240.png b/Js/jquery/ui/css/excite-bike/images/ui-icons_ffffff_256x240.png Binary files differnew file mode 100755 index 0000000..42f8f99 --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/images/ui-icons_ffffff_256x240.png diff --git a/Js/jquery/ui/css/excite-bike/jquery-ui-1.8.14.custom.css b/Js/jquery/ui/css/excite-bike/jquery-ui-1.8.14.custom.css new file mode 100644 index 0000000..dc3c9bc --- /dev/null +++ b/Js/jquery/ui/css/excite-bike/jquery-ui-1.8.14.custom.css @@ -0,0 +1,328 @@ +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=segoe%20ui,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=3px&bgColorHeader=f9f9f9&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=cccccc&fcHeader=e69700&iconColorHeader=5fa5e3&bgColorContent=eeeeee&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=0a82eb&bgColorDefault=1484e6&bgTextureDefault=08_diagonals_thick.png&bgImgOpacityDefault=22&borderColorDefault=ffffff&fcDefault=ffffff&iconColorDefault=fcdd4a&bgColorHover=2293f7&bgTextureHover=08_diagonals_thick.png&bgImgOpacityHover=26&borderColorHover=2293f7&fcHover=ffffff&iconColorHover=ffffff&bgColorActive=e69700&bgTextureActive=08_diagonals_thick.png&bgImgOpacityActive=20&borderColorActive=e69700&fcActive=ffffff&iconColorActive=ffffff&bgColorHighlight=c5ddfc&bgTextureHighlight=07_diagonals_small.png&bgImgOpacityHighlight=25&borderColorHighlight=ffffff&fcHighlight=333333&iconColorHighlight=0b54d5&bgColorError=e69700&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=20&borderColorError=e69700&fcError=ffffff&iconColorError=ffffff&bgColorOverlay=e6b900&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=e69700&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=20&thicknessShadow=0px&offsetTopShadow=6px&offsetLeftShadow=6px&cornerRadiusShadow=3px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: segoe ui, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: segoe ui, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #eeeeee url(images/ui-bg_inset-hard_100_eeeeee_1x100.png) 50% bottom repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #cccccc; background: #f9f9f9 url(images/ui-bg_highlight-soft_100_f9f9f9_1x100.png) 50% 50% repeat-x; color: #e69700; font-weight: bold; } +.ui-widget-header a { color: #e69700; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #ffffff; background: #1484e6; font-weight: bold; color: #ffffff; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #ffffff; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #2293f7; background: #2293f7 url(images/ui-bg_diagonals-thick_26_2293f7_40x40.png) 50% 50% repeat; font-weight: bold; color: #ffffff; } +.ui-state-hover a, .ui-state-hover a:hover { color: #ffffff; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #e69700; background: #e69700; font-weight: bold; color: #ffffff; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #ffffff; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #ffffff; background: #c5ddfc url(images/ui-bg_diagonals-small_25_c5ddfc_40x40.png) 50% 50% repeat; color: #333333; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #333333; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #e69700; background: #e69700 url(images/ui-bg_diagonals-thick_20_e69700_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_0a82eb_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_0a82eb_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_5fa5e3_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_fcdd4a_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_0b54d5_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; -khtml-border-top-left-radius: 3px; border-top-left-radius: 3px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; -khtml-border-top-right-radius: 3px; border-top-right-radius: 3px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; -khtml-border-bottom-left-radius: 3px; border-bottom-left-radius: 3px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; -khtml-border-bottom-right-radius: 3px; border-bottom-right-radius: 3px; } + +/* Overlays */ +.ui-widget-overlay { background: #e6b900 url(images/ui-bg_flat_0_e6b900_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: 6px 0 0 6px; padding: 0px; background: #e69700 url(images/ui-bg_flat_0_e69700_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 3px; -khtml-border-radius: 3px; -webkit-border-radius: 3px; border-radius: 3px; }/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 0.6em 0.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js b/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js new file mode 100644 index 0000000..42413ed --- /dev/null +++ b/Js/jquery/ui/js/jquery-ui-1.8.21.custom.js @@ -0,0 +1,1937 @@ +/*! + * jQuery UI 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.21", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/*! + * jQuery UI Position 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); +/*! + * jQuery UI Dialog 1.8.21 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.21", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); |
